Replied: Sat, 21 Apr 2001 09:04:01 -0400 Replied: "Rafael Corchuelo" Return-Path: corchu@lsi.us.es Return-Path: Delivered-To: fox@csit.fsu.edu Received: from mail.cs.fsu.edu (mail.cs.fsu.edu [128.186.121.245]) by mailer.csit.fsu.edu (Postfix) with ESMTP id F0D6B23A06 for ; Wed, 18 Apr 2001 11:50:21 -0400 (EDT) Received: from arturo.lsi.us.es (arturo.lsi.us.es [150.214.141.54]) by mail.cs.fsu.edu (8.9.3/8.9.3) with ESMTP id LAA10368 for ; Wed, 18 Apr 2001 11:49:43 -0400 Received: from mortadelo (mortadelo.lsi.us.es [150.214.141.66]) by arturo.lsi.us.es (8.9.2/8.9.3) with SMTP id RAA00484 for ; Wed, 18 Apr 2001 17:52:15 +0200 (MET DST) Message-ID: <04c601c0c81f$d559afe0$428dd696@lsi.us.es> From: "Rafael Corchuelo" To: Subject: Submission to CCPE Date: Wed, 18 Apr 2001 17:54:13 +0200 MIME-Version: 1.0 Content-Type: multipart/mixed; boundary="----=_NextPart_000_04BF_01C0C830.93DD6780" X-Priority: 3 X-MSMail-Priority: Normal X-Mailer: Microsoft Outlook Express 5.00.2314.1300 X-MIMEOLE: Produced By Microsoft MimeOLE V5.00.2314.1300 This is a multi-part message in MIME format. ------=_NextPart_000_04BF_01C0C830.93DD6780 Content-Type: multipart/alternative; boundary="----=_NextPart_001_04C0_01C0C830.93DD6780" ------=_NextPart_001_04C0_01C0C830.93DD6780 Content-Type: text/plain; charset="iso-8859-1" Content-Transfer-Encoding: quoted-printable Dear Professor Fox, My name is Rafael Corchuelo, and I am an associate professor at the = University of Sevilla, Spain. I am contacting you regardig a letter = Mss. Maggie Bond sent me this morning about a recent submission to CCPE. = She has encouraged me to address you personally. (Maggie Bond wrote:) With regard to your paper. I was informed that it has also been = submitted to Europar 2001. At present it is under review for = Concurrency and Computing: Practice and experience and I will let you = know as soon as possible of developments on that score. As far as = Europar is concerned, I have been advised that it could be considered = but that you should not expect to have the paper published in both = areas. I would like to inform you that we submitted a short version of our = recent work to Europar'01, however, we have not submitted the same = paper. The Europar version is 10 page long, whereas the paper submitted = to CCPE is 28 page long. The reason is that the work we have submitted = to Europar is a short description of our results, and there we focus on = showing our ideas and the algorithm we have developed. However, we do = not provide a correctness proof, a detailed insight into the algorithm = and its performance concerns, a comparative simulation analysis, or a = detailed insight into related work. In the article we submitted to CCPE, = we extend the results we show in the Europar paper this way. That is the reason why we submitted our full paper to CCPE, and an = extended abstract to Europar. I thought that was common practice because = I have seen many papers that include a short footnote like this: "An = extended abstract of this article was presented at the XYZ Conference." = =20 However, if you think that is a problem, we will not accept publication = at Europar if the paper is finally accepted. We're sorry for this = trouble. I have attached a copy of the paper we submitted to Europar so = that you can check the article we have submitted to CCPE adds a lot of = value to this extended abstract.=20 Many thanks. I'm looking forward to your answer.=20 Rafael -- =20 Dr. Rafael Corchuelo =20 Dep. de Lenguajes y Sistemas Inform=E1ticos Facultad de Inform=E1tica y Estad=EDstica Universidad de Sevilla Avda. de la Reina Mercedes s/n Sevilla, E-41012 =20 Tel: +34 95 455 27 70 Fax: +34 95 455 71 39 Emilios: corchu@lsi.us.es WWW: www.lsi.us.es/~corchu ------=_NextPart_001_04C0_01C0C830.93DD6780 Content-Type: text/html; charset="iso-8859-1" Content-Transfer-Encoding: quoted-printable
Dear Professor Fox,
 
My name is Rafael Corchuelo, and I am an associate = professor=20 at the University of Sevilla, Spain.  I am contacting you=20 regardig a letter Mss. Maggie Bond sent me this morning about a = recent=20 submission to CCPE.  She has encouraged me to address you = personally.
(Maggie Bond=20 wrote:)
With regard to = your=20 paper.  I was informed that it has also been submitted to Europar = 2001.  At present it is under review for Concurrency and = Computing:=20 Practice and experience and I will let you know as soon as possible of = developments on that score.  As far as Europar is concerned, I = have been=20 advised that it could be considered but that you should not expect to = have the=20 paper published in both areas.

I would like to inform you that we submitted a short version of our = recent=20 work to Europar'01, however, we have not submitted the same paper. The = Europar=20 version is 10 page long, whereas the paper submitted to CCPE is 28 page = long.=20 The reason is that the work we have submitted to Europar is a short = description=20 of our results, and there we focus on showing our ideas and the = algorithm=20 we have developed. However, we do not provide a correctness proof, a = detailed=20 insight into the algorithm and its performance concerns, a comparative=20 simulation analysis, or a detailed insight into related work. In the = article we=20 submitted to CCPE, we extend the results we show in the Europar paper = this=20 way.

That is the reason why we submitted our full paper to CCPE, and an = extended=20 abstract to Europar. I thought that was common practice because I=20 have seen many papers that include a short footnote like this: "An = extended=20 abstract of this article was presented at the XYZ = Conference."  =20

However, if you think that is a problem, we will not accept = publication at=20 Europar if the paper is finally accepted. We're sorry for this = trouble.  I=20 have attached a copy of the paper we submitted to Europar so that you = can check=20 the article we have submitted to CCPE adds a lot of value to this = extended=20 abstract.

Many thanks. I'm looking forward to your answer.

Rafael

--
 
Dr. Rafael=20 Corchuelo
 
Dep. de Lenguajes y Sistemas = Inform=E1ticos
Facultad de=20 Inform=E1tica y Estad=EDstica
Universidad de Sevilla
Avda. de la = Reina=20 Mercedes s/n
Sevilla, E-41012
 
Tel:  +34 95 455 27=20 70
Fax: +34 95 455 71 39
Emilios: corchu@lsi.us.es
WWW: www.lsi.us.es/~corchu
------=_NextPart_001_04C0_01C0C830.93DD6780-- ------=_NextPart_000_04BF_01C0C830.93DD6780 Content-Type: application/postscript; name="europar01.ps" Content-Transfer-Encoding: quoted-printable Content-Disposition: attachment; filename="europar01.ps" %!PS-Adobe-2.0 %%Creator: dvips 5.83 (MiKTeX 1.20c) Copyright 1998 Radical Eye Software %%Title: europar01.dvi %%CreationDate: Sat Feb 10 18:58:48 2001 %%Pages: 11 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: DVIPS.EXE europar01 %DVIPSParameters: dpi=3D600, compressed %DVIPSSource: TeX output 2001.02.10:1858 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: special.pro %! TeXDict begin/SDict 200 dict N SDict begin/@SpecialDefaults{/hs 612 N /vs 792 N/ho 0 N/vo 0 N/hsc 1 N/vsc 1 N/ang 0 N/CLIP 0 N/rwiSeen false N /rhiSeen false N/letter{}N/note{}N/a4{}N/legal{}N}B/@scaleunit 100 N /@hscale{@scaleunit div/hsc X}B/@vscale{@scaleunit div/vsc X}B/@hsize{ /hs X/CLIP 1 N}B/@vsize{/vs X/CLIP 1 N}B/@clip{/CLIP 2 N}B/@hoffset{/ho X}B/@voffset{/vo X}B/@angle{/ang X}B/@rwi{10 div/rwi X/rwiSeen true N}B /@rhi{10 div/rhi X/rhiSeen true N}B/@llx{/llx X}B/@lly{/lly X}B/@urx{ /urx X}B/@ury{/ury X}B/magscale true def end/@MacSetUp{userdict/md known {userdict/md get type/dicttype eq{userdict begin md length 10 add md maxlength ge{/md md dup length 20 add dict copy def}if end md begin /letter{}N/note{}N/legal{}N/od{txpose 1 0 mtx defaultmatrix dtransform S atan/pa X newpath clippath mark{transform{itransform moveto}}{transform{ itransform lineto}}{6 -2 roll transform 6 -2 roll transform 6 -2 roll transform{itransform 6 2 roll itransform 6 2 roll itransform 6 2 roll curveto}}{{closepath}}pathforall newpath counttomark array astore/gc xdf pop ct 39 0 put 10 fz 0 fs 2 F/|______Courier fnt invertflag{PaintBlack} if}N/txpose{pxs pys scale ppr aload pop por{noflips{pop S neg S TR pop 1 -1 scale}if xflip yflip and{pop S neg S TR 180 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{pop S neg S TR pop 180 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{ppr 1 get neg ppr 0 get neg TR}if}{ noflips{TR pop pop 270 rotate 1 -1 scale}if xflip yflip and{TR pop pop 90 rotate 1 -1 scale ppr 3 get ppr 1 get neg sub neg ppr 2 get ppr 0 get neg sub neg TR}if xflip yflip not and{TR pop pop 90 rotate ppr 3 get ppr 1 get neg sub neg 0 TR}if yflip xflip not and{TR pop pop 270 rotate ppr 2 get ppr 0 get neg sub neg 0 S TR}if}ifelse scaleby96{ppr aload pop 4 -1 roll add 2 div 3 1 roll add 2 div 2 copy TR .96 dup scale neg S neg S TR}if}N/cp{pop pop showpage pm restore}N end}if}if}N/normalscale{ Resolution 72 div VResolution 72 div neg scale magscale{DVImag dup scale }if 0 setgray}N/psfts{S 65781.76 div N}N/startTexFig{/psf$SavedState save N userdict maxlength dict begin/magscale true def normalscale currentpoint TR/psf$ury psfts/psf$urx psfts/psf$lly psfts/psf$llx psfts /psf$y psfts/psf$x psfts currentpoint/psf$cy X/psf$cx X/psf$sx psf$x psf$urx psf$llx sub div N/psf$sy psf$y psf$ury psf$lly sub div N psf$sx psf$sy scale psf$cx psf$sx div psf$llx sub psf$cy psf$sy div psf$ury sub TR/showpage{}N/erasepage{}N/copypage{}N/p 3 def @MacSetUp}N/doclip{ psf$llx psf$lly psf$urx psf$ury currentpoint 6 2 roll newpath 4 copy 4 2 roll moveto 6 -1 roll S lineto S lineto S lineto closepath clip newpath moveto}N/endTexFig{end psf$SavedState restore}N/@beginspecial{SDict begin/SpecialSave save N gsave normalscale currentpoint TR @SpecialDefaults count/ocount X/dcount countdictstack N}N/@setspecial{ CLIP 1 eq{newpath 0 0 moveto hs 0 rlineto 0 vs rlineto hs neg 0 rlineto closepath clip}if ho vo TR hsc vsc scale ang rotate rwiSeen{rwi urx llx sub div rhiSeen{rhi ury lly sub div}{dup}ifelse scale llx neg lly neg TR }{rhiSeen{rhi ury lly sub div dup scale llx neg lly neg TR}if}ifelse CLIP 2 eq{newpath llx lly moveto urx lly lineto urx ury lineto llx ury lineto closepath clip}if/showpage{}N/erasepage{}N/copypage{}N newpath}N /@endspecial{count ocount sub{pop}repeat countdictstack dcount sub{end} repeat grestore SpecialSave restore end}N/@defspecial{SDict begin}N /@fedspecial{end}B/li{lineto}B/rl{rlineto}B/rc{rcurveto}B/np{/SaveX currentpoint/SaveY X N 1 setlinecap newpath}N/st{stroke SaveX SaveY moveto}N/fil{fill SaveX SaveY moveto}N/ellipse{/endangle X/startangle X /yrad X/xrad X/savematrix matrix currentmatrix N TR xrad yrad scale 0 0 1 startangle endangle arc savematrix setmatrix}N end %%EndProcSet TeXDict begin 39158280 55380996 1000 600 600 (F:\usr\Corchu\Articulos\AOP\EuroPar01/europar01.dvi) @start %DVIPSBitmapFont: Fa cmmi6 6 2 /Fa 2 117 df<13F8EA0FF0A21200A2485AA4485AA4380787E0EB9FF8EBB83CEBE01C38 0FC01E1380A21300001E5BA35C5AA2ECF0201530481460EB01E015C0A239F000E380ECFF 000060133C1C247CA224>104 D<133013785BA4485AA4485AB51280A23803C000485AA4 48C7FCA4121EA25B1480383C03001306A25BEA1C38EA0FF0EA07C011217D9F18>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb cmr6 6 1 /Fb 1 44 df<1438B2B712FEA3C70038C7FCB227277C9F2F>43 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc cmmi7 7 5 /Fc 5 117 df<133EEA07FEA2EA007CA213FCA25BA21201A25BA2120314FCEBE3FF9038 EF0780D807FC13C0EBF00313E0A2EA0FC014071380A2121FEC0F801300A248EB1F00A200 3E1406143E127EEC7C0C127C151800FCEB3C30157048EB1FE00070EB0F801F297CA727> 104 D<130E131F5BA2133E131C90C7FCA7EA03E0487EEA0C78EA187C1230A212605B12C0 A2EA01F0A3485AA2485AA2EBC180EA0F81A2381F0300A213066C5A131CEA07F06C5A1128 7DA617>I<133EEA07FEA2EA007CA213FCA25BA21201A25BA21203EC07809038E01FC0EC 38600007EB61E014C3EBC187EBC307D80FC613C09038CC038001B8C7FC13E0487E13FEEB 3F80EB0FC0486C7E1303003E1460A2127EECC0C0127CECC18012FC903801E30038F800FE 0070137C1B297CA723>107 D<3907801FC0390FE07FF03918F0E0F83930F1807CEBFB00 D860FE133C5B5B00C1147C5B1201A248485BA34A5AEA07C01660EC03E0A23A0F8007C0C0 A2EDC180913803C300D81F0013C7EC01FE000EEB00F8231B7D9929>110 D<131C133EA25BA45BA4485AB512E0A23801F000485AA4485AA4485AA448C7FC1460A214 C0123EEB0180EB0300EA1E06EA1F1CEA0FF8EA03E013267EA419>116 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd cmr7 7 3 /Fd 3 51 df<140EB3A2B812E0A3C7000EC8FCB3A22B2B7DA333>43 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215267BA521>49 D<13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4127CC7FC15 005C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA018039030003 0012065A001FB5FC5A485BB5FCA219267DA521>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe cmti9 9 44 /Fe 44 122 df39 D44 DI49 DI57 D<1370EA01FC1203A413F8EA00E01300B0121C12 7F5AA45A12380E20779F18>I<161C163CA2167C16FCA21501821503A2ED077E150F150E 151CA21538A2157015F015E0EC01C0A2913803807F82EC0700A2140E141E141C5CA25CA2 5C49B6FCA25B913880003F49C7EA1F80A2130E131E131C133C13385B13F05B12011203D8 0FF0EC3FC0D8FFFE903807FFFEA32F367BB539>65 D67 D<0107B612C04915F017FC903A003F8001FEEE007FEF1F8092C7EA0FC0 EF07E05CEF03F0147E170102FE15F8A25CA21301A25CA2130317035CA2130718F04A1407 A2130F18E04A140F18C0011F151F18805CEF3F00133F177E91C85AA2494A5A4C5A017E4A 5A4C5A01FE4A5A047EC7FC49495A0001EC0FF8007FB612E0B7C8FC15F835337BB23A>I< 0107B712F05B18E0903A003F80001F1707170392C7FC17015C18C0147EA214FEA24A130E A20101EC1E03041C13804A91C7FC163C13035E9138F001F891B5FC5B5EECE0011500130F 5E5C1707011F01015BEEC00E0280141E92C7121C133F173C91C812381778495DA2017E14 014C5A01FE14074C5A49141F00014AB45A007FB7FCB8FC94C7FC34337CB234>I<0107B7 12E05B18C0903A003F80003F170F170792C7FC17035C1880147EA214FEA25C161C0101EC 3C07043813004A91C7FCA20103147816704A13F0150349B5FCA25EECE003130F6F5A14C0 A2011F13035E1480A2013F90C9FCA291CAFCA25BA2137EA213FEA25B1201387FFFFCB5FC A233337CB232>I<010FB51280A216009038003FC05DA292C7FCA25CA2147EA214FEA25C A21301A25CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133FA291C8FCA25BA213 7EA213FEA25B1201B512F8A25C21337BB21E>73 D<0107B512C05BA29026003FC0C7FC5D A292C8FCA25CA2147EA214FEA25CA21301A25CA21303A25CA21307A25CA2130FA25C17E0 011F140117C05C1603013F1580160791C7FCEE0F005B5E017E143EA201FE5CED01FC4913 030001EC1FF8007FB6FCB7FC5E2B337CB230>76 D<902607FFC0ED7FFC4917FF81D9003F 4B1300611803023BED077CA2027BED0EFC610273151C1838DAF1F01439F071F014E118E1 0101ED01C36102C1EC0383EF070301031607050E5BEC80F8171C0107ED380F6102001470 A249EDE01FDC01C090C7FC130EEE0380011E017C5C933807003E011C140EA2013C4A137E 187C01385C5E017816FC6F485B1370ED3FC001F0EC80016000011500D807F81503277FFF 803E90B512C0B5EB3C01151C46337BB245>I79 D<0107B612C04915F883903A003F8001FEEE003FEF1F8092C713C0170F5C18E014 7EA214FEEF1FC05CA201011680173F4A1500177E010315FE5F4AEB03F8EE07E00107EC3F C091B6C7FC16F802E0C9FC130FA25CA2131FA25CA2133FA291CAFCA25BA2137EA213FEA2 5B1201387FFFF0B5FCA233337CB234>I<0107B512FE49ECFFC017F0903A003F8007F8EE 01FCEE007E92C7127F835C1880147EA214FEEF7F005CA2010115FE5F4A13015F01034A5A EE0FC04A495A04FEC7FC49B512F016C09138E003E0ED01F8010F6D7E167C4A137EA2131F A25CA2013F14FEA291C7FCA24913015E137EEF01C001FE150318805B00011607277FFFF0 001400B5ECFE0EEE7E1CC9EA1FF8EE07E032357BB238>82 D<913901FC018091380FFF03 023F13C791387E07EF903A01F801FF0049487E4A7F495A4948133E131F91C7FC5B013E14 3CA3137E1638A293C7FC137FA26D7E14E014FE90381FFFC06D13F86D7F01017F6D6C7E02 0F7F1400153F6F7E150FA4120EA2001E5D121CA2151F003C92C7FCA2003E143E5D127E00 7F5C6D485A9038C007E039F3F80FC000F0B5C8FC38E03FFC38C00FF029377AB42B>I<00 03B812C05A1880903AF800FC003F260FC001141F0180150F01005B001EEE07001403121C 003C4A5BA200380107140E127800705CA2020F141E00F0161CC74990C7FCA2141FA25DA2 143FA292C9FCA25CA2147EA214FEA25CA21301A25CA21303A25CA21307A25C497E001FB5 12F05AA2323374B237>I<3B3FFFF801FFFE485CA2D801FEC7EA1FC049EC0F8017004914 0EA2161E120349141CA2163C1207491438A21678120F491470A216F0121F495CA2150112 3F90C75BA215035A007E5DA2150712FE4892C7FCA25D150E48141E151C153C153815786C 5C5D007C1301007E495A003EEB0F806C011EC8FC380FC0FC6CB45A000113E06C6CC9FC2F 3570B239>I97 D<137EEA0FFE121F5B1200A35BA21201A25BA21203A25BA212 07A2EBC3E0EBCFF8380FDC3EEBF81F497E01E01380EA1FC0138015C013005AA2123EA200 7E131F1580127CA2143F00FC14005AA2147EA25CA2387801F85C495A6C485A495A6C48C7 FCEA0FFCEA03F01A3578B323>I<14FCEB07FF90381F078090383E03C0EBFC013801F803 3803F0073807E00F13C0120F391F80070091C7FC48C8FCA35A127EA312FE5AA4007C14C0 EC01E0A2EC03C06CEB0F80EC1F006C137C380F81F03803FFC0C648C7FC1B2278A023>I< ED0FC0EC03FFA21680EC001FA31600A25DA2153EA2157EA2157CA215FCA2903803F0F8EB 0FF8EB3E1DEB7C0F496C5AEA01F0EA03E000071303D80FC05BA2381F8007A2D83F005BA2 140F5A007E5CA2141F12FE4891C7FC1506EC3F075DEC3E0E147E007C141EECFE1CEB01FC D83C03133C393E07BE38391F0E1E783907FC0FF03901F003C0223578B327>II<151FED7FC0EDF0E0020113 F0EC03E3A2EC07C316E0EDC1C091380FC0005DA4141F92C7FCA45C143E90381FFFFEA3D9 007EC7FC147CA414FC5CA513015CA413035CA413075CA3130FA25CA3131F91C8FCA35B13 3E1238EA7E3CA2EAFE7812FC485AEA78E0EA3FC0000FC9FC244582B418>I<143FECFF80 903803E1E6903807C0FF90380F807FEB1F00133E017E133F49133EA24848137EA2484813 7CA215FC12074913F8A21401A2D80FC013F0A21403120715E01407140F141F3903E03FC0 0001137FEBF0FF38007FCF90381F0F801300141FA21500A25C143E1238007E137E5C00FE 5B48485A387803E0387C0F80D81FFFC7FCEA07F820317CA023>III<1538157C15FCA315701500AB143EECFF80903801E3C090380383E0 EB0701130FEB0E03131C133C133814071378013013C01300140FA21580A2141FA21500A2 5CA2143EA2147EA2147CA214FCA25CA21301A25CA213035C1238387E07C0A238FE0F8048 48C7FCEAF83EEA787CEA3FF0EA0F801E4283B118>II<133FEA07FF5A13FEEA007EA3137CA213FCA213 F8A21201A213F0A21203A213E0A21207A213C0A2120FA21380A2121FA21300A25AA2123E A2127EA2127C1318EAFC1C133CEAF838A21378137012F013F0EAF8E01279EA3FC0EA0F00 103579B314>I<2703C003F8137F3C0FF00FFE01FFC03C1E783C1F07C1E03C1C7CF00F8F 01F03B3C3DE0079E0026383FC001FC7FD97F805B007001005B5E137ED8F0FC90380FC001 00E05FD860F8148012000001021F130360491400A200034A13076049013E130FF0818000 07027EEC83C0051F138049017C1403A2000F02FC1407053E130049495CEF1E0E001F0101 5D183C010049EB0FF0000E6D48EB03E03A227AA03F>I<3903C007F0390FF01FFC391E78 7C1E391C7CF01F393C3DE00F26383FC01380EB7F8000781300EA707EA2D8F0FC131F00E0 1500EA60F8120000015C153E5BA20003147E157C4913FCEDF8180007153C0201133801C0 13F0A2000F1578EDE070018014F016E0001FECE1C015E390C7EAFF00000E143E26227AA0 2B>I<14FCEB07FF90381F07C090383E03E09038FC01F0EA01F83903F000F8485A5B120F 484813FCA248C7FCA214014814F8127EA2140300FE14F05AA2EC07E0A2007CEB0FC01580 141FEC3F006C137E5C381F01F0380F83E03803FF80D800FCC7FC1E2278A027>I<011E13 7C90387F81FF9039F3C387C09039E3EF03E03901E1FE01D9C1FC13F0EBC3F8000313F001 8314F814E0EA07871307000313C01200010F130316F01480A2011F130716E01400A249EB 0FC0A2013EEB1F80A2017EEB3F00017F133E5D5D9038FF81F09038FDC3E09038F8FF8002 7EC7FC000190C8FCA25BA21203A25BA21207A25BB5FCA325307FA027>I<3903C00FC039 0FF03FF0391E78F078391C7DE03C393C3FC0FC00381380EB7F00007814F8D8707E137015 00EAF0FC12E0EA60F812001201A25BA21203A25BA21207A25BA2120FA25BA2121FA290C8 FC120E1E227AA020>114 D I<1303EB0F80A3131FA21400A25BA2133EA2137EA2137C387FFFF8A2B5FC3800F800A212 01A25BA21203A25BA21207A25BA2120FA25B1460001F13F014E01300130114C01303001E 1380EB07005BEA0F1EEA07F8EA01E015307AAE19>II<01F01338 D803FC13FCEA0F1E120E121C123C0038147CEA783E0070143CA2137ED8F07C1338EA60FC C65A1578000114705BA215F0000314E05BA2EC01C0A2EBC003158014071500EBE00EA26C 6C5A3800F878EB7FE0EB1F801E227AA023>II<13F0D803FC1307D80F1E130F000E141F121C123C0038143F D8783E133E1270A2017E137ED8F07C137CEA60FCC65A15FC000114F85BA21401000314F0 13E0A2140315E0EA07C0A20003130715C0EBE00F141F0001133F9038F07F8038007FEFEB 1F8FEB001F1500A25C003E133E007E137E147C5C007C5BEA7001495A38380780D83C1FC7 FCEA0FFCEA07F020317AA025>121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmmib10 10 1 /Ff 1 12 df11 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg cmbx10 10 18 /Fg 18 124 df46 D<141E143E14FE1307133FB5FCA313CFEA000FB3B3A6007FB61280A4213779B630> 49 DII80 D97 D<903801FFC0010F13FC017F13FFD9FF8013802603FE0013C048485AEA 0FF8121F13F0123F6E13804848EB7F00151C92C7FC12FFA9127FA27F123FED01E06C7E15 036C6CEB07C06C6C14806C6C131FC69038C07E006DB45A010F13F00101138023257DA42A >99 DI<9038 03FF80011F13F0017F13FC3901FF83FE3A03FE007F804848133F484814C0001FEC1FE05B 003FEC0FF0A2485A16F8150712FFA290B6FCA301E0C8FCA4127FA36C7E1678121F6C6C14 F86D14F000071403D801FFEB0FE06C9038C07FC06DB51200010F13FC010113E025257DA4 2C>II105 D<01FED97FE0EB0FFC00FF902601FFFC90383FFF80020701FF90B512 E0DA1F81903983F03FF0DA3C00903887801F000749DACF007F00034914DE6D48D97FFC6D 7E4A5CA24A5CA291C75BB3A3B5D8FC1FB50083B512F0A44C257DA451>109 D<01FEEB7FC000FF903803FFF8020F13FE91381F03FFDA3C011380000713780003497E6D 4814C05CA25CA291C7FCB3A3B5D8FC3F13FFA430257DA435>I<903801FFC0010F13F801 7F13FFD9FF807F3A03FE003FE048486D7E48486D7E48486D7EA2003F81491303007F81A3 00FF1680A9007F1600A3003F5D6D1307001F5DA26C6C495A6C6C495A6C6C495A6C6C6CB4 5A6C6CB5C7FC011F13FC010113C029257DA430>I<9039FF01FF80B5000F13F0023F13FC 9138FE07FFDAF00113800007496C13C06C0180EB7FE091C713F0EE3FF8A2EE1FFCA3EE0F FEAA17FC161FA217F8163F17F06E137F6E14E06EEBFFC0DAF00313809139FC07FE009138 3FFFF8020F13E0020390C7FC91C9FCACB512FCA42F357EA435>I<9038FE03F000FFEB0F FEEC3FFF91387C7F809138F8FFC000075B6C6C5A5CA29138807F80ED3F00150C92C7FC91 C8FCB3A2B512FEA422257EA427>114 D<130FA55BA45BA25B5BA25A1207001FEBFFE0B6 FCA3000390C7FCB21578A815F86CEB80F014816CEBC3E090383FFFC06D1380903803FE00 1D357EB425>116 D123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmmi9 9 31 /Fh 31 120 df<147F903803FFE090380FC0F890383F007C017C017E1360497F484815E0 484890381F80C0120748481481EEC1804848130F003F15C390C7140016C74815C6007E15 CE16DC16D816F8485D5E5E127CA3151F6C143F037713C06C903801E7E03A0F800783E13B 07C07E03E3803B01FFF801FF003A007F80007C2B227EA031>11 D<16035E5EA24C7EA216 3F167FA216FFA2ED01BFED033F831506161F150C1518A215301570156015C083EC018002 03130F15001406A25C141C14184A80A2027FB5FC91B6FCA2903901800007A249C7FC1306 835B16035B5B1370136013E01201D807F04A7EB549B512F0A25B34367DB53A>65 D67 D<010FB712FEA218FC903A 003FC000031700187C4B143CA2027F151C181892C8FCA25CA24A1303A201014A13380406 13304A1500160E13035E4A137C91B512FC5B5EECF0001638130F16305C1860011F027013 E0046013C04A140104001380133F17034A15005F017F150EA291C8121E5F49157C5F4914 030001ED1FF0B8FCA25F37337DB239>69 D<010FB712FCA218F8903A003FC00007170018 785D1838147F183092C8FCA25CA25C16060101020E1370040C13604A1500A20103141C5E 5C16F849B5FCA25EECF001010F130016605CA2011F14E05E5CA2013F91C8FCA25CA2137F A291CAFCA25BA25B487EB6FCA336337DB231>I<0107B512E05BA29039001FF0005DA25D A2143FA25DA2147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25C A2131FA25CA2133FA25CA2137FA291C8FC5B007F13FEB5FCA223337EB222>73 D<010FB500C090B5FCA39026003FE0C7EA1FE04B1500183E4B143818F0027FEC01C04D5A 92C7000EC7FC5F4A5C17E04A495A4C5A0101020EC8FC5E4A5B16F0010313011503ECF80F 4B7E0107133FEDF3FCECF1C39138F381FE90380FF7019138FC00FF5C5C49486D7EA24A6D 7EA2013F6E7EA24A6D7EA2137F707E91C7FC707E5B707E5B00014B7EB500FC013F13F85E A240337DB241>75 D<010FB512F0A39026003FE0C7FC5DA25DA2147FA292C8FCA25CA25C A21301A25CA21303A25CA21307A25CA2130FA25C170C011F151C17185C1738013F153017 705C17E0137F160191C7EA03C0160749EC0F80161F49147F0001913803FF00B8FCA25E2E 337DB234>I<90260FFFE049B5FCA281D9001F9138000FE04A6CEC07801900DA33FC1406 A2DA71FE140E180C146081DAE07F141C701318ECC03F82010116386F6C133014806F7E01 0316706F6C136014001503496E13E003015C0106801500010EECFF0160010CEC7F81A201 1CEC3FC395C7FC0118EC1FE3A20138EC0FF717F60130140717FE017014035F01601401A2 13E0705A1201D807F01578B57E1730A240337DB23D>78 DI<010FB612F017FE83903B003FC0007FC0EF1F E0EF07F05DEF03F8147FA292C713FCA25CEF07F85CA2010116F0170F4A15E0EF1FC00103 ED3F80EF7F004A14FEEE03FC0107EC1FF091B612C04CC7FC02F0C9FC130FA25CA2131FA2 5CA2133FA25CA2137FA291CAFCA25BA25B1201B512FCA336337DB231>I<010FB67E17F8 17FE903A003FC001FF9338003FC0EF1FE04B130FEF07F0147FA292C713F8A25CEF0FF05C A20101ED1FE018C04AEC3F8018000103157E4C5A4AEB07F0EE3FC049B500FEC7FC16F891 38F0007E82010F6E7E707E5C83131FA25CA2013F141FA25CA2017F143F5F91C7FC180649 160E180C49161C00011718B500FC011F133893380FE070040713E0C93803FFC09338007F 0037357DB23A>82 D<03FF13180207EBE038021FEBF87891397F00FCF802FCEB1FF0D901 F0130F4948130749481303494814E0A249C71201A2013E15C0A3137E1780A2017F91C7FC 8080EB3FF014FF15F06D13FE6D6D7E6D806D80010080020F7F1400150F6F7E1503150115 00A2120CA2001C5D1218A2150100385D003C14035E4B5A007E4A5A007F141F6D49C7FCD8 7BE0137C39F9FC03F839F07FFFE0D8E01F138026C003FEC8FC2D377CB42F>I<0003B812 F05A18E0903AF0007F000FD80F8049130390C71401000E5C48EE00C01401121800384A13 01A2003001031580127000605CA20207140300E01700C74990C7FCA2140FA25DA2141FA2 5DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25C497E001FB512FEA334 337FB22D>I<267FFFFE90380FFFF8A3000190C8EA7F0049153C1738491530A217701203 491560A217E01207495DA21601120F495DA21603121F4992C7FCA25E123F491406A2160E 127F90C8120CA2161C5A481518A216381630481570166016E04B5A7E007E4A5A4BC8FC00 7F140E6C143C6C6C5B6C6C485A3907F00FC06CB5C9FCC613FCEB1FE035357BB234>I97 D<147F903803FFC090380FC0F090383F0038137C4913F83801F0013803E0031207 EA0FC090388001F0001F90C7FC123F90C8FCA25A127EA45AA3127C150C151C15386C1470 15E06CEB03C0390F800F003807C07E3801FFF038007F801E227EA021>99 D I<14FE903807FF8090381F03C090387C01E03801F800485A485A485A485A1401D83F0013 C01403007EEB0F80ECFE00387FFFF8B5128000FCC8FCA45AA415186C1438007C147015E0 003CEB01C0003EEB07806CEB1E00380F80FC3803FFE0C690C7FC1D227DA024>I103 DII107 DI 110 D<147F903803FFC090380FC1F090383F00F8017C137C497F485A48487F1207485A5B 001F1580123F90C7FCED3F005A127EA25D157E5A15FE5D007C5C14014A5A5D6C495A4A5A 6C49C7FC380F807E3807C1F83801FFE06C6CC8FC21227EA025>I<3903E003E0390FF81F F8391C7C3C1C0018EB703E39383EE0FE38303FC0EB7F800070EB00FCEA607E157000E014 00EAC0FEEA40FC1200A212015BA312035BA312075BA3120F5BA3121F5B0007C8FC1F227E A023>114 DII<13F8D803FEEB01C0 D8070FEB03E0000EEB8007121C001813C00038140FEA301F0070018013C01260013F131F 00E0130000401580C65A017E133F13FE491400A25D120149137E1602EDFE0716064913FC A2160E0201130C9039F803F81C1618000090380F7C38D97C1C137090393FF81FE0903907 E0078028227EA02C>I<01F01507D803FC903903800F80D8071E903907C01FC0D80E1F13 0F121C00380180140F0030021F1307013FEC8003007013000060160149133FD8E07E1680 00401500EA00FE494913030001170049137EA203FE5B00031606495B170E170CA24B131C 4915186D15384A6C5B17600001010314E03B00F8077E01C0903A7C0E3F078090273FFC0F FEC7FC903907F001F832227EA037>119 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmmib10 12 1 /Fi 1 12 df11 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj cmmi10 10 46 /Fj 46 122 df11 D<013FB512FE90B7FC5A5A4815FE260F801CC7FCEA1E005A00385B5A5A 481378C7FC147014F0A4495AA31303A3495AA3130FA25C131FA3133FA291C8FC131E2825 7EA324>28 D<121C127FEAFF80A5EA7F00121C0909798817>58 D<121C127FEAFF80A213 C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A12600A19798817>II<150C151E153EA2153C 157CA2157815F8A215F01401A215E01403A215C01407A21580140FA215005CA2141E143E A2143C147CA2147814F8A25C1301A25C1303A2495AA25C130FA291C7FC5BA2131E133EA2 133C137CA2137813F8A25B1201A25B1203A25B1207A25B120FA290C8FC5AA2121E123EA2 123C127CA2127812F8A25A12601F537BBD2A>I<126012FCB4FCEA7FC0EA1FF0EA07FCEA 01FF38007FC0EB1FF0EB07FCEB01FF9038007FC0EC1FF0EC07FCEC01FF9138007FC0ED1F F0ED07FCED01FF9238007FC0EE1FF0EE07FCEE01FF9338007F80EF1FC0A2EF7F80933801 FF00EE07FCEE1FF0EE7FC04B48C7FCED07FCED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7F C04948C9FCEB07FCEB1FF0EB7FC04848CAFCEA07FCEA3FF0EA7FC048CBFC12FC12703232 79AD41>I<1760177017F01601A21603A21607160FA24C7EA216331673166316C3A2ED01 83A2ED0303150683150C160115181530A21560A215C014011580DA03007FA20206130014 0E140C5C021FB5FC5CA20260C7FC5C83495A8349C8FC1306A25BA25B13385B01F0168048 7E000716FFB56C013F13FF5EA2383C7DBB3E>65 D<9339FF8001C0030F13E0037F9038F8 0380913A01FF807E07913A07F8000F0FDA1FE0EB079FDA3F80903803BF0002FFC76CB4FC D901FC80495A4948157E495A495A4948153E017F163C49C9FC5B1201484816385B120748 5A1830121F4993C7FCA2485AA3127F5BA312FF90CCFCA41703A25F1706A26C160E170C17 1C5F6C7E5F001F5E6D4A5A6C6C4A5A16076C6C020EC8FC6C6C143C6C6C5C6CB4495A9039 3FE00FC0010FB5C9FC010313FC9038007FC03A3D7CBA3B>67 D<0103B7FC4916E018F890 3B0007F80007FE4BEB00FFF03F80020FED1FC0180F4B15E0F007F0021F1503A24B15F818 01143F19FC5DA2147FA292C8FCA25C18035CA2130119F84A1507A2130319F04A150FA201 0717E0181F4A16C0A2010FEE3F80A24AED7F00187E011F16FE4D5A4A5D4D5A013F4B5A4D 5A4A4A5A057FC7FC017F15FEEE03FC91C7EA0FF049EC7FC0B8C8FC16FC16C03E397DB845 >I<0103B812F05BA290260007F8C7123F4B1407F003E0020F150118005DA2141FA25D19 C0143FA24B1330A2027F1470190092C7126017E05C16014A495A160F49B6FCA25F9138FC 000F01031407A24A6DC8FCA201075C18034A130660010F160693C7FC4A150E180C011F16 1C18184A1538A2013F5E18F04A4A5AA2017F15074D5A91C8123F49913803FF80B9FCA295 C7FC3C397DB83D>I<0103B812E05BA290260007F8C7123F4B140FF003C0140F18015DA2 141FA25D1980143FA25D1760027F14E095C7FC92C75AA24A1301A24A495A16070101141F 91B6FC94C8FCA2903903FC001F824A130EA21307A24A130CA2010F141CA24A90C9FCA213 1FA25CA2133FA25CA2137FA291CBFC497EB612C0A33B397DB835>II<0107B512FCA216F890390007F8005DA2140FA25DA2141FA25DA2143F A25DA2147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131F A25CA2133FA25CA2137FA291C8FC497EB6FCA326397DB824>73 D<0103B500F8903807FF FC5BA290260007F8C813804BEDFC0019F0020F4B5AF003804B4AC7FC180E021F1538604B 5CEF0380023F4AC8FC170E4B133C1770027F5C4C5ADB0007C9FC160E4A5B167E4A13FE4B 7E01015B92380E7F80ECFC1CED383F010301E07FECFDC04A486C7EECFF00D907FC6D7E5C 4A130783130F707E5C1601011F81A24A6D7EA2013F6F7EA24A143F84137F717E91C8123F 496C81B60107B512C0A26146397DB847>75 D<0103B6FC5B5E90260007FCC8FC5D5D140F A25DA2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CA21307 18404A15C0A2010F150118804A1403A2011F16005F4A1406170E013F151E171C4A143C17 7C017F5D160391C7120F49EC7FF0B8FCA25F32397DB839>I<902603FFF891381FFFF849 6D5CA2D90007030113006FEC007C02061678DA0EFF157081020C6D1460A2DA1C3F15E070 5CEC181F82023815016F6C5C1430150702706D1303030392C7FC02607FA2DAE0015C7013 06ECC0008201016E130EEF800C5C163F0103EDC01C041F131891C713E0160F49EDF03818 300106140717F8010E02031370EFFC60130CEE01FE011C16E004005B011815FF177F1338 600130153FA20170151F95C8FC01F081EA07FCB512E01706A245397DB843>78 D<4BB4FC031F13F09238FE01FC913903F0007EDA07C0EB1F80DA1F80EB0FC0023EC7EA07 E002FCEC03F0495A4948EC01F8495A4948EC00FC495A49C912FE49167E13FE49167F1201 485AA2485AA2120F5B001F17FFA2485AA34848ED01FEA400FFEE03FC90C9FCA2EF07F8A2 EF0FF0A218E0171F18C0EF3F806C167F180017FE4C5A6C6C5D1603001F4B5A6D4A5A000F ED1F806C6C4AC7FC6D147E0003EC01F8D801FC495AD8007EEB0FC090263F807FC8FC9038 07FFF801001380383D7CBA3F>I<0103B7FC4916E018F8903B0007F80007FC4BEB00FE18 7F020FED3F80F01FC05DA2021F16E0A25DA2143FF03FC05DA2027FED7F80A292C8130018 FE4A4A5A604AEC07F04D5A0101ED3FC04CB4C7FC91B612FC17E0D903FCCAFCA25CA21307 A25CA2130FA25CA2131FA25CA2133FA25CA2137FA291CBFC497EB6FCA33B397DB835>I< 4BB4FC031F13F09238FE01FC913903F0007EDA07C0EB1F80DA1F80EB0FC0023EC7EA07E0 02FCEC03F0495A4948EC01F8495A4948EC00FC495A013F16FE49C9FC13FE187F485A1203 5B12075B120F4916FF121FA2485AA34848ED01FEA448C9EA03FCA3EF07F8A218F0170F18 E0171F18C0EF3F807EEF7F0017FEDA07C05B6C90391FF001F8903980383803001F496C48 5A9139E00C0FE0260FC0C0EB1F80D807E1D90E3FC7FC0280137ED803F1EB07F8D801F95C 3A007FC00FC0903A3FE07F0003903807FFFE0100018F5BDA000F1306170E171E705A177C EEC1F816FF5FA25F5F6F5B6F48C7FCED00F8384B7CBA42>I<0103B612F849EDFF8018E0 903B0007F8001FF84BEB03FCEF00FE020F157FA24BEC3F80A2021F16C0A25DA2143FF07F 805DA2027FEDFF006092C7485A4D5A4A4A5A4D5A4AEC1F80057FC7FC0101EC07F891B612 E094C8FC9139FC000FC00103EC03F0707E4A6D7E831307177E5C177F010F5D5F5CA2011F 1401A25CA2133F16034A4A1360A2017F17E019C091C71401496C01011480B61503933900 FE0700EF7E0ECAEA1FFCEF07F03B3B7DB83F>I<92391FE00380DBFFFC130002036D5A91 390FE01F8F91393F0007DF027EEB01FE02F81300495A4948147E177C4948143C495AA201 1F153891C8FCA3491530A28094C7FC80806D7E14FEECFFE06D13FE6DEBFFC06D14F06D80 6D80021F7F02037FEC003F03037F1500167F163F161FA3120C160FA2001C151F94C7FCA3 003C153EA25E003E5D127E007F4A5A6D495A6DEB0FC0D8F9F0495AD8F0FE01FEC8FC39E0 3FFFF8010F13E0D8C00190C9FC313D7CBA33>I<0003B812FEA25A903AF8003FC00101C0 913880007E4848163C90C7007F141C121E001C92C7FCA2485CA200305C00701718006013 0112E0485CA21403C716005DA21407A25DA2140FA25DA2141FA25DA2143FA25DA2147FA2 92C9FCA25CA25CA21301A25CA21303A25CEB0FFC003FB6FC5AA237397EB831>I<003FB5 6C48B51280485DA226007F80C7381FF00091C8EA07C0604993C7FCA2491506A20001160E 170C5BA20003161C17185BA20007163817305BA2000F167017605BA2001F16E05F5BA200 3F15015F5BA2007F150394C8FC90C8FCA25E4815065A160E160C161C161816385E127E5E 4B5A6C4A5A4BC9FC6C6C131E6C6C5B6C6C13F83903F807E06CB55A6C6C48CAFCEB0FF039 3B7BB839>I<267FFFFC91383FFFC0B55DA2000390C83807FC006C48ED03E06060000094 C7FC5F17065FA25F6D5DA26D5D17E05F4C5AA24CC8FC6E1306A2013F5C161C16185EA25E 6E5BA2011F495A150393C9FC1506A25D6E5AA2010F5B157015605DA2ECE18002E3CAFC14 F3EB07F614FE5C5CA25C5CA26D5AA25C91CBFC3A3B7CB830>I<277FFFFC01B500F890B5 1280B5FC60000390C7D807FCC7380FF80001FC4BEC03E000016204035E98C7FC621A0604 075DA2040F5DA2041B5D6216336D02735D1663000003C34A5A83DB01834AC8FC04815CDB 0301140603075D1506030C5DA203185D1970033015606115606D01E04A5A15C090267F01 804AC9FC17FEDA030014060400130E0206150C020E5D140C4A5DA24A5D18E04A5D715A5C 4A92CAFCA26DC85AA2013E157C1778133C1770133801301560513B7CB84E>I89 D<147E903803FF8090390FC1C38090391F00EFC0017E13 7F49133F485A4848EB1F8012075B000F143F48481400A2485A5D007F147E90C7FCA215FE 485C5AA214015D48150CA21403EDF01C16181407007C1538007E010F1330003E131F027B 13706C01E113E03A0F83C0F9C03A03FF007F80D800FCEB1F0026267DA42C>97 D99 D<163FED1FFFA3ED007F167EA216FEA216FCA21501A216F8A21503A216F0A21507A2 027E13E0903803FF8790380FC1CF90381F00EF017EEB7FC049133F485A4848131F000715 805B000F143F485A1600485A5D127F90C7127EA215FE5A485CA21401A248ECF80CA21403 161CEDF0181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0F9C0 3A03FF007F80D800FCEB1F00283B7DB92B>II103 DI<14E0EB03F8A21307A314F0EB01C090C7FCAB13F8EA03FEEA070F000E138012 1C121812381230EA701F1260133F00E0130012C05BEA007EA213FE5B1201A25B12035BA2 0007131813E01438000F133013C01470EB806014E014C01381EB838038078700EA03FEEA 00F815397EB71D>I107 DIIII<90390F8003F090391FE00FFC903939 F03C1F903A70F8700F80903AE0FDE007C09038C0FF80030013E00001491303018015F05C EA038113015CA2D800031407A25CA20107140FA24A14E0A2010F141F17C05CEE3F80131F EE7F004A137E16FE013F5C6E485A4B5A6E485A90397F700F80DA383FC7FC90387E1FFCEC 07E001FEC9FCA25BA21201A25BA21203A25B1207B512C0A32C3583A42A>I<3903E001F8 3907F807FE390E3C1E07391C3E381F3A183F703F800038EBE07F0030EBC0FF00705B0060 1500EC007E153CD8E07F90C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA312 0F5BA3121F5B0007C9FC21267EA425>114 D<14FF010313C090380F80F090383E003801 78131C153C4913FC0001130113E0A33903F000F06D13007F3801FFE014FC14FF6C14806D 13C0011F13E013039038003FF014071403001E1301127FA24814E0A348EB03C012F800E0 EB07800070EB0F006C133E001E13F83807FFE0000190C7FC1E267CA427>II<13F8D803FE1438D8070F147C000E6D 13FC121C1218003814011230D8701F5C12601503EAE03F00C001005B5BD8007E1307A201 FE5C5B150F1201495CA2151F120349EC80C0A2153F1681EE0180A2ED7F0303FF13001201 4A5B3A00F8079F0E90397C0E0F1C90393FFC07F8903907F001F02A267EA430>I<01F816 F0D803FE9138E001F8D8070F903801F003000ED9800314FC121C12180038020713010030 EDE000D8701F167C1260030F143CD8E03F163800C001005B5BD8007E131F183001FE5C5B 033F1470000117604991C7FCA218E000034A14C049137E17011880170318005F03FE1306 170E000101015C01F801BF5B3B00FC039F8070903A7E0F0FC0E0903A1FFC03FFC0902703 F0007FC7FC36267EA43B>119 D<13F8D803FE1470D8070F14F8000EEB8001121C121800 381403003015F0EA701F1260013F130700E0010013E012C05BD8007E130F16C013FE5B15 1F000115805BA2153F000315005BA25D157EA315FE5D1401000113033800F80790387C1F F8EB3FF9EB0FE1EB00035DA2000E1307D83F805B007F495AA24A5A92C7FCEB003E007C5B 00705B6C485A381E07C06CB4C8FCEA01FC25367EA429>121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk cmti10 10 22 /Fk 22 122 df<04FFEB03F003039038E00FFC923A0FC0F01F1E923A3F00783E0F923A7E 01F87C3FDB7C03EBFC7F03FC14F8DA01F813F905F1137EDC01E1133C913B03F00003F000 A314074B130760A3140F4B130F60A3010FB812C0A3903C001F80001F8000A3023F143F92 C790C7FCA44A5C027E147EA402FE14FE4A5CA413014A13015FA313034A13035FA313074A 495AA44948495AA44948495AA3001CD9038090C8FC007E90380FC03F013E143E00FE011F 5B133C017C5C3AF8780F01E0D878F0EB07C0273FE003FFC9FC390F8000FC404C82BA33> 11 D13 D<14F8EB07FE90381F871C90383E03FE137CEBF80112 0148486C5A485A120FEBC001001F5CA2EA3F801403007F5C1300A21407485C5AA2140F5D 48ECC1C0A2141F15831680143F1587007C017F1300ECFF076C485B9038038F8E391F0F07 9E3907FE03FC3901F000F0222677A42A>97 D<133FEA1FFFA3C67E137EA313FE5BA31201 5BA312035BA31207EBE0F8EBE7FE9038EF0F80390FFC07C013F89038F003E013E0D81FC0 13F0A21380A2123F1300A214075A127EA2140F12FE4814E0A2141F15C05AEC3F80A21500 5C147E5C387801F8007C5B383C03E0383E07C0381E1F80D80FFEC7FCEA01F01C3B77B926 >I<147F903803FFC090380FC1E090381F0070017E13784913383901F801F83803F00312 0713E0120FD81FC013F091C7FC485AA2127F90C8FCA35A5AA45AA3153015381578007C14 F0007EEB01E0003EEB03C0EC0F806CEB3E00380F81F83803FFE0C690C7FC1D2677A426> II<147F903803FFC090380FC1E090383F00F0017E13785B485A485A485A120F4913 F8001F14F0383F8001EC07E0EC1F80397F81FF00EBFFF891C7FC90C8FC5A5AA55AA21530 007C14381578007E14F0003EEB01E0EC03C06CEB0F806CEB3E00380781F83803FFE0C690 C7FC1D2677A426>I103 DII108 DII<147F903803FFC090380F C1F090381F00F8017E137C5B4848137E4848133E0007143F5B120F485AA2485A157F127F 90C7FCA215FF5A4814FEA2140115FC5AEC03F8A2EC07F015E0140F007C14C0007EEB1F80 003EEB3F00147E6C13F8380F83F03803FFC0C648C7FC202677A42A>I<9039078007C090 391FE03FF090393CF0787C903938F8E03E9038787FC00170497EECFF00D9F0FE148013E0 5CEA01E113C15CA2D80003143FA25CA20107147FA24A1400A2010F5C5E5C4B5A131F5EEC 80035E013F495A6E485A5E6E48C7FC017F133EEC70FC90387E3FF0EC0F8001FEC9FCA25B A21201A25BA21203A25B1207B512C0A3293580A42A>I<3903C003F0390FF01FFC391E78 3C0F381C7C703A3C3EE03F8038383FC0EB7F800078150000701300151CD8F07E90C7FCEA E0FE5BA2120012015BA312035BA312075BA3120F5BA3121F5BA3123F90C9FC120E212679 A423>114 D<14FE903807FF8090380F83C090383E00E04913F00178137001F813F00001 130313F0A215E00003EB01C06DC7FC7FEBFFC06C13F814FE6C7F6D13807F010F13C01300 143F141F140F123E127E00FE1480A348EB1F0012E06C133E00705B6C5B381E03E06CB45A D801FEC7FC1C267AA422>II<13F8D803FEEB01C0D8078FEB03E0390E0F8007121E121C0038140F131F007815C012 70013F131F00F0130000E015805BD8007E133FA201FE14005B5D120149137EA215FE1203 49EBFC0EA20201131E161C15F813E0163CD9F003133814070001ECF07091381EF8F03A00 F83C78E090393FF03FC090390FC00F00272679A42D>I<01F0130ED803FC133FD8071EEB 7F80EA0E1F121C123C0038143F49131F0070140FA25BD8F07E140000E08013FEC6485B15 0E12015B151E0003141C5BA2153C000714385B5DA35DA24A5A140300035C6D48C7FC0001 130E3800F83CEB7FF8EB0FC0212679A426>I<01F01507D803FC903903801F80D8071E90 3907C03FC0D80E1F130F121C123C0038021F131F49EC800F00701607A249133FD8F07E16 8000E0ED000313FEC64849130718000001147E5B03FE5B0003160E495BA2171E00070101 141C01E05B173C1738A217781770020314F05F0003010713016D486C485A000190391E7C 07802800FC3C3E0FC7FC90393FF81FFE90390FE003F0322679A437>I<13F0D803FCEB01 C0D8071EEB03E0D80E1F1307121C123C0038140F4914C01270A249131FD8F07E148012E0 13FEC648133F160012015B5D0003147E5BA215FE00075C5BA214015DA314035D14070003 130FEBF01F3901F87FE038007FF7EB1FC7EB000F5DA2141F003F5C48133F92C7FC147E14 7C007E13FC387001F8EB03E06C485A383C1F80D80FFEC8FCEA03F0233679A428>121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl cmsy10 10 7 /Fl 7 107 df<007FB81280B912C0A26C17803204799641>0 D39 D<156015F0A21401EB07F190383FFFE0EB7C1FEBF00748486C5AD803C07F4848487ED80F 007FA248497E001E14BC153C003E143E141FA248EB1E1F143EA2143CA2147C00FC158014 7814F8A214F0A21301A214E01303A214C0A21307A21480A2130FA214005B007C1500131E A2D87E3E5BA2D83E3C133E137CA21378001F5C13F8000F14784913F800075C0003495AEB E0033901F007802603FC1FC7FCEBFFFEEBC7F0D807C0C8FCA25BA26CC9FC21477CBF2A> 59 D<18F017011707A3170FA2171F60173F1737177F176F17EF17CF04017F178F160317 0FEE0707160EA2161C161816381630167016E0A2ED01C016801503ED0700A2150E5DA25D 157815705D02018103CFB5FCEC03BF4AB6FCA2020EC71203141E5C143802788100205B38 6001E0EAF0036C4848140126FE1F8081B5C8FC190C49EEFF3C496F13F06C4817E06C4817 806C48EE7E00D8078093C7FC3E407DBB42>65 D67 D76 D<126012F0B3B3B3B3A91260045377BD17>106 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmbx12 12 35 /Fm 35 124 df49 DII<163FA25E5E 5D5DA25D5D5D5DA25D92B5FCEC01F7EC03E7140715C7EC0F87EC1F07143E147E147C14F8 EB01F0EB03E0130714C0EB0F80EB1F00133E5BA25B485A485A485A120F5B48C7FC123E5A 12FCB91280A5C8000F90C7FCAC027FB61280A531417DC038>I<0007150301E0143F01FF EB07FF91B6FC5E5E5E5E5E16804BC7FC5D15E092C8FC01C0C9FCAAEC3FF001C1B5FC01C7 14C001DF14F09039FFE03FFC9138000FFE01FC6D7E01F06D13804915C0497F6C4815E0C8 FC6F13F0A317F8A4EA0F80EA3FE0487E12FF7FA317F05B5D6C4815E05B007EC74813C012 3E003F4A1380D81FC0491300D80FF0495AD807FEEBFFFC6CB612F0C65D013F1480010F01 FCC7FC010113C02D427BC038>I58 D67 D70 D73 D77 DI<923807FFC092 B512FE0207ECFFC0021F15F091267FFE0013FC902601FFF0EB1FFF01070180010313C049 90C76C7FD91FFC6E6C7E49486F7E49486F7E01FF8348496F7E48496F1380A248496F13C0 A24890C96C13E0A24819F04982003F19F8A3007F19FC49177FA400FF19FEAD007F19FC6D 17FFA3003F19F8A26D5E6C19F0A26E5D6C19E0A26C6D4B13C06C19806E5D6C6D4B13006C 6D4B5A6D6C4B5A6D6C4B5A6D6C4A5B6D01C001075B6D01F0011F5B010101FE90B5C7FC6D 90B65A023F15F8020715C002004AC8FC030713C047467AC454>II82 D<003FBA12E0A59026FE000FEB8003D87FE09338003FF049171F90C71607A2007E 1803007C1801A300781800A400F819F8481978A5C81700B3B3A20107B8FCA545437CC24E >84 D87 D<903801FFE0011F13FE017F 6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E486C6D7EA26F7FA36F7F6C5A6C5AEA00 F090C7FCA40203B5FC91B6FC1307013F13F19038FFFC01000313E0000F1380381FFE0048 5A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83FFE013EEBFFC03A1FFF80FC7F0007EB FFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36>97 D99 DIII< EB7FC0B5FCA512037EB1ED07FE92383FFF8092B512E002C114F89139C7F03FFC9138CF80 1F9139DF000FFE14DE14FC4A6D7E5CA25CA35CB3A7B60083B512FEA537457CC43E>104 D<137C48B4FC4813804813C0A24813E0A56C13C0A26C13806C1300EA007C90C7FCAAEB7F C0EA7FFFA512037EB3AFB6FCA518467CC520>I107 DI<90397F8007FEB590383FFF8092B512E0028114F8913987F03FFC9138 8F801F000390399F000FFE6C139E14BC02F86D7E5CA25CA35CB3A7B60083B512FEA5372D 7CAC3E>110 DI<90397FC0 0FF8B590B57E02C314E002CF14F89139DFC03FFC9139FF001FFE000301FCEB07FF6C496D 13804A15C04A6D13E05C7013F0A2EF7FF8A4EF3FFCACEF7FF8A318F017FFA24C13E06E15 C06E5B6E4913806E4913006E495A9139DFC07FFC02CFB512F002C314C002C091C7FCED1F F092C9FCADB67EA536407DAC3E>I<90387F807FB53881FFE0028313F0028F13F8ED8FFC 91389F1FFE000313BE6C13BC14F8A214F0ED0FFC9138E007F8ED01E092C7FCA35CB3A5B6 12E0A5272D7DAC2E>114 D<90391FFC038090B51287000314FF120F381FF003383FC000 49133F48C7121F127E00FE140FA215077EA27F01E090C7FC13FE387FFFF014FF6C14C015 F06C14FC6C800003806C15806C7E010F14C0EB003F020313E0140000F0143FA26C141F15 0FA27EA26C15C06C141FA26DEB3F8001E0EB7F009038F803FE90B55A00FC5CD8F03F13E0 26E007FEC7FC232F7CAD2C>III119 D121 D123 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fn cmbx9 9 29 /Fn 29 122 df<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C0C7A8B19>46 D<147814F81303131FEA03FFB5FCA3EAFC1F1200B3B2007FB512FEA41F317AB02C>49 DII<120FEA3FC0EA7FE0EAFFF0A6EA7FE0 EA3FC0EA0F00C7FCA9120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C217AA019> 58 D65 D68 D 70 D75 D77 D<003FB812F8A4D9F003EB801FD87F 80ED03FC01001501007E1600007C177CA20078173CA400F8173E48171EA4C71600B3A901 1FB612F0A437327DB13E>84 D86 D97 DI<90 3807FF80013F13F090B512FC3903FE01FE4848487EEA0FF8EA1FF0EA3FE0A2007F6D5A49 6C5A153000FF91C7FCA9127F7FA2003FEC07807F6C6C130F000FEC1F00D807FE133E3903 FF80FCC6EBFFF8013F13E0010790C7FC21217DA027>II<903803FF80013F13F090B512FC48EB03FE3907FC00 7F4848EB3F804848EB1FC05B003FEC0FE0127F5B16F012FF150790B6FCA301C0C8FCA412 7F7F123F16F06C7E000F14016C6CEB03E0D803FEEB0FC03A01FF807F806C6CB51200011F 13FC010313E024217EA029>I<16F890390FFC07FE90387FFF9F48B6127F3907FC0FFC38 0FF003001F14FED9E001133E003FECFF1C1600A6001F5CEBF003000F5C3907FC0FF890B5 12E0486C1380D90FFCC7FC48C9FCA37F7F90B512F015FE6CECFF8016E06C15F06C15F848 15FC121F393F80001F48C7EA03FE481401481400A46C14016C6CEB03FC6C6CEB07F86C6C EB0FF0D80FFCEB7FE00003B61280C6ECFE00010F13E028327EA12C>103 D105 D108 D<3901F803FF00FF010F13C0023F13F09138FC0FF89039F9E007FC380FFBC06CB4486C7E 1400A25BA25BB2B539E07FFFF0A42C217DA031>110 D<903803FF80011F13F090B512FE 48EB01FF3A07FC007FC0D80FF0EB1FE0001F15F049130F003F15F8491307007F15FCA300 FF15FEA8007F15FCA26D130F003F15F8001F15F06D131F6C6CEB3FE06C6CEB7FC03A01FF 01FF006CEBFFFE013F13F80103138027217EA02C>I<3901FC07FC00FF90387FFF8001FD B512E09039FFF01FF89138C007FC000F90380003FE6C4880496D1380A26F13C0A3EE7FE0 A9EEFFC0A34B1380A26D4913006D495A9138C00FFC9138F03FF801FDB512E0D9FC7F1380 DA0FF8C7FC91C9FCABB512E0A42B307EA031>I<3901F81F8000FFEB7FF0ECFFF89038F9 E3FC9038FBC7FE380FFF876C1307A213FEEC03FCEC01F8EC0060491300B1B512F0A41F21 7EA024>114 D<9038FFE1C0000713FF5A383F803F387E000F14075A14037EA26C6CC7FC 13FCEBFFE06C13FC806CEBFF80000F14C06C14E0C6FC010F13F0EB007F140F00F0130714 037EA26C14E06C13076CEB0FC09038C01F8090B5120000F913FC38E03FE01C217DA023> I<133CA5137CA313FCA21201A212031207001FB51280B6FCA3D807FCC7FCB0EC03C0A790 38FE078012033901FF0F006C13FEEB3FFCEB0FF01A2F7EAE22>II119 D121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fo cmtt9 9 17 /Fo 17 127 df<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A728927>46 D<1538157C15FCA2140115F8140315F0140715E0140F15C0141F1580143F1500A25C147E 14FE5C13015C13035C13075C130F5CA2131F5C133F91C7FC5B137E13FE5B12015B12035B A212075B120F5B121F5B123F90C8FC5A127E12FE5AA25A12781E3A7CB327>I64 D100 DI<153F90391FC0FF80D97FF313C048B612E05A4814EF390FF07F873A1FC01FC3C0ED C000EB800F48486C7EA66C6C485AEBC01FA2390FF07F8090B5C7FC5C485BEB7FF0EB1FC0 90C9FCA27F6CB5FC15E015F84814FE4880EB8001007EC7EA3F80007C140F00FC15C04814 07A46C140F007C1580007F143F6C6CEB7F009038F807FF6CB55A000714F86C5CC614C0D9 0FFCC7FC23337EA027>103 D<130F497E497EA46D5A6DC7FC90C8FCA7383FFF80487FA3 7EEA000FB3A4007FB512F0B6FC15F815F07E1D2F7BAE27>105 D<143C147E14FFA4147E 143C1400A73801FFFE4813FFA37EC7123FB3B0147E1238007C13FE38FE01FC1303B512F8 14F06C13E06C13803807FE0018407CAE27>I<387FFF80B57EA37EEA000FB3B2007FB512 F8B612FCA36C14F81E2E7CAD27>108 D<387FE0FFD8FFF313C090B512F0816C800003EB 81FE49C67E49EB3F8049131F16C049130FA216E01507A6150F16C07F151F6DEB3F80157F 6DEBFF009038FF83FEECFFFC5D5D01F313C0D9F0FEC7FC91C8FCAC387FFF80B57EA36C5B 23317F9F27>112 D<397FFC03FC39FFFE0FFF023F13804A13C0007F90B5FC39007FFE1F 14F89138F00F809138E002004AC7FC5CA291C8FCA2137EAD007FB57EB67EA36C5C22207E 9F27>114 D<9038FFF3800007EBFFC0121F5A5AEB803F38FC000F5AA2EC07806C90C7FC EA7F8013FC383FFFF06C13FC000713FF00011480D8000F13C09038003FE014070078EB03 F000FC1301A27E14036CEB07E0EBE01F90B512C01580150000FB13FC38707FF01C207B9F 27>I<133C137EA8007FB512F0B612F8A36C14F0D8007EC7FCAE1518157EA415FE6D13FC 1483ECFFF86D13F06D13E0010313C0010013001F297EA827>I<397FE01FF8486C487EA3 007F131F00031300B21401A21403EBFC0F6CB612E016F07EEB3FFE90390FF87FE024207F 9F27>I<3A7FFE07FFE000FF15F06D5A497E007F15E03A0F80001F00A36D5B0007143EA4 14F0EBC1F83903E3FC7CA4EBE79EA200011478A301F713F8A2EBFF0F6C5CA3EBFE079038 7C03E024207F9F27>119 D<001FB512FE4814FFA490380001FEEC03FCEC07F8EC0FF000 1EEB1FE0C7EA3FC0EC7F80ECFF00495A495A495AEB1FE0495A495A49C7FC485A4848131E 4848133F485A485A485A485AB7FCA46C14FE20207E9F27>122 D<3901F003803903FC07 C0000F130F381FFE1F393FFF7F80397FBFFF0038FE1FFE486C5A00F813F0387003E01A0A 7AAD27>126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmr9 9 71 /Fp 71 124 df<91393FE00FE0903A01FFF83FF8903A07E01EF83C903A1F800FF07E903A 3F001FE0FE017E133F4914C0485A1738484890381F8000ACB812C0A33B03F0001F8000B3 A7486C497EB50083B5FCA32F357FB42D>11 DI<137813FCA212011203EA07F813E0 EA0FC0EA1F801300123C5A5A12400E0E71B326>19 D<123C127EB4FCA21380A2127F123D 1201A412031300A25A1206120E120C121C5A5A126009177AB315>39 D<14C01301EB0380EB0F00130E5B133C5B5BA2485A485AA212075B120F90C7FC5AA2121E 123EA3123C127CA55AB0127CA5123C123EA3121E121FA27E7F12077F1203A26C7E6C7EA2 13787F131C7F130FEB0380EB01C01300124A79B71E>I<12C07E1270123C121C7E120F6C 7E6C7EA26C7E6C7EA27F1378137C133C133EA2131E131FA37F1480A5EB07C0B0EB0F80A5 14005BA3131E133EA2133C137C137813F85BA2485A485AA2485A48C7FC120E5A123C1270 5A5A124A7CB71E>I<123C127EB4FCA21380A2127F123D1201A412031300A25A1206120E 120C121C5A5A126009177A8715>44 DI<123C127E12FFA4127E 123C08087A8715>I<1530157815F8A215F01401A215E01403A215C01407A21580140FA2 15005CA2143EA2143C147CA2147814F8A25C1301A25C1303A25C1307A2495AA291C7FC5B A2131E133EA2133C137CA2137813F8A25B1201A25B1203A2485AA25B120FA290C8FC5AA2 121E123EA2123C127CA2127812F8A25A12601D4B7CB726>II<13075B5B137FEA07FFB5FC13BFEAF83F1200B3B3A2 497E007FB51280A319327AB126>III< EC01C0A214031407A2140F141FA2143F147F146F14CF1301EB038F140F1307130E130C13 1C13381330137013E013C0EA0180120313001206120E120C5A123812305A12E0B71280A3 C7380FC000A94A7E0107B51280A321337EB226>I<000C14C0380FC00F90B5128015005C 5C14F014C0D80C18C7FC90C8FCA9EB0FC0EB7FF8EBF07C380FC03F9038001F80EC0FC012 0E000CEB07E0A2C713F01403A215F8A41218127E12FEA315F0140712F8006014E01270EC 0FC06C131F003C14806CEB7F00380F80FE3807FFF8000113E038003F801D347CB126>I< 14FE903807FF80011F13E090383F00F0017C13703901F801F8EBF003EA03E01207EA0FC0 EC01F04848C7FCA248C8FCA35A127EEB07F0EB1FFC38FE381F9038700F809038E007C039 FFC003E0018013F0EC01F8130015FC1400A24814FEA5127EA4127F6C14FCA26C13010180 13F8000F14F0EBC0030007EB07E03903E00FC03901F81F806CB51200EB3FFCEB0FE01F34 7DB126>I<1230123C003FB6FCA34814FEA215FC0070C7123800601430157015E04814C0 1401EC0380C7EA07001406140E5C141814385CA25CA2495A1303A3495AA2130FA3131F91 C7FCA25BA55BA9131C20347CB126>III<123C127E12FFA4127E123C1200B0123C127E12FF A4127E123C08207A9F15>I<15E0A34A7EA24A7EA34A7EA3EC0DFE140CA2EC187FA34A6C 7EA202707FEC601FA202E07FECC00FA2D901807F1507A249486C7EA301066D7EA2010E80 010FB5FCA249800118C77EA24981163FA2496E7EA3496E7EA20001821607487ED81FF04A 7ED8FFFE49B512E0A333367DB53A>65 DIIIIII73 D<017FB5FCA39038003FE0EC1FC0B3B1127EB4FCA4EC3F805A0060140000705B6C13FE6C 485A380F03F03803FFC0C690C7FC20357DB227>IIIII80 D82 D<90381FE00390387FFC0748B5FC3907F01FCF390F8003FF48C7FC003E80814880A20078 8000F880A46C80A27E92C7FC127F13C0EA3FF013FF6C13F06C13FF6C14C06C14F0C68001 3F7F01037F9038003FFF140302001380157F153FED1FC0150F12C0A21507A37EA26CEC0F 80A26C15006C5C6C143E6C147E01C05B39F1FC03F800E0B512E0011F138026C003FEC7FC 22377CB42B>I<007FB712FEA390398007F001D87C00EC003E0078161E0070160EA20060 160600E01607A3481603A6C71500B3AB4A7E011FB512FCA330337DB237>IIII89 D91 D93 D97 DII<153FEC0FFFA3EC007F81AEEB07F0EB3FFCEBFC0F3901F003BF39 07E001FF48487E48487F8148C7FCA25A127E12FEAA127E127FA27E6C6C5BA26C6C5B6C6C 4813803A03F007BFFC3900F81E3FEB3FFCD90FE0130026357DB32B>III<151F90391FC07F809039FFF8E3C03901F07FC73907E03F033A0FC01F8380 9039800F8000001F80EB00074880A66C5CEB800F000F5CEBC01F6C6C48C7FCEBF07C380E FFF8380C1FC0001CC9FCA3121EA2121F380FFFFEECFFC06C14F06C14FC4880381F000100 3EEB007F4880ED1F8048140FA56C141F007C15006C143E6C5C390FC001F83903F007E0C6 B51280D91FFCC7FC22337EA126>IIIIII<2703F01FE013FF00FF90267FF80313C0903BF1E07C0F03E0 903BF3803E1C01F02807F7003F387FD803FE1470496D486C7EA2495CA2495CB3486C496C 487EB53BC7FFFE3FFFF0A33C217EA041>I<3903F01FC000FFEB7FF09038F1E0FC9038F3 807C3907F7007EEA03FE497FA25BA25BB3486CEB7F80B538C7FFFCA326217EA02B>II<3903F03F8000FFEBFFE09038 F3C0F89038F7007ED807FE7F6C48EB1F804914C049130F16E0ED07F0A3ED03F8A9150716 F0A216E0150F16C06D131F6DEB3F80160001FF13FC9038F381F89038F1FFE0D9F07FC7FC 91C8FCAA487EB512C0A325307EA02B>I<903807F00390383FFC07EBFC0F3901F8038F38 07E001000F14DF48486CB4FC497F123F90C77E5AA25A5AA9127FA36C6C5B121F6D5B000F 5B3907E003BF3903F0073F3800F81EEB3FF8EB0FE090C7FCAAED7F8091380FFFFCA32630 7DA029>I<3803E07C38FFE1FF9038E38F809038E71FC0EA07EEEA03ECA29038FC0F8049 C7FCA35BB2487EB512E0A31A217FA01E>II<1330A51370A313F0A21201A212031207381FFFFEB5FCA23803F000AF1403 A814073801F806A23800FC0EEB7E1CEB1FF8EB07E0182F7FAD1E>IIIII<3A7FFF807FF8A33A07F8001FC00003EC0F800001EC070015066C6C5BA26D131C017E 1318A26D5BA2EC8070011F1360ECC0E0010F5BA2903807E180A214F3010390C7FC14FBEB 01FEA26D5AA31478A21430A25CA214E05CA2495A1278D8FC03C8FCA21306130EEA701CEA 7838EA1FF0EA0FC025307F9F29>I<003FB512F0A2EB000F003C14E00038EB1FC00030EB 3F800070137F1500006013FE495A13035CC6485A495AA2495A495A49C7FC153013FE485A 12035B48481370485A001F14604913E0485A387F000348130F90B5FCA21C207E9F22>I< B712F8A22502809426>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fq cmr10 10 76 /Fq 76 127 df11 DIII 16 D<133C137EA213FE1201EA03FC13F0EA07E0EA0FC0EA1F80EA1E005A5A5A12C00F0F 6FB92A>19 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206 120E5A5A5A12600A1979B917>39 D<146014E0EB01C0EB0380EB0700130E131E5B5BA25B 485AA2485AA212075B120F90C7FCA25A121EA2123EA35AA65AB2127CA67EA3121EA2121F 7EA27F12077F1203A26C7EA26C7E1378A27F7F130E7FEB0380EB01C0EB00E01460135278 BD20>I<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378A2137C133C133E131EA2 131F7FA21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A25B131EA2133E133C137C 1378A25BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD20>I<15301578B3A600 7FB812F8B912FCA26C17F8C80078C8FCB3A6153036367BAF41>43 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A 12600A19798817>II<121C127FEAFF80A5EA7F00121C09097988 17>I48 DIII<1538A2 157815F8A2140114031407A2140F141F141B14331473146314C313011483EB0303130713 06130C131C131813301370136013C01201EA038013005A120E120C5A123812305A12E0B7 12F8A3C73803F800AB4A7E0103B512F8A325397EB82A>I<0006140CD80780133C9038F0 03F890B5FC5D5D158092C7FC14FC38067FE090C9FCABEB07F8EB3FFE9038780F803907E0 07E090388003F0496C7E12066E7EC87EA28181A21680A4123E127F487EA490C71300485C 12E000605C12700030495A00385C6C1303001E495A6C6C485A3907E03F800001B5C7FC38 007FFCEB1FE0213A7CB72A>II<12301238123E003F B612E0A316C05A168016000070C712060060140E5D151800E01438485C5D5DC712014A5A 92C7FC5C140E140C141C5CA25CA214F0495AA21303A25C1307A2130FA3495AA3133FA513 7FA96DC8FC131E233B7BB82A>II I<121C127FEAFF80A5EA7F00121CC7FCB2121C127FEAFF80A5EA7F00121C092479A317> I<121C127FEAFF80A5EA7F00121CC7FCB2121C127F5A1380A4127F121D1201A412031300 A25A1206A2120E5A121812385A1260093479A317>I<007FB812F8B912FCA26C17F8CCFC AE007FB812F8B912FCA26C17F836167B9F41>61 D<1538A3157CA315FEA34A7EA34A6C7E A202077FEC063FA2020E7FEC0C1FA2021C7FEC180FA202387FEC3007A202707FEC6003A2 02C07F1501A2D901807F81A249C77F167FA20106810107B6FCA24981010CC7121FA2496E 7EA3496E7EA3496E7EA213E0707E1201486C81D80FFC02071380B56C90B512FEA3373C7D BB3E>65 DI<913A01FF800180020FEBE003027F13F8903A01FF807E 07903A03FC000F0FD90FF0EB039F4948EB01DFD93F80EB00FF49C8127F01FE153F120148 48151F4848150FA248481507A2485A1703123F5B007F1601A35B00FF93C7FCAD127F6DED 0180A3123F7F001F160318006C7E5F6C7E17066C6C150E6C6C5D00001618017F15386D6C 5CD91FE05C6D6CEB03C0D903FCEB0F80902701FF803FC7FC9039007FFFFC020F13F00201 1380313D7BBA3C>IIIIIII<013FB512E0A39039001FFC00EC07F8B3B3A3123FEA7F80EAFFC0A44A5A13 80D87F005B0070131F6C5C6C495A6C49C7FC380781FC3801FFF038007F80233B7DB82B> I76 DIIII< B612FEEDFFE016F8000190388007FE6C90C76C7EEE3FC0707E707E707EA2707EA283A65F A24C5AA24C5A4C5AEE3F8004FFC8FCED07FC91B512E05E9138000FF0ED03F8ED00FE8270 7E707EA2161F83A583A6F00180A217F8160F1803486D01071400B66D6C5A040113069338 00FE0ECAEA3FFCEF07F0393B7DB83D>82 DI<003FB812E0A3D9C003EB001F273E0001FE13 0348EE01F00078160000701770A300601730A400E01738481718A4C71600B3B0913807FF 80011FB612E0A335397DB83C>II87 D91 D93 D97 DIIII<147E903803FF8090380FC1E0EB1F8790 383F0FF0137EA213FCA23901F803C091C7FCADB512FCA3D801F8C7FCB3AB487E387FFFF8 A31C3B7FBA19>IIII< EB01C0EB07F0EB0FF8A5EB07F0EB01C090C7FCAAEB01F813FFA313071301B3B3A2123C12 7E00FF13F01303A214E038FE07C0127C383C0F00EA0FFEEA03F8154984B719>III<2703F00FF0EB1FE000FFD93FFCEB7FF8913AF03F01E0 7E903BF1C01F83803F3D0FF3800FC7001F802603F70013CE01FE14DC49D907F8EB0FC0A2 495CA3495CB3A3486C496CEB1FE0B500C1B50083B5FCA340257EA445>I<3903F00FF000 FFEB3FFCECF03F9039F1C01F803A0FF3800FC03803F70013FE496D7EA25BA35BB3A3486C 497EB500C1B51280A329257EA42E>II<3903F01FE000FFEB7FF89038 F1E07E9039F3801F803A0FF7000FC0D803FEEB07E049EB03F04914F849130116FC150016 FEA3167FAA16FEA3ED01FCA26DEB03F816F06D13076DEB0FE001F614C09039F7803F0090 38F1E07E9038F0FFF8EC1FC091C8FCAB487EB512C0A328357EA42E>II<3807E01F00 FFEB7FC09038E1E3E09038E387F0380FE707EA03E613EE9038EC03E09038FC0080491300 A45BB3A2487EB512F0A31C257EA421>II<1318A51338A31378A313F8120112031207001FB5FCB6FC A2D801F8C7FCB215C0A93800FC011580EB7C03017E13006D5AEB0FFEEB01F81A347FB220 >IIIIII<003FB512FCA2EB8003D83E0013F8003CEB07F00038EB0FE012300070EB1FC0 EC3F800060137F150014FE495AA2C6485A495AA2495A495A495AA290387F000613FEA248 5A485A0007140E5B4848130C4848131CA24848133C48C7127C48EB03FC90B5FCA21F247E A325>II126 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fr cmbx12 14.4 22 /Fr 22 122 df<171F4D7E4D7EA24D7EA34C7FA24C7FA34C7FA34C7FA24C7FA34C808304 7F80167E8304FE804C7E03018116F8830303814C7E03078116E083030F814C7E031F8116 8083033F8293C77E4B82157E8403FE824B800201835D840203834B800207835D844AB87E A24A83A3DA3F80C88092C97E4A84A2027E8202FE844A82010185A24A820103854A820107 85A24A82010F855C011F717FEBFFFCB600F8020FB712E0A55B547BD366>65 D<932601FFFCEC01C0047FD9FFC013030307B600F81307033F03FE131F92B8EA803F0203 DAE003EBC07F020F01FCC7383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901 F8824949824949824949824949824990CA7E494883A2484983485B1B7F485B481A3FA248 49181FA3485B1B0FA25AA298C7FC5CA2B5FCAE7EA280A2F307C07EA36C7FA21B0F6C6D19 80A26C1A1F6C7F1C006C6D606C6D187EA26D6C606D6D4C5A6D6D16036D6D4C5A6D6D4C5A 6D01FC4C5A6D6DEE7F806D6C6C6C4BC7FC6E01E0EC07FE020F01FEEC1FF80203903AFFE0 01FFF0020091B612C0033F93C8FC030715FCDB007F14E0040101FCC9FC525479D261>67 DI73 D77 D<91260FFF80130791B500F85B010702FF5B011FEDC03F49ED F07F9026FFFC006D5A4801E0EB0FFD4801800101B5FC4848C87E48488149150F001F8249 81123F4981007F82A28412FF84A27FA26D82A27F7F6D93C7FC14C06C13F014FF15F86CEC FF8016FC6CEDFFC017F06C16FC6C16FF6C17C06C836C836D826D82010F82130301008202 1F16801400030F15C0ED007F040714E01600173F050F13F08383A200788200F882A3187F A27EA219E07EA26CEFFFC0A27F6D4B13806D17006D5D01FC4B5A01FF4B5A02C04A5A02F8 EC7FF0903B1FFFC003FFE0486C90B65AD8FC0393C7FC48C66C14FC48010F14F048D9007F 90C8FC3C5479D24B>83 D97 D<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE00 01FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F1300705A 4892C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C6D EC3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49C7 FC020113E033387CB63C>99 D<913803FFC0023F13FC49B6FC010715C04901817F903A3F FC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C0488191C7FC4817E0 A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06CEE01F06E14037E 6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB03FE903A0FFFC0 3FF8010390B55A010015C0021F49C7FC020113F034387CB63D>101 D104 D<137F497E000313E0487FA2487FA76C5BA26C5BC613806D C7FC90C8FCADEB3FF0B5FCA512017EB3B3A6B612E0A51B547BD325>I108 DII<913801FFE0021F13FE91B612C0010315F0010F9038807FFC903A1FFC00 0FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C86C7EA24883A24848 6F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA26C5F6E147F6C5F6C 6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF807FFC6D90B55A0100 15C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5010F13FE033FEBFFC092 B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC602806D7F92C76C7F4A824A6E 7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA2615F616E4A5BA26E4A5B6E 4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E06F1480031F01FCC8FC03 0313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590380FFF80033F13E04B13 F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF150014EE02FEEB3F FC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980 127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C 816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC007F00 F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FF C00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414 FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE 07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B0203 13802A4D7ECB34>II<007FB500F090387FFFFEA5C66C 48C7000F90C7FC6D6CEC07F86D6D5C6D6D495A6D4B5A6F495A6D6D91C8FC6D6D137E6D6D 5B91387FFE014C5A6E6C485A6EEB8FE06EEBCFC06EEBFF806E91C9FCA26E5B6E5B6F7E6F 7EA26F7F834B7F4B7F92B5FCDA01FD7F03F87F4A486C7E4A486C7E020F7FDA1FC0804A48 6C7F4A486C7F02FE6D7F4A6D7F495A49486D7F01076F7E49486E7E49486E7FEBFFF0B500 FE49B612C0A542357EB447>120 DI E %EndDVIPSBitmapFont end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 1 1 1 0 bop 883 448 a Fr(A)44 b(Solution)i(to)f(Implemen)l(t)h(Multipart)l (y)849 598 y(Sync)l(hronisation)f(in)g(Dynamic)g(Con)l(texts)784 886 y Fq(Jos)n(\023)-39 b(e)26 b(A.)i(P)n(\023)-39 b(erez,)25 b(Rafael)i(Corc)n(h)n(uelo,)f(Joaqu)-9 b(\023)-32 b(\020n)26 b(P)n(e)r(~)-44 b(na,)26 b(and)i(Miguel)f(T)-7 b(oro)826 1060 y Fp(Univ)n(ersidad)25 b(de)g(Sevilla,)i(Dpto.)e(de)h(Lengua)t (jes)h(y)e(Sistemas)h(Inform\023)-38 b(aticos)1024 1152 y(Avda.)25 b(de)h(la)g(Reina)g(Mercedes,)h(s/n.)f(Sevilla)g(41.012)i (\(Spain\))954 1243 y(E{mail:)f Fo(jperez@lsi.us.es)p Fp(,)i(w)n(eb)d(page:)h Fo(www.lsi.us.es/~tdg)759 1557 y Fn(Abstract)43 b Fp(In)21 b(this)g(pap)r(er,)h(w)n(e)f(presen)n(t)g (an)h(algorithm)f(for)i(implemen)n(ting)c(m)n(ul-)759 1648 y(tipart)n(y)27 b(sync)n(hronisation,)g(whic)n(h)g(is)g(the)g (core)g(of)h(the)e(no)n(v)n(el)h(m)n(ultipart)n(y)e(in)n(ter-)759 1739 y(action)39 b(mo)r(del.)e(It)g(impro)n(v)n(es)g(on)g(other)h (results)g(in)f(that)h(it)f(can)h(b)r(e)f(used)h(in)759 1831 y(a)33 b(con)n(text)g(in)f(whic)n(h)h(the)f(set)h(of)h(participan) n(ts)f(in)g(an)g(in)n(teraction)g(cannot)g(b)r(e)759 1922 y(kno)n(wn)i(at)g(compile)g(time,)f(and)h(setting)g(up)f(comm)n (unication)g(links)h(amongst)759 2013 y(in)n(teraction)27 b(managers)f(is)g(costly)g(or)g(completely)f(imp)r(ossible.)759 2173 y Fn(Key)k(w)n(ords:)c Fp(Multipart)n(y)h(sync)n(hronisation)g (algorithms,)h(dynamic)d(systems.)523 2443 y Fm(1)112 b(In)m(tro)s(duction)523 2633 y Fq(Most)30 b(programming)e(languages)g (for)h(distributed)h(systems)g(allo)n(w)f(the)h(user)f(to)h(express)523 2733 y(binary)h(in)n(teractions)g(amongst)g(en)n(tities)h(suc)n(h)g(as) f(pro)r(cesses,)g(ob)5 b(jects)31 b(or)g(comp)r(onen)n(ts.)523 2832 y(This)22 b(mo)r(del)g(can)g(b)r(e)g(easily)f(extended)h(to)g(in)n (teractions)f(that)h(in)n(v)n(olv)n(e)f(an)g(arbitrary)f(n)n(um-)523 2932 y(b)r(er)i(of)g(en)n(tities)g(that)g(need)g(to)f(agree)g(and)g(co) r(op)r(erate)g(to)h(ac)n(hiev)n(e)e(a)h(common)h(goal.)e(These)523 3031 y(in)n(teractions)32 b(are)g(usually)h(said)f(to)h(b)r(e)h(m)n (ultipart)n(y)-7 b(,)32 b(and)h(they)h(pro)n(vide)d(a)i(higher)f(lev)n (el)523 3131 y(of)j(abstraction)f(b)r(ecause)h(they)g(allo)n(w)f(an)h (arbitrary)e(n)n(um)n(b)r(er)i(of)g(en)n(tities)h(to)f(sync)n(hro-)523 3231 y(nise,)25 b(exc)n(hange)f(data)h(and)g(p)r(erform)g(some)f(join)n (t)i(actions)e(co)r(ordinately)g(without)i(taking)523 3330 y(implemen)n(tation)e(details)f(in)n(to)g(accoun)n(t.)g(Multipart) n(y)g(in)n(teractions)f(hide)i(sev)n(eral)d(under-)523 3430 y(lying)34 b(p)r(oin)n(t{to{p)r(oin)n(t)g(comm)n(unication)f(op)r (erations,)h(as)f(w)n(ell)i(as)e(the)i(order)e(in)i(whic)n(h)523 3530 y(they)28 b(m)n(ust)g(o)r(ccur)e(or)h(the)h(algorithm)f(used)g(to) h(ac)n(hiev)n(e)e(m)n(ultipart)n(y)h(sync)n(hronisation.)648 3629 y(Since)36 b(the)h(m)n(ultipart)n(y)e(in)n(teraction)h(mo)r(del)g (w)n(as)f(presen)n(ted,)h(it)h(has)f(attracted)f(an)523 3729 y(increasing)g(n)n(um)n(b)r(er)h(of)g(researc)n(hers,)d(and)k(man) n(y)e(languages)g(o\013ering)g(linguistic)h(sup-)523 3828 y(p)r(ort)43 b(ha)n(v)n(e)e(b)r(een)i(presen)n(ted)f(in)h(the)h (literature)e([Jou92)n(,FF96)o(,CPT00)o(].)h(It)g(has)f(also)523 3928 y(attracted)c(the)h(atten)n(tion)g(of)g(the)g(designers)f(of)g (the)i(w)n(ell{kno)n(wn)d(Catalysis)g(metho)r(d)523 4028 y([D)n(W99],)e(whic)n(h)g(is)h(a)f(next)g(generation)f(approac)n(h)f (for)i(the)h(systematic)f(UML{based,)523 4127 y(business{driv)n(en)c (dev)n(elopmen)n(t)i(of)g(comp)r(onen)n(t{based)f(systems.)g(Catalysis) g(has)h(b)r(een)523 4227 y(used)f(b)n(y)f(F)-7 b(ortune)31 b(500)f(companies)h(in)h(\014elds)f(including)h(\014nance,)g(telecomm)n (unication,)523 4327 y(insurance,)24 b(man)n(ufacturing,)h(em)n(b)r (edded)h(systems,)e(pro)r(cess)g(con)n(trol,)g(\015igh)n(t)h(sim)n (ulation,)523 4426 y(tra)n(v)n(el)30 b(and)g(transp)r(ortation,)g(or)g (systems)g(managemen)n(t,)g(th)n(us)h(pro)n(ving)f(the)h(adequacy)523 4526 y(of)d(this)f(no)n(v)n(el)g(in)n(teraction)g(mo)r(del)g(in)h(so)f (di\013eren)n(t)h(application)f(domains.)648 4625 y(Man)n(y)j (solutions)g(to)g(implemen)n(t)i(m)n(ultipart)n(y)e(sync)n (hronisation,)f(whic)n(h)h(is)h(the)g(core)523 4725 y(of)d(the)h(mo)r (del,)f(ha)n(v)n(e)f(b)r(een)i(prop)r(osed)e(in)h(the)h(literature.)e (Unfortunately)-7 b(,)28 b(they)h(assume)523 4825 y(that)38 b(en)n(tities)g(participating)f(in)i(an)e(in)n(teraction)g(and)h(in)n (teraction)f(managers)f(can)i(b)r(e)523 4924 y(kno)n(wn)26 b(at)h(compile)g(time,)h(whic)n(h)f(is)f(problematical)g(if)i(w)n(e)e (are)g(in)n(terested)h(in)g(compiling)p eop %%Page: 2 2 2 1 bop 523 448 a Fq(languages)26 b(suc)n(h)h(as)f Fl(C)5 b(AL)28 b Fq([CPT00)o(])f(that)h(allo)n(w)e(for)h(dynamic)g(creation)g (or)f(destruction)523 548 y(of)i(ob)5 b(jects)27 b(or)f(in)n (teractions)h(in)h(ligh)n(tly{coupled)e(systems.)648 654 y(This)k(pap)r(er)g(aims)g(at)g(presen)n(ting)g(a)g(solution)g(to)g (implemen)n(t)h(m)n(ultipart)n(y)f(sync)n(hro-)523 754 y(nisation)c(that)h(is)g(w)n(ell{suited)f(to)h(b)r(e)g(used)g(in)g (dynamic)g(systems;)f(section)g(2)h(in)n(tro)r(duces)523 853 y(the)32 b(in)n(teraction)f(mo)r(del)h(w)n(e)g(deal)g(with;)g (section)g(3)f(presen)n(ts)g(our)g(solution)h(along)e(with)523 953 y(some)d(p)r(erformance)g(results;)h(section)f(4)h(compares)e(it)j (with)f(other)g(authors')f(w)n(ork,)f(and,)523 1053 y(\014nally)-7 b(,)28 b(some)f(conclusions)f(are)h(dra)n(wn)f(in)i(section)f(5.)523 1351 y Fm(2)112 b(The)38 b(Multipart)m(y)e(In)m(teraction)g(Mo)s(del)h (in)g(a)h(Nutshell)523 1584 y Fq(In)h(this)g(section,)f(w)n(e)g(in)n (tro)r(duce)h(the)g(main)f(features)g(of)h(the)g(m)n(ultipart)n(y)f(in) n(teraction)523 1683 y(mo)r(del)31 b(w)n(e)f(deal)g(with.)h(The)f(only) g(di\013erence)h(with)g(the)g(standard)e(is)h(that)h(the)g(iden)n(tit)n (y)523 1783 y(of)d(the)g(en)n(tities)f(that)h(can)f(participate)g(in)h (an)g(in)n(teraction)e(is)i(only)f(kno)n(wn)g(at)g(run)h(time.)648 1889 y(In)20 b(this)g(con)n(text,)f(the)i(terms)e Fk(entity)27 b Fq(or)20 b Fk(p)l(articip)l(ant)29 b Fq(refer)19 b(to)h(an)n(y)f (computing)g(artifact)523 1989 y(that)26 b(is)g(able)f(to)h(p)r(erform) f(lo)r(cal)g(computations)g(and)h(decides)g(autonomously)e(when)i(it)g (is)523 2089 y(in)n(terested)k(in)h(participating)f(in)h(a)g(n)n(um)n (b)r(er)f(of)h(in)n(teractions.)f(Multipart)n(y)g(in)n(teractions)523 2188 y(are)24 b(usually)g(pro)n(vided)f(as)h(guards)f(in)i(m)n(ulti-c)n (hoice)f(commands,)g(so)g(that)h(an)f(en)n(tit)n(y)h(ma)n(y)523 2288 y(b)r(e)j(willing)f(to)g(participate)f(in)i(sev)n(eral)d(in)n (teractions)h(at)h(the)h(same)e(time,)i(although)e(only)523 2387 y(one)h(will)h(b)r(e)g(\014nally)f(executed)h(at)g(a)f(time.)648 2494 y(Eac)n(h)21 b(in)n(teraction)g(is)h(iden)n(ti\014ed)h(b)n(y)f(an) g Fk(inter)l(action)j(name)p Fq(,)d(and)g(has)g(a)g(\014xed)g(n)n(um)n (b)r(er)523 2593 y(of)27 b(participan)n(ts)e(referred)h(to)g(as)g(its)h Fk(c)l(ar)l(dinality)p Fq(.)h(Often,)f(w)n(e)g(refer)f(to)g(in)n (teractions)f(with)523 2693 y(cardinalit)n(y)d Fj(n)h Fq(as)g Fj(n)p Fq({part)n(y)e(in)n(teractions.)h(In)i(general,)e Fj(n)h Fq(can)g(b)r(e)g(assumed)g(to)g(b)r(e)h(greater)523 2793 y(or)37 b(equal)g(than)h(t)n(w)n(o,)f(although)g(the)h(results)f (w)n(e)g(sho)n(w)g(w)n(ork)f(w)n(ell)i(with)g(single-part)n(y)523 2892 y(in)n(teractions.)26 b(F)-7 b(or)27 b(an)g Fj(n)p Fq({part)n(y)f(in)n(teraction)g(to)h(b)r(ecome)h Fk(enable)l(d)p Fq(,)g Fj(n)g Fq(participan)n(ts)e(need)523 2992 y(to)e(b)r(e)h Fk(o\013ering)i(p)l(articip)l(ation)33 b Fq(in)24 b(it,)g(i.e.,)h(an)f (attempt)g(to)g(participate)g(in)g(an)g(in)n(teraction)523 3091 y(dela)n(ys)30 b(an)i(en)n(tit)n(y)f(un)n(til)h(all)f(other)g (participan)n(ts)f(are)h(a)n(v)-5 b(ailable.)30 b(Once)h(sev)n(eral)f (en)n(tities)523 3191 y(ha)n(v)n(e)i(b)r(een)h(sync)n(hronised,)f(comm) n(unication)g(dep)r(ends)i(v)n(ery)e(m)n(uc)n(h)h(on)f(the)i (constructs)523 3291 y(pro)n(vided)28 b(b)n(y)h(the)g(language)e(under) i(consideration,)f(but)h(most)g(ha)n(v)n(e)f(b)r(een)h(designed)g(so) 523 3390 y(that)f(it)g(is)f(relativ)n(ely)g(easy)f(to)i(determine)g (data)f(comm)n(unication)f(requiremen)n(ts.)648 3497 y(It)j(is)g(w)n(orth)f(noting)h(that)h(an)f(in)n(teraction)f(b)r(eing)h (enabled)g(do)r(es)g(not)g(amoun)n(t)g(to)g(its)523 3596 y(execution)21 b(b)r(ecause)h(t)n(w)n(o)f(or)g(more)g(in)n(teractions)f (ma)n(y)h(b)r(e)h Fk(c)l(on\015icting)30 b Fq(if)22 b(they)g(share)f (com-)523 3696 y(mon)32 b(participan)n(ts.)f(Giv)n(en)h(that)h(a)e (participan)n(t)h(cannot)f(commit)i(to)f(t)n(w)n(o)f(in)n(teractions) 523 3795 y(sim)n(ultaneously)-7 b(,)28 b(an)g(election)g(under)g (con\015icting)g(in)n(teractions)g(needs)g(to)g(b)r(e)h(held.)g(The)523 3895 y(one)e(that)h(is)f(executed)h(is)f(referred)g(to)g(as)g(the)h Fk(winner)i(inter)l(action)k Fq(and)28 b(the)g(rest)f(as)g(the)523 3995 y Fk(loser)k(inter)l(actions)p Fq(.)523 4293 y Fm(3)112 b(Our)38 b(Prop)s(osal:)f Fi(\013)p Fm({core)523 4526 y Fq(The)22 b(idea)g(b)r(ehind)g Fj(\013)p Fq({core)f(consists)g(of)h (considering)f(an)h(en)n(tit)n(y)f(that)i(o\013ers)e(participation)523 4625 y(in)29 b(more)e(than)i(one)f(in)n(teraction)f(as)h(a)g Fk(shar)l(e)l(d)j(r)l(esour)l(c)l(e)k Fq(amongst)27 b(a)h(n)n(um)n(b)r (er)g(of)g(co)r(ordi-)523 4725 y(nators,)d(eac)n(h)g(one)h(resp)r (onsible)f(for)h(managing)f(one)g(in)n(teraction.)h(F)-7 b(or)25 b(an)h(in)n(teraction)f(to)523 4825 y(b)r(e)g(executed,)f(its)h (corresp)r(onding)d(co)r(ordinator)h(m)n(ust)h(ensure)g(exclusiv)n(e)f (access)h(to)g(all)g(of)523 4924 y(its)k(participan)n(ts)e(b)n(y)i(lo)r (c)n(king)e(them)j(in)e(a)h(giv)n(en)e(order.)p eop %%Page: 3 3 3 2 bop 648 448 a Fq(W)-7 b(e)31 b(describ)r(e)g Fj(\013)p Fq({core)e(b)n(y)i(means)f(of)h(state)g(transition)f(diagrams,)g(whic)n (h)g(are)g(\014nite)523 548 y(deterministic)e(automata)g(comp)r(osed)f (of)h(a)g(\014nite)h(n)n(um)n(b)r(er)e(of)i(states)e(and)h(atomic)g (tran-)523 648 y(sitions)33 b(amongst)f(them.)j(The)e(initial)h(state)f (is)g(lab)r(eled)h(b)n(y)f(an)g(arro)n(w)e(without)j(origin,)523 747 y(and)27 b(ev)n(ery)g(transition)g(is)g(lab)r(eled)h(b)n(y)f(a)g (sp)r(eci\014cation)h(of)f(the)h(follo)n(wing)f(form:)1661 897 y([)p Fj(g)s(uar)r(d)p Fq(])h Fj(messag)s(e)p 1661 934 606 4 v 1850 1010 a(action)648 1140 y(messag)s(e)21 b Fq(denotes)i(the)g(message)f(that)h(causes)f(a)g(transition)h(to)f(o) r(ccur,)h(and)g(it)g(can)g(b)r(e)523 1239 y(an)n(y)j(of)h(those)f(that) h(are)f(describ)r(ed)g(in)h(T)-7 b(able)27 b(1.)f(If)h(it)g(is)g (omitted,)g(a)g(transition)f(dep)r(ends)523 1339 y(solely)f(on)g(the)i (guard.)d Fj(action)i Fq(is)f(a)h(list)g(of)f(sen)n(tences)g(that)i (are)d(executed)i(if)g(a)g(transition)523 1439 y(o)r(ccurs.)20 b(W)-7 b(e)21 b(use)g(assignmen)n(ts,)e(and)i(sen)n(tences)f(of)h(the)g (form)g Fj(S)5 b(end)p Fq(\()p Fj(r)r(ecipient;)14 b(messag)s(e)p Fq(\))523 1538 y(to)34 b(send)f(messages.)f(The)i(w)n(ord)f Fj(S)5 b(ender)35 b Fq(refers)e(to)h(the)g(iden)n(ti\014er)f(of)h(the)g (co)r(ordinator)523 1638 y(or)29 b(participan)n(t)f(that)i(sen)n(t)f (the)h(message)e(that)i(caused)f(a)g(transition)g(to)g(o)r(ccur.)g (Finally)-7 b(,)523 1738 y Fj(g)s(uar)r(d)27 b Fq(is)g(a)f(b)r(o)r (olean)g(expression.)g(F)-7 b(or)26 b(a)g(transition)h(to)f(o)r(ccur,)h (its)g(corresp)r(onding)d(mes-)523 1837 y(sage)19 b(m)n(ust)h(b)r(e)h (receiv)n(ed)e(and)i(the)f(guard)f(m)n(ust)i(hold;)f(otherwise)f(the)i (message)e(is)h(ignored.)523 1937 y(If)28 b(a)f(guard)g(is)g(omitted)h (it)g(is)g(assumed)f(to)g(b)r(e)h Fj(tr)r(ue)g Fq(b)n(y)f(default.)648 2036 y(W)-7 b(e)30 b(only)g(need)h(to)f(mak)n(e)f(t)n(w)n(o)h (assumptions)f(ab)r(out)h(the)h(message)e(passing)g(system:)523 2136 y(\(i\))i(no)e(message)g(is)h(lost,)g(and)f(\(ii\))i(messages)d (sen)n(t)i(from)g(the)g(same)g(origin)e(to)i(the)h(same)523 2236 y(destination)c(m)n(ust)h(b)r(e)g(receiv)n(ed)f(in)h(the)f(same)h (order)e(they)i(w)n(ere)e(sen)n(t.)p 529 2436 2871 4 v 527 2528 4 92 v 541 2500 a Fn(Message)p 1154 2528 V 303 w(Description)p 3398 2528 V 529 2531 2871 4 v 529 2548 V 527 2730 4 183 v 541 2611 a Fh(AC)5 b(K)g(R)q(E)t(F)p 1154 2730 V 269 w Fp(Message)46 b(sen)n(t)e(from)f(a)h(co)r(ordinator)h (to)f(ac)n(kno)n(wledge)h(it)f(has)g(got)g(a)1167 2703 y Fh(R)q(E)t(F)11 b(U)d(S)t(E)29 b Fp(message)e(from)e(a)h(participan)n (t.)p 3398 2730 V 529 2733 2871 4 v 527 2916 4 183 v 541 2797 a Fh(LO)r(C)5 b(K)p 1154 2916 V 389 w Fp(Message)25 b(sen)n(t)d(from)h(a)f(co)r(ordinator)i(to)f(a)g(shared)g(participan)n (t)f(to)h(request)1167 2889 y(exclusiv)n(e)j(access)h(to)f(it.)p 3398 2916 V 529 2919 2871 4 v 527 3102 4 183 v 541 2983 a Fh(O)r(F)11 b(F)g(E)t(R)p 1154 3102 V 327 w Fp(Message)36 b(sen)n(t)e(from)g(a)g(participan)n(t)g(to)g(a)g(n)n(um)n(b)r(er)e(of)j (co)r(ordinators)h(to)1167 3075 y(o\013er)26 b(them)f(participation)h (in)g(the)f(in)n(teractions)i(they)e(manage.)p 3398 3102 V 529 3105 2871 4 v 527 3379 4 274 v 541 3169 a Fh(O)r(K)p 1154 3379 V 501 w Fp(Message)37 b(sen)n(t)e(from)f(a)i(participan)n(t)f (to)g(a)g(co)r(ordinator)h(to)f(notify)g(that)1167 3261 y(it)c(gran)n(ts)h(it)f(exclusiv)n(e)g(access.)i(This)e(message)h(is)g (sen)n(t)e(as)i(a)f(reply)g(to)g(a)1167 3352 y Fh(LO)r(C)5 b(K)32 b Fp(message.)p 3398 3379 V 529 3383 2871 4 v 527 3565 4 183 v 541 3447 a Fh(P)11 b(AR)q(T)g(I)6 b(C)f(I)h(P)11 b(AT)g(E)p 1154 3565 V 22 w Fp(Message)27 b(sen)n(t)d(from)h(a)g (participan)n(t)f(to)h(only)f(one)h(co)r(ordinator)h(to)f(inform)1167 3538 y(it)h(that)f(it)h(is)h(only)e(in)n(terested)h(in)f(the)h(in)n (teraction)g(it)g(manages.)p 3398 3565 V 529 3569 2871 4 v 527 3660 4 92 v 541 3633 a Fh(R)q(E)t(F)11 b(U)d(S)t(E)p 1154 3660 V 278 w Fp(Message)23 b(sen)n(t)e(from)g(a)g(participan)n(t)g (to)g(a)h(co)r(ordinator)g(to)f(cancel)h(an)f(o\013er.)p 3398 3660 V 529 3663 2871 4 v 527 3846 4 183 v 541 3727 a Fh(S)t(T)11 b(AR)q(T)p 1154 3846 V 357 w Fp(Message)30 b(sen)n(t)e(from)g(a)g(co)r(ordinator)i(to)e(a)g(lo)r(c)n(k)n(ed)g (participan)n(t)g(to)h(notify)1167 3819 y(it)d(that)f(the)h(in)n (teraction)g(it)g(manages)g(ma)n(y)e(start.)p 3398 3846 V 529 3849 2871 4 v 527 4032 4 183 v 541 3913 a Fh(U)8 b(N)g(LO)r(C)d(K)p 1154 4032 V 260 w Fp(Message)27 b(sen)n(t)d(from)g (a)h(co)r(ordinator)h(to)f(a)f(shared)h(participan)n(t)g(to)f(release) 1167 4005 y(exclusiv)n(e)i(access.)p 3398 4032 V 529 4035 2871 4 v 1367 4095 a Fn(T)-7 b(able)28 b(1.)e Fp(Messages)i(used)d (b)n(y)g Fh(\013)p Fp({core.)523 4674 y Fg(3.1)95 b Ff(\013)p Fg({core)31 b(in)h(a)g(participan)m(t)523 4825 y Fq(The)d(state)g (transition)f(diagram)f(for)i(participan)n(ts)f(is)g(sho)n(wn)h(in)g (Figure)f(1,)h(and)f(a)h(short)523 4924 y(description)19 b(of)h(its)h(v)-5 b(ariables)18 b(is)i(sho)n(wn)f(in)i(T)-7 b(able)19 b(2.)h(Initially)-7 b(,)20 b(they)g(are)f(p)r(erforming)h(lo) r(cal)p eop %%Page: 4 4 4 3 bop 523 448 a Fq(computations)20 b(in)i(state)f Fj(AC)6 b(T)12 b(I)7 b(V)18 b(E)26 b Fq(un)n(til)c(they)f(assign)f(the)h(set)g (of)g(in)n(teractions)f(in)h(whic)n(h)523 548 y(they)32 b(are)f(in)n(terested)h(to)g(v)-5 b(ariable)30 b Fj(I)7 b(S)e Fq(.)32 b(If)h Fl(j)p Fj(I)7 b(S)e Fl(j)30 b Fq(=3D)g(1,)h(a)h (participan)n(t)f(is)h(only)f(in)n(terested)523 648 y(in)40 b(one)g(in)n(teraction)f(and)h(sends)g(a)g Fj(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)43 b Fq(message)c(to)h(its)g(co)r(ordinator)523 747 y(\(transition)26 b(2\).)f(Since)h(the)h(target)e(state)g(of)h (this)g(transition)g(is)f Fj(LO)r(C)6 b(K)g(E)f(D)r Fq(,)26 b(this)g(means)523 847 y(that)c(the)h(participan)n(t)e(gets)h(lo)r(c)n (k)n(ed)f(automatically)g(once)g(the)i(o\013er)e(is)h(made.)g(If)h Fl(j)p Fj(I)7 b(S)e Fl(j)23 b Fj(>)f Fq(1,)523 946 y(it)k(then)g(sends) f(an)g Fj(O)r(F)12 b(F)g(E)5 b(R)26 b Fq(message)e(to)i(eac)n(h)e(co)r (ordinator)f(whose)i(iden)n(ti\014er)g(is)h(in)f Fj(I)7 b(S)e Fq(,)523 1046 y(and)27 b(reac)n(hes)f(the)i Fj(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)27 b Fq(state)h(\(transition)f(1\).)p 599 1278 2730 4 v 597 1370 4 92 v 611 1342 a Fn(V)-7 b(ariable)p 941 1370 V 24 w(Description)p 3327 1370 V 599 1373 2730 4 v 599 1390 V 597 1572 4 183 v 726 1454 a Fh(I)6 b(S)p 942 1572 V 142 w Fp(It)32 b(is)i(a)f(set)g(of)g(iden)n (ti\014ers)g(that)g(allo)n(w)h(us)f(to)g(refer)h(to)f(eac)n(h)g(co)r (ordinator)h(in)955 1545 y(whic)n(h)26 b(a)g(participan)n(t)f(is)i(in)n (terested.)p 3327 1572 V 599 1576 2730 4 v 597 1758 4 183 v 667 1640 a Fh(l)q(ock)r(er)p 942 1758 V 81 w Fp(It)c(iden)n (ti\014es)h(the)f(co)r(ordinator)j(that)d(has)i(lo)r(c)n(k)n(ed)e(a)i (participan)n(t,)f(i.e.,)h(the)f Fe(cur-)955 1731 y(r)l(ent)29 b(pr)l(osp)l(e)l(ctive)h(winner)e(c)l(o)l(or)l(dinator)p Fp(.)p 3327 1758 V 599 1762 2730 4 v 597 2036 4 274 v 685 1826 a Fh(l)q(ock)r(s)p 942 2036 V 98 w Fp(It)e(is)g(a)h(set)g(of)g (iden)n(ti\014ers)f(that)g(allo)n(w)i(us)e(to)g(refer)i(to)e(eac)n(h)g (co)r(ordinator)i(from)955 1917 y(whic)n(h)k(a)h(participan)n(t)f(has)g (receiv)n(ed)g(a)h Fh(LO)r(C)5 b(K)38 b Fp(message)33 b Fe(after)41 b Fp(the)32 b(one)g(re-)955 2008 y(ceiv)n(ed)25 b(from)h(the)f(curren)n(t)g(prosp)r(ectiv)n(e)h(winner)g(co)r (ordinator.)p 3327 2036 V 599 2039 2730 4 v 597 2222 4 183 v 748 2103 a Fh(n)p 942 2222 V 161 w Fp(It)g(is)g(a)h(coun)n(ter) f(used)g(to)h(determine)e(when)h(ev)n(ery)g(in)n(v)n(olv)n(ed)f(co)r (ordinator)j(has)955 2194 y(ac)n(kno)n(wledged)e(a)g Fh(R)q(E)t(F)11 b(U)d(S)t(E)29 b Fp(message)d(from)g(the)f(participan)n (t.)p 3327 2222 V 599 2225 2730 4 v 597 2590 4 366 v 640 2289 a Fh(unl)q(ock)r(s)p 942 2590 V 53 w Fp(It)20 b(is)g(a)h(set)g(of)g(iden)n(ti\014ers)f(that)g(allo)n(w)i(us)e(to)h (refer)g(to)f(prosp)r(ectiv)n(e)h(winner)f(co)r(or-)955 2380 y(dinators)25 b(that)f(had)f(to)i(release)h(a)e(participan)n(t.)h (When)e(a)i(participan)n(t)f(receiv)n(es)955 2471 y(an)32 b Fh(U)8 b(N)g(LO)r(C)d(K)38 b Fp(message)33 b(from)f(its)g(prosp)r (ectiv)n(e)g(winner)g(co)r(ordinator,)h(it)f(is)955 2563 y(said)26 b(that)f(it)h(has)g(b)r(een)g Fe(r)l(eje)l(cte)l(d)35 b Fp(b)n(y)24 b(the)i(co)r(ordinator.)p 3327 2590 V 599 2594 2730 4 v 1108 2654 a Fn(T)-7 b(able)29 b(2.)d Fp(V)-6 b(ariables)26 b(used)f(b)n(y)g Fh(\013)p Fp({core)i(in)f(participan)n (ts.)648 3121 y Fq(In)f(the)g Fj(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)25 b Fq(state,)f(a)h(participan)n(t)f(w)n(aits)h(to)g(b)r(e)g (lo)r(c)n(k)n(ed)f(and)h(lea)n(v)n(es)e(it)j(when)523 3221 y(it)d(receiv)n(es)f(a)h Fj(LO)r(C)6 b(K)29 b Fq(message)21 b(from)i(a)f(co)r(ordinator)f(that)j(b)r(ecomes)e(then)i(a)f Fk(pr)l(osp)l(e)l(ctive)523 3321 y(winner)43 b Fq(\(transition)33 b(3\).)h(On)g(reception)f(of)h(this)g(message,)e(participan)n(ts)h(ac)n (kno)n(wledge)523 3420 y(with)c(an)g Fj(O)r(K)35 b Fq(message)27 b(and)i(reac)n(h)e(the)i(state)g Fj(LO)r(C)6 b(K)g(E)f(D)r Fq(.)29 b(Subsequen)n(t)g Fj(LO)r(C)6 b(K)34 b Fq(mes-)523 3520 y(sages)29 b(are)h(temp)r(orarily)f(stored)h(in)h Fj(l)r(ock)s(s)f Fq(without)h(ac)n(kno)n(wledging)e(reception)h (\(transi-)523 3620 y(tion)j(4\).)f(This)g(b)r(eha)n(viour)g(allo)n(ws) f(the)h(prosp)r(ectiv)n(e)g(winner)g(to)g(ha)n(v)n(e)g(exclusiv)n(e)f (access)523 3719 y(to)38 b(a)g(shared)f(participan)n(t)h(un)n(til)g(it) h(can)f(reac)n(h)f(a)g(decision)h(and)g(decide)h(whether)f(the)523 3819 y(in)n(teraction)27 b(it)h(manages)e(ma)n(y)h(start)g(or)f(not.) 648 3928 y(In)33 b(the)g Fj(LO)r(C)6 b(K)g(E)f(D)35 b Fq(state,)e(a)g(participan)n(t)f(w)n(aits)g(for)h(the)g(prosp)r(ectiv)n (e)f(winner)h(co-)523 4028 y(ordinator)38 b(to)i(send)f(it)i(an)e Fj(U)9 b(N)g(LO)r(C)d(K)45 b Fq(message,)39 b(indicating)g(it)h(is)g(a) f(loser)g(and)h(the)523 4127 y(in)n(teraction)25 b(it)g(manages)g(will) g(not)h(b)r(e)g(executed,)f(or)g(a)g Fj(S)5 b(T)12 b(AR)q(T)35 b Fq(message,)24 b(indicating)i(it)523 4227 y(is)c(the)h(winner)f(and)g (the)g(in)n(teraction)g(it)g(manages)f(can)h(start.)g(The)g(former)f (case)h(has)f(to)i(b)r(e)523 4327 y(dealt)h(with)g(dep)r(ending)g(on)g (the)g(a)n(v)-5 b(ailabilit)n(y)23 b(of)g(other)h(co)r(ordinators)d(in) j(the)g Fj(l)r(ock)s(s)g Fq(set.)g(If)523 4426 y(there)j(is)f(at)h (least)f(one)h(co)r(ordinator)e(in)i(this)g(set)g(\(transition)f(5\),)h (one)f(of)h(them)g(is)g(c)n(hosen)523 4526 y(arbitrarily)j(and)h(b)r (ecomes)h(the)g(new)f(prosp)r(ectiv)n(e)g(winner.)h(Then,)g(an)f Fj(O)r(K)38 b Fq(message)30 b(is)523 4625 y(sen)n(t)c(to)g(it,)g(and)g (the)h(participan)n(t)e(remains)g(in)i(the)f(lo)r(c)n(k)n(ed)f(state.)h (If)h Fj(unl)r(ock)s(s)21 b Fq(=3D)i Fl(;)j Fq(\(tran-)523 4725 y(sition)34 b(6\),)g(this)g(means)f(that)h(no)g(co)r(ordinator)e (can)h(b)r(e)h(elected)g(as)g(a)f(new)h(prosp)r(ectiv)n(e)523 4825 y(winner)26 b(for)g(the)h(time)g(b)r(eing,)g(and)f(the)h (participan)n(t)e(has)h(to)h(return)e(to)i(the)g Fj(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)523 4924 y Fq(state.)27 b(During)g(this)h (transition,)e(o\013ers)h(are)f(re-sen)n(t)g(to)h(the)h(co)r (ordinators)d(that)j(ha)n(v)n(e)e(al-)p eop %%Page: 5 5 5 4 bop 523 2361 a @beginspecial 56.689999 @llx 56.689999 @lly 461.690002 @urx 337.079987 @ury 3458 @rwi @setspecial %%BeginDocument: dte-part.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip046.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:31 1/29/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 461.69 337.08 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 337.039 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 sl n 306 612 M 416 612 L 421 612 L 426 610 L 431 608 L 435 605 L 439 602 L 442 597 L 444 593 L 445 588 L 446 583 L 446 553 L 445 548 L 444 543 L 442 538 L 439 534 L 435 530 L 431 527 L 426 525 L 421 524 L 416 524 L 306 524 L 300 524 L 295 525 L 291 527 L 287 530 L 283 534 L 280 538 L 278 543 L 276 548 L 276 553 L 276 583 L 276 588 L 278 593 L 280 597 L 283 602 L 287 605 L 291 608 L 295 610 L 300 612 L 306 612 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [20.57 0 0 -20.738 0 0]/Times-Roman MF (A)323 574 MS (C)337 574 MS (T)351 574 MS (I)364 574 MS (V)371 574 MS = (E)386 574 MS n 1575 618 M 1685 618 L 1691 618 L 1696 616 L 1700 614 L 1704 611 L 1708 607 L 1711 603 L 1713 599 L 1715 594 L 1715 588 L 1715 559 L 1715 554 L 1713 549 L 1711 544 L 1708 540 L 1704 536 L 1700 533 L 1696 531 L 1691 530 L 1685 529 L 1575 529 L 1570 530 L 1565 531 L 1560 533 L 1556 536 L 1552 540 L 1549 544 L 1547 549 L 1546 554 L 1545 559 L 1545 588 L 1546 594 L 1547 599 L 1549 603 L 1552 607 L 1556 611 L 1560 614 L 1565 616 L 1570 618 L 1575 618 L cp gs 1 g e gr s (L)1588 580 MS (O)1601 580 MS (C)1616 580 MS (K)1629 580 MS (E)1644 580 = MS (D)1657 580 MS n 926 157 M 1036 157 L 1041 157 L 1046 156 L 1051 153 L 1055 150 L 1059 147 L 1062 143 L 1064 138 L 1065 133 L 1066 128 L 1066 98 L 1065 93 L 1064 88 L 1062 84 L 1059 79 L 1055 76 L 1051 73 L 1046 71 L 1041 69 L 1036 69 L 926 69 L 920 69 L 915 71 L 911 73 L 907 76 L 903 79 L 900 84 L 898 88 L 897 93 L 896 98 L 896 128 L 897 133 L 898 138 L 900 143 L 903 147 L 907 150 L 911 153 L 915 156 L 920 157 L 926 157 L cp gs 1 g e gr s (W)935 119 MS (A)955 119 MS (I)970 119 MS (T)977 119 MS (I)990 119 MS = (N)997 119 MS (G)1012 119 MS n 167 642 M 167 638 L 169 635 L 171 632 L 173 629 L 177 628 L 180 627 L 184 627 L 187 628 L 190 629 L 193 632 L 195 635 L 196 638 L 197 642 L 196 645 L 195 648 L 193 651 L 190 654 L 187 655 L 184 656 L 180 656 L 177 655 L 173 654 L 171 651 L 169 648 L 167 645 L 167 642 L cp gs 0.102 g e gr s 1 j 1 setlinecap 6 sl n 264 567 M 259 567 L 254 567 L 248 568 L 243 569 L 238 570 L 233 572 L 229 574 L 224 576 L 220 578 L 216 581 L 212 585 L 208 588 L 204 592 L 200 597 L 197 601 L 194 606 L 190 612 L 187 617 L 184 623 L 182 630 L CM 0.246 0.246 scale s SM n 262 573 M 276 568 L 263 560 L 262 573 L cp e n 176 175 M 512 175 L 512 19 L 176 19 L 176 175 L cp e 1 sl n 158 157 M 494 157 L 494 1 L 158 1 L 158 157 L cp gs 1 g e gr s [24.938 0 0 -24.988 0 0]/Times-Roman MF (I)166 27 MS (S)174 27 MS (:)188 27 MS ( )195 27 MS (S)201 27 MS (e)215 = 27 MS (t)226 27 MS ( )233 27 MS (o)240 27 MS (f)252 27 MS ( )260 27 MS = (C)267 27 MS (o)283 27 MS (o)296 27 MS (r)308 27 MS (d)316 27 MS (i)329 27 MS (n)336 27 MS (a)348 27 MS (t)359 27 MS (o)366 27 MS (r)379 = 27 MS (l)166 57 MS (o)173 57 MS (c)186 57 MS (k)197 57 MS (s)209 57 MS (:)219 = 57 MS ( )226 57 MS (S)232 57 MS (e)246 57 MS (t)257 57 MS ( )264 57 MS = (o)271 57 MS (f)283 57 MS ( )291 57 MS (C)297 57 MS (o)314 57 MS (o)327 57 MS (r)339 57 MS (d)347 57 MS (i)360 57 MS (n)367 57 MS (a)379 = 57 MS (t)390 57 MS (o)397 57 MS (r)410 57 MS (l)166 87 MS (o)173 87 MS (c)186 87 MS (k)197 87 MS (e)209 87 MS (r)220 = 87 MS (:)229 87 MS ( )236 87 MS (C)242 87 MS (o)259 87 MS (o)271 87 MS = (r)283 87 MS (d)292 87 MS (i)304 87 MS (n)311 87 MS (a)324 87 MS (t)335 87 MS (o)342 87 MS (r)354 87 MS (u)166 117 MS (n)179 117 MS (l)191 117 MS (o)198 117 MS (c)211 117 MS = (k)222 117 MS (s)234 117 MS (:)244 117 MS ( )251 117 MS (S)257 117 MS = (e)271 117 MS (t)282 117 MS ( )289 117 MS (o)295 117 MS (f)308 117 MS ( = )316 117 MS (C)322 117 MS (o)339 117 MS (o)352 117 MS (r)364 117 MS (d)372 117 MS = (i)385 117 MS (n)392 117 MS (a)404 117 MS (t)415 117 MS (o)422 117 MS = (r)435 117 MS (n)166 147 MS (:)179 147 MS ( )186 147 MS (i)192 147 MS (n)199 147 MS = (t)212 147 MS (e)219 147 MS (g)230 147 MS (e)242 147 MS (r)253 147 MS n 689 984 M 800 984 L 805 983 L 810 982 L 815 980 L 819 977 L 822 973 L 825 969 L 828 964 L 829 959 L 829 954 L 829 925 L 829 920 L 828 915 L 825 910 L 822 906 L 819 902 L 815 899 L 810 897 L 805 896 L 800 895 L 689 895 L 684 896 L 679 897 L 675 899 L 670 902 L 667 906 L 664 910 L 662 915 L 660 920 L 660 925 L 660 954 L 660 959 L 662 964 L 664 969 L 667 973 L 670 977 L 675 980 L 679 982 L 684 983 L 689 984 L cp gs 1 g e gr s [20.57 0 0 -20.738 0 0]/Times-Roman MF (S)717 946 MS (Y)728 946 MS (N)743 946 MS (C)758 946 MS 6 sl n 878 116 M 859 119 L 840 123 L 821 127 L 803 131 L 785 135 L 768 140 L 751 145 L 734 150 L 717 156 L 701 162 L 686 168 L 670 175 L 655 181 L 640 189 L 626 196 L 612 204 L 598 212 L 585 220 L 572 229 L 559 238 L 547 247 L 535 256 L 523 266 L 512 276 L 501 286 L 490 297 L 480 308 L 470 319 L 460 331 L 451 343 L 442 355 L 433 367 L 425 380 L 417 393 L 409 406 L 402 420 L 395 434 L 389 448 L 382 463 L 376 477 L 371 492 L 366 508 L 361 524 L CM 0.246 0.246 scale s SM n 877 123 M 896 113 L 875 109 L 877 123 L cp e n 990 173 M 1001 190 L 1012 207 L 1024 224 L 1035 240 L 1047 255 L 1059 271 L 1072 286 L 1085 301 L 1098 315 L 1111 329 L 1125 343 L 1139 356 L 1153 369 L 1168 382 L 1183 395 L 1198 407 L 1214 418 L 1230 430 L 1246 441 L 1262 452 L 1279 462 L 1296 472 L 1314 482 L 1331 492 L 1349 501 L 1367 510 L 1386 518 L 1405 526 L 1424 534 L 1444 541 L 1463 548 L 1483 555 L 1504 562 L 1524 568 L 1545 574 L CM 0.246 0.246 scale s SM n 985 178 M 981 157 L 997 171 L 985 178 L cp e n 1620 514 M 1609 498 L 1598 482 L 1587 467 L 1575 451 L 1563 436 L 1550 422 L 1537 407 L 1524 393 L 1511 379 L 1497 365 L 1483 352 L 1468 339 L 1453 326 L 1438 313 L 1423 300 L 1407 288 L 1391 276 L 1374 265 L 1357 253 L 1340 242 L 1323 231 L 1305 221 L 1287 210 L 1268 200 L 1250 190 L 1230 181 L 1211 171 L 1191 162 L 1171 153 L 1151 145 L 1130 137 L 1109 128 L 1087 121 L 1066 113 L CM 0.246 0.246 scale s SM n 1625 509 M 1630 529 L 1614 516 L 1625 509 L cp e n 1630 618 M 1616 633 L 1602 647 L 1587 661 L 1572 675 L 1557 689 L 1542 702 L 1526 714 L 1510 727 L 1494 739 L 1477 751 L 1460 762 L 1443 773 L 1425 784 L 1408 794 L 1390 804 L 1371 813 L 1353 823 L 1334 832 L 1315 840 L 1295 848 L 1276 856 L 1256 864 L 1236 871 L 1215 878 L 1194 884 L 1173 890 L 1152 896 L 1130 901 L 1108 906 L 1086 911 L 1063 915 L 1041 919 L 1018 923 L 994 926 L 970 929 L 947 932 L 922 934 L 898 936 L 873 938 L 848 939 L CM 0.246 0.246 scale s SM n 849 932 M 829 940 L 850 946 L 849 932 L cp e n 1528 580 M 1501 590 L 1475 599 L 1448 608 L 1421 616 L 1395 624 L 1368 631 L 1341 638 L 1314 645 L 1287 651 L 1260 656 L 1234 661 L 1207 666 L 1179 671 L 1152 674 L 1125 678 L 1098 681 L 1071 683 L 1044 686 L 1017 687 L 989 688 L 962 689 L 935 690 L 907 690 L 880 689 L 852 688 L 825 687 L 797 685 L 770 683 L 742 680 L 714 677 L 686 673 L 659 669 L 631 665 L 603 660 L 575 655 L 547 649 L 519 642 L 491 636 L 463 629 L 435 621 L 407 613 L CM 0.246 0.246 scale s SM n 1529 587 M 1545 574 L 1524 575 L 1529 587 L cp e n 1722 591 M 1727 604 L 1732 617 L 1736 629 L 1741 641 L 1745 652 L 1749 663 L 1753 674 L 1757 684 L 1760 694 L 1763 703 L 1766 712 L 1769 721 L 1771 729 L 1774 737 L 1776 744 L 1778 751 L 1780 758 L 1781 764 L 1782 770 L 1784 775 L 1784 780 L 1785 785 L 1785 789 L 1786 792 L 1786 796 L 1786 799 L 1785 801 L 1785 803 L 1784 805 L 1783 806 L 1781 807 L 1780 807 L 1778 807 L 1776 807 L 1774 806 L 1772 805 L 1770 803 L 1767 801 L 1764 799 L 1761 796 L 1757 793 L 1754 789 L 1750 785 L 1746 781 L 1742 776 L 1737 770 L 1733 765 L 1728 759 L 1723 752 L 1718 745 L 1712 738 L 1707 730 L 1701 722 L 1695 713 L 1688 704 L 1682 695 L 1675 685 L 1668 675 L 1661 664 L 1654 654 L 1646 642 L 1638 630 L 1630 618 L CM 0.246 0.246 scale s SM n 1729 590 M 1715 574 L 1716 595 L 1729 590 L cp e n 1722 556 M 1727 543 L 1731 530 L 1736 518 L 1740 506 L 1745 494 L 1749 483 L 1752 472 L 1756 462 L 1759 452 L 1763 442 L 1766 433 L 1768 424 L 1771 416 L 1773 408 L 1775 400 L 1777 393 L 1779 386 L 1781 380 L 1782 374 L 1783 369 L 1784 363 L 1785 359 L 1785 354 L 1786 351 L 1786 347 L 1786 344 L 1785 341 L 1785 339 L 1784 337 L 1783 336 L 1782 335 L 1781 334 L 1779 334 L 1778 334 L 1776 335 L 1773 336 L 1771 337 L 1769 339 L 1766 341 L 1763 344 L 1760 347 L 1756 350 L 1753 354 L 1749 358 L 1745 363 L 1741 368 L 1736 374 L 1732 380 L 1727 386 L 1722 393 L 1717 400 L 1711 407 L 1706 415 L 1700 424 L 1694 432 L 1688 441 L 1681 451 L 1674 461 L 1668 471 L 1660 482 L 1653 493 L 1646 505 L 1638 517 L 1630 529 L CM 0.246 0.246 scale s SM n 1728 557 M 1715 574 L 1716 552 L 1728 557 L cp e n 660 940 M 645 937 L 630 935 L 616 932 L 602 929 L 589 926 L 575 923 L 563 919 L 550 916 L 538 912 L 527 907 L 516 903 L 505 898 L 494 893 L 484 888 L 475 883 L 465 877 L 456 871 L 448 865 L 440 859 L 432 853 L 424 846 L 417 839 L 411 832 L 404 825 L 398 817 L 393 809 L 388 801 L 383 793 L 379 784 L 375 776 L 371 767 L 368 758 L 365 748 L 362 739 L 360 729 L 358 719 L 357 708 L 356 698 L 355 687 L 355 676 L 355 665 L 356 654 L 357 642 L 358 630 L CM 0.246 0.246 scale s SM n 351 631 M 361 612 L 365 633 L 351 631 L cp e n 694 985 M 692 992 L 690 999 L 689 1005 L 688 1011 L 687 1017 L 686 1022 L 685 1027 L 685 1031 L 684 1035 L 684 1039 L 684 1042 L 684 1045 L 684 1048 L 685 1050 L 685 1052 L 686 1053 L 687 1054 L 688 1055 L 689 1055 L 691 1055 L 692 1054 L 694 1053 L 696 1052 L 698 1050 L 700 1048 L 702 1046 L 705 1043 L 708 1039 L 710 1036 L 713 1032 L 717 1027 L 720 1023 L 723 1017 L 727 1012 L 731 1006 L 735 1000 L CM 0.246 0.246 scale s SM n 740 1005 M 745 984 L 728 998 L 740 1005 L cp e 1 sl n 335 329 M 336 323 L 337 317 L 339 312 L 343 307 L 346 303 L 351 299 L 356 296 L 362 294 L 368 293 L 373 293 L 379 294 L 385 296 L 390 299 L 394 303 L 398 307 L 402 312 L 404 317 L 405 323 L 406 329 L 405 334 L 404 340 L 402 345 L 398 350 L 394 355 L 390 358 L 385 361 L 379 363 L 373 364 L 368 364 L 362 363 L 356 361 L 351 358 L 346 355 L 343 350 L 339 345 L 337 340 L 336 334 L 335 329 L cp gs 0.902 g e gr s %%IncludeFont: Helvetica [33.402 0 0 -33.234 0 0]/Helvetica MF (1)361 339 MS n 630 606 M 631 600 L 632 595 L 635 589 L 638 584 L 642 580 L 646 577 L 652 574 L 657 572 L 663 571 L 669 571 L 674 572 L 680 574 L 685 577 L 690 580 L 694 584 L 697 589 L 699 595 L 701 600 L 701 606 L 701 612 L 699 618 L 697 623 L 694 628 L 690 632 L 685 636 L 680 639 L 674 641 L 669 642 L 663 642 L 657 641 L 652 639 L 646 636 L 642 632 L 638 628 L 635 623 L 632 618 L 631 612 L 630 606 L cp gs 0.902 g e gr s (2)656 616 MS n 1162 122 M 1162 116 L 1163 110 L 1166 105 L 1169 100 L 1173 96 L 1178 92 L 1183 89 L 1188 88 L 1194 87 L 1200 87 L 1206 88 L 1211 89 L 1216 92 L 1221 96 L 1225 100 L 1228 105 L 1231 110 L 1232 116 L 1232 122 L 1232 128 L 1231 133 L 1228 139 L 1225 144 L 1221 148 L 1216 152 L 1211 154 L 1206 156 L 1200 157 L 1194 157 L 1188 156 L 1183 154 L 1178 152 L 1173 148 L 1169 144 L 1166 139 L 1163 133 L 1162 128 L 1162 122 L cp gs 0.902 g e gr s (3)1188 132 MS n 1634 358 M 1634 352 L 1636 347 L 1638 341 L 1641 336 L 1645 332 L 1650 328 L 1655 326 L 1661 324 L 1667 323 L 1672 323 L 1678 324 L 1684 326 L 1689 328 L 1693 332 L 1697 336 L 1701 341 L 1703 347 L 1704 352 L 1705 358 L 1704 364 L 1703 370 L 1701 375 L 1697 380 L 1693 384 L 1689 388 L 1684 391 L 1678 393 L 1672 393 L 1667 393 L 1661 393 L 1655 391 L 1650 388 L 1645 384 L 1641 380 L 1638 375 L 1636 370 L 1634 364 L 1634 358 L cp gs 0.902 g e gr s (4)1660 368 MS n 1658 801 M 1658 795 L 1660 789 L 1662 784 L 1665 779 L 1669 775 L 1674 771 L 1679 768 L 1684 766 L 1690 766 L 1696 766 L 1702 766 L 1707 768 L 1712 771 L 1717 775 L 1721 779 L 1724 784 L 1727 789 L 1728 795 L 1728 801 L 1728 807 L 1727 812 L 1724 818 L 1721 823 L 1717 827 L 1712 830 L 1707 833 L 1702 835 L 1696 836 L 1690 836 L 1684 835 L 1679 833 L 1674 830 L 1669 827 L 1665 823 L 1662 818 L 1660 812 L 1658 807 L 1658 801 L cp gs 0.902 g e gr s (5)1684 811 MS n 926 222 M 926 216 L 928 211 L 930 205 L 933 201 L 937 196 L 942 193 L 947 190 L 952 188 L 958 187 L 964 187 L 970 188 L 975 190 L 980 193 L 985 196 L 989 201 L 992 205 L 995 211 L 996 216 L 996 222 L 996 228 L 995 234 L 992 239 L 989 244 L 985 248 L 980 252 L 975 255 L 970 257 L 964 258 L 958 258 L 952 257 L 947 255 L 942 252 L 937 248 L 933 244 L 930 239 L 928 234 L 926 228 L 926 222 L cp gs 0.902 g e gr s (6)952 232 MS n 1250 895 M 1251 889 L 1252 884 L 1254 878 L 1258 874 L 1262 869 L 1266 866 L 1271 863 L 1277 861 L 1283 860 L 1289 860 L 1294 861 L 1300 863 L 1305 866 L 1310 869 L 1314 874 L 1317 878 L 1319 884 L 1321 889 L 1321 895 L 1321 901 L 1319 907 L 1317 912 L 1314 917 L 1310 921 L 1305 925 L 1300 928 L 1294 930 L 1289 931 L 1283 931 L 1277 930 L 1271 928 L 1266 925 L 1262 921 L 1258 917 L 1254 912 L 1252 907 L 1251 901 L 1250 895 L cp gs 0.902 g e gr s (7)1276 905 MS n 660 1132 M 660 1126 L 662 1120 L 664 1115 L 667 1110 L 671 1105 L 676 1102 L 681 1099 L 687 1097 L 692 1096 L 698 1096 L 704 1097 L 710 1099 L 715 1102 L 719 1105 L 723 1110 L 726 1115 L 729 1120 L 730 1126 L 731 1132 L 730 1137 L 729 1143 L 726 1148 L 723 1153 L 719 1158 L 715 1161 L 710 1164 L 704 1166 L 698 1167 L 692 1167 L 687 1166 L 681 1164 L 676 1161 L 671 1158 L 667 1153 L 664 1148 L 662 1143 L 660 1137 L 660 1132 L cp gs 0.902 g e gr s (8)686 1142 MS n 796 860 M 796 854 L 798 848 L 800 843 L 803 838 L 807 834 L 812 830 L 817 827 L 822 826 L 828 825 L 834 825 L 840 826 L 845 827 L 850 830 L 855 834 L 859 838 L 862 843 L 865 848 L 866 854 L 867 860 L 866 866 L 865 871 L 862 877 L 859 882 L 855 886 L 850 890 L 845 892 L 840 894 L 834 895 L 828 895 L 822 894 L 817 892 L 812 890 L 807 886 L 803 882 L 800 877 L 798 871 L 796 866 L 796 860 L cp gs 0.902 g e gr s (1)813 870 MS (0)831 870 MS 6 sl n 791 896 M 789 887 L 786 878 L 784 870 L 782 862 L 779 854 L 777 847 L 775 840 L 772 834 L 770 828 L 768 823 L 766 818 L 763 814 L 761 809 L 759 806 L 756 803 L 754 800 L 752 797 L 750 795 L 747 794 L 745 793 L 743 792 L 741 792 L 739 792 L 736 793 L 734 794 L 732 795 L 730 797 L 728 800 L 725 803 L 723 806 L 721 809 L 719 814 L 717 818 L 715 823 L 713 828 L 710 834 L 708 840 L 706 847 L 704 854 L 702 862 L 700 870 L 698 878 L CM 0.246 0.246 scale s SM n 692 875 M 694 896 L 705 878 L 692 875 L cp e 1 sl n 306 872 M 306 866 L 307 860 L 310 855 L 313 850 L 317 846 L 322 842 L 327 839 L 332 837 L 338 836 L 344 836 L 350 837 L 355 839 L 360 842 L 365 846 L 369 850 L 372 855 L 374 860 L 376 866 L 376 872 L 376 878 L 374 883 L 372 889 L 369 893 L 365 898 L 360 901 L 355 904 L 350 906 L 344 907 L 338 907 L 332 906 L 327 904 L 322 901 L 317 898 L 313 893 L 310 889 L 307 883 L 306 878 L 306 872 L cp gs 0.902 g e gr s (1)322 882 MS (1)341 882 MS n 227 238 M 501 238 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (O)415 264 MS (F)433 264 MS (F)446 264 MS (E)460 264 MS (R)475 264 MS = (\))492 264 MS (\()391 264 MS (i)399 264 MS (,)406 264 MS ( )386 264 MS (S)336 264 MS (e)350 264 MS (n)361 264 MS (d)373 264 MS (I)279 264 MS (S)287 264 MS (i)246 264 MS (1)390 228 MS (])402 228 MS ( )366 228 MS (|)363 228 MS (I)337 228 MS (S)345 228 MS ([)318 228 MS (|)326 228 MS %%IncludeFont: Symbol [24.988 0 0 -24.988 0 0]/Symbol MF (\256)306 264 MS (\316)257 264 MS (")228 264 MS gs n 14 29 372 205 CB (>)372 228 MS gr n 742 483 M 991 483 L s (\306)850 659 MS (=3D)831 659 MS (\306)820 621 MS (=3D)809 621 MS (=3D)814 584 MS (=3D)756 509 MS gs n 14 29 874 450 CB (=3D)874 473 MS gr [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)825 659 MS (u)743 659 MS (n)756 659 MS (l)768 659 MS (o)775 659 MS (c)788 659 MS = (k)799 659 MS (s)811 659 MS (:)803 621 MS (l)746 621 MS (o)753 621 MS (c)765 621 MS (k)776 621 MS (s)789 621 MS (i)834 584 MS (:)808 584 MS (l)743 584 MS (o)750 584 MS (c)762 584 MS (k)773 584 MS (e)786 584 MS = (r)797 584 MS ( )805 584 MS (E)966 546 MS (\))982 546 MS (P)823 546 MS (A)837 546 MS (R)855 546 MS (T)872 546 MS (I)887 546 MS = (C)895 546 MS (I)911 546 MS (P)919 546 MS (A)933 546 MS (T)951 546 MS (\()797 546 MS (i)805 546 MS (,)812 546 MS ( )792 546 MS (S)742 546 MS (e)756 546 MS (n)767 546 MS (d)780 546 MS (\()864 509 MS (I)872 509 MS (S)880 509 MS (\))894 509 MS (E)776 509 MS (l)792 509 MS (e)799 509 MS (m)810 509 MS (e)829 509 MS = (n)840 509 MS (t)853 509 MS ( )860 509 MS (i)742 509 MS (1)891 473 MS (])904 473 MS ( )868 473 MS (|)865 473 MS (I)839 473 MS (S)847 473 MS ([)820 473 MS (|)829 473 MS n 1371 58 M 1550 58 L s (O)1505 196 MS (K)1523 196 MS (\))1541 196 MS (\()1427 196 MS (l)1435 196 MS (o)1442 196 MS (c)1454 196 MS (k)1465 196 = MS (e)1478 196 MS (r)1489 196 MS (,)1497 196 MS ( )1421 196 MS (S)1372 196 MS (e)1386 196 MS (n)1397 196 MS (d)1409 196 MS (:)1455 159 MS (u)1373 159 MS (n)1385 159 MS (l)1398 159 MS (o)1405 159 MS (c)1417 159 = MS (k)1428 159 MS (s)1441 159 MS (:)1430 121 MS (l)1372 121 MS (o)1379 121 MS (c)1392 121 MS (k)1403 121 MS (s)1415 121 = MS (S)1465 84 MS (e)1479 84 MS (n)1490 84 MS (d)1503 84 MS (e)1515 84 MS = (r)1526 84 MS (:)1440 84 MS (l)1372 84 MS (o)1379 84 MS (c)1392 84 MS (k)1403 84 MS (e)1415 84 MS = (r)1426 84 MS (L)1427 48 MS (O)1441 48 MS (C)1460 48 MS (K)1476 48 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\306)1481 159 MS (=3D)1461 159 MS (\306)1455 121 MS (=3D)1436 121 MS (=3D)1446 84 MS n 1580 273 M 1835 273 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF ({)1742 299 MS (S)1754 299 MS (e)1768 299 MS (n)1779 299 MS (d)1792 299 = MS (e)1804 299 MS (r)1815 299 MS (})1824 299 MS ( )1716 299 MS (l)1664 299 MS (o)1671 299 MS (c)1684 299 MS (k)1695 299 MS (s)1707 299 = MS (:)1639 299 MS (l)1582 299 MS (o)1589 299 MS (c)1601 299 MS (k)1612 299 MS (s)1625 299 = MS (L)1674 264 MS (O)1689 264 MS (C)1706 264 MS (K)1723 264 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\310)1721 299 MS (=3D)1644 299 MS n 1520 876 M 1825 876 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF ({)1732 1015 MS (S)1744 1015 MS (e)1758 1015 MS (n)1769 1015 MS (d)1782 = 1015 MS (e)1794 1015 MS (r)1805 1015 MS (})1814 1015 MS ( )1729 1015 MS ( )1705 1015 MS (u)1629 1015 MS (n)1641 1015 MS (l)1654 1015 MS (o)1661 1015 MS (c)1673 = 1015 MS (k)1684 1015 MS (s)1697 1015 MS ( )1623 1015 MS (:)1604 1015 MS (u)1522 1015 MS (n)1534 1015 MS (l)1547 1015 MS (o)1554 1015 MS (c)1567 = 1015 MS (k)1578 1015 MS (s)1590 1015 MS ({)1665 977 MS (l)1677 977 MS (o)1684 977 MS (c)1696 977 MS (k)1707 977 = MS (e)1720 977 MS (r)1731 977 MS (})1739 977 MS ( )1648 977 MS (\\)1655 977 MS ( )1661 977 MS (l)1597 977 MS (o)1604 977 MS (c)1616 977 MS (k)1627 977 MS (s)1640 977 = MS (:)1579 977 MS (l)1522 977 MS (o)1529 977 MS (c)1541 977 MS (k)1552 977 MS (s)1565 977 = MS (O)1656 940 MS (K)1674 940 MS (\))1692 940 MS ( )1651 940 MS (\()1576 940 MS (l)1584 940 MS (o)1591 940 MS (c)1604 940 MS (k)1615 940 = MS (e)1627 940 MS (r)1638 940 MS (,)1646 940 MS ( )1570 940 MS (S)1521 940 MS (e)1535 940 MS (n)1546 940 MS (d)1558 940 MS (\()1703 902 MS (l)1712 902 MS (o)1719 902 MS (c)1731 902 MS (k)1742 902 = MS (s)1755 902 MS (\))1764 902 MS (E)1615 902 MS (l)1631 902 MS (e)1638 902 MS (m)1649 902 MS (e)1668 902 = MS (n)1679 902 MS (t)1692 902 MS ( )1699 902 MS (:)1589 902 MS (l)1522 902 MS (o)1529 902 MS (c)1541 902 MS (k)1552 902 MS (e)1565 902 = MS (r)1576 902 MS ( )1674 867 MS (U)1680 867 MS (N)1698 867 MS (L)1716 867 MS (O)1731 867 = MS (C)1749 867 MS (K)1766 867 MS (])1668 867 MS ([)1559 867 MS (l)1568 867 MS (o)1575 867 MS (c)1587 867 MS (k)1598 867 = MS (s)1611 867 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\310)1711 1015 MS (=3D)1610 1015 MS (=3D)1585 977 MS (=3D)1595 902 MS gs n 21 30 1647 843 CB (\306)1647 867 MS gr gs n 14 30 1627 843 CB (\271)1627 867 MS gr n 635 303 M 1085 303 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (O)998 329 MS (F)1016 329 MS (F)1030 329 MS (E)1043 329 MS (R)1059 329 = MS (\))1075 329 MS ( )992 329 MS (\()972 329 MS (i)980 329 MS (,)987 329 MS ( )967 329 MS (S)917 329 MS (e)931 329 MS (n)942 329 MS (d)955 329 MS ( )882 329 MS ({)792 329 MS (S)804 329 MS (e)818 329 MS (n)829 329 MS (d)841 329 MS = (e)854 329 MS (r)865 329 MS (})873 329 MS ( )788 329 MS ( )765 329 MS (u)688 329 MS (n)701 329 MS (l)713 329 MS (o)720 329 MS (c)733 329 MS = (k)744 329 MS (s)756 329 MS ( )663 329 MS (i)657 329 MS ( )652 329 MS ( )861 293 MS (U)867 293 MS (N)885 293 MS (L)903 293 MS (O)918 293 MS = (C)936 293 MS (K)952 293 MS (])854 293 MS ([)747 293 MS (l)755 293 MS (o)762 293 MS (c)775 293 MS (k)786 293 MS = (s)798 293 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\256)888 329 MS (\310)770 329 MS (\316)666 329 MS (")635 329 MS gs n 21 29 833 270 CB (\306)833 293 MS gr gs n 14 29 814 270 CB (=3D)814 293 MS gr n 1024 965 M 1312 965 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (c)1128 1103 MS (k)1139 1103 MS (e)1152 1103 MS (r)1163 1103 MS (\))1171 = 1103 MS (e)1025 1103 MS (x)1036 1103 MS (e)1049 1103 MS (c)1060 1103 MS (u)1071 = 1103 MS (t)1084 1103 MS (e)1091 1103 MS (\()1102 1103 MS (l)1110 1103 MS = (o)1117 1103 MS (|)1099 1066 MS (|)1067 1066 MS ( )1063 1066 MS (:)1044 1066 MS (n)1026 1066 MS (R)1209 1028 MS (E)1226 1028 MS (F)1242 1028 MS (U)1255 1028 MS (S)1273 = 1028 MS (E)1287 1028 MS (\))1302 1028 MS ( )1204 1028 MS (\()1183 1028 MS (i)1192 1028 MS (,)1199 1028 MS ( )1178 1028 MS (S)1128 1028 MS (e)1142 1028 MS (n)1153 1028 MS (d)1166 1028 MS ( )1093 1028 MS ( )1053 1028 MS (i)1046 1028 MS ( )1041 1028 MS ({)1204 991 MS (l)1216 991 MS (o)1223 991 MS (c)1235 991 MS (k)1246 991 = MS (e)1259 991 MS (r)1270 991 MS (})1278 991 MS (\\)1194 991 MS (u)1111 991 MS (n)1124 991 MS (l)1136 991 MS (o)1143 991 MS (c)1156 991 = MS (k)1167 991 MS (s)1179 991 MS (\\)1099 991 MS (I)1073 991 MS (S)1081 991 MS (:)1047 991 MS (S)1128 955 MS (T)1142 955 MS (A)1157 955 MS (R)1175 955 MS (T)1192 955 = MS [24.988 0 7.723 -24.988 0 0]/Symbol MF (a)1075 1066 MS (a)1076 1028 MS (a)1023 991 MS [24.988 0 0 -24.988 0 0]/Symbol MF (=3D)1050 1066 MS (\256)1099 1028 MS (\316)1056 1028 MS (")1025 1028 MS (=3D)1053 991 MS n 806 778 M 974 778 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF gs n 13 28 924 781 CB (1)924 804 MS gr gs n 13 28 890 781 CB (n)890 804 MS gr gs n 7 28 864 781 CB (:)864 804 MS gr gs n 13 28 847 781 CB (n)847 804 MS gr (A)876 768 MS (C)894 768 MS (K)910 768 MS (R)928 768 MS (E)945 768 MS = (F)960 768 MS ( )870 768 MS (1)851 768 MS (])864 768 MS ([)806 768 MS (n)814 768 MS [24.988 0 0 -24.988 0 0]/Symbol MF gs n 14 30 908 779 CB (-)908 804 MS gr gs n 14 30 870 779 CB (=3D)870 804 MS gr gs n 14 29 834 745 CB (>)834 768 MS gr n 605 1076 M 676 1076 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (L)607 1067 MS (O)621 1067 MS (C)639 1067 MS (K)656 1067 MS n 422 948 M 591 948 L s [24.988 0 0 -24.988 0 0]/Symbol MF (\306)521 974 MS (=3D)502 974 MS gs n 14 30 450 915 CB (=3D)450 939 MS gr [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)496 974 MS (I)471 974 MS (S)479 974 MS (A)492 939 MS (C)510 939 MS (K)527 939 MS (R)545 939 MS (E)561 939 MS = (F)577 939 MS ( )486 939 MS (1)467 939 MS (])480 939 MS ([)422 939 MS (n)430 939 MS n 198 546 M 264 546 L s [24.988 0 0 -24.988 0 0]/Symbol MF (\306)242 572 MS (=3D)223 572 MS [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)217 572 MS (I)199 572 MS (S)207 572 MS 6 sl n 791 985 M 794 992 L 796 998 L 799 1005 L 801 1011 L 803 1016 L 804 1021 L 806 1026 L 807 1030 L 808 1034 L 809 1038 L 810 1041 L 811 1044 L 811 1047 L 811 1049 L 811 1051 L 810 1052 L 810 1054 L 809 1054 L 808 1055 L 807 1055 L 806 1054 L 804 1054 L 802 1053 L 800 1051 L 798 1049 L 796 1047 L 793 1045 L 790 1042 L 787 1038 L 784 1035 L 781 1031 L 777 1026 L 773 1022 L 769 1016 L 765 1011 L 760 1005 L 756 999 L CM 0.246 0.246 scale s SM n 751 1004 M 745 984 L 762 996 L 751 1004 L cp e 1 sl n 778 1126 M 778 1120 L 780 1114 L 782 1109 L 785 1104 L 789 1100 L 794 1096 L 799 1093 L 805 1091 L 810 1090 L 816 1090 L 822 1091 L 828 1093 L 833 1096 L 837 1100 L 841 1104 L 845 1109 L 847 1114 L 848 1120 L 849 1126 L 848 1131 L 847 1137 L 845 1142 L 841 1147 L 837 1152 L 833 1155 L 828 1158 L 822 1160 L 816 1161 L 810 1161 L 805 1160 L 799 1158 L 794 1155 L 789 1152 L 785 1147 L 782 1142 L 780 1137 L 778 1131 L 778 1126 L cp gs 0.902 g e gr s [33.402 0 0 -33.234 0 0]/Helvetica MF (9)804 1136 MS n 827 1076 M 935 1076 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (U)829 1067 MS (N)847 1067 MS (L)865 1067 MS (O)880 1067 MS (C)898 1067 = MS (K)915 1067 MS showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Helvetica %%+ Symbol %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 1147 2535 a Fn(Figure)15 b(1.)25 b Fh(\013)p Fp({core)i(state)f(diagram)g(for)h(participan)n(ts.)523 2961 y Fq(ready)j(rejected)g(the)h(participan)n(t)f(b)r(ecause)h(it)g (has)f(not)h(executed)f(an)n(y)g(in)n(teraction)g(and)523 3061 y(is)e(still)f(in)n(terested)h(in)f(them.)648 3231 y(When)36 b(a)g Fj(S)5 b(T)12 b(AR)q(T)46 b Fq(message)35 b(is)h(receiv)n(ed)f(from)h(the)h(curren)n(t)e(prosp)r(ectiv)n(e)g (winner)523 3330 y(co)r(ordinator)29 b(in)j(the)f Fj(LO)r(C)6 b(K)g(E)f(D)34 b Fq(state)d(\(transition)g(7\),)g(the)g(in)n(teraction) g(that)g(co)r(ordi-)523 3430 y(nator)37 b(manages)g(has)g(b)r(een)i (selected)f(for)f(execution)h(and)g(it)g(ma)n(y)g(start.)f(Ho)n(w)n(ev) n(er,)f(a)523 3530 y Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)32 b Fq(message)27 b(has)h(to)g(b)r(e)g(sen)n(t)g(to)g(the)h(co)r (ordinators)d(of)i(the)h(in)n(teractions)e(in)h(set)523 3629 y Fj(I)7 b(S)e Fq(,)27 b(except)g(for)g(those)f(that)i(are)e(kno)n (wn)g(to)h(b)r(e)h(losers)e(and)h(the)g(winner,)g(in)g(order)f(to)h (in-)523 3729 y(form)h(them)h(that)g(this)g(participan)n(t)f(is)g(not)g (in)n(terested)h(in)f(them)h(an)n(ymore.)e(Notice)i(that)523 3828 y(on)c(receiving)f(a)h Fj(S)5 b(T)12 b(AR)q(T)35 b Fq(message,)23 b(the)j(participan)n(t)e(cannot)h(return)g(to)g(the)g Fj(AC)6 b(T)12 b(I)7 b(V)19 b(E)523 3928 y Fq(state)29 b(immediately)g(b)r(ecause)f(it)i(\014rst)e(has)h(to)f(w)n(ait)h(for)f (the)h(co)r(ordinators)e(it)i(has)g(sen)n(t)f(a)523 4028 y Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)33 b Fq(message)28 b(to)g(ac)n(kno)n (wledge)f(its)i(receipt)g(b)n(y)f(means)g(of)h(an)g Fj(AC)6 b(K)g(R)q(E)f(F)40 b Fq(mes-)523 4127 y(sage.)32 b(This)h(is)g(essen)n (tial,)f(b)r(ecause)h(if)h(the)f(participan)n(t)f(executed)i(the)f(in)n (teraction)f(and)523 4227 y(o\013ered)k(participation)f(in)i(other)e (in)n(teractions)g(immediately)i(after,)e Fj(AC)6 b(K)g(R)q(E)f(F)48 b Fq(mes-)523 4327 y(sages)26 b(from)h(the)i(co)r(ordinators)c(that)j (where)f(sen)n(t)g(a)h Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)32 b Fq(message)26 b(b)r(efore)h(migh)n(t)523 4426 y(b)r(e)33 b(misundersto)r(o)r(d)f(if)h(another)f(in)n(teraction)f(w)n(as)h (executed)h(to)r(o)f(so)r(on.)g(Consequen)n(tly)-7 b(,)523 4526 y(the)26 b(participan)n(t)f(has)f(to)i(remain)e(in)i(an)f(in)n (termediate)g(state)h(called)f Fj(S)5 b(Y)18 b(N)9 b(C)31 b Fq(un)n(til)26 b(ev)n(ery)523 4625 y(co)r(ordinator)20 b(that)h(w)n(as)g(sen)n(t)h(a)f Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)26 b Fq(message)20 b(ac)n(kno)n(wledges)f(its)j(receipt.)f Fj(LO)r(C)6 b(K)523 4725 y Fq(or)21 b Fj(U)9 b(N)g(LO)r(C)d(K)27 b Fq(messages)20 b(ma)n(y)h(also)f(b)r(e)i(receiv)n(ed)f(in)h(this)g (state)f(from)g(co)r(ordinators)f(that)523 4825 y(w)n(ere)32 b(o\013ered)g(participation,)g(but)i(they)f(are)f(ignored)f(b)r(ecause) i(a)f Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)37 b Fq(message)523 4924 y(has)27 b(just)h(b)r(een)g(sen)n(t)g(to)f(inform)h(them)g(ab)r (out)f(the)h(new)g(situation.)p eop %%Page: 6 6 6 5 bop 523 448 a Fg(3.2)95 b Ff(\013)p Fg({core)31 b(in)h(a)g(co)s (ordinator)523 627 y Fq(Figure)27 b(2)g(sho)n(ws)g(the)h(state)f (transition)g(diagram)g(for)g(co)r(ordinators,)e(and)j(T)-7 b(able)27 b(3)g(giv)n(es)523 727 y(a)g(brief)h(explanation)f(of)g(its)h (v)-5 b(ariables.)p 599 940 2730 4 v 597 1031 4 92 v 611 1004 a Fn(V)e(ariable)p 941 1031 V 24 w(Description)p 3327 1031 V 599 1035 2730 4 v 599 1051 V 597 1234 4 183 v 641 1115 a Fh(cur)r(r)r(ent)p 942 1234 V 53 w Fp(It)28 b(is)h(the)g(participan)n(t)g(the)f(co)r(ordinator)i(is)g(curren)n(tly) e(trying)g(to)h(lo)r(c)n(k,)g(i.e.,)i(a)955 1207 y Fh(LO)r(C)5 b(K)32 b Fp(message)26 b(has)g(b)r(een)f(sen)n(t)h(to)g(it,)g(but)f(no) g(reply)h(has)f(arriv)n(ed,)h(y)n(et.)p 3327 1234 V 599 1237 2730 4 v 597 1420 4 183 v 748 1301 a Fh(n)p 942 1420 V 161 w Fp(It)19 b(is)h(an)g(o\013er)g(coun)n(ter,)f(and)h(is)g (used)f(in)h(order)f(to)h(detect)g(when)f(the)g(in)n(teraction)955 1392 y(a)26 b(co)r(ordinator)h(manages)f(is)g(enabled.)p 3327 1420 V 599 1423 2730 4 v 597 1515 4 92 v 655 1487 a Fh(shar)r(ed)p 942 1515 V 66 w Fp(It)f(is)h(the)f(set)h(of)h (participan)n(ts)f(shared)g(with)g(other)f(co)r(ordinators.)p 3327 1515 V 599 1518 2730 4 v 597 1609 4 92 v 639 1582 a Fh(w)r(aiting)p 942 1609 V 55 w Fp(It)g(is)h(a)g(set)g(of)h (participan)n(ts)f(not)f(lo)r(c)n(k)n(ed,)h(y)n(et.)p 3327 1609 V 599 1612 2730 4 v 1100 1673 a Fn(T)-7 b(able)29 b(3.)c Fp(V)-6 b(ariables)26 b(used)g(b)n(y)e Fh(\013)p Fp({core)j(in)f(co)r(ordinators.)523 3960 y @beginspecial 56.689999 @llx 56.689999 @lly 473.910004 @urx 305.859985 @ury 3458 @rwi @setspecial %%BeginDocument: dte-coord.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip048.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:35 1/29/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 473.91 305.86 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 305.855 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 sl n 445 429 M 555 429 L 560 428 L 565 427 L 570 425 L 574 422 L 578 418 L 581 414 L 583 409 L 584 404 L 585 399 L 585 370 L 584 365 L 583 360 L 581 355 L 578 351 L 574 347 L 570 344 L 565 342 L 560 341 L 555 340 L 445 340 L 440 341 L 435 342 L 430 344 L 426 347 L 422 351 L 419 355 L 417 360 L 416 365 L 415 370 L 415 399 L 416 404 L 417 409 L 419 414 L 422 418 L 426 422 L 430 425 L 435 427 L 440 428 L 445 429 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [24.926 0 0 -24.984 0 0]/Times-Roman MF (A)430 392 MS (C)448 392 MS (C)465 392 MS (E)482 392 MS (P)497 392 MS = (T)511 392 MS (I)526 392 MS (N)534 392 MS (G)552 392 MS n 1603 429 M 1714 429 L 1719 428 L 1724 427 L 1728 425 L 1733 422 L 1736 418 L 1739 414 L 1741 409 L 1743 404 L 1743 399 L 1743 370 L 1743 365 L 1741 360 L 1739 355 L 1736 351 L 1733 347 L 1728 344 L 1724 342 L 1719 341 L 1714 340 L 1603 340 L 1598 341 L 1593 342 L 1589 344 L 1584 347 L 1581 351 L 1578 355 L 1576 360 L 1574 365 L 1574 370 L 1574 399 L 1574 404 L 1576 409 L 1578 414 L 1581 418 L 1584 422 L 1589 425 L 1593 427 L 1598 428 L 1603 429 L cp gs 1 g e gr s (L)1603 392 MS (O)1618 392 MS (C)1636 392 MS (K)1652 392 MS (I)1670 392 = MS (N)1678 392 MS (G)1696 392 MS n 165 591 M 165 587 L 166 584 L 168 581 L 171 579 L 174 577 L 178 577 L 181 577 L 185 577 L 188 579 L 191 581 L 193 584 L 194 587 L 194 591 L 194 595 L 193 598 L 191 601 L 188 603 L 185 605 L 181 606 L 178 606 L 174 605 L 171 603 L 168 601 L 166 598 L 165 595 L 165 591 L cp gs 0.102 g e gr s n 1395 1037 M 1826 1037 L 1826 860 L 1395 860 L 1395 1037 L cp e n 1377 1019 M 1808 1019 L 1808 842 L 1377 842 L 1377 1019 L cp gs 1 g e gr s (w)1385 878 MS (a)1403 878 MS (i)1414 878 MS (t)1421 878 MS (i)1428 878 = MS (n)1435 878 MS (g)1448 878 MS (:)1460 878 MS ( )1467 878 MS (S)1473 = 878 MS (e)1487 878 MS (t)1498 878 MS ( )1505 878 MS (o)1512 878 MS = (f)1524 878 MS ( )1532 878 MS (P)1539 878 MS (a)1553 878 MS (r)1564 878 MS (t)1572 878 MS (i)1579 878 = MS (c)1586 878 MS (i)1597 878 MS (p)1604 878 MS (a)1616 878 MS (n)1627 = 878 MS (t)1640 878 MS (l)1385 908 MS (o)1392 908 MS (c)1405 908 MS (k)1416 908 MS (e)1428 908 = MS (d)1439 908 MS (:)1452 908 MS ( )1459 908 MS (S)1465 908 MS (e)1479 = 908 MS (t)1490 908 MS ( )1497 908 MS (o)1503 908 MS (f)1516 908 MS ( = )1524 908 MS (P)1530 908 MS (a)1544 908 MS (r)1555 908 MS (t)1564 908 MS (i)1571 908 MS (c)1578 908 = MS (i)1589 908 MS (p)1596 908 MS (a)1608 908 MS (n)1619 908 MS (t)1631 = 908 MS (s)1385 938 MS (h)1395 938 MS (a)1408 938 MS (r)1419 938 MS (e)1427 938 = MS (d)1438 938 MS (:)1450 938 MS ( )1457 938 MS (S)1464 938 MS (e)1478 = 938 MS (t)1489 938 MS ( )1496 938 MS (o)1502 938 MS (f)1514 938 MS ( = )1523 938 MS (P)1529 938 MS (a)1543 938 MS (r)1554 938 MS (t)1562 938 MS (i)1569 938 MS (c)1576 938 = MS (i)1587 938 MS (p)1594 938 MS (a)1606 938 MS (n)1617 938 MS (t)1630 = 938 MS (c)1385 968 MS (u)1396 968 MS (r)1409 968 MS (r)1417 968 MS (e)1425 968 = MS (n)1436 968 MS (t)1449 968 MS (:)1456 968 MS ( )1463 968 MS (P)1469 = 968 MS (a)1483 968 MS (r)1494 968 MS (t)1502 968 MS (i)1509 968 MS = (c)1516 968 MS (i)1527 968 MS (p)1534 968 MS (a)1547 968 MS (n)1558 968 MS (t)1570 968 MS (n)1385 998 MS (:)1398 998 MS ( )1405 998 MS (i)1411 998 MS (n)1418 998 = MS (t)1431 998 MS (e)1438 998 MS (g)1449 998 MS (e)1461 998 MS (r)1472 = 998 MS 1 j 1 setlinecap 6 sl n 415 385 M 410 373 L 404 361 L 399 350 L 394 339 L 389 328 L 384 318 L 380 309 L 376 299 L 372 290 L 369 282 L 365 274 L 362 266 L 359 259 L 357 252 L 355 245 L 352 239 L 351 233 L 349 228 L 348 223 L 347 218 L 346 214 L 345 210 L 345 206 L 345 203 L 345 200 L 345 198 L 346 196 L 347 194 L 348 193 L 349 192 L 351 192 L 353 192 L 355 192 L 357 193 L 360 194 L 363 196 L 366 197 L 369 200 L 373 202 L 377 205 L 381 209 L 385 213 L 390 217 L 395 221 L 400 226 L 405 232 L 411 237 L 416 244 L 423 250 L 429 257 L 435 264 L 442 272 L 449 280 L 457 288 L 464 297 L 472 306 L 480 316 L 488 326 L CM 0.246 0.246 scale s SM n 482 329 M 500 340 L 493 320 L 482 329 L cp e n 415 385 M 410 396 L 405 408 L 400 419 L 395 429 L 390 440 L 386 450 L 382 459 L 378 468 L 375 477 L 371 485 L 368 493 L 366 501 L 363 508 L 361 515 L 358 521 L 357 527 L 355 533 L 354 538 L 352 543 L 352 547 L 351 551 L 351 555 L 350 558 L 350 561 L 351 564 L 351 566 L 352 568 L 353 569 L 354 570 L 356 571 L 358 571 L 360 571 L 362 571 L 364 570 L 367 569 L 370 567 L 373 565 L 377 562 L 381 560 L 384 556 L 389 553 L 393 549 L 398 544 L 403 540 L 408 535 L 413 529 L 419 523 L 425 517 L 431 510 L 437 503 L 444 496 L 451 488 L 458 480 L 465 471 L 473 462 L 480 453 L 488 443 L CM 0.246 0.246 scale s SM n 482 440 M 500 429 L 493 449 L 482 440 L cp e n 585 385 M 590 373 L 595 361 L 600 350 L 605 339 L 609 328 L 613 318 L 617 309 L 621 299 L 624 291 L 627 282 L 630 274 L 633 266 L 636 259 L 638 252 L 640 245 L 642 239 L 643 233 L 645 228 L 646 223 L 647 218 L 648 214 L 648 210 L 648 206 L 648 203 L 648 200 L 648 198 L 647 196 L 646 194 L 645 193 L 643 192 L 642 192 L 640 192 L 638 192 L 636 193 L 633 194 L 630 196 L 627 197 L 624 200 L 621 202 L 617 205 L 613 209 L 609 213 L 605 217 L 600 221 L 595 226 L 590 232 L 585 237 L 579 243 L 573 250 L 568 257 L 561 264 L 555 272 L 548 280 L 542 288 L 534 297 L 527 306 L 519 316 L 512 326 L CM 0.246 0.246 scale s SM n 518 328 M 500 340 L 507 320 L 518 328 L cp e n 1607 341 M 1604 330 L 1600 320 L 1596 309 L 1592 299 L 1588 289 L 1583 280 L 1577 271 L 1571 262 L 1565 254 L 1559 246 L 1552 238 L 1545 230 L 1537 223 L 1529 216 L 1521 210 L 1512 204 L 1503 198 L 1494 192 L 1484 187 L 1474 182 L 1464 178 L 1453 174 L 1442 170 L 1431 166 L 1419 163 L 1407 160 L 1394 157 L 1381 155 L 1368 153 L 1354 152 L 1340 150 L 1326 149 L 1311 149 L 1296 148 L 1281 148 L 1265 149 L 1249 149 L 1233 150 L 1216 152 L 1199 153 L 1181 155 L 1163 157 L 1145 160 L 1127 163 L 1108 166 L 1088 170 L 1069 174 L 1049 178 L 1028 182 L 1008 187 L 987 192 L 965 198 L 943 204 L 921 210 L 899 216 L 876 223 L 853 230 L 829 238 L 805 246 L 781 254 L 756 262 L 731 271 L 706 280 L 680 289 L 654 299 L 628 309 L 601 320 L 574 330 L 547 341 L CM 0.246 0.246 scale s SM n 1595 324 M 1607 341 L 1608 320 L 1595 324 L cp e n 585 385 M 590 396 L 595 408 L 600 419 L 605 429 L 609 440 L 613 450 L 617 459 L 621 468 L 625 477 L 628 485 L 631 493 L 634 501 L 636 508 L 638 515 L 640 521 L 642 527 L 644 533 L 645 538 L 646 543 L 647 547 L 648 551 L 648 555 L 648 558 L 648 561 L 648 564 L 647 566 L 646 568 L 645 569 L 644 570 L 643 571 L 641 571 L 639 571 L 637 571 L 634 570 L 631 569 L 628 567 L 625 565 L 622 562 L 618 560 L 614 556 L 610 553 L 606 549 L 601 544 L 596 540 L 591 535 L 586 529 L 580 523 L 575 517 L 569 510 L 562 503 L 556 496 L 549 488 L 542 480 L 535 471 L 528 462 L 520 453 L 512 443 L CM 0.246 0.246 scale s SM n 518 440 M 500 429 L 508 449 L 518 440 L cp e 1 sl n 256 201 M 256 196 L 258 190 L 260 185 L 263 180 L 267 175 L 272 172 L 277 169 L 283 167 L 288 166 L 294 166 L 300 167 L 306 169 L 311 172 L 315 175 L 319 180 L 322 185 L 325 190 L 326 196 L 327 201 L 326 207 L 325 213 L 322 218 L 319 223 L 315 227 L 311 231 L 306 234 L 300 236 L 294 237 L 288 237 L 283 236 L 277 234 L 272 231 L 267 227 L 263 223 L 260 218 L 258 213 L 256 207 L 256 201 L cp gs 0.902 g e gr s %%IncludeFont: Helvetica [33.391 0 0 -33.23 0 0]/Helvetica MF (1)282 211 MS n 628 154 M 628 148 L 630 143 L 632 137 L 635 132 L 639 128 L 644 125 L 649 122 L 654 120 L 660 119 L 666 119 L 672 120 L 677 122 L 683 125 L 687 128 L 691 132 L 694 137 L 697 143 L 698 148 L 699 154 L 698 160 L 697 166 L 694 171 L 691 176 L 687 180 L 683 184 L 677 187 L 672 189 L 666 189 L 660 189 L 654 189 L 649 187 L 644 184 L 639 180 L 635 176 L 632 171 L 630 166 L 628 160 L 628 154 L cp gs 0.902 g e gr s (2)654 164 MS n 274 591 M 274 585 L 276 580 L 278 574 L 281 569 L 285 565 L 290 562 L 295 559 L 300 557 L 306 556 L 312 556 L 318 557 L 323 559 L 328 562 L 333 565 L 337 569 L 340 574 L 343 580 L 344 585 L 344 591 L 344 597 L 343 602 L 340 608 L 337 613 L 333 617 L 328 621 L 323 623 L 318 625 L 312 626 L 306 626 L 300 625 L 295 623 L 290 621 L 285 617 L 281 613 L 278 608 L 276 602 L 274 597 L 274 591 L cp gs 0.902 g e gr s (3)300 601 MS n 616 641 M 617 635 L 618 630 L 620 624 L 623 619 L 627 615 L 632 612 L 637 609 L 643 607 L 649 606 L 654 606 L 660 607 L 666 609 L 671 612 L 675 615 L 679 619 L 683 624 L 685 630 L 686 635 L 687 641 L 686 647 L 685 653 L 683 658 L 679 663 L 675 667 L 671 671 L 666 674 L 660 676 L 654 677 L 649 677 L 643 676 L 637 674 L 632 671 L 627 667 L 623 663 L 620 658 L 618 653 L 617 647 L 616 641 L cp gs 0.902 g e gr s (4)642 651 MS n 1159 83 M 1159 77 L 1161 72 L 1163 66 L 1166 62 L 1170 57 L 1175 54 L 1180 51 L 1186 49 L 1191 48 L 1197 48 L 1203 49 L 1209 51 L 1214 54 L 1218 57 L 1222 62 L 1226 66 L 1228 72 L 1229 77 L 1230 83 L 1229 89 L 1228 95 L 1226 100 L 1222 105 L 1218 109 L 1214 113 L 1209 116 L 1203 118 L 1197 119 L 1191 119 L 1186 118 L 1180 116 L 1175 113 L 1170 109 L 1166 105 L 1163 100 L 1161 95 L 1159 89 L 1159 83 L cp gs 0.902 g e gr s (5)1185 93 MS 6 sl n 1607 430 M 1601 444 L 1594 457 L 1587 470 L 1580 483 L 1573 496 L 1565 508 L 1557 519 L 1549 530 L 1540 541 L 1532 551 L 1523 561 L 1514 571 L 1504 580 L 1494 588 L 1484 597 L 1474 605 L 1464 612 L 1453 619 L 1442 626 L 1431 632 L 1420 638 L 1408 644 L 1396 649 L 1384 654 L 1372 658 L 1359 662 L 1346 666 L 1333 669 L 1320 671 L 1306 674 L 1292 676 L 1278 677 L 1264 678 L 1249 679 L 1235 679 L 1220 679 L 1205 679 L 1189 678 L 1173 677 L 1157 675 L 1141 673 L 1124 671 L 1108 668 L 1090 664 L 1073 661 L 1056 657 L 1038 652 L 1020 647 L 1002 642 L 983 636 L 965 630 L 946 624 L 926 617 L 907 610 L 887 602 L 867 594 L 847 586 L 827 577 L 806 568 L 785 558 L 764 548 L 743 538 L 721 527 L 699 515 L 677 504 L 654 492 L 632 479 L 609 466 L 586 453 L 562 439 L CM 0.246 0.246 scale s SM n 567 434 M 547 430 L 560 446 L 567 434 L cp e 1 sl n 1690 562 M 1690 556 L 1692 550 L 1694 545 L 1697 540 L 1701 536 L 1706 532 L 1711 529 L 1717 527 L 1722 526 L 1728 526 L 1734 527 L 1740 529 L 1745 532 L 1749 536 L 1753 540 L 1757 545 L 1759 550 L 1760 556 L 1761 562 L 1760 567 L 1759 573 L 1757 579 L 1753 583 L 1749 587 L 1745 591 L 1740 594 L 1734 596 L 1728 597 L 1722 597 L 1717 596 L 1711 594 L 1706 591 L 1701 587 L 1697 583 L 1694 579 L 1692 573 L 1690 567 L 1690 562 L cp gs 0.902 g e gr s (6)1716 572 MS 6 sl n 1574 385 M 603 385 L CM 0.246 0.246 scale s SM n 605 378 M 585 385 L 605 391 L 605 378 L cp e 1 sl n 1448 334 M 1449 329 L 1450 323 L 1452 317 L 1456 313 L 1460 308 L 1464 305 L 1469 302 L 1475 300 L 1481 299 L 1487 299 L 1492 300 L 1498 302 L 1503 305 L 1508 308 L 1512 313 L 1515 317 L 1517 323 L 1519 329 L 1519 334 L 1519 340 L 1517 346 L 1515 351 L 1512 356 L 1508 360 L 1503 364 L 1498 367 L 1492 369 L 1487 370 L 1481 370 L 1475 369 L 1469 367 L 1464 364 L 1460 360 L 1456 356 L 1452 351 L 1450 346 L 1449 340 L 1448 334 L cp gs 0.902 g e gr s (7)1474 344 MS 6 sl n 1671 442 M 1681 452 L 1690 461 L 1699 470 L 1707 479 L 1716 487 L 1724 495 L 1731 502 L 1739 510 L 1746 516 L 1753 523 L 1760 529 L 1766 535 L 1772 540 L 1778 545 L 1783 550 L 1789 554 L 1794 558 L 1798 561 L 1803 565 L 1807 567 L 1811 570 L 1814 572 L 1817 574 L 1820 575 L 1823 576 L 1826 577 L 1828 577 L 1830 577 L 1831 577 L 1833 576 L 1834 575 L 1835 573 L 1835 571 L 1835 569 L 1835 567 L 1835 564 L 1834 560 L 1833 557 L 1832 553 L 1831 548 L 1829 544 L 1827 538 L 1825 533 L 1822 527 L 1819 521 L 1816 514 L 1813 507 L 1809 500 L 1805 492 L 1801 484 L 1796 476 L 1792 467 L 1787 458 L 1781 449 L 1776 439 L 1770 429 L 1763 418 L 1757 407 L 1750 396 L 1743 385 L CM 0.246 0.246 scale s SM n 1677 439 M 1658 429 L 1668 448 L 1677 439 L cp e 1 sl n 1424 556 M 1425 550 L 1426 544 L 1429 539 L 1432 534 L 1436 530 L 1440 526 L 1446 523 L 1451 521 L 1457 520 L 1463 520 L 1469 521 L 1474 523 L 1479 526 L 1484 530 L 1488 534 L 1491 539 L 1493 544 L 1495 550 L 1495 556 L 1495 562 L 1493 567 L 1491 573 L 1488 578 L 1484 582 L 1479 585 L 1474 588 L 1469 590 L 1463 591 L 1457 591 L 1451 590 L 1446 588 L 1440 585 L 1436 582 L 1432 578 L 1429 573 L 1426 567 L 1425 562 L 1424 556 L cp gs 0.902 g e gr s (8)1451 566 MS 6 sl n 399 393 M 386 400 L 373 407 L 361 414 L 349 421 L 337 428 L 326 435 L 315 442 L 305 449 L 295 455 L 286 462 L 276 469 L 268 476 L 259 482 L 251 489 L 244 496 L 237 502 L 230 509 L 224 515 L 218 522 L 212 528 L 207 535 L 202 541 L 198 547 L 195 554 L 191 560 L 188 566 L 185 573 L 183 579 L 181 585 L 180 591 L CM 0.246 0.246 scale s SM n 401 400 M 415 385 L 394 388 L 401 400 L cp e 1 sl n 162 357 M 291 357 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)207 495 MS (:)181 495 MS (n)164 495 MS (:)232 458 MS (s)163 458 MS (h)173 458 MS (a)185 458 MS (r)196 458 MS (e)204 458 MS = (d)215 458 MS (:)244 420 MS (w)164 420 MS (a)182 420 MS (i)193 420 MS (t)200 420 MS (i)207 420 MS = (n)214 420 MS (g)226 420 MS (:)234 383 MS (l)163 383 MS (o)170 383 MS (c)183 383 MS (k)194 383 MS (e)206 383 MS = (d)217 383 MS %%IncludeFont: Symbol [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)187 495 MS (\306)257 458 MS (=3D)238 458 MS (\306)269 420 MS (=3D)249 420 MS (\306)259 383 MS (=3D)240 383 MS n 172 34 M 473 34 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)358 135 MS (S)370 135 MS (e)384 135 MS (n)395 135 MS (d)407 135 MS = (e)420 135 MS (r)431 135 MS (})439 135 MS ( )354 135 MS ( )331 135 MS (s)266 135 MS (h)276 135 MS (a)289 135 MS (r)300 135 MS (e)308 135 MS = (d)319 135 MS ( )261 135 MS (:)243 135 MS (s)173 135 MS (h)182 135 MS (a)195 135 MS (r)206 135 MS (e)214 135 MS = (d)225 135 MS ({)380 97 MS (S)392 97 MS (e)406 97 MS (n)417 97 MS (d)430 97 MS (e)442 = 97 MS (r)453 97 MS (})462 97 MS ( )377 97 MS ( )353 97 MS ( )273 97 MS (w)279 97 MS (a)297 97 MS (i)308 97 MS (t)315 97 MS (i)322 = 97 MS (n)329 97 MS (g)341 97 MS (:)254 97 MS (w)174 97 MS (a)192 97 MS (i)203 97 MS (t)210 97 MS (i)217 97 MS (n)224 = 97 MS (g)236 97 MS (1)250 60 MS (n)216 60 MS ( )210 60 MS (:)192 60 MS (n)173 60 MS ( )441 24 MS (O)363 24 MS (F)381 24 MS (F)395 24 MS (E)408 24 MS (R)424 24 MS ( )357 24 MS (y)339 24 MS (])351 24 MS (C)240 24 MS (a)257 24 MS (r)268 24 MS (d)276 24 MS (i)288 24 MS (n)295 = 24 MS (a)308 24 MS (l)319 24 MS (i)326 24 MS (t)333 24 MS ( )234 24 MS ([)196 24 MS (n)204 24 MS ( )217 24 MS [24.984 0 0 -24.984 0 0]/Symbol MF (\310)336 135 MS (=3D)248 135 MS (\310)359 97 MS (=3D)260 97 MS (+)234 60 MS (=3D)198 60 MS gs n 14 29 222 1 CB (<)222 24 MS gr n 703 93 M 1031 93 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)915 156 MS (S)927 156 MS (e)941 156 MS (n)952 156 MS (d)965 156 MS = (e)977 156 MS (r)988 156 MS (})996 156 MS ( )889 156 MS (l)823 156 MS (o)830 156 MS (c)842 156 MS (k)853 156 MS (e)866 156 MS = (d)877 156 MS ( )817 156 MS (:)799 156 MS (l)727 156 MS (o)734 156 MS (c)747 156 MS (k)758 156 MS (e)770 156 MS = (d)781 156 MS (1)805 119 MS (n)771 119 MS ( )765 119 MS (:)746 119 MS (n)728 119 MS (E)1014 83 MS (P)870 83 MS (A)884 83 MS (R)903 83 MS (T)919 83 MS (I)934 83 MS (C)942 = 83 MS (I)959 83 MS (P)966 83 MS (A)980 83 MS (T)999 83 MS ( )865 83 MS (y)847 83 MS (])858 83 MS (C)747 83 MS (a)764 83 MS (r)775 83 MS (d)783 83 MS (i)796 83 MS (n)803 = 83 MS (a)815 83 MS (l)826 83 MS (i)833 83 MS (t)840 83 MS ( )742 83 MS ([)703 83 MS (n)711 83 MS ( )724 83 MS [24.984 0 0 -24.984 0 0]/Symbol MF (\310)894 156 MS (=3D)805 156 MS (+)789 119 MS (=3D)752 119 MS gs n 14 29 729 60 CB (<)729 83 MS gr n 203 677 M 487 677 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)372 816 MS (S)384 816 MS (e)398 816 MS (n)409 816 MS (d)421 816 MS = (e)434 816 MS (r)445 816 MS (})453 816 MS ( )355 816 MS (\\)361 816 MS ( )368 816 MS (s)291 816 MS (h)301 816 MS (a)313 816 MS (r)324 816 MS (e)332 816 MS = (d)343 816 MS (:)273 816 MS (s)203 816 MS (h)213 816 MS (a)226 816 MS (r)237 816 MS (e)245 816 MS = (d)256 816 MS ({)394 778 MS (S)406 778 MS (e)420 778 MS (n)431 778 MS (d)444 778 MS = (e)456 778 MS (r)467 778 MS (})475 778 MS ( )378 778 MS (\\)384 778 MS ( )391 778 MS (w)303 778 MS (a)321 778 MS (i)332 778 MS (t)339 778 MS (i)346 778 MS = (n)353 778 MS (g)366 778 MS (:)285 778 MS (w)205 778 MS (a)223 778 MS (i)234 778 MS (t)241 778 MS (i)248 778 MS = (n)255 778 MS (g)267 778 MS (A)341 741 MS (C)359 741 MS (K)376 741 MS (R)394 741 MS (E)411 741 MS = (F)426 741 MS (\))440 741 MS ( )335 741 MS (r)322 741 MS (,)330 741 MS (S)203 741 MS (e)217 741 MS (n)228 741 MS (d)241 741 MS (\()253 741 MS = (S)261 741 MS (e)275 741 MS (n)286 741 MS (d)299 741 MS (e)311 741 MS (0)380 703 MS (\))392 703 MS ( )374 703 MS (:)370 703 MS ( )366 703 MS (1)357 703 MS (n)323 703 MS ( )317 703 MS (?)308 703 MS ( )302 703 MS (0)291 703 MS ( )286 703 MS (\()246 703 MS (n)255 703 MS ( )267 703 MS ( )241 703 MS (:)222 703 MS (n)204 703 MS (R)298 667 MS (E)315 667 MS (F)330 667 MS (U)344 667 MS (S)362 667 MS = (E)376 667 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)279 816 MS (=3D)290 778 MS (-)341 703 MS (>)273 703 MS (=3D)228 703 MS n 597 728 M 917 728 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)643 904 MS (:)617 904 MS (n)599 904 MS (:)668 867 MS (s)598 867 MS (h)608 867 MS (a)620 867 MS (r)631 867 MS (e)640 867 MS = (d)651 867 MS (:)680 829 MS (w)599 829 MS (a)617 829 MS (i)628 829 MS (t)635 829 MS (i)642 829 MS = (n)649 829 MS (g)662 829 MS ( )714 792 MS ( )689 792 MS (:)670 792 MS (l)599 792 MS (o)606 792 MS (c)618 792 MS (k)629 792 MS (e)642 792 MS = (d)653 792 MS (S)828 754 MS (T)842 754 MS (A)857 754 MS (R)875 754 MS (T)892 754 MS = (\))907 754 MS ( )823 754 MS (\()803 754 MS (i)811 754 MS (,)818 754 MS ( )798 754 MS (S)748 754 MS (e)762 754 MS (n)773 754 MS (d)786 754 MS ( )743 754 MS ( )715 754 MS (l)649 754 MS (o)656 754 MS (c)668 754 MS (k)679 754 MS (e)692 754 MS = (d)703 754 MS ( )643 754 MS ( )626 754 MS (i)620 754 MS ( )615 754 MS (])898 718 MS ( )872 718 MS ( )854 718 MS (s)789 718 MS (h)799 718 MS (a)811 718 MS (r)822 718 MS (e)831 718 MS = (d)842 718 MS ( )784 718 MS (y)752 718 MS ( )764 718 MS (C)652 718 MS (a)669 718 MS (r)680 718 MS (d)688 718 MS (i)701 718 MS = (n)708 718 MS (a)720 718 MS (l)731 718 MS (i)738 718 MS (t)745 718 MS ( )647 718 MS ([)608 718 MS (n)616 718 MS ( )629 718 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)623 904 MS (\306)686 867 MS (=3D)674 867 MS (\306)705 829 MS (=3D)686 829 MS (\306)694 792 MS (=3D)676 792 MS (\256)720 754 MS (\316)629 754 MS (")598 754 MS gs n 21 29 877 695 CB (\306)877 718 MS gr gs n 14 29 859 695 CB (=3D)859 718 MS gr gs n 15 29 770 695 CB (\331)770 718 MS gr gs n 14 29 634 695 CB (=3D)634 718 MS gr n 1250 34 M 1550 34 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (L)1396 135 MS (O)1411 135 MS (C)1429 135 MS (K)1445 135 MS (\))1463 135 = MS (\()1309 135 MS (c)1317 135 MS (u)1328 135 MS (r)1341 135 MS (r)1349 135 = MS (e)1357 135 MS (n)1368 135 MS (t)1380 135 MS (,)1387 135 MS ( )1303 135 MS (S)1254 135 MS (e)1268 135 MS (n)1279 135 MS (d)1291 135 MS ({)1453 97 MS (c)1465 97 MS (u)1476 97 MS (r)1488 97 MS (r)1497 97 MS = (e)1505 97 MS (n)1516 97 MS (t)1528 97 MS (})1535 97 MS (\\)1443 97 MS (w)1362 97 MS (a)1380 97 MS (i)1391 97 MS (t)1398 97 MS (i)1405 97 MS = (n)1412 97 MS (g)1425 97 MS (:)1336 97 MS (w)1255 97 MS (a)1273 97 MS (i)1284 97 MS (t)1291 97 MS (i)1298 97 MS = (n)1305 97 MS (g)1318 97 MS ( )1529 60 MS (\()1438 60 MS (w)1447 60 MS (a)1464 60 MS (i)1475 60 MS (t)1483 60 MS = (i)1489 60 MS (n)1497 60 MS (g)1509 60 MS (\))1521 60 MS ( )1433 60 MS (S)1348 60 MS (m)1362 60 MS (a)1381 60 MS (l)1392 60 MS (l)1399 60 MS = (e)1406 60 MS (s)1417 60 MS (t)1427 60 MS (:)1330 60 MS (c)1254 60 MS (u)1265 60 MS (r)1278 60 MS (r)1286 60 MS (e)1294 60 MS = (n)1305 60 MS (t)1318 60 MS (])1541 24 MS ( )1515 24 MS ( )1496 24 MS (s)1432 24 MS (h)1441 24 MS (a)1454 24 MS (r)1465 24 MS (e)1473 24 MS = (d)1484 24 MS ( )1427 24 MS (y)1395 24 MS ( )1406 24 MS (C)1295 24 MS (a)1312 24 MS (r)1323 24 MS (d)1331 24 MS (i)1343 24 MS = (n)1350 24 MS (a)1363 24 MS (l)1374 24 MS (i)1381 24 MS (t)1388 24 MS ( )1289 24 MS ([)1250 24 MS (n)1259 24 MS ( )1271 24 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1341 97 MS (=3D)1336 60 MS gs n 21 29 1520 1 CB (\306)1520 24 MS gr gs n 14 29 1502 1 CB (\271)1502 24 MS gr gs n 15 29 1412 1 CB (\331)1412 24 MS gr gs n 14 29 1277 1 CB (=3D)1277 24 MS gr n 1188 223 M 1507 223 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)1352 361 MS (:)1326 361 MS (n)1308 361 MS ( )1302 361 MS (;)1296 361 MS (:)1258 361 MS (s)1188 361 MS (h)1198 361 MS (a)1211 361 MS (r)1222 361 MS (e)1230 361 = MS (d)1241 361 MS ( )1309 324 MS (w)1316 324 MS (a)1334 324 MS (i)1345 324 MS (t)1352 324 = MS (i)1359 324 MS (n)1366 324 MS (g)1378 324 MS (;)1304 324 MS ( )1279 324 MS (:)1260 324 MS (l)1189 324 MS (o)1196 324 MS (c)1208 324 MS (k)1219 324 MS (e)1232 324 = MS (d)1243 324 MS (S)1418 286 MS (T)1432 286 MS (A)1447 286 MS (R)1465 286 MS (T)1482 286 = MS (\))1497 286 MS ( )1413 286 MS (\()1393 286 MS (i)1401 286 MS (,)1408 286 MS ( )1388 286 MS (S)1338 286 MS (e)1352 286 MS (n)1363 286 MS (d)1376 286 MS ( )1333 286 MS ( )1305 286 MS (l)1239 286 MS (o)1246 286 MS (c)1259 286 MS (k)1270 286 MS (e)1282 286 = MS (d)1293 286 MS ( )1234 286 MS ( )1216 286 MS (i)1210 286 MS ( )1205 286 MS ({)1375 249 MS (c)1387 249 MS (u)1398 249 MS (r)1410 249 MS (r)1419 249 = MS (e)1427 249 MS (n)1438 249 MS (t)1450 249 MS (})1457 249 MS ( )1371 249 MS ( )1348 249 MS (l)1282 249 MS (o)1289 249 MS (c)1302 249 MS (k)1313 249 MS (e)1325 249 = MS (d)1336 249 MS ( )1277 249 MS (:)1258 249 MS ( )1254 249 MS (l)1189 249 MS (o)1196 249 MS (c)1208 249 MS (k)1219 249 MS (e)1232 249 = MS (d)1243 249 MS (O)1398 213 MS (K)1416 213 MS ( )1392 213 MS (])1386 213 MS ( )1360 213 MS ( )1341 213 MS (a)1285 213 MS (i)1296 213 MS (t)1303 213 MS (i)1310 213 MS (n)1317 213 = MS (g)1329 213 MS ([)1258 213 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1332 361 MS (\306)1276 361 MS (=3D)1264 361 MS (\306)1418 324 MS (=3D)1398 324 MS (\306)1284 324 MS (=3D)1266 324 MS (\256)1310 286 MS (\316)1219 286 MS (")1188 286 MS (\310)1353 249 MS (=3D)1264 249 MS gs n 21 30 1365 189 CB (\306)1365 213 MS gr gs n 14 30 1347 189 CB (=3D)1347 213 MS gr NTPSOct95 /FontSV save put %%BeginFont: Times_New_Roman_Cursiva025 10 dict dup begin /FontType 3 def /FontMatrix [1 25 div 0 0 1 25 div 0 0] def /FontBBox [-5 -23 25 16] def /Encoding 256 array def 0 1 255 {Encoding exch /.notdef put} for /BuildGlyph {0 begin exch /CD get exch get /CI exch def CI 0 get 0 CI 1 4 getinterval aload pop setcachedevice CI 5 get CI 6 get true [1 0 0 -1 0 0] dup 4 CI 7 get put dup 5 CI 8 get put CI 9 get imagemask end}def /BuildGlyph load 0 5 dict put /BuildChar {1 index /Encoding get exch get 1 index /BuildGlyph get exec} bind def /CD 256 dict def CD /.notdef[.24 0 0 0 0 1 1 0 0 {<>}]put Encoding 90 /c90 put CD /c90 [16 0 11 16 0 16 11 0 11 <~0I-'s0OZs#).FLp)Ish$(iU=3D"&3p~>]put end /Times_New_Roman_Cursiva025 exch definefont pop %%EndFont [25 0 0 -25 0 0]/Times_New_Roman_Cursiva025 MF (Z)1268 213 MS n 1116 425 M 1538 425 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (|)1232 638 MS (|)1200 638 MS (n)1162 638 MS ( )1175 638 MS (:)1136 638 MS (n)1117 638 MS ( )1278 601 MS (\\)1284 601 MS ( )1291 601 MS (l)1213 601 MS (o)1220 601 MS (c)1232 601 MS (k)1243 601 MS (e)1256 601 = MS (d)1266 601 MS ( )1207 601 MS (:)1188 601 MS (l)1117 601 MS (o)1124 601 MS (c)1137 601 MS (k)1148 601 MS (e)1160 601 = MS (d)1171 601 MS (\\)1283 564 MS (s)1213 564 MS (h)1222 564 MS (a)1235 564 MS (r)1246 564 MS (e)1254 564 = MS (d)1265 564 MS (:)1187 564 MS (s)1117 564 MS (h)1126 564 MS (a)1139 564 MS (r)1150 564 MS (e)1158 564 = MS (d)1169 564 MS (A)1259 526 MS (C)1277 526 MS (K)1294 526 MS (R)1312 526 MS (E)1329 526 = MS (F)1344 526 MS (\))1358 526 MS ( )1254 526 MS (\()1171 526 MS (S)1180 526 MS (e)1194 526 MS (n)1205 526 MS (d)1217 526 = MS (e)1229 526 MS (r)1240 526 MS (,)1249 526 MS ( )1166 526 MS (S)1116 526 MS (e)1130 526 MS (n)1141 526 MS (d)1154 526 MS (U)1404 489 MS (N)1422 489 MS (L)1440 489 MS (O)1454 489 MS (C)1472 489 = MS (K)1489 489 MS (\))1507 489 MS (\()1379 489 MS (i)1387 489 MS (,)1394 489 MS ( )1374 489 MS (S)1324 489 MS (e)1338 489 MS (n)1349 489 MS (d)1362 489 MS (})1278 489 MS (S)1209 489 MS (e)1223 489 MS (n)1234 489 MS (d)1247 489 MS (e)1259 489 = MS (r)1270 489 MS ({)1199 489 MS (\\)1189 489 MS (i)1134 489 MS (S)1457 451 MS (e)1471 451 MS (n)1482 451 MS (d)1495 451 MS (e)1507 451 = MS (r)1518 451 MS (})1526 451 MS ( )1453 451 MS ({)1365 451 MS (c)1377 451 MS (u)1388 451 MS (r)1401 451 MS (r)1409 451 = MS (e)1417 451 MS (n)1428 451 MS (t)1441 451 MS (,)1448 451 MS (s)1266 451 MS (h)1276 451 MS (a)1288 451 MS (r)1299 451 MS (e)1308 451 = MS (d)1319 451 MS (\))1331 451 MS (\()1164 451 MS (l)1173 451 MS (o)1180 451 MS (c)1192 451 MS (k)1203 451 = MS (e)1215 451 MS (d)1226 451 MS (:)1138 451 MS (R)1280 416 MS (E)1297 416 MS (F)1312 416 MS (U)1326 416 MS (S)1344 416 = MS (E)1358 416 MS [24.984 0 7.723 -24.984 0 0]/Symbol MF (a)1208 638 MS (a)1294 601 MS (a)1293 564 MS (a)1165 489 MS (a)1115 451 MS [24.984 0 0 -24.984 0 0]/Symbol MF (-)1181 638 MS (=3D)1142 638 MS (=3D)1194 601 MS (=3D)1193 564 MS (\256)1294 489 MS (\316)1145 489 MS (")1117 489 MS (\310)1344 451 MS (\307)1243 451 MS (=3D)1144 451 MS n 1500 654 M 1792 654 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (L)1639 792 MS (O)1654 792 MS (C)1672 792 MS (K)1688 792 MS (\))1706 792 = MS (n)1609 792 MS (t)1621 792 MS (,)1628 792 MS (S)1500 792 MS (e)1514 792 MS (n)1525 792 MS (d)1538 792 MS (\()1550 792 = MS (c)1558 792 MS (u)1569 792 MS (r)1582 792 MS (r)1590 792 MS (e)1598 = 792 MS ({)1698 755 MS (c)1710 755 MS (u)1721 755 MS (r)1733 755 MS (r)1742 755 = MS (e)1750 755 MS (n)1761 755 MS (t)1773 755 MS (})1780 755 MS (\\)1688 755 MS (w)1608 755 MS (a)1626 755 MS (i)1637 755 MS (t)1644 755 MS (i)1651 755 = MS (n)1658 755 MS (g)1670 755 MS (:)1582 755 MS (w)1502 755 MS (a)1520 755 MS (i)1531 755 MS (t)1538 755 MS (i)1545 755 = MS (n)1552 755 MS (g)1564 755 MS (\()1692 717 MS (w)1700 717 MS (a)1718 717 MS (i)1729 717 MS (t)1736 717 = MS (i)1743 717 MS (n)1750 717 MS (g)1762 717 MS (\))1775 717 MS (S)1601 717 MS (m)1615 717 MS (a)1635 717 MS (l)1646 717 MS (l)1653 717 = MS (e)1660 717 MS (s)1671 717 MS (t)1680 717 MS ( )1687 717 MS (:)1577 717 MS (c)1501 717 MS (u)1512 717 MS (r)1524 717 MS (r)1533 717 MS (e)1541 717 = MS (n)1552 717 MS (t)1564 717 MS ({)1687 680 MS (c)1699 680 MS (u)1710 680 MS (r)1722 680 MS (r)1730 680 = MS (e)1739 680 MS (n)1750 680 MS (t)1762 680 MS (})1769 680 MS ( )1683 680 MS ( )1660 680 MS (l)1594 680 MS (o)1601 680 MS (c)1614 680 MS (k)1625 680 MS (e)1637 680 = MS (d)1648 680 MS ( )1589 680 MS (:)1570 680 MS ( )1566 680 MS (l)1501 680 MS (o)1508 680 MS (c)1520 680 MS (k)1531 680 MS (e)1544 680 = MS (d)1555 680 MS (O)1696 644 MS (K)1714 644 MS ( )1691 644 MS (])1685 644 MS ( )1658 644 MS ( )1639 644 MS (a)1583 644 MS (i)1594 644 MS (t)1601 644 MS (i)1608 644 MS (n)1615 644 = MS (g)1627 644 MS ([)1557 644 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1587 755 MS (=3D)1582 717 MS (\310)1665 680 MS (=3D)1576 680 MS gs n 21 30 1664 620 CB (\306)1664 644 MS gr gs n 14 30 1645 620 CB (\271)1645 644 MS gr [25 0 0 -25 0 0]/Times_New_Roman_Cursiva025 MF (Z)1566 644 MS 6 sl n 547 341 M 544 333 L 541 325 L 538 317 L 535 309 L 533 303 L 530 296 L 527 290 L 525 284 L 522 279 L 519 274 L 517 270 L 514 266 L 512 262 L 509 259 L 507 256 L 504 254 L 502 252 L 499 251 L 497 250 L 495 249 L 492 249 L 490 249 L 488 249 L 485 250 L 483 252 L 481 254 L 479 256 L 477 259 L 475 262 L 473 265 L 470 269 L 468 273 L 466 278 L 464 283 L 463 289 L 461 295 L 459 301 L 457 308 L 455 315 L 453 323 L CM 0.246 0.246 scale s SM n 447 320 M 449 341 L 460 323 L 447 320 L cp e 1 sl n 478 241 M 517 241 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (O)479 231 MS (K)497 231 MS n 492 172 M 493 166 L 494 160 L 496 155 L 500 150 L 504 146 L 508 142 L 513 139 L 519 138 L 525 137 L 530 137 L 536 138 L 542 139 L 547 142 L 551 146 L 555 150 L 558 155 L 561 160 L 562 166 L 563 172 L 562 178 L 561 183 L 558 189 L 555 194 L 551 198 L 547 202 L 542 204 L 536 206 L 530 207 L 525 207 L 519 206 L 513 204 L 508 202 L 504 198 L 500 194 L 496 189 L 494 183 L 493 178 L 492 172 L cp gs 0.902 g e gr s [33.391 0 0 -33.23 0 0]/Helvetica MF (9)518 182 MS showpage FontSV restore PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Helvetica %%+ Symbol %%+ Times-Roman %%DocumentSuppliedFonts: %%+ Times_New_Roman_Cursiva025 end %%Pages: 1 %%EOF %%EndDocument @endspecial 1081 4134 a Fn(Figure)16 b(2.)25 b Fp(State)h(transition)g (diagram)g(for)g(co)r(ordinators.)648 4426 y Fq(A)42 b(co)r(ordinator)e(ma)n(y)i(b)r(e)h(in)f(t)n(w)n(o)g(di\013eren)n(t)g (states)g(called)g Fj(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)42 b Fq(and)523 4526 y Fj(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(.)26 b(While)g(it)g(is)f(in)h(the)g Fj(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)25 b Fq(state,)g(it)h(accepts)f(o\013ers)g(from)g (par-)523 4625 y(ticipan)n(ts.)35 b(Those)f(o\013ers)g(can)h(b)r(e)g (made)g(b)n(y)g(means)f(of)h Fj(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)39 b Fq(messages,)523 4725 y(in)32 b(the)g(case)e(of)i (non{shared)d(participan)n(ts)i(\(transition)g(2\),)g(or)g(b)n(y)g (means)g(of)h Fj(O)r(F)12 b(F)g(E)5 b(R)523 4825 y Fq(messages,)31 b(in)h(the)g(case)g(of)g(shared)f(participan)n(ts)g(\(transition)h (1\).)g(In)g(the)h(former)e(case,)523 4924 y(since)i(non{shared)e (participan)n(ts)i(automatically)f(lo)r(c)n(k)g(themselv)n(es,)h(they)g (are)f(directly)p eop %%Page: 7 7 7 6 bop 523 448 a Fq(stored)36 b(in)h(the)g Fj(l)r(ock)s(ed)f Fq(set.)h(In)g(the)g(latter,)g(the)g(participan)n(t)f(that)h(made)g (the)g(o\013er)f(is)523 548 y(w)n(aiting)26 b(to)g(b)r(e)h(lo)r(c)n(k)n (ed,)f(so)g(the)g(co)r(ordinator)f(stores)g(its)i(iden)n(ti\014er)f(in) h(b)r(oth)g(the)g Fj(w)r(aiting)523 648 y Fq(and)g Fj(shar)r(ed)h Fq(sets.)g(In)g(b)r(oth)g(cases,)e(the)i(o\013er)f(coun)n(ter)g Fj(n)g Fq(is)h(increased.)648 763 y(The)23 b Fj(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)24 b Fq(state)f(is)h(a)f(bit)h(more)f (complex)g(than)h(it)g(migh)n(t)g(seem,)f(b)r(ecause)523 862 y(while)g(a)f(co)r(ordinator)f(is)h(still)h(w)n(aiting)f(for)h (o\013ers,)f(it)h(ma)n(y)f(receiv)n(e)f(a)h Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)27 b Fq(message)523 962 y(from)g(a)f(participan)n(t) h(that)g(w)n(an)n(ts)f(to)h(cancel)g(its)g(o\013er)g(b)r(ecause)g (another)f(co)r(ordinator)f(in)523 1061 y(whic)n(h)c(it)h(w)n(as)e(in)n (terested)h(has)g(reacted)f(more)h(quic)n(kly)-7 b(.)20 b(Since)i(this)f(participan)n(t)g(is)g(shared,)523 1161 y(the)g(co)r(ordinator)d(needs)i(to)g(remo)n(v)n(e)f(it)h(from)g(the)h Fj(shar)r(ed)g Fq(set)f(and)g(also)f(from)h(the)h Fj(w)r(aiting)523 1261 y Fq(set)32 b(b)r(ecause)g(no)f Fj(LO)r(C)6 b(K)38 b Fq(message)31 b(has)g(b)r(een)h(sen)n(t)g(to)g(it.)g(An)h Fj(AC)6 b(K)g(R)q(E)f(F)44 b Fq(message)30 b(is)523 1360 y(sen)n(t)20 b(to)h(ac)n(kno)n(wledge)d(the)j Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)25 b Fq(message,)19 b(and)h(the)h(o\013er)f(coun)n (ter)f Fj(n)i Fq(is)f(decreased.)648 1475 y(When)g Fj(n)g Fq(equals)f(the)h(cardinalit)n(y)f(of)h(the)g(in)n(teraction)f(a)h(co)r (ordinator)e(manages)g(in)j(the)523 1575 y Fj(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)31 b Fq(state,)g(it)h(gets)e(enabled)h(and)g(there)g (are)f(t)n(w)n(o)g(p)r(ossible)h(con)n(tin)n(uations)523 1675 y(dep)r(ending)39 b(on)g(the)g(existence)f(of)h(shared)f (participan)n(ts.)g(If)h(the)g(co)r(ordinator)e(has)h(no)523 1774 y(shared)26 b(participan)n(ts)g(\(transition)h(4\),)g(it)h(has)e (not)h(to)g(comp)r(ete)h(for)e(an)n(y)g(of)h(them.)h(Th)n(us,)523 1874 y(it)g(can)e(send)i(immediately)f(a)g Fj(S)5 b(T)12 b(AR)q(T)37 b Fq(message)26 b(to)h(eac)n(h)f(of)h(its)g(participan)n (ts)g(to)g(notify)523 1974 y(them)e(that)g(they)g(can)f(start)g(the)h (in)n(teraction)f(it)h(manages.)e(Otherwise)h(\(transition)g(5\),)h(it) 523 2073 y(needs)j(to)f(carefully)g(lo)r(c)n(k)g(shared)f(participan)n (ts.)648 2188 y(The)33 b(solution)g(w)n(e)g(ha)n(v)n(e)f(adopted)h (consists)g(of)g(establishing)g(a)g(partial{order)d(rela-)523 2288 y(tionship)23 b(amongst)f(shared)g(resources)f(so)h(that)h(they)g (ha)n(v)n(e)f(to)h(b)r(e)g(acquired)f(in)h(increasing)523 2387 y(order.)31 b(\(According)h(to)g(their)g(net)h(address)e(or)g (GUID,)i(for)f(instance.\))g(Th)n(us,)g(for)g(a)g(co-)523 2487 y(ordinator)e(to)h(lo)r(c)n(k)f(a)h(participan)n(t)g Fj(P)12 b Fq(,)31 b(it)h(m)n(ust)f(ha)n(v)n(e)g(lo)r(c)n(k)n(ed)f (previously)g(ev)n(ery)g(shared)523 2587 y(participan)n(t)c Fj(Q)h Fq(suc)n(h)f(that)h Fj(Q)c(<)g(P)12 b Fq(.)26 b(If)i(it)f(cannot)f(lo)r(c)n(k)g(it,)i(i.e.,)f(it)g(receiv)n(es)e(a)i Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)523 2686 y Fq(message)23 b(from)h(it,)h(it)f(m)n(ust)h(unlo)r(c)n(k)f(ev)n(ery)f(preceding)g (participan)n(t.)h(This)g(algorithm)f(w)n(as)523 2786 y(pro)n(v)n(en)k(not)i(to)g(pro)r(duce)g(an)n(y)f(deadlo)r(c)n(ks,)g (and)g(it)i(is)f(quite)g(e\013ectiv)n(e)g([CES71)n(].)g(In)h(b)r(oth) 523 2886 y(cases,)h(the)i(answ)n(er)e(ma)n(y)g(b)r(e)i(dela)n(y)n(ed)e (for)h(some)f(time)i(if)g(the)f(participan)n(t)g(is)g(curren)n(tly)523 2985 y(lo)r(c)n(k)n(ed)27 b(b)n(y)g(another)g(co)r(ordinator.)648 3100 y(Therefore,)37 b(the)i(smallest)f(participan)n(t)g(in)h(the)g Fj(w)r(aiting)i Fq(set)e(is)f(remo)n(v)n(ed)f(from)i(it)523 3200 y(and)25 b(sen)n(t)f(a)g Fj(LO)r(C)6 b(K)31 b Fq(message)23 b(during)h(transition)g(5.)h(This)f(participan)n(t)g(ma)n(y)g(reply)g (with)523 3300 y(an)35 b Fj(O)r(K)41 b Fq(message,)33 b(indicating)i(that)g(it)h(has)e(b)r(een)i(lo)r(c)n(k)n(ed,)e(or)g(a)g Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)39 b Fq(message,)523 3399 y(indicating)27 b(that)h(it)g(is)g(no)f(longer)f(in)n(terested)i(in)g (the)g(in)n(teraction)e(it)i(manages.)648 3514 y(Pro)r(cessing)h(an)j Fj(O)r(K)38 b Fq(message)30 b(dep)r(ends)i(on)g(the)g(n)n(um)n(b)r(er)f (of)h(participan)n(ts)f(w)n(aiting)523 3614 y(to)41 b(b)r(e)g(lo)r(c)n (k)n(ed.)e(If)i(there)g(is)f(a)h(participan)n(t)e(in)i(the)g Fj(w)r(aiting)i Fq(set)e(\(transition)f(6\),)h(the)523 3713 y(participan)n(t)31 b(that)i(has)e(sen)n(t)h(the)g Fj(O)r(K)38 b Fq(message)31 b(is)h(stored)f(in)h(the)g Fj(l)r(ock)s(ed)g Fq(set,)g(and)g(the)523 3813 y(next)e(w)n(aiting)e (participan)n(t)h(in)g(the)h Fj(w)r(aiting)i Fq(set)d(is)g(selected)g (to)h(b)r(e)f(lo)r(c)n(k)n(ed.)g(Otherwise,)523 3913 y(ev)n(ery)24 b(shared)h(participan)n(t)f(has)h(b)r(een)h(lo)r(c)n(k)n (ed.)f(Th)n(us,)g(the)h(in)n(teraction)e(can)h(b)r(e)h(executed)523 4012 y(and)h(a)h Fj(S)5 b(T)12 b(AR)q(T)37 b Fq(message)26 b(is)i(sen)n(t)f(to)h(ev)n(ery)e(participan)n(t)h(\(transition)g(7\).) 648 4127 y(Pro)r(cessing)38 b(a)h Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)45 b Fq(message)38 b(is)i(quite)h(di\013eren)n(t)f(\(transition)f(8\),)h (b)r(ecause)523 4227 y(this)35 b(means)f(that)i(one)e(of)h(the)g (shared)f(participan)n(ts)g(that)h(ha)n(v)n(e)e(not)i(b)r(een)g(lo)r(c) n(k)n(ed)f(y)n(et)523 4327 y(cancels)24 b(its)i(o\013er.)e(This)h(is)g (a)g(similar)f(situation)h(to)g(that)h(of)f(transition)f(3,)h(except)g (for)g(the)523 4426 y(fact)j(that)h(some)e(participan)n(ts)g(ma)n(y)h (ha)n(v)n(e)f(already)f(b)r(een)j(lo)r(c)n(k)n(ed.)e(Th)n(us,)h(all)g (the)g(shared)523 4526 y(participan)n(ts)37 b(that)g(are)g(already)f (lo)r(c)n(k)n(ed)h(ha)n(v)n(e)f(to)i(b)r(e)g(unlo)r(c)n(k)n(ed)e(in)i (order)e(to)i(prev)n(en)n(t)523 4625 y(deadlo)r(c)n(ks.)31 b(The)g(co)r(ordinator)f(then)i(sends)f(an)h Fj(U)9 b(N)g(LO)r(C)d(K)37 b Fq(message)30 b(to)i(ev)n(ery)e(lo)r(c)n(k)n(ed)523 4725 y(participan)n(t,)c(to)g(the)g(participan)n(t)g(curren)n(tly)f(b)r (eing)h(lo)r(c)n(k)n(ed,)g(and)g(an)g Fj(AC)6 b(K)g(R)q(E)f(F)38 b Fq(to)26 b(the)523 4825 y(participan)n(t)20 b(that)h(sen)n(t)g(the)g Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)25 b Fq(message)20 b(b)r(efore)h(reac)n (hing)e(the)i Fj(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)523 4924 y Fq(state)27 b(again.)p eop %%Page: 8 8 8 7 bop 523 448 a Fg(3.3)95 b(P)m(erformance)523 623 y Fj(\013)p Fq({core)21 b(w)n(as)f(implemen)n(ted)i(in)g(the)g(lab)r (oratory)e(using)h(Ja)n(v)-5 b(a)20 b(1.2)h(and)h(Orbacus)e(3.3.2,)g (and)523 722 y(w)n(e)27 b(prepared)f(a)g(set)h(of)g(syn)n(thetic)g (programmes)e(that)j(w)n(ere)e(run)h(on)f(200)g(MHz)h(P)n(en)n(tium)523 822 y(isolated)g(net)n(w)n(ork)f(to)i(test)f(ho)n(w)g(it)h(p)r (erforms.)648 923 y(T)-7 b(ests)28 b(shall)g(b)r(e)h(referred)f(to)h (as)f Fj(T)1737 935 y Fd(1)1773 923 y Fj(;)14 b(T)1859 935 y Fd(2)1896 923 y Fj(;)g(:)g(:)g(:)g(;)g(T)2130 935 y Fc(n)2174 923 y Fq(,)29 b(and)g(eac)n(h)e Fj(T)2625 935 y Fc(k)2695 923 y Fq(consists)h(of)g Fj(k)k Fq(binary)523 1023 y(in)n(teractions,)f(referred)g(to)h(as)f Fj(I)1561 1035 y Fc(i)1621 1023 y Fq(\()p Fj(i)g Fq(=3D)f(1)p Fj(;)14 b Fq(2)p Fj(;)g(:)g(:)g(:)e(;)i(k)s Fq(\),)32 b(and)g Fj(k)24 b Fq(+)d(1)32 b(participan)n(ts,)f(referred)523 1122 y(to)k(as)g Fj(P)795 1134 y Fc(i)858 1122 y Fq(\()p Fj(i)h Fq(=3D)f(1)p Fj(;)14 b Fq(2)p Fj(;)g(:)g(:)g(:)f(;)h(k)26 b Fq(+)d(1\).)36 b Fj(P)1703 1134 y Fd(1)1740 1122 y Fj(;)14 b(P)1830 1134 y Fd(2)1868 1122 y Fj(;)g(:)g(:)g(:)f(;)h(P)2105 1134 y Fc(k)2182 1122 y Fq(o\013er)34 b(participation)h(in)g(in)n (teractions)523 1222 y Fj(I)559 1234 y Fd(1)597 1222 y Fj(;)14 b(I)670 1234 y Fd(2)707 1222 y Fj(;)g(;)g(:)g(:)g(:)g(I)928 1234 y Fc(k)969 1222 y Fq(,)26 b(resp)r(ectiv)n(ely)-7 b(,)26 b(and)g Fj(P)1699 1234 y Fc(k)q Fd(+1)1850 1222 y Fq(o\013ers)f(participation)g(in)i(an)n(y)e(in)n(teraction,)g(th)n (us)523 1322 y(making)32 b(them)h(con\015icting.)f(Eac)n(h)f(test)i(w)n (as)e(run)i(for)f(a)g(duration)f(needed)i(to)f(sc)n(hedule)523 1421 y(eac)n(h)18 b(in)n(teraction)f(100)g(times,)i(and)g(w)n(e)f (measured)f(the)i(follo)n(wing)f(metrics:)g(\(i\))h(the)g(a)n(v)n (erage)523 1521 y(selection)28 b(time,)h(i.e,)f(the)h(time)g(elapsed)e (from)h(the)h(instan)n(t)f(a)g(co)r(ordinator)e(detects)j(that)523 1620 y(it)23 b(is)g(enabled)g(un)n(til)h(the)f(instan)n(t)g(it)g(kno)n (ws)f(it)i(is)e(a)h(winner,)g(\(ii\))h(the)f(n)n(um)n(b)r(er)g(of)g (messages)523 1720 y(exc)n(hanged)j(during)h(the)h(exp)r(erimen)n(ts,)g (and)f(\(iii\))i(the)f(elapsed)f(time)h(to)f(run)h(eac)n(h)e(test.)667 2970 y @beginspecial 56.689999 @llx 56.689999 @lly 422.049988 @urx 202.759995 @ury 3112 @rwi @setspecial %%BeginDocument: exper.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip054.wmf %%Creator: Windows NT 4.0 %%CreationDate: 15:53 12/4/2000 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 422.05 202.76 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 202.957 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate n 1501 590 166 9 B 1 g f 1 sl 0 g n 1503 592 165 8 B cp s n 551 46 M 1653 46 L 1653 415 L 551 415 L 551 46 L cp 0.754 g e 0 g gs n 1102 1 551 355 CB n 551 355 M 1653 355 L s gr gs n 1102 1 551 292 CB n 551 292 M 1653 292 L s gr gs n 1102 1 551 231 CB n 551 231 M 1653 231 L s gr gs n 1102 1 551 169 CB n 551 169 M 1653 169 L s gr gs n 1102 1 551 108 CB n 551 108 M 1653 108 L s gr gs n 1102 1 551 46 CB n 551 46 M 1653 46 L s gr gs n 1 369 661 46 CB n 661 46 M 661 415 L s gr gs n 1 369 770 46 CB n 770 46 M 770 415 L s gr gs n 1 369 882 46 CB n 882 46 M 882 415 L s gr gs n 1 369 992 46 CB n 992 46 M 992 415 L s gr gs n 1 369 1102 46 CB n 1102 46 M 1102 415 L s gr gs n 1 369 1212 46 CB n 1212 46 M 1212 415 L s gr gs n 1 369 1321 46 CB n 1321 46 M 1321 415 L s gr gs n 1 369 1433 46 CB n 1433 46 M 1433 415 L s gr gs n 1 369 1543 46 CB n 1543 46 M 1543 415 L s gr gs n 1 369 1653 46 CB n 1653 46 M 1653 415 L s gr 1 j 1 setlinecap 0.5 g n 551 46 M 1653 46 L CM 1.637 1.641 scale s SM n 1653 46 M 1653 415 L CM 1.637 1.641 scale s SM n 1653 415 M 551 415 L CM 1.637 1.641 scale s SM n 551 415 M 551 46 L CM 1.637 1.641 scale s SM 0 g n 551 46 M 551 415 L s n 542 415 M 551 415 L s n 542 355 M 551 355 L s n 542 292 M 551 292 L s n 542 231 M 551 231 L s n 542 169 M 551 169 L s n 542 108 M 551 108 L s n 542 46 M 551 46 L s n 551 415 M 1653 415 L s 3 sl 0.105 g n 606 415 M 716 172 L CM 1.637 1.641 scale s SM n 716 172 M 826 166 L CM 1.637 1.641 scale s SM n 826 166 M 936 163 L CM 1.637 1.641 scale s SM n 936 163 M 1046 158 L CM 1.637 1.641 scale s SM n 1046 158 M 1157 151 L CM 1.637 1.641 scale s SM n 1157 151 M 1267 141 L CM 1.637 1.641 scale s SM n 1267 141 M 1377 133 L CM 1.637 1.641 scale s SM n 1377 133 M 1487 126 L CM 1.637 1.641 scale s SM n 1487 126 M 1597 120 L CM 1.637 1.641 scale s SM 0.289 g n 606 404 M 716 387 L CM 1.637 1.641 scale s SM n 716 387 M 826 371 L CM 1.637 1.641 scale s SM n 826 371 M 936 361 L CM 1.637 1.641 scale s SM n 936 361 M 1046 346 L CM 1.637 1.641 scale s SM n 1046 346 M 1157 333 L CM 1.637 1.641 scale s SM n 1157 333 M 1267 325 L CM 1.637 1.641 scale s SM n 1267 325 M 1377 309 L CM 1.637 1.641 scale s SM n 1377 309 M 1487 296 L CM 1.637 1.641 scale s SM n 1487 296 M 1597 286 L CM 1.637 1.641 scale s SM 0.355 g n 606 383 M 716 348 L CM 1.637 1.641 scale s SM n 716 348 M 826 317 L CM 1.637 1.641 scale s SM n 826 317 M 936 282 L CM 1.637 1.641 scale s SM n 936 282 M 1046 253 L CM 1.637 1.641 scale s SM n 1046 253 M 1157 215 L CM 1.637 1.641 scale s SM n 1157 215 M 1267 184 L CM 1.637 1.641 scale s SM n 1267 184 M 1377 151 L CM 1.637 1.641 scale s SM n 1377 151 M 1487 113 L CM 1.637 1.641 scale s SM n 1487 113 M 1597 80 L CM 1.637 1.641 scale s SM n 21 21 597 405 B 0.105 g f 1 sl n 606 415 M 598 407 L CM 1.637 1.641 scale s SM n 606 415 M 615 424 L CM 1.637 1.641 scale s SM n 606 415 M 598 424 L CM 1.637 1.641 scale s SM n 606 415 M 615 407 L CM 1.637 1.641 scale s SM n 606 415 M 606 407 L CM 1.637 1.641 scale s SM n 606 415 M 606 424 L CM 1.637 1.641 scale s SM n 21 21 706 163 B f n 716 172 M 708 164 L CM 1.637 1.641 scale s SM n 716 172 M 725 181 L CM 1.637 1.641 scale s SM n 716 172 M 708 181 L CM 1.637 1.641 scale s SM n 716 172 M 725 164 L CM 1.637 1.641 scale s SM n 716 172 M 716 164 L CM 1.637 1.641 scale s SM n 716 172 M 716 181 L CM 1.637 1.641 scale s SM n 21 21 816 156 B f n 826 166 M 818 158 L CM 1.637 1.641 scale s SM n 826 166 M 834 174 L CM 1.637 1.641 scale s SM n 826 166 M 818 174 L CM 1.637 1.641 scale s SM n 826 166 M 834 158 L CM 1.637 1.641 scale s SM n 826 166 M 826 158 L CM 1.637 1.641 scale s SM n 826 166 M 826 174 L CM 1.637 1.641 scale s SM n 21 21 926 153 B f n 936 163 M 928 154 L CM 1.637 1.641 scale s SM n 936 163 M 944 171 L CM 1.637 1.641 scale s SM n 936 163 M 928 171 L CM 1.637 1.641 scale s SM n 936 163 M 944 154 L CM 1.637 1.641 scale s SM n 936 163 M 936 154 L CM 1.637 1.641 scale s SM n 936 163 M 936 171 L CM 1.637 1.641 scale s SM n 21 21 1036 148 B f n 1046 158 M 1038 149 L CM 1.637 1.641 scale s SM n 1046 158 M 1054 166 L CM 1.637 1.641 scale s SM n 1046 158 M 1038 166 L CM 1.637 1.641 scale s SM n 1046 158 M 1054 149 L CM 1.637 1.641 scale s SM n 1046 158 M 1046 149 L CM 1.637 1.641 scale s SM n 1046 158 M 1046 166 L CM 1.637 1.641 scale s SM n 21 21 1148 141 B f n 1157 151 M 1149 143 L CM 1.637 1.641 scale s SM n 1157 151 M 1166 159 L CM 1.637 1.641 scale s SM n 1157 151 M 1149 159 L CM 1.637 1.641 scale s SM n 1157 151 M 1166 143 L CM 1.637 1.641 scale s SM n 1157 151 M 1157 143 L CM 1.637 1.641 scale s SM n 1157 151 M 1157 159 L CM 1.637 1.641 scale s SM n 20 21 1258 131 B f n 1267 141 M 1259 133 L CM 1.637 1.641 scale s SM n 1267 141 M 1276 149 L CM 1.637 1.641 scale s SM n 1267 141 M 1259 149 L CM 1.637 1.641 scale s SM n 1267 141 M 1276 133 L CM 1.637 1.641 scale s SM n 1267 141 M 1267 133 L CM 1.637 1.641 scale s SM n 1267 141 M 1267 149 L CM 1.637 1.641 scale s SM n 21 21 1367 123 B f n 1377 133 M 1369 125 L CM 1.637 1.641 scale s SM n 1377 133 M 1385 141 L CM 1.637 1.641 scale s SM n 1377 133 M 1369 141 L CM 1.637 1.641 scale s SM n 1377 133 M 1385 125 L CM 1.637 1.641 scale s SM n 1377 133 M 1377 125 L CM 1.637 1.641 scale s SM n 1377 133 M 1377 141 L CM 1.637 1.641 scale s SM n 21 21 1477 117 B f n 1487 126 M 1479 118 L CM 1.637 1.641 scale s SM n 1487 126 M 1495 135 L CM 1.637 1.641 scale s SM n 1487 126 M 1479 135 L CM 1.637 1.641 scale s SM n 1487 126 M 1495 118 L CM 1.637 1.641 scale s SM n 1487 126 M 1487 118 L CM 1.637 1.641 scale s SM n 1487 126 M 1487 135 L CM 1.637 1.641 scale s SM n 21 21 1587 110 B f n 1597 120 M 1589 112 L CM 1.637 1.641 scale s SM n 1597 120 M 1605 128 L CM 1.637 1.641 scale s SM n 1597 120 M 1589 128 L CM 1.637 1.641 scale s SM n 1597 120 M 1605 112 L CM 1.637 1.641 scale s SM n 1597 120 M 1597 112 L CM 1.637 1.641 scale s SM n 1597 120 M 1597 128 L CM 1.637 1.641 scale s SM 0.289 g n 606 392 M 618 415 L 595 415 L 606 392 L cp gs e gr CM 1.637 1.641 scale s SM n 716 376 M 728 399 L 705 399 L 716 376 L cp gs e gr CM 1.637 1.641 scale s SM n 826 360 M 838 383 L 815 383 L 826 360 L cp gs e gr CM 1.637 1.641 scale s SM n 936 350 M 948 373 L 925 373 L 936 350 L cp gs e gr CM 1.637 1.641 scale s SM n 1046 335 M 1057 358 L 1034 358 L 1046 335 L cp gs e gr CM 1.637 1.641 scale s SM n 1157 322 M 1169 345 L 1146 345 L 1157 322 L cp gs e gr CM 1.637 1.641 scale s SM n 1267 314 M 1279 337 L 1256 337 L 1267 314 L cp gs e gr CM 1.637 1.641 scale s SM n 1377 297 M 1389 320 L 1366 320 L 1377 297 L cp gs e gr CM 1.637 1.641 scale s SM n 1487 284 M 1499 307 L 1476 307 L 1487 284 L cp gs e gr CM 1.637 1.641 scale s SM n 1597 274 M 1609 297 L 1586 297 L 1597 274 L cp gs e gr CM 1.637 1.641 scale s SM 0.355 g n 606 371 M 618 383 L 606 394 L 595 383 L 606 371 L cp gs e gr CM 1.637 1.641 scale s SM n 716 337 M 728 348 L 716 360 L 705 348 L 716 337 L cp gs e gr CM 1.637 1.641 scale s SM n 826 305 M 838 317 L 826 328 L 815 317 L 826 305 L cp gs e gr CM 1.637 1.641 scale s SM n 936 271 M 948 282 L 936 294 L 925 282 L 936 271 L cp gs e gr CM 1.637 1.641 scale s SM n 1046 241 M 1057 253 L 1046 264 L 1034 253 L 1046 241 L cp gs e gr CM 1.637 1.641 scale s SM n 1157 204 M 1169 215 L 1157 227 L 1146 215 L 1157 204 L cp gs e gr CM 1.637 1.641 scale s SM n 1267 172 M 1279 184 L 1267 195 L 1256 184 L 1267 172 L cp gs e gr CM 1.637 1.641 scale s SM n 1377 140 M 1389 151 L 1377 163 L 1366 151 L 1377 140 L cp gs e gr CM 1.637 1.641 scale s SM n 1487 102 M 1499 113 L 1487 125 L 1476 113 L 1487 102 L cp gs e gr CM 1.637 1.641 scale s SM n 1597 69 M 1609 80 L 1597 92 L 1586 80 L 1597 69 L cp gs e gr CM 1.637 1.641 scale s SM %%IncludeFont: Helvetica [26.262 0 0 -26.262 0 0]/Helvetica MF 0 g (0)515 426 MS (2)515 365 MS (4)515 302 MS (6)515 242 MS (8)515 179 MS (1)500 119 MS (0)515 119 MS (1)500 56 MS (2)515 56 MS n 183 458 M 1653 458 L s n 183 581 M 1653 581 L s n 551 415 M 1653 415 L s n 183 458 M 183 581 L s n 551 415 M 551 581 L s n 661 415 M 661 581 L s n 770 415 M 770 581 L s n 882 415 M 882 581 L s n 992 415 M 992 581 L s n 1102 415 M 1102 581 L s n 1212 415 M 1212 581 L s n 1321 415 M 1321 581 L s n 1433 415 M 1433 581 L s n 1543 415 M 1543 581 L s n 1653 415 M 1653 581 L s 3 sl 0.105 g n 191 483 M 241 483 L CM 1.637 1.641 scale s SM n 21 21 206 473 B f 1 sl n 216 483 M 208 474 L CM 1.637 1.641 scale s SM n 216 483 M 224 491 L CM 1.637 1.641 scale s SM n 216 483 M 208 491 L CM 1.637 1.641 scale s SM n 216 483 M 224 474 L CM 1.637 1.641 scale s SM n 216 483 M 216 474 L CM 1.637 1.641 scale s SM n 216 483 M 216 491 L CM 1.637 1.641 scale s SM 0 g (A)247 493 MS (v)265 493 MS (r)277 493 MS (.)285 493 MS ( )292 493 MS = (S)298 493 MS (e)316 493 MS (l)331 493 MS (e)336 493 MS (c)351 493 MS = (t)364 493 MS (i)370 493 MS (o)377 493 MS (n)392 493 MS ( )405 493 MS = (T)411 493 MS (i)426 493 MS (m)433 493 MS (e)454 493 MS ( )469 493 MS (\()475 493 MS = (m)483 493 MS (s)505 493 MS (\))518 493 MS (0)598 491 MS (7)698 491 MS (,)713 491 MS (9)720 491 MS (8)808 491 MS (,)823 491 MS (1)829 491 MS (8)920 491 MS (,)934 491 MS (2)941 491 MS (8)1030 491 MS (,)1044 491 MS (4)1051 491 MS (8)1139 491 MS (,)1154 491 MS (6)1161 491 MS (8)1249 491 MS (,)1264 491 MS (9)1271 491 MS (9)1359 491 MS (,)1374 491 MS (2)1381 491 MS (9)1471 491 MS (,)1485 491 MS (4)1492 491 MS (9)1581 491 MS (,)1595 491 MS (6)1602 491 MS gs n 1466 1 185 501 CB n 183 501 M 1653 501 L s gr 3 sl 0.289 g n 191 524 M 241 524 L CM 1.637 1.641 scale s SM 1 sl n 216 515 M 224 532 L 208 532 L 216 515 L cp gs e gr CM 1.637 1.641 scale s SM 0 g (N)247 534 MS (o)265 534 MS (.)280 534 MS ( )287 534 MS (O)293 534 MS = (f)313 534 MS ( )319 534 MS (M)326 534 MS (e)347 534 MS (s)362 534 MS = (s)375 534 MS (a)388 534 MS (g)403 534 MS (e)418 534 MS (s)433 534 MS ( = )446 534 MS (\()452 534 MS (x)460 534 MS (1)472 534 MS (0)487 534 MS (0)501 534 MS = (0)516 534 MS (\))531 534 MS (0)588 532 MS (,)603 532 MS (4)610 532 MS (0)690 532 MS (,)705 532 MS (9)711 532 MS (2)726 532 MS (1)800 532 MS (,)815 532 MS (4)821 532 MS (4)836 532 MS (1)911 532 MS (,)926 532 MS (7)933 532 MS (6)948 532 MS (2)1015 532 MS (,)1030 532 MS (2)1036 532 MS (4)1051 532 MS (8)1066 532 = MS (2)1131 532 MS (,)1146 532 MS (6)1153 532 MS (8)1167 532 MS (2)1235 532 MS (,)1249 532 MS (9)1256 532 MS (2)1271 532 MS (4)1285 532 = MS (3)1351 532 MS (,)1366 532 MS (4)1372 532 MS (6)1387 532 MS (3)1463 532 MS (,)1477 532 MS (9)1484 532 MS (2)1499 532 MS (4)1572 532 MS (,)1587 532 MS (2)1594 532 MS (2)1608 532 MS gs n 1466 1 185 542 CB n 183 542 M 1653 542 L s gr 3 sl 0.355 g n 191 565 M 241 565 L CM 1.637 1.641 scale s SM 1 sl n 216 557 M 224 565 L 216 573 L 208 565 L 216 557 L cp gs e gr CM 1.637 1.641 scale s SM gs n 196 29 247 550 CB 0 g (E)247 575 MS (l)265 575 MS (a)270 575 MS (p)285 575 MS (s)300 575 MS = (e)313 575 MS (d)328 575 MS ( )342 575 MS (T)349 575 MS (i)364 575 MS = (m)370 575 MS (e)392 575 MS ( )406 575 MS (\()413 575 MS (s)421 575 MS = (\))434 575 MS gr 0 g (1)580 573 MS (,)595 573 MS (0)601 573 MS (5)616 573 MS (2)698 573 MS (,)713 573 MS (2)720 573 MS (3)808 573 MS (,)823 573 MS (2)829 573 MS (4)920 573 MS (,)934 573 MS (3)941 573 MS (5)1030 573 MS (,)1044 573 MS (3)1051 573 MS (6)1139 573 MS (,)1154 573 MS (5)1161 573 MS (7)1249 573 MS (,)1264 573 MS (5)1271 573 MS (8)1359 573 MS (,)1374 573 MS (6)1381 573 MS (9)1471 573 MS (,)1485 573 MS (8)1492 573 MS (1)1572 573 MS (0)1587 573 MS (,)1602 573 MS (9)1608 573 MS (T)590 447 MS (1)605 447 MS (T)700 447 MS (2)715 447 MS (T)810 447 MS (3)825 447 MS (T)921 447 MS (4)936 447 MS (T)1031 447 MS (5)1046 447 MS (T)1141 447 MS (6)1156 447 MS (T)1251 447 MS (7)1266 447 MS (T)1361 447 MS (8)1376 447 MS (T)1472 447 MS (9)1487 447 MS (T)1576 447 MS (1)1590 447 MS (0)1605 447 MS n 1503 592 165 8 B cp s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Helvetica %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 1426 3144 a Fn(Figure)15 b(3.)25 b Fp(Exp)r(erimen)n(tal)g (results.)648 3430 y Fq(Figure)31 b(3)h(sho)n(ws)f(the)h(results)g(of)g (our)f(tests.)h(Theoretically)-7 b(,)31 b(the)h(a)n(v)n(erage)d (selection)523 3530 y(time)e(is)g(indep)r(enden)n(t)h(from)e(the)i(n)n (um)n(b)r(er)e(of)h(con\015icting)g(in)n(teractions)e(in)i(our)g (scenario,)523 3629 y(b)r(ecause)34 b(when)h(co)r(ordinator)d Fj(I)1549 3641 y Fc(i)1612 3629 y Fq(b)r(ecomes)i(enabled)g(in)h(test)g Fj(T)2582 3641 y Fc(k)2657 3629 y Fq(\(participan)n(ts)f Fj(P)3209 3641 y Fc(i)3271 3629 y Fq(and)523 3729 y Fj(P)576 3741 y Fc(k)q Fd(+1)732 3729 y Fq(ha)n(v)n(e)29 b(o\013ered)h (participation)g(in)h Fj(I)1832 3741 y Fc(i)1860 3729 y Fq(\),)g(it)g(sends)f(a)g Fj(LO)r(C)6 b(K)37 b Fq(message)29 b(to)h(its)h(shared)523 3828 y(participan)n(t)37 b Fj(P)1013 3840 y Fc(k)q Fd(+1)1139 3828 y Fq(.)h(The)g(\014rst)g Fj(LO)r(C)6 b(K)44 b Fq(message)37 b(receiv)n(ed)g(b)n(y)h Fj(P)2703 3840 y Fc(k)q Fd(+1)2866 3828 y Fq(is)h(replied)e(with)523 3928 y(an)e Fj(O)r(K)41 b Fq(message,)33 b(so)h(the)h(p)r(erio)r(d)g (of)g(time)g(since)g Fj(I)2242 3940 y Fc(i)2305 3928 y Fq(detects)g(it)g(is)g(enabled)f(un)n(til)i(the)523 4028 y(instan)n(t)f(it)g(kno)n(ws)f(it)h(is)g(the)g(winner)g(should)f (b)r(e)i(ab)r(out)e(2)p Fj(\034)9 b Fq(,)35 b(b)r(eing)g Fj(\034)45 b Fq(the)35 b(time)h(tak)n(en)523 4127 y(to)28 b(transmit)g(a)g(message.)f(In)h(our)f(system,)h Fj(\034)34 b Fl(')24 b Fq(2)14 b Fj(ms)p Fq(.)27 b(If)i(the)f Fj(LO)r(C)6 b(K)35 b Fq(message)26 b(sen)n(t)i(b)n(y)523 4227 y(co)r(ordinator)h Fj(I)1008 4239 y Fc(i)1068 4227 y Fq(is)i(not)h(the)f(\014rst)h(one)f (receiv)n(ed)f(b)n(y)h Fj(P)2279 4239 y Fc(i)p Fd(+1)2391 4227 y Fq(,)h(this)f(co)r(ordinator)f(will)h(get)g(a)523 4327 y Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)30 b Fq(message)23 b(from)i Fj(P)1494 4339 y Fc(k)q Fd(+1)1645 4327 y Fq(as)g(a)f(reply)-7 b(,)25 b(so)r(oner)f(or)h(later.)f(Since)i(ev)n(ery)e(time)i Fj(P)3280 4339 y Fc(k)q Fd(+1)523 4426 y Fq(participates)36 b(in)h(one)g(in)n(teraction)e(it)j(m)n(ust)f(refuse)f Fj(k)27 b Fl(\000)e Fq(1)36 b(co)r(ordinators,)f(the)i(a)n(v)n(erage) 523 4526 y(refuse)h(time)g(is)g(more)f(v)-5 b(arian)n(t,)37 b(b)r(ecause)g(the)h(\014rst)g(co)r(ordinator)e(that)i(is)g(refused)g (has)523 4625 y(to)31 b(w)n(ait)g(less)g(time)g(than)h(the)f(co)r (ordinators)e(that)j(are)e(refused)h(after)g(it.)g(The)h(reason)d(is) 523 4725 y(that)d(our)f(implemen)n(tation)h(w)n(as)f(written)h(in)g(Ja) n(v)-5 b(a,)25 b(and)h(the)g(lo)r(op)f(w)n(e)h(use)f(to)h(send)g Fj(k)18 b Fl(\000)c Fq(1)523 4825 y Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)27 b Fq(messages)21 b(tak)n(es)h(a)g(time)h(that)g(is)g (comparable)e(to)h(the)h(time)g(a)g(message)e(tak)n(es)523 4924 y(to)28 b(get)f(to)g(its)h(destination.)p eop %%Page: 9 9 9 8 bop 648 448 a Fq(When)26 b Fj(k)k Fq(co)r(ordinators)24 b(comp)r(ete)i(to)g(lo)r(c)n(k)g(the)g(shared)g(participan)n(t)f Fj(P)2920 460 y Fc(k)q Fd(+1)3046 448 y Fq(,)h(eac)n(h)f(one)523 548 y(has)36 b(a)g(success)f(ratio)g(1)p Fj(=3Dk)s = Fq(.)h(In)g(other)g(w) n(ords,)f(the)i(b)r(ottle)g(nec)n(k)e(of)i(our)e(system)h(is)h(the)523 648 y(shared)18 b(participan)n(t)g Fj(P)1249 660 y Fc(k)q Fd(+1)1374 648 y Fq(.)h(Since)g(the)g(n)n(um)n(b)r(er)g(of)f(in)n (teractions)g(it)h(can)g(run)f(p)r(er)h(time)g(unit)523 747 y(dep)r(ends)29 b(on)g(the)g(underlying)g(computers)f(and)h(it)g (is)g(constan)n(t,)g(it)g(will)g(participate)f(less)523 847 y(times)h(p)r(er)f(unit)h(time)g(in)f(eac)n(h)g(one)g(as)f(the)i(n) n(um)n(b)r(er)f(of)h(o\013ered)e(in)n(teractions)g(increases.)523 946 y(Theoretically)-7 b(,)35 b(the)i(a)n(v)n(erage)c(n)n(um)n(b)r(er)j (of)g(times)g(it)h(executes)f(a)f(in)n(teraction)g(p)r(er)h(time)523 1046 y(unit)30 b(should)g(b)r(e)g(1)p Fj(=3Dk)1211 1016 y Fc(th)1308 1046 y Fq(the)g(times)g(it)g(w)n(ould)g(execute)f(it)i(in) f(absence)f(of)g(con\015icts.)h(This)523 1146 y(means)25 b(that)h(the)g(time)g(tak)n(en)e(b)n(y)i(a)f(co)r(ordinator)e(to)i (execute)h(a)f(n)n(um)n(b)r(er)g(of)g(in)n(teractions)523 1245 y(sharing)g(a)h(participan)n(t)g(with)h Fj(k)19 b Fl(\000)d Fq(1)26 b(co)r(ordinators)f(should)h(b)r(e)h(nearly)e Fj(k)30 b Fq(times)d(the)f(time)523 1345 y(tak)n(en)h(to)h(execute)f (the)h(same)f(n)n(um)n(b)r(er)g(of)h(in)n(teractions)e(without)i (con\015icts.)648 1446 y(In)40 b(Figure)f(3,)h(w)n(e)g(can)f (appreciate)g(an)h(imp)r(ortan)n(t)g(di\013erence)g(b)r(et)n(w)n(een)g (the)g(\014rst)523 1546 y(column)26 b(and)f(the)h(follo)n(wing)f(ones.) g(T)-7 b(est)26 b Fj(T)1897 1558 y Fd(1)1959 1546 y Fq(is)g(a)f (particular)f(case,)h(since)h(co)r(ordinator)d Fj(I)3367 1558 y Fd(1)523 1646 y Fq(do)r(es)29 b(not)g(ha)n(v)n(e)f(to)i(lo)r(c)n (k)e(an)n(y)h(participan)n(ts,)f(so)h(its)g(selection)g(time)h(is)f (zero.)f(T)-7 b(o)29 b(execute)523 1745 y(an)j(in)n(teraction,)g(four)h (messages)e(need)i(to)f(b)r(e)h(sen)n(t)g(\(t)n(w)n(o)f Fj(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)36 b Fq(and)d(t)n(w)n(o) 523 1845 y Fj(S)5 b(T)12 b(AR)q(T)g Fq(\),)31 b(so)h(400)f(messages)g (are)h(transmitted.)h(Although)f(this)h(should)g(require)e(only)523 1945 y(ab)r(out)19 b(800)14 b Fj(ms)p Fq(,)j(the)j(co)r(ordinator)d (elapses)h(1.05)g(seconds)g(due)h(to)g(computation)g(o)n(v)n(erhead.) 648 2046 y(T)-7 b(est)23 b Fj(T)875 2058 y Fd(1)936 2046 y Fq(giv)n(es)f(us)h(the)h(v)n(ery)f(b)r(est)h(case.)e(When)j (con\015icting)e(in)n(teractions)f(app)r(ear,)h(co-)523 2146 y(ordinators)d(m)n(ust)i(lo)r(c)n(k)g(their)g(shared)f(participan) n(t)g Fj(P)2208 2158 y Fc(k)q Fd(+1)2333 2146 y Fq(.)h(Then,)h(6)e (messages)g(are)g(needed)523 2245 y(to)38 b(execute)f(an)h(in)n (teraction)f(\(one)h Fj(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)5 b Fq(,)36 b(one)h Fj(O)r(F)12 b(F)g(E)5 b(R)q Fq(,)39 b(one)e Fj(LO)r(C)6 b(K)g Fq(,)523 2345 y(one)31 b Fj(O)r(K)38 b Fq(and)31 b(t)n(w)n(o)g Fj(S)5 b(T)12 b(AR)q(T)g Fq(\);)30 b(but)i(ev)n(ery)e(time)i(a)g(co)r(ordinator)d(is) j(refused,)f(a)g(p)r(enalt)n(y)523 2445 y(of)f(4)f(messages)f(is)h (added)g(\(one)h Fj(R)q(E)5 b(F)12 b(U)d(S)c(E)g Fq(,)29 b(one)g Fj(U)9 b(N)g(LO)r(C)d(K)g Fq(,)29 b(another)f Fj(O)r(F)12 b(F)g(E)5 b(R)31 b Fq(and)523 2544 y(another)24 b Fj(LO)r(C)6 b(K)g Fq(\).)26 b(Since)g(the)f(selection)g(time)h(is)f (measured)g(from)g(the)h(time)f(that)h(an)f(in-)523 2644 y(teraction)h(b)r(ecomes)g(enabled)h(un)n(til)g(the)g(time)g(the)g Fj(O)r(K)33 b Fq(is)27 b(receiv)n(ed,)e(the)i(selection)f(time)523 2743 y(should)k(b)r(e)g(2)p Fj(\034)36 b Fl(')27 b Fq(4)14 b Fj(ms)29 b Fq(\(the)i(transmission)e(time)h(of)g(one)g Fj(LO)r(C)6 b(K)35 b Fq(and)30 b(one)g Fj(O)r(K)6 b Fq(\).)30 b(F)-7 b(ur-)523 2843 y(thermore,)25 b(the)g(time)h(eac)n(h)f(co)r (ordinator)e(tak)n(es)i(to)g(execute)g(100)f(in)n(teractions)g(should)i (b)r(e)523 2943 y(the)e(time)g(needed)f(to)g(transmit)g(600)f(messages) g(plus)h(a)g(p)r(enalt)n(y)g(ev)n(ery)f(time)i(that)g(it)g(is)f(re-)523 3042 y(fused.)i(The)g(n)n(um)n(b)r(er)f(of)h(times)g(that)g(a)f(co)r (ordinator)f(is)i(refused)f(should)h(b)r(e)g(prop)r(ortional)523 3142 y(to)j(the)f(n)n(um)n(b)r(er)h(of)f(co)r(ordinators.)648 3243 y(The)f(measures)e(w)n(e)i(got)f(are)h(sligh)n(tly)f(greater)f (than)i(theoretically)f(exp)r(ected,)i(due)f(to)523 3343 y(computation)e(o)n(v)n(erhead.)e(With)j(t)n(w)n(o)e(co)r(ordinators,)f (the)j(selection)f(time)g(is)g(almost)g(8)14 b Fj(ms)523 3443 y Fq(\(four)35 b(more)f(than)i(exp)r(ected\))f(and)g(the)h(time)g (tak)n(en)e(to)h(run)g(100)f(in)n(teractions)g(is)h(also)523 3542 y(a)29 b(bit)g(greater)e(than)i(exp)r(ected)h(\(double)f(the)g (time)h(elapsed)e(b)n(y)h(only)f(one)h(co)r(ordinator\).)523 3642 y(This)i(di\013erence)g(can)g(b)r(e)h(justi\014ed)g(if)g(w)n(e)f (tak)n(e)f(the)i(n)n(um)n(b)r(er)f(of)g(messages)f(transmitted)523 3742 y(in)n(to)h(accoun)n(t.)f(Recall)h(that)g(600)e(messages)h(are)g (needed)h(to)g(execute)g(100)e(in)n(teractions,)523 3841 y(so)k(320)f(extra)h(messages)f(ha)n(v)n(e)h(b)r(een)h(added)g(when)g (a)f(co)r(ordinator)f(has)h(b)r(een)h(refused.)523 3941 y(F)-7 b(urthermore,)21 b(the)i(time)g(needed)f(to)g(transmit)g(920)f (messages)f(is)j(1)p Fj(:)p Fq(840)14 b Fj(ms)p Fq(,)20 b(so)h(a)h(p)r(enalt)n(y)523 4040 y(of)28 b(360)14 b Fj(ms)25 b Fq(app)r(ears)i(due)h(to)f(computation)g(o)n(v)n(erhead.)523 4315 y Fm(4)112 b(Related)37 b(w)m(ork)523 4524 y Fq(The)32 b(\014rst)f(algorithms)f(for)h(m)n(ultipart)n(y)f(sync)n(hronisation)g (w)n(ere)g(presen)n(ted)h(b)n(y)g(Chandy)523 4624 y(and)24 b(Misra)g([CM88)o(],)h(and)f(they)h(b)r(ecame)f(the)h(basis)f(of)h (Bagro)r(dia's)d(algorithms)h([Bag89)n(],)523 4723 y(whic)n(h)28 b(are)e(the)i(most)g(cited)g(in)f(the)h(literature.)648 4825 y(Bagro)r(dia)e(\014rst)i(presen)n(ted)g(a)h(basic)f(algorithm)f (called)h(EM)g(that)h(uses)g(a)f(n)n(um)n(b)r(er)g(of)523 4924 y(in)n(teraction)20 b(managers,)f(eac)n(h)i(one)g(resp)r(onsible)f (for)g(managing)g(a)h(subset)g(of)g(in)n(teractions.)p eop %%Page: 10 10 10 9 bop 523 448 a Fq(When)34 b(a)f(participan)n(t)g(w)n(an)n(ts)g(to)h (participate)f(in)h(a)f(n)n(um)n(b)r(er)g(of)h(in)n(teractions,)e(it)i (sends)523 548 y Fj(r)r(eady)h Fq(messages)30 b(to)h(the)h(corresp)r (onding)d(managers,)h(that)i(ha)n(v)n(e)e(to)h(co)r(ordinate)g(in)g (or-)523 648 y(der)e(to)g(ac)n(hiev)n(e)f(m)n(utual)h(exclusion)g(of)g (con\015icting)g(in)n(teractions.)f(In)h(this)h(case,)e(m)n(utual)523 747 y(exclusion)k(is)g(ac)n(hiev)n(ed)f(b)n(y)h(means)g(of)g(a)g (circulating)g(tok)n(en)f(that)i(allo)n(ws)e(the)i(manager)523 847 y(ha)n(ving)27 b(it)h(to)f(execute)h(as)e(man)n(y)h (non{con\015icting)g(in)n(teractions)f(as)h(p)r(ossible.)648 970 y(Ha)n(ving)f(a)i(circulating)e(tok)n(en)h(has)h(sev)n(eral)d(dra)n (wbac)n(ks)h(b)r(ecause)h(it)h(amoun)n(ts)f(to)h(ad-)523 1069 y(ditional)35 b(net)n(w)n(ork)e(load,)h(ev)n(en)h(if)g(no)g(in)n (teraction)f(is)g(enabled.)h(The)g(tok)n(en)f(also)g(needs)523 1169 y(to)29 b(circulate)f(amongst)g(managers)f(in)i(a)g(giv)n(en)f (order,)f(th)n(us)i(organising)e(them)i(in)g(a)g(uni-)523 1268 y(directional)k(ring,)g(whic)n(h)h(ma)n(y)f(lead)g(to)h(a)g (situation)f(in)h(whic)n(h)g(a)f(manager)g(can)g(nev)n(er)523 1368 y(execute)26 b(one)f(of)h(the)g(in)n(teractions)f(it)h(is)g(resp)r (onsible)f(for)g(b)r(ecause)g(it)h(nev)n(er)f(gets)h(to)f(ha)n(v)n(e) 523 1468 y(the)33 b(tok)n(en)e(at)i(the)f(righ)n(t)g(time.)h(In)f Fj(\013)p Fq({core,)g(there)g(is)g(a)g(co)r(ordinator,)e(i.e.,)j(a)f (manager,)523 1567 y(p)r(er)e(in)n(teraction)e(and)i(the)g(exclusion)f (is)g(ac)n(hiev)n(ed)g(b)n(y)g(lo)r(c)n(king)g(participan)n(ts)g(in)h (a)f(giv)n(en)523 1667 y(order.)c Fj(\013)p Fq({core)f(also)h(reduces)h (the)g(p)r(ossibilit)n(y)f(of)h(an)g(in)n(teraction)f(nev)n(er)g(b)r (eing)h(executed)523 1767 y(b)r(ecause)33 b(when)g(a)f(participan)n(t)h (is)g(in)g(the)g Fj(LO)r(C)6 b(K)g(E)f(D)35 b Fq(state)e(and)g(it)g(is) g(unlo)r(c)n(k)n(ed)g(b)n(y)f(a)523 1866 y(co)r(ordinator,)f(it)h (selects)h(the)f(next)h(prosp)r(ectiv)n(e)f(winner)g(co)r(ordinator)e (randomly)-7 b(,)32 b(th)n(us)523 1966 y(in)n(tro)r(ducing)c(some)g(v) -5 b(ariabilit)n(y)27 b(in)i(the)g(exclusion)e(problem.)h(In)h (addition,)f Fj(\013)p Fq({core)f(do)r(es)523 2065 y(not)20 b(require)f(the)i(set)f(of)h(participan)n(ts)e(to)h(b)r(e)h(kno)n(wn)e (in)i(adv)-5 b(ance,)19 b(whic)n(h)i(is)f(an)g(in)n(teresting)523 2165 y(feature)27 b(b)r(ecause)g(it)i(allo)n(ws)d(our)h(algorithm)f(to) h(b)r(e)h(used)g(in)g(op)r(en)g(systems.)648 2288 y(A)j(mo)r(di\014ed)h (v)n(ersion)d(of)j(the)f(basic)g(algorithm)f(w)n(as)g(also)g(presen)n (ted)h(in)g([Bag89)n(].)h(It)523 2387 y(w)n(as)k(called)g(MEM,)g(and)g (it)h(com)n(bines)f(the)h(sync)n(hronisation)e(tec)n(hnique)h(used)h (in)f(EM)523 2487 y(with)28 b(the)f(idea)g(of)g(using)g(auxiliary)e (resources)g(to)i(arbitrate)f(b)r(et)n(w)n(een)h(con\015icting)g(in)n (ter-)523 2587 y(actions.)f(The)h(exclusion)e(problem)h(is)h(solv)n(ed) e(b)n(y)i(mapping)f(the)h(m)n(ultipart)n(y)f(in)n(teraction)523 2686 y(problem)i(on)n(to)g(the)h(w)n(ell-kno)n(wn)f(dining)g (philosophers)g(problem)g(or)g(on)n(to)g(the)h(drinking)523 2786 y(philosophers)f(problem.)g(In)i(this)f(extension,)g (con\015icting)g(managers)e(are)h(considered)g(to)523 2886 y(b)r(e)c(philosophers)f(that)h(need)g(to)f(acquire)g(a)h(single)f (fork)g(or)g(b)r(ottle)h(placed)g(b)r(et)n(w)n(een)f(them)523 2985 y(in)e(m)n(utual)f(exclusion.)g(The)g(fork)g(or)f(the)i(b)r(ottle) g(is)f(then)h(a)f(shared)g(resource)e(whose)i(acqui-)523 3085 y(sition)26 b(guaran)n(tees)d(m)n(utual)j(exclusion)f(amongst)g (con\015icting)g(in)n(teractions.)g(A)h(di\016cult)n(y)523 3184 y(arises)i(in)i(MEM)g(b)r(ecause)f(b)r(et)n(w)n(een)g(enablemen)n (t)h(detection)g(and)f(acquisition)g(of)h(forks,)523 3284 y(a)24 b(con\015icting)g(in)n(teraction)g(ma)n(y)g(ha)n(v)n(e)f (started)h(executing.)h(The)f(complex)h(part)f(of)g(MEM)523 3384 y(is)g(the)h(w)n(a)n(y)e(it)i(uses)f(the)h(information)f(comm)n (unicated)g(during)g(the)h(m)n(utual)f(exclusion)g(to)523 3483 y(detect)k(that)g(an)f(enablemen)n(t)h(is)f(no)h(longer)e(curren)n (t.)648 3606 y(MEM)32 b(has)g(an)g(imp)r(ortan)n(t)g(dra)n(wbac)n(k)e (b)r(ecause)i(the)h(n)n(um)n(b)r(er)f(of)g(forks)g(o)g(b)r(ottles)g(a) 523 3706 y(manager)25 b(needs)i(to)f(acquire)g(increases)f(as)i(the)g (n)n(um)n(b)r(er)f(of)h(con\015icting)f(in)n(teractions)g(in-)523 3805 y(creases.)c(This)i(implies)g(that)g(the)g(probabilit)n(y)e(of)i (acquiring)f(all)g(the)h(resources)e(decreases)523 3905 y(accordingly)-7 b(.)21 b(In)i Fj(\013)p Fq({core,)f(there)g(is)h(no)f (need)h(for)f(virtual)g(resources.)f(Instead)h(shared)g(pro-)523 4005 y(cesses)32 b(are)g(considered)g(to)h(b)r(e)g(resources)e(that)i (co)r(ordinators)e(need)i(to)f(acquire.)g(Th)n(us,)523 4104 y(the)g(probabilit)n(y)f(of)i(gaining)e(m)n(utual)h(exclusion)f (decreases)f(as)i(the)g(n)n(um)n(b)r(er)g(of)g(shared)523 4204 y(participan)n(ts)h(increases,)g(but,)i(in)g(general,)e(this)i(is) f(less)g(problematical)f(b)r(ecause)h(most)523 4303 y(practical)g(m)n (ultipart)n(y)h(in)n(teractions)f(are)h(three{)f(or)h(four{part)n(y)-7 b(.)33 b(In)n(teractions)i(with)g(a)523 4403 y(higher)i(cardinalit)n(y) g(are)f(not)i(usual,)f(but,)i(ev)n(en)e(in)h(those)f(cases,)g(there)h (is)f(an)h(upp)r(er,)523 4503 y(small)27 b(b)r(ound)h(on)g(the)g(maxim) n(um)f(n)n(um)n(b)r(er)g(of)h(shared)e(participan)n(ts.)648 4625 y(An)31 b(additional)g(dra)n(wbac)n(k)e(is)i(that)h(managers)d (need)i(to)h(kno)n(w)e(eac)n(h)g(other)h(in)h(b)r(oth)523 4725 y(EM)g(and)g(MEM)f(b)r(ecause)h(they)g(need)h(to)e(co)r(ordinate)g (from)h(time)h(to)f(time)g(in)g(order)f(to)523 4825 y(prev)n(en)n(t)24 b(some)h(coun)n(ters)f(from)g(o)n(v)n(er\015o)n(wing,)f(whic)n(h)i(is)g (satisfactory)e(in)i(con)n(texts)g(with)g(a)523 4924 y(\014xed)f(n)n(um)n(b)r(er)f(of)g(en)n(tities)h(and)f(in)n (teractions,)g(but)h(undesirable)f(in)g(a)g(dynamic)h(con)n(text.)p eop %%Page: 11 11 11 10 bop 523 448 a Fm(5)112 b(Conclusions)37 b(and)h(F)-9 b(uture)38 b(W)-9 b(ork)523 648 y Fq(In)34 b(this)f(pap)r(er,)g(w)n(e)g (ha)n(v)n(e)f(presen)n(ted)h(a)g(solution)g(to)g(implemen)n(t)h(m)n (ultipart)n(y)f(sync)n(hro-)523 747 y(nisation)j(that)g(impro)n(v)n(es) f(on)h(others)f(in)i(that)f(it)h(do)r(es)e(not)i(require)e(the)h(set)h (of)f(activ)n(e)523 847 y(en)n(tities)25 b(in)f(a)g(system)g(to)h(b)r (e)f(\014xed)h(and)f(kno)n(wn)g(in)g(adv)-5 b(ance,)24 b(whic)n(h)h(mak)n(es)e(our)h(solution)523 946 y(app)r(ealing)j(for)g (dynamic)g(systems.)648 1046 y(The)f(algorithm)f(relies)h(on)g(a)g (idea)h(that)f(w)n(as)g(in)n(tro)r(duced)g(and)g(pro)n(v)n(en)f(to)i(b) r(e)f(correct)523 1146 y(y)n(ears)d(ago)h(in)h(the)g(\014eld)g(of)g(op) r(erating)f(systems.)g(Although)h(this)g(idea)g(did)g(not)g(w)n(ork)e (w)n(ell)523 1245 y(in)34 b(this)f(\014eld)h(b)r(ecause)f(resources)e (in)j(an)f(op)r(erating)g(system)g(are)f(di\016cult)i(to)g(sort)e(and) 523 1345 y(usually)25 b(cannot)h(b)r(e)g(requested)f(in)i(increasing)d (order,)h(it)h(has)f(b)r(een)i(successfully)e(applied)523 1445 y(in)33 b Fj(\013)p Fq({core.)e(W)-7 b(e)33 b(ha)n(v)n(e)f(also)f (presen)n(ted)h(an)h(exp)r(erimen)n(tal)f(study)h(that)f(sho)n(ws)g (that)h(our)523 1544 y(solution)27 b(ac)n(hiev)n(es)f(a)h(go)r(o)r(d)g (p)r(erformance.)648 1644 y(In)36 b(a)f(c)n(hapter)h(of)g([CR)-7 b(T)1444 1614 y Fd(+)1499 1644 y Fq(99)o(],)36 b(w)n(e)g(presen)n(ted)f (a)h(previous)f(solution)g(to)h(implemen)n(t)523 1743 y(m)n(ultipart)n(y)31 b(in)n(teractions)g(that)i(also)e(had)g(co)r (ordinators,)f(and)i(a)g(cen)n(tral)f(sc)n(heduler)g(re-)523 1843 y(sp)r(onsible)23 b(for)f(selecting)h(amongst)f(con\015icting)g (ones.)g(Although)h(this)h(solution)e(w)n(as)g(suit-)523 1943 y(able)29 b(for)h(some)f(problems)g(in)h(the)g(tra\016c)f(con)n (trol)g(area,)f(the)i(cen)n(tral)f(con\015ict)h(resolutor)523 2042 y(is)e(problematical)e(in)i(the)g(general)e(case.)648 2142 y(Curren)n(tly)-7 b(,)21 b(w)n(e)g(are)g(w)n(orking)f(to)i(impro)n (v)n(e)e(our)h(algorithm)g(so)g(that)h(participan)n(ts)f(need)523 2242 y(not)33 b(re{send)e(their)i(o\013ers)f(when)g(they)h(are)f (rejected)h(b)n(y)f(a)g(co)r(ordinator)f(and)h(no)h(other)523 2341 y(co)r(ordinator)25 b(has)h(tried)g(to)h(lo)r(c)n(k)f(them.)h(W)-7 b(e)27 b(are)f(also)f(using)i Fj(\013)p Fq({core)e(as)h(the)h(basis)f (of)h(the)523 2441 y(run{time)g(supp)r(ort)h(needed)g(to)f(run)g Fl(C)5 b(AL)28 b Fq(programmes)e([CPT00)n(].)523 2707 y Fm(References)523 2897 y Fp([Bag89])103 b(R.)30 b(Bagro)r(dia.)48 b(Pro)r(cess)31 b(sync)n(hronization:)f(Design)g(and)f(p)r(erformance)g (ev)l(aluation)874 2989 y(of)42 b(distributed)e(algorithms.)79 b Fe(IEEE)41 b(T)-6 b(r)l(ansactions)44 b(on)d(Softwar)l(e)i(Engine)l (ering)p Fp(,)874 3080 y(15\(9\):1053{1065,)31 b(Septem)n(b)r(er)24 b(1989.)523 3171 y([CES71])83 b(E.G.)25 b(Co\013man,)e(M.)h(J.)g (Elphic)n(k,)f(and)g(A.)g(Shoshani.)30 b(System)22 b(deadlo)r(c)n(ks.) 31 b Fe(Comput-)874 3263 y(ing)d(Surveys)p Fp(,)g(3\(2\):67{78,)g(June) e(1971.)523 3354 y([CM88])108 b(K.M.)46 b(Chandy)f(and)g(J.)h(Misra.)94 b Fe(Par)l(al)t(lel)45 b(Pr)l(o)l(gr)l(am)i(Design:)f(A)f(F)-6 b(oundation)p Fp(.)874 3445 y(Addison{W)g(esley)g(,)26 b(1988.)523 3537 y([CPT00])71 b(R.)30 b(Corc)n(h)n(uelo,)h(J.A.)f(P)n (\023)-36 b(erez,)31 b(and)f(M.)g(T)-6 b(oro.)48 b(A)29 b(m)n(ultipart)n(y)f(co)r(ordination)j(asp)r(ect)874 3628 y(language.)36 b Fe(A)n(CM)27 b(Sigplan)p Fp(,)f(35\(12\):24{32,)k (Decem)n(b)r(er)25 b(2000.)523 3719 y([CR)-6 b(T)705 3688 y Fb(+)756 3719 y Fp(99])43 b(R.)19 b(Corc)n(h)n(uelo,)i(D.)f (Ruiz,)g(M.)g(T)-6 b(oro,)21 b(J.M.)g(Prieto,)g(and)f(J.L.)h(Arjona.)k (A)19 b(distributed)874 3811 y(solution)27 b(to)e(m)n(ultipart)n(y)f (in)n(teraction.)35 b(In)25 b Fe(R)l(e)l(c)l(ent)k(A)l(dvanc)l(es)g(in) e(Signal)g(Pr)l(o)l(c)l(essing)874 3902 y(and)j(Communic)l(ations)p Fp(,)e(pages)h(318{323.)h(W)-6 b(orld)27 b(Scien)n(ti\014c)h (Engineering)g(So)r(ciet)n(y)-6 b(,)874 3993 y(1999.)523 4085 y([D)n(W99])97 b(D.F.)29 b(D'Souza)f(and)g(A.C.)g(Wills.)43 b Fe(Obje)l(cts,)30 b(Comp)l(onents,)h(and)f(F)-6 b(r)l(ameworks)32 b(with)874 4176 y(UML:)26 b(The)h(Catalysis)g(Appr)l(o)l(ach)p Fp(.)34 b(Addison{W)-6 b(esley)g(,)24 b(Reading,)h(Mass.,)h(1)f (edition,)874 4267 y(1999.)523 4359 y([FF96])133 b(N.)28 b(F)-6 b(rancez)28 b(and)f(I.)h(F)-6 b(orman.)40 b Fe(Inter)l(acting)31 b(pr)l(o)l(c)l(esses:)h(A)d(multip)l(arty)i(appr)l(o)l(ach)g(to)874 4450 y(c)l(o)l(or)l(dinate)l(d)f(distribute)l(d)g(pr)l(o)l(gr)l(amming) p Fp(.)35 b(Addison{W)-6 b(esley)g(,)26 b(1996.)523 4541 y([Jou92])113 b(Y.J.)30 b(Joung.)45 b(A)28 b(comprehensiv)n(e)g(study)g (of)i(the)f(complexit)n(y)e(of)j(m)n(ultipart)n(y)d(in)n(ter-)874 4633 y(action.)50 b(In)29 b Fe(Pr)l(o)l(c)l(e)l(e)l(dings)34 b(of)e(the)h(19)1968 4601 y Fa(th)2064 4633 y Fe(A)n(nnual)f(A)n(CM)f (Symp)l(osium)i(on)f(Principles)874 4724 y(of)d(Pr)l(o)l(gr)l(amming)g (L)l(anguages)i(POPL'92)p Fp(,)c(pages)h(142{153.)i(A)n(CM)d(Press,)h (Jan)n(uary)874 4815 y(1992.)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF ------=_NextPart_000_04BF_01C0C830.93DD6780 Content-Type: application/postscript; name="CCPE.ps" Content-Transfer-Encoding: quoted-printable Content-Disposition: attachment; filename="CCPE.ps" %!PS-Adobe-2.0 %%Creator: dvips 5.83 (MiKTeX 1.20c) Copyright 1998 Radical Eye Software %%Title: alfa-core.dvi %%CreationDate: Mon Feb 26 18:45:33 2001 %%Pages: 27 %%PageOrder: Ascend %%BoundingBox: 0 0 596 842 %%DocumentFonts: Times-Roman Times-Italic Times-Bold Helvetica %%+ Helvetica-Bold Helvetica-Oblique Helvetica-BoldOblique %%+ Times-BoldItalic Courier Courier-Bold Courier-Oblique %%+ Courier-BoldOblique Symbol %%EndComments %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: DVIPS.EXE alfa-core %DVIPSParameters: dpi=3D600, compressed %DVIPSSource: TeX output 2001.02.26:1845 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72 mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{ landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[ matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{ statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0] N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin /FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array /BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2 array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get }B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub} B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr 1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3 1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx 0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{ rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B /chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{ /cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{ A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse} ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17 {2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{ 1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop} forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn /BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put }if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{ bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{ SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{ userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X 1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4 index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N /p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{ /Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT) (LaserWriter 16/600)]{A length product length le{A length product exch 0 exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot} imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M} B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{ p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end %%EndProcSet %%BeginProcSet: 8r.enc % @@psencodingfile@{ % author =3D "S. Rahtz, P. MacKay, Alan Jeffrey, B. Horn, K. Berry", % version =3D "0.6", % date =3D "1 July 1998", % filename =3D "8r.enc", % email =3D "tex-fonts@@tug.org", % docstring =3D "Encoding for TrueType or Type 1 fonts % to be used with TeX." % @} %=20 % Idea is to have all the characters normally included in Type 1 fonts % available for typesetting. This is effectively the characters in Adobe % Standard Encoding + ISO Latin 1 + extra characters from Lucida. %=20 % Character code assignments were made as follows: %=20 % (1) the Windows ANSI characters are almost all in their Windows ANSI % positions, because some Windows users cannot easily reencode the % fonts, and it makes no difference on other systems. The only Windows % ANSI characters not available are those that make no sense for % typesetting -- rubout (127 decimal), nobreakspace (160), softhyphen % (173). quotesingle and grave are moved just because it's such an % irritation not having them in TeX positions. %=20 % (2) Remaining characters are assigned arbitrarily to the lower part % of the range, avoiding 0, 10 and 13 in case we meet dumb software. %=20 % (3) Y&Y Lucida Bright includes some extra text characters; in the % hopes that other PostScript fonts, perhaps created for public % consumption, will include them, they are included starting at 0x12. %=20 % (4) Remaining positions left undefined are for use in (hopefully) % upward-compatible revisions, if someday more characters are generally % available. %=20 % (5) hyphen appears twice for compatibility with both=20 % ASCII and Windows. %=20 /TeXBase1Encoding [ % 0x00 (encoded characters from Adobe Standard not in Windows 3.1) /.notdef /dotaccent /fi /fl /fraction /hungarumlaut /Lslash /lslash /ogonek /ring /.notdef /breve /minus /.notdef=20 % These are the only two remaining unencoded characters, so may as % well include them. /Zcaron /zcaron=20 % 0x10 /caron /dotlessi=20 % (unusual TeX characters available in, e.g., Lucida Bright) /dotlessj /ff /ffi /ffl=20 /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef /.notdef % very contentious; it's so painful not having quoteleft and quoteright % at 96 and 145 that we move the things normally found there to here. /grave /quotesingle=20 % 0x20 (ASCII begins) /space /exclam /quotedbl /numbersign /dollar /percent /ampersand /quoteright /parenleft /parenright /asterisk /plus /comma /hyphen /period /slash % 0x30 /zero /one /two /three /four /five /six /seven /eight /nine /colon /semicolon /less /equal /greater /question % 0x40 /at /A /B /C /D /E /F /G /H /I /J /K /L /M /N /O % 0x50 /P /Q /R /S /T /U /V /W /X /Y /Z /bracketleft /backslash /bracketright /asciicircum /underscore % 0x60 /quoteleft /a /b /c /d /e /f /g /h /i /j /k /l /m /n /o % 0x70 /p /q /r /s /t /u /v /w /x /y /z /braceleft /bar /braceright /asciitilde /.notdef % rubout; ASCII ends % 0x80 /.notdef /.notdef /quotesinglbase /florin /quotedblbase /ellipsis /dagger /daggerdbl /circumflex /perthousand /Scaron /guilsinglleft /OE /.notdef /.notdef /.notdef % 0x90 /.notdef /.notdef /.notdef /quotedblleft /quotedblright /bullet /endash /emdash /tilde /trademark /scaron /guilsinglright /oe /.notdef /.notdef /Ydieresis % 0xA0 /.notdef % nobreakspace /exclamdown /cent /sterling /currency /yen /brokenbar /section /dieresis /copyright /ordfeminine /guillemotleft /logicalnot /hyphen % Y&Y (also at 45); Windows' softhyphen /registered /macron % 0xD0 /degree /plusminus /twosuperior /threesuperior /acute /mu /paragraph /periodcentered /cedilla /onesuperior /ordmasculine /guillemotright /onequarter /onehalf /threequarters /questiondown % 0xC0 /Agrave /Aacute /Acircumflex /Atilde /Adieresis /Aring /AE /Ccedilla /Egrave /Eacute /Ecircumflex /Edieresis /Igrave /Iacute /Icircumflex /Idieresis % 0xD0 /Eth /Ntilde /Ograve /Oacute /Ocircumflex /Otilde /Odieresis /multiply /Oslash /Ugrave /Uacute /Ucircumflex /Udieresis /Yacute /Thorn /germandbls % 0xE0 /agrave /aacute /acircumflex /atilde /adieresis /aring /ae /ccedilla /egrave /eacute /ecircumflex /edieresis /igrave /iacute /icircumflex /idieresis % 0xF0 /eth /ntilde /ograve /oacute /ocircumflex /otilde /odieresis /divide /oslash /ugrave /uacute /ucircumflex /udieresis /yacute /thorn /ydieresis ] def %%EndProcSet %%BeginProcSet: texnansi.enc % @psencodingfile{ % author =3D "Y&Y, Inc.", % version =3D "1.1", % date =3D "1 December 1996", % filename =3D "texnansi.enc", % email =3D "help@YandY.com", % address =3D "45 Walden Street // Concord, MA 01742, USA", % codetable =3D "ISO/ASCII", % checksum =3D "xx", % docstring =3D "Encoding for fonts in Adobe Type 1 format for use = with TeX." % } % % The idea is to have all 228 characters normally included in Type 1 = text % fonts (plus a few more) available for typesetting. This is = effectively % the character set in Adobe Standard Encoding, ISO Latin 1, plus a few = more. % % Character code assignments were made as follows: % % (1) The character layout largely matches `ASCII' in the 32 -- 126 = range, % except for `circumflex' in 94 and `tilde' in 126, to match `TeX text' % (`asciicircumflex' and `asciitilde' appear in 158 and 142 instead). % % (2) The character layout matches `Windows ANSI' in almost all places, % except for `quoteright' in 39 and `quoteleft' in 96 to match ASCII % (`quotesingle' and `grave' appear in 129 and 18 instead). % % (3) The character layout matches `TeX typewriter' used by CM text = fonts % in most places (except for discordant positions such as hungarumlaut % (instead of braceright), dotaccent (instead of underscore) etc. % % (4) Remaining characters are assigned arbitrarily to the `control = character' % range (0 -- 31), avoiding 0, 9, 10 and 13 in case we meet dumb = software % - similarly one should really avoid 127 and 128 if possible. % In addition, the 8 open slots in Windows ANSI between 128 and 159 are = used. % % (5) Y&Y Lucida Bright includes some extra ligatures and such; ff, ffi, = ffl, % and `dotlessj,' these are included 11 -- 15, and 17. % % (6) Hyphen appears both at 45 and 173 for compatibility with both = ASCII % and Windows ANSI. % % (7) It doesn't really matter where ligatures appear (both real, such = as ffi, % and pseudo such as ---) since these should not be accessed directly, = only % via ligature information in the TFM file. % % SAMPLE USAGE (in `psfonts.map' file for DVIPS): %=20 % lbr LucidaBright "TeXnANSIEncoding ReEncodeFont" 100 D<380F01F0381FC7F838 31CE1CEA61F8EBF03C00C1137C13E014383803C000A4485AA448C7FCA4121EA2120C1617 7D951D>114 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fb cmr5 5 2 /Fb 2 42 df<13301360EA01C0EA038013001206120E5AA25AA35AA312F0AB1270A37EA3 7EA27E12067E1380EA01C0EA006013300C297B9E16>40 D<12C0126012387E120C7E1207 EA0380A2EA01C0A3EA00E0A313F0AB13E0A3EA01C0A3EA0380A2EA070012065A121C5A12 605A0C297C9E16>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fc cmsy5 5 2 /Fc 2 81 df<90381FFF80137F48B5FCD803F0C7FCEA07C048C8FC121E5A123812781270 A212F05AB61280A300E0C8FC7E1270A212781238123C7E7EEA07C0EA03F06CB512806C7E 131F191F7A9927>50 D<90383FFFF048B512FE000FECFF80261F070013C0D8380FEB1FE0 0070140700F0140300E0140112C0120016C0010E1303011E1480ED0700150E011C133C90 383C01F8ECFFE0013D90C7FCEB3BF80178C8FCA2137013F05B1201A25B12035B0002C9FC 231F7C9B29>80 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fd cmmi5 5 4 /Fd 4 113 df<127012F812FCA2127C120CA31218A2123012601240060D7A8413>59 D<3801FFFC14F838001F00A4133EA45BA45BA4485AA4485AA4EA7FFE12FF161C7D9B1A> 73 D<137013F8A213F013E01300A6EA0F80EA1FC0EA31E01261A2EAC3C01203EA0780A3 EA0F001308EA1E18A213301370EA0FE0EA07800D1D7D9C16>105 D<3803C0F8380FE3FE380CFF0F3918FC07803830F80313F01200A23801E007A3EC0F00EA 03C0141E6D5A6D5A3807BFE0EB8F800180C7FCA248C8FCA4EA7FE012FF191A7F911F> 112 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fe cmex7 7 1 /Fe 1 82 df81 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Ff cmsy7 7 2 /Ff 2 122 df0 D<137013F8A71370A6387C71F0B512F8A3387C 71F038007000A413F8B31370AB15357CA81E>121 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fg lasy10 10 1 /Fg 1 51 df<003FB712FEB9FCA300F0C9120FB3B3A4B9FCA4303079B43E>50 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fh cmmi7 7 19 /Fh 19 121 df<3907801F80390FE07FE03918F1E0F03930F380F89038FE0078485AA25B D8C1F013F8A21201A23903E001F0A43907C003E0A4390F8007C0A4391F000F80A2120EC7 FCEC1F00A4143EA4143C14381D267D9922>17 D<15185DA45DA45DA44A5AD803E01438D8 07F01478D80C7814FC39187C03000030157C163C1260D9F806131C00C01518A2EA01F05C 1630EA03E0A24A1360EA07C016C0ED0180EC30030003EC070001E0130E00015C9038F860 7039007E61E090383FFF80D907FEC7FCEB00C0A4495AA449C8FCA326347DA72C>32 D<1238127C12FE12FFA2127F123B1203A31206A3120C121812381270122008127A8614> 59 D<4AB41308020FEBE01891397F80F038903A01F8001870D903E0EB0CF0D90F801307 49C71203013E15E05B491401485A484815C0485A120F5B001F168090C8FC4892C7FCA212 7EA4127C12FCA21606007C5DA35E007E5D123E5E6C5D6C6C495A00074AC7FCD803E0130E 6C6C13383900FE01F090383FFFC0D907FCC8FC2D2A7DA830>67 D<90383FFFF0A2903801 FC005CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133FA291C7FCA25BA2137EA2 13FEA25BA21201A25BA21203B512C0A21C287DA71D>73 D<90263FFFF0EB7FF8A2D901FC C7EA1FC04AEC1E005F010315704C5A4AEB03804CC7FC0107141C5E4A13E04B5A010FEB07 80030EC8FC4A5A157C011F13FE14C3EC877F149E90393FB83F8014F09138C01FC0148049 486C7EA2017E6D7EA201FE6D7EA2496D7EA200016E7EA249147FA2000382B539C007FFF8 A235287DA738>75 D<90383FFFF8A2D901FCC7FC5CA21303A25CA21307A25CA2130FA25C A2131FA25CA2133FA291C8FCA249141C1618137E163801FE1430167049146016E0000114 01ED03C0491307ED0F800003147FB7FC160026287DA72E>I<4AB4FC021F13E091387E01 F8903901F0007ED907C0131F4948EB0F80011EC7EA07C0137C49EC03E0485AEE01F0485A 485A120F4915F8121F90C8FC5A17F0007E1503A4EE07E05AEE0FC0A2EE1F80A2007CED3F 00007E153E167E003E5D4B5A6C4A5A6DEB07C0000F4A5A6C6C013FC7FCD803F013FC3900 FC03F090383FFFC0D907FCC8FC2D2A7DA832>79 D<013FB512E016FC903901FC007F4AEB 0F80EE07C0010315E016035C17F01307EE07E05CA2010FEC0FC017804AEB1F00163E011F 14F8ED07F091B51280A290393F800FE0ED03F002007F15015BA2137EA201FE1303A2495C A20001160817184914E017380003EDF070B5D8C00113E0923800FFC0C9EA3F002D297DA7 32>82 D97 D<133EEA07FEA2EA007CA213FCA25BA21201A25BA2120314FCEBE3FF9038EF 0780D807FC13C0EBF00313E0A2EA0FC014071380A2121FEC0F801300A248EB1F00A2003E 1406143E127EEC7C0C127C151800FCEB3C30157048EB1FE00070EB0F801F297CA727> 104 D<130E131F5BA2133E131C90C7FCA7EA03E0487EEA0C78EA187C1230A212605B12C0 A2EA01F0A3485AA2485AA2EBC180EA0F81A2381F0300A213066C5A131CEA07F06C5A1128 7DA617>I<1407EC0F80141FA21500140E91C7FCA7EB03E0EB07F8EB0C3C1318EB303E13 6013C0A248485AA2C7FCA25CA4495AA4495AA4495AA4495AA21238D87C1FC7FC12FC133E 485AEA70F8EA7FE0EA1F80193380A61B>I<133EEA07FEA2EA007CA213FCA25BA21201A2 5BA21203EC07809038E01FC0EC38600007EB61E014C3EBC187EBC307D80FC613C09038CC 038001B8C7FC13E0487E13FEEB3F80EB0FC0486C7E1303003E1460A2127EECC0C0127CEC C18012FC903801E30038F800FE0070137C1B297CA723>I<3B07801FC007E03B0FE07FF0 1FF83B18F0E0F8783C3B30F1807CE03E903AFB007D801ED860FEEB3F005B49133E00C14A 133E5B1201A24848495BA35F4848485A1830EE01F0A23C0F8003E003E060A218C0933801 E180271F0007C013E3933800FF00000E6D48137C341B7D993B>109 D<3907801FC0390FE07FF03918F0E0F83930F1807CEBFB00D860FE133C5B5B00C1147C5B 1201A248485BA34A5AEA07C01660EC03E0A23A0F8007C0C0A2EDC180913803C300D81F00 13C7EC01FE000EEB00F8231B7D9929>I<9038F007C03901FC1FF039031E78780006EBE0 3C90381FC01C000CEB801E14005B0018141F133E1200137E153E137CA213FC157C5B1578 000114F0A2EC01E0EC03C03903FC07809038FE1F00EBE7FCEBE1F0D807E0C7FCA25BA212 0FA25B121FEAFFF8A22025809922>112 D<131C133EA25BA45BA4485AB512E0A23801F0 00485AA4485AA4485AA448C7FC1460A214C0123EEB0180EB0300EA1E06EA1F1CEA0FF8EA 03E013267EA419>116 D<90387C03C03901FF0FF03907079C30390E03B078000CEBF0F8 001813E1123015F0396007C0E015001200A2495AA449C7FC15301238007C1460EAFC3E15 C0EAF87E39F06F03803970C70700383F83FE381F01F81D1B7D9926>120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fi cmsy10 10 18 /Fi 18 111 df<007FB81280B912C0A26C17803204799641>0 D<121C127FEAFF80A5EA 7F00121C0909799917>I15 D20 D<126012F812FEEA7F80EA3FE0EA0FF8EA03FEC66C7EEB3FE0EB0FF8EB03 FE903800FF80EC3FE0EC0FF8EC03FE913800FF80ED3FE0ED0FF8ED03FE923800FF80EE3F E0EE0FF8EE03FE933800FF80EF3FC0171FEF7F80933801FF00EE07FCEE1FF0EE7FC04B48 C7FCED07FCED1FF0ED7FC04A48C8FCEC07FCEC1FF0EC7FC04948C9FCEB07FCEB1FF0EB7F C04848CAFCEA07FCEA1FF0EA7FC048CBFC12FC1270CCFCAE007FB81280B912C0A26C1780 324479B441>I39 D54 D<0060161800F0163C6C167CA200781678007C16F8A2003C16F0003E1501A26CED03E0A2 6C16C06D1407A2000716806D140FA26C6CEC1F00A26CB612FEA36C5D01F8C7127CA2017C 5CA2013C5C013E1301A2011E5C011F1303A26D6C485AA201075CECC00FA2010391C7FC6E 5AA2903801F03EA20100133CECF87CA2EC7878EC7CF8A2EC3FF0A26E5AA36E5AA36E5A6E C8FC2E3C80B92F>56 D<156015F0A21401EB07F190383FFFE0EB7C1FEBF00748486C5AD8 03C07F4848487ED80F007FA248497E001E14BC153C003E143E141FA248EB1E1F143EA214 3CA2147C00FC1580147814F8A214F0A21301A214E01303A214C0A21307A21480A2130FA2 14005B007C1500131EA2D87E3E5BA2D83E3C133E137CA21378001F5C13F8000F14784913 F800075C0003495AEBE0033901F007802603FC1FC7FCEBFFFEEBC7F0D807C0C8FCA25BA2 6CC9FC21477CBF2A>59 D<18F017011707A3170FA2171F60173F1737177F176F17EF17CF 04017F178F1603170FEE0707160EA2161C161816381630167016E0A2ED01C016801503ED 0700A2150E5DA25D157815705D02018103CFB5FCEC03BF4AB6FCA2020EC71203141E5C14 3802788100205B386001E0EAF0036C4848140126FE1F8081B5C8FC190C49EEFF3C496F13 F06C4817E06C4817806C48EE7E00D8078093C7FC3E407DBB42>65 D67 D76 D<0203B512F8027FECFF8049B712F0010F 8290273FC3F00313FED978039038003FFF2601E00702071380D803C06F13C0D807801500 000F177FD81F00EE3FE0484A141F123E5A0078010F150F12C0C7FC4B15C0A3021FED1F80 A24B1500183EA2023F5D6092C85A4D5A4D5A4A4A5A027E020EC7FC173C17F84AEB03E0EE 3F80DB1FFEC8FC0101EB7FF89138F8FFC0DAF9FCC9FC02F8CAFC495AA3495AA3495AA349 5AA291CBFC5BA2137EA35B13F013C03B3D7FB83A>80 D<14034A7E4A7EA24A7EA34A7EA2 EC7CF8A2ECF87CA2ECF03C0101133EA249487EA249486C7EA249486C7EA2EC00034980A2 013E6D7EA2496D7EA20178147801F8147CA2484880A2484880A24848EC0F80A249140700 0F16C0A248C8EA03E0A2003EED01F0A2003C1500007C16F8A248167CA248163C00601618 2E347CB137>94 D102 D<12FCEAFFC0EA07F0EA01FC EA007E7F80131F80130FB3A7801307806D7E6D7EEB007EEC1FF0EC07F8EC1FF0EC7E0049 5A495A495A5C130F5CB3A7131F5C133F91C7FC137E485AEA07F0EAFFC000FCC8FC1D537A BD2A>I<126012F0B3B3B3B3A91260045377BD17>106 D<126012F07EA21278127CA2123C 123EA2121E121FA27E7FA212077FA212037FA212017FA212007FA21378137CA2133C133E A2131E131FA27F80A2130780A26D7EA2130180A2130080A21478147CA2143C143EA2141E 141FA2801580A2140715C0A2140315E0A2140115F0A2140015F8A21578157CA2153C153E A2151E150C1F537BBD2A>110 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fj cmr10 10 17 /Fj 17 121 df<146014E0EB01C0EB0380EB0700130E131E5B5BA25B485AA2485AA21207 5B120F90C7FCA25A121EA2123EA35AA65AB2127CA67EA3121EA2121F7EA27F12077F1203 A26C7EA26C7E1378A27F7F130E7FEB0380EB01C0EB00E01460135278BD20>40 D<12C07E12707E7E7E120F6C7E6C7EA26C7E6C7EA21378A2137C133C133E131EA2131F7F A21480A3EB07C0A6EB03E0B2EB07C0A6EB0F80A31400A25B131EA2133E133C137C1378A2 5BA2485A485AA2485A48C7FC120E5A5A5A5A5A13527CBD20>I<15301578B3A6007FB812 F8B912FCA26C17F8C80078C8FCB3A6153036367BAF41>43 D48 DIII<1538A2157815F8A2140114031407A2140F 141F141B14331473146314C313011483EB030313071306130C131C131813301370136013 C01201EA038013005A120E120C5A123812305A12E0B712F8A3C73803F800AB4A7E0103B5 12F8A325397EB82A>I<0006140CD80780133C9038F003F890B5FC5D5D158092C7FC14FC 38067FE090C9FCABEB07F8EB3FFE9038780F803907E007E090388003F0496C7E12066E7E C87EA28181A21680A4123E127F487EA490C71300485C12E000605C12700030495A00385C 6C1303001E495A6C6C485A3907E03F800001B5C7FC38007FFCEB1FE0213A7CB72A>II56 D<007FB812F8B912FCA26C 17F8CCFCAE007FB812F8B912FCA26C17F836167B9F41>61 D91 D93 D101 D<3903F01FE000FFEB7FF89038F1E07E9039F3801F803A0FF7000FC0D803 FEEB07E049EB03F04914F849130116FC150016FEA3167FAA16FEA3ED01FCA26DEB03F816 F06D13076DEB0FE001F614C09039F7803F009038F1E07E9038F0FFF8EC1FC091C8FCAB48 7EB512C0A328357EA42E>112 D120 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fk cmmi9 9 33 /Fk 33 120 df<147F903803FFE090380FC0F890383F007C017C017E1360497F484815E0 484890381F80C0120748481481EEC1804848130F003F15C390C7140016C74815C6007E15 CE16DC16D816F8485D5E5E127CA3151F6C143F037713C06C903801E7E03A0F800783E13B 07C07E03E3803B01FFF801FF003A007F80007C2B227EA031>11 D<16035E5EA24C7EA216 3F167FA216FFA2ED01BFED033F831506161F150C1518A215301570156015C083EC018002 03130F15001406A25C141C14184A80A2027FB5FC91B6FCA2903901800007A249C7FC1306 835B16035B5B1370136013E01201D807F04A7EB549B512F0A25B34367DB53A>65 D67 D<010FB712FEA218FC903A 003FC000031700187C4B143CA2027F151C181892C8FCA25CA24A1303A201014A13380406 13304A1500160E13035E4A137C91B512FC5B5EECF0001638130F16305C1860011F027013 E0046013C04A140104001380133F17034A15005F017F150EA291C8121E5F49157C5F4914 030001ED1FF0B8FCA25F37337DB239>69 D<010FB712FCA218F8903A003FC00007170018 785D1838147F183092C8FCA25CA25C16060101020E1370040C13604A1500A20103141C5E 5C16F849B5FCA25EECF001010F130016605CA2011F14E05E5CA2013F91C8FCA25CA2137F A291CAFCA25BA25B487EB6FCA336337DB231>II<0107B512E05BA29039001FF0005DA25DA2143F A25DA2147FA292C7FCA25CA25CA21301A25CA21303A25CA21307A25CA2130FA25CA2131F A25CA2133FA25CA2137FA291C8FC5B007F13FEB5FCA223337EB222>73 D<010FB500C090B5FCA39026003FE0C7EA1FE04B1500183E4B143818F0027FEC01C04D5A 92C7000EC7FC5F4A5C17E04A495A4C5A0101020EC8FC5E4A5B16F0010313011503ECF80F 4B7E0107133FEDF3FCECF1C39138F381FE90380FF7019138FC00FF5C5C49486D7EA24A6D 7EA2013F6E7EA24A6D7EA2137F707E91C7FC707E5B707E5B00014B7EB500FC013F13F85E A240337DB241>75 D<010FB512F0A39026003FE0C7FC5DA25DA2147FA292C8FCA25CA25C A21301A25CA21303A25CA21307A25CA2130FA25C170C011F151C17185C1738013F153017 705C17E0137F160191C7EA03C0160749EC0F80161F49147F0001913803FF00B8FCA25E2E 337DB234>I<90260FFFE049B5FCA281D9001F9138000FE04A6CEC07801900DA33FC1406 A2DA71FE140E180C146081DAE07F141C701318ECC03F82010116386F6C133014806F7E01 0316706F6C136014001503496E13E003015C0106801500010EECFF0160010CEC7F81A201 1CEC3FC395C7FC0118EC1FE3A20138EC0FF717F60130140717FE017014035F01601401A2 13E0705A1201D807F01578B57E1730A240337DB23D>78 DI<010FB612F017FE83903B003FC0007FC0EF1F E0EF07F05DEF03F8147FA292C713FCA25CEF07F85CA2010116F0170F4A15E0EF1FC00103 ED3F80EF7F004A14FEEE03FC0107EC1FF091B612C04CC7FC02F0C9FC130FA25CA2131FA2 5CA2133FA25CA2137FA291CAFCA25BA25B1201B512FCA336337DB231>I<010FB67E17F8 17FE903A003FC001FF9338003FC0EF1FE04B130FEF07F0147FA292C713F8A25CEF0FF05C A20101ED1FE018C04AEC3F8018000103157E4C5A4AEB07F0EE3FC049B500FEC7FC16F891 38F0007E82010F6E7E707E5C83131FA25CA2013F141FA25CA2017F143F5F91C7FC180649 160E180C49161C00011718B500FC011F133893380FE070040713E0C93803FFC09338007F 0037357DB23A>82 D<03FF13180207EBE038021FEBF87891397F00FCF802FCEB1FF0D901 F0130F4948130749481303494814E0A249C71201A2013E15C0A3137E1780A2017F91C7FC 8080EB3FF014FF15F06D13FE6D6D7E6D806D80010080020F7F1400150F6F7E1503150115 00A2120CA2001C5D1218A2150100385D003C14035E4B5A007E4A5A007F141F6D49C7FCD8 7BE0137C39F9FC03F839F07FFFE0D8E01F138026C003FEC8FC2D377CB42F>I<0003B812 F05A18E0903AF0007F000FD80F8049130390C71401000E5C48EE00C01401121800384A13 01A2003001031580127000605CA20207140300E01700C74990C7FCA2140FA25DA2141FA2 5DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25C497E001FB512FEA334 337FB22D>I<267FFFFE90380FFFF8A3000190C8EA7F0049153C1738491530A217701203 491560A217E01207495DA21601120F495DA21603121F4992C7FCA25E123F491406A2160E 127F90C8120CA2161C5A481518A216381630481570166016E04B5A7E007E4A5A4BC8FC00 7F140E6C143C6C6C5B6C6C485A3907F00FC06CB5C9FCC613FCEB1FE035357BB234>I<26 7FFFF8ECFFFEB5FCA2000390C8EA1FE06C48ED0F006C6C151E171C5F6D6C14605F6D6C13 014C5A4CC7FC6D6C13065E5E6D6C5B5E6D6C13E04B5A4B5AD903FC90C8FC15065D6D6C5A 5D6D6C5A15E05D6E5A92C9FCA2147E14FEA35C1301A35C1303A35C1307A2130F0007B512 E0A337337EB22D>89 D97 D<147F903803FFC090380FC0F090383F0038137C4913 F83801F0013803E0031207EA0FC090388001F0001F90C7FC123F90C8FCA25A127EA45AA3 127C150C151C15386C147015E06CEB03C0390F800F003807C07E3801FFF038007F801E22 7EA021>99 DI<14FE903807FF8090381F03C090387C01E03801F800485A485A485A485A14 01D83F0013C01403007EEB0F80ECFE00387FFFF8B5128000FCC8FCA45AA415186C143800 7C147015E0003CEB01C0003EEB07806CEB1E00380F80FC3803FFE0C690C7FC1D227DA024 >I103 DII107 DI 110 D<147F903803FFC090380FC1F090383F00F8017C137C497F485A48487F1207485A5B 001F1580123F90C7FCED3F005A127EA25D157E5A15FE5D007C5C14014A5A5D6C495A4A5A 6C49C7FC380F807E3807C1F83801FFE06C6CC8FC21227EA025>I<3903E003E0390FF81F F8391C7C3C1C0018EB703E39383EE0FE38303FC0EB7F800070EB00FCEA607E157000E014 00EAC0FEEA40FC1200A212015BA312035BA312075BA3120F5BA3121F5B0007C8FC1F227E A023>114 DII<13F8D803FEEB01C0 D8070FEB03E0000EEB8007121C001813C00038140FEA301F0070018013C01260013F131F 00E0130000401580C65A017E133F13FE491400A25D120149137E1602EDFE0716064913FC A2160E0201130C9039F803F81C1618000090380F7C38D97C1C137090393FF81FE0903907 E0078028227EA02C>I<01F01507D803FC903903800F80D8071E903907C01FC0D80E1F13 0F121C00380180140F0030021F1307013FEC8003007013000060160149133FD8E07E1680 00401500EA00FE494913030001170049137EA203FE5B00031606495B170E170CA24B131C 4915186D15384A6C5B17600001010314E03B00F8077E01C0903A7C0E3F078090273FFC0F FEC7FC903907F001F832227EA037>119 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fl cmr7 7 6 /Fl 6 53 df<140EB3A2B812E0A3C7000EC8FCB3A22B2B7DA333>43 D48 D<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215267BA521 >I<13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4127CC7FC 15005C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA0180390300 030012065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F8381C007C 0030137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF8091C7FC38 0001E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B6C5B381F 01F03807FFC0C690C7FC19277DA521>I<1438A2147814F81301A2130313071306130C13 1C131813301370136013C012011380EA03005A120E120C121C5A12305A12E0B612E0A2C7 EAF800A7497E90383FFFE0A21B277EA621>I E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fm cmmi10 10 50 /Fm 50 120 df11 D15 D17 D22 D<160C161C1618A316381630A316701660 A316E05EA315015EA301F80103130FD803FE9138001F80D8070F153F000E018015C0001C 5C001814060038161F0030160FD8701F010E13070060140C1703D8E03F168000C0EB001C 491318EA007E180001FE13384913305F000116064913700360130E5F000316184901E013 384B133017705F0201495AD801F849485A4CC7FC160E2600FC035B017EEB0078013FEB01 E090390FE30F80902603FFFEC8FC9038003FF00206C9FCA2140E140CA3141C1418A31438 1430A314701460324B7EB936>32 D<121C127FEAFF80A5EA7F00121C0909798817>58 D<121C127FEAFF80A213C0A3127F121C1200A412011380A2120313005A1206120E5A5A5A 12600A19798817>I I<150C151E153EA2153C157CA2157815F8A215F01401A215E01403A215C01407A2158014 0FA215005CA2141E143EA2143C147CA2147814F8A25C1301A25C1303A2495AA25C130FA2 91C7FC5BA2131E133EA2133C137CA2137813F8A25B1201A25B1203A25B1207A25B120FA2 90C8FC5AA2121E123EA2123C127CA2127812F8A25A12601F537BBD2A>I<126012FCB4FC EA7FC0EA1FF0EA07FCEA01FF38007FC0EB1FF0EB07FCEB01FF9038007FC0EC1FF0EC07FC EC01FF9138007FC0ED1FF0ED07FCED01FF9238007FC0EE1FF0EE07FCEE01FF9338007F80 EF1FC0A2EF7F80933801FF00EE07FCEE1FF0EE7FC04B48C7FCED07FCED1FF0ED7FC04A48 C8FCEC07FCEC1FF0EC7FC04948C9FCEB07FCEB1FF0EB7FC04848CAFCEA07FCEA3FF0EA7F C048CBFC12FC1270323279AD41>I<1760177017F01601A21603A21607160FA24C7EA216 331673166316C3A2ED0183A2ED0303150683150C160115181530A21560A215C014011580 DA03007FA202061300140E140C5C021FB5FC5CA20260C7FC5C83495A8349C8FC1306A25B A25B13385B01F01680487E000716FFB56C013F13FF5EA2383C7DBB3E>65 D<9339FF8001C0030F13E0037F9038F80380913A01FF807E07913A07F8000F0FDA1FE0EB 079FDA3F80903803BF0002FFC76CB4FCD901FC80495A4948157E495A495A4948153E017F 163C49C9FC5B1201484816385B1207485A1830121F4993C7FCA2485AA3127F5BA312FF90 CCFCA41703A25F1706A26C160E170C171C5F6C7E5F001F5E6D4A5A6C6C4A5A16076C6C02 0EC8FC6C6C143C6C6C5C6CB4495A90393FE00FC0010FB5C9FC010313FC9038007FC03A3D 7CBA3B>67 D<0103B7FC4916E018F8903B0007F80007FE4BEB00FFF03F80020FED1FC018 0F4B15E0F007F0021F1503A24B15F81801143F19FC5DA2147FA292C8FCA25C18035CA213 0119F84A1507A2130319F04A150FA2010717E0181F4A16C0A2010FEE3F80A24AED7F0018 7E011F16FE4D5A4A5D4D5A013F4B5A4D5A4A4A5A057FC7FC017F15FEEE03FC91C7EA0FF0 49EC7FC0B8C8FC16FC16C03E397DB845>I<0103B812F05BA290260007F8C7123F4B1407 F003E0020F150118005DA2141FA25D19C0143FA24B1330A2027F1470190092C7126017E0 5C16014A495A160F49B6FCA25F9138FC000F01031407A24A6DC8FCA201075C18034A1306 60010F160693C7FC4A150E180C011F161C18184A1538A2013F5E18F04A4A5AA2017F1507 4D5A91C8123F49913803FF80B9FCA295C7FC3C397DB83D>I<0103B812E05BA290260007 F8C7123F4B140FF003C0140F18015DA2141FA25D1980143FA25D1760027F14E095C7FC92 C75AA24A1301A24A495A16070101141F91B6FC94C8FCA2903903FC001F824A130EA21307 A24A130CA2010F141CA24A90C9FCA2131FA25CA2133FA25CA2137FA291CBFC497EB612C0 A33B397DB835>II<0107B512FCA216F890390007 F8005DA2140FA25DA2141FA25DA2143FA25DA2147FA292C7FCA25CA25CA21301A25CA213 03A25CA21307A25CA2130FA25CA2131FA25CA2133FA25CA2137FA291C8FC497EB6FCA326 397DB824>73 D<0103B500F8903807FFFC5BA290260007F8C813804BEDFC0019F0020F4B 5AF003804B4AC7FC180E021F1538604B5CEF0380023F4AC8FC170E4B133C1770027F5C4C 5ADB0007C9FC160E4A5B167E4A13FE4B7E01015B92380E7F80ECFC1CED383F010301E07F ECFDC04A486C7EECFF00D907FC6D7E5C4A130783130F707E5C1601011F81A24A6D7EA201 3F6F7EA24A143F84137F717E91C8123F496C81B60107B512C0A26146397DB847>75 D<0103B6FC5B5E90260007FCC8FC5D5D140FA25DA2141FA25DA2143FA25DA2147FA292C9 FCA25CA25CA21301A25CA21303A25CA2130718404A15C0A2010F150118804A1403A2011F 16005F4A1406170E013F151E171C4A143C177C017F5D160391C7120F49EC7FF0B8FCA25F 32397DB839>I<902603FFF891381FFFF8496D5CA2D90007030113006FEC007C02061678 DA0EFF157081020C6D1460A2DA1C3F15E0705CEC181F82023815016F6C5C143015070270 6D1303030392C7FC02607FA2DAE0015C701306ECC0008201016E130EEF800C5C163F0103 EDC01C041F131891C713E0160F49EDF03818300106140717F8010E02031370EFFC60130C EE01FE011C16E004005B011815FF177F1338600130153FA20170151F95C8FC01F081EA07 FCB512E01706A245397DB843>78 D<4BB4FC031F13F09238FE01FC913903F0007EDA07C0 EB1F80DA1F80EB0FC0023EC7EA07E002FCEC03F0495A4948EC01F8495A4948EC00FC495A 49C912FE49167E13FE49167F1201485AA2485AA2120F5B001F17FFA2485AA34848ED01FE A400FFEE03FC90C9FCA2EF07F8A2EF0FF0A218E0171F18C0EF3F806C167F180017FE4C5A 6C6C5D1603001F4B5A6D4A5A000FED1F806C6C4AC7FC6D147E0003EC01F8D801FC495AD8 007EEB0FC090263F807FC8FC903807FFF801001380383D7CBA3F>I<0103B7FC4916E018 F8903B0007F80007FC4BEB00FE187F020FED3F80F01FC05DA2021F16E0A25DA2143FF03F C05DA2027FED7F80A292C8130018FE4A4A5A604AEC07F04D5A0101ED3FC04CB4C7FC91B6 12FC17E0D903FCCAFCA25CA21307A25CA2130FA25CA2131FA25CA2133FA25CA2137FA291 CBFC497EB6FCA33B397DB835>I<4BB4FC031F13F09238FE01FC913903F0007EDA07C0EB 1F80DA1F80EB0FC0023EC7EA07E002FCEC03F0495A4948EC01F8495A4948EC00FC495A01 3F16FE49C9FC13FE187F485A12035B12075B120F4916FF121FA2485AA34848ED01FEA448 C9EA03FCA3EF07F8A218F0170F18E0171F18C0EF3F807EEF7F0017FEDA07C05B6C90391F F001F8903980383803001F496C485A9139E00C0FE0260FC0C0EB1F80D807E1D90E3FC7FC 0280137ED803F1EB07F8D801F95C3A007FC00FC0903A3FE07F0003903807FFFE0100018F 5BDA000F1306170E171E705A177CEEC1F816FF5FA25F5F6F5B6F48C7FCED00F8384B7CBA 42>I<0103B612F849EDFF8018E0903B0007F8001FF84BEB03FCEF00FE020F157FA24BEC 3F80A2021F16C0A25DA2143FF07F805DA2027FEDFF006092C7485A4D5A4A4A5A4D5A4AEC 1F80057FC7FC0101EC07F891B612E094C8FC9139FC000FC00103EC03F0707E4A6D7E8313 07177E5C177F010F5D5F5CA2011F1401A25CA2133F16034A4A1360A2017F17E019C091C7 1401496C01011480B61503933900FE0700EF7E0ECAEA1FFCEF07F03B3B7DB83F>I<9239 1FE00380DBFFFC130002036D5A91390FE01F8F91393F0007DF027EEB01FE02F81300495A 4948147E177C4948143C495AA2011F153891C8FCA3491530A28094C7FC80806D7E14FEEC FFE06D13FE6DEBFFC06D14F06D806D80021F7F02037FEC003F03037F1500167F163F161F A3120C160FA2001C151F94C7FCA3003C153EA25E003E5D127E007F4A5A6D495A6DEB0FC0 D8F9F0495AD8F0FE01FEC8FC39E03FFFF8010F13E0D8C00190C9FC313D7CBA33>I<0003 B812FEA25A903AF8003FC00101C0913880007E4848163C90C7007F141C121E001C92C7FC A2485CA200305C007017180060130112E0485CA21403C716005DA21407A25DA2140FA25D A2141FA25DA2143FA25DA2147FA292C9FCA25CA25CA21301A25CA21303A25CEB0FFC003F B6FC5AA237397EB831>I<003FB56C48B51280485DA226007F80C7381FF00091C8EA07C0 604993C7FCA2491506A20001160E170C5BA20003161C17185BA20007163817305BA2000F 167017605BA2001F16E05F5BA2003F15015F5BA2007F150394C8FC90C8FCA25E4815065A 160E160C161C161816385E127E5E4B5A6C4A5A4BC9FC6C6C131E6C6C5B6C6C13F83903F8 07E06CB55A6C6C48CAFCEB0FF0393B7BB839>I<267FFFFC91383FFFC0B55DA2000390C8 3807FC006C48ED03E06060000094C7FC5F17065FA25F6D5DA26D5D17E05F4C5AA24CC8FC 6E1306A2013F5C161C16185EA25E6E5BA2011F495A150393C9FC1506A25D6E5AA2010F5B 157015605DA2ECE18002E3CAFC14F3EB07F614FE5C5CA25C5CA26D5AA25C91CBFC3A3B7C B830>I<277FFFFC01B500F890B51280B5FC60000390C7D807FCC7380FF80001FC4BEC03 E000016204035E98C7FC621A0604075DA2040F5DA2041B5D6216336D02735D1663000003 C34A5A83DB01834AC8FC04815CDB0301140603075D1506030C5DA203185D197003301560 6115606D01E04A5A15C090267F01804AC9FC17FEDA030014060400130E0206150C020E5D 140C4A5DA24A5D18E04A5D715A5C4A92CAFCA26DC85AA2013E157C1778133C1770133801 301560513B7CB84E>I89 D<147E903803FF8090390FC1C38090391F00EFC0017E137F49133F485A4848EB1F801207 5B000F143F48481400A2485A5D007F147E90C7FCA215FE485C5AA214015D48150CA21403 EDF01C16181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83C0F9C0 3A03FF007F80D800FCEB1F0026267DA42C>97 D<133FEA1FFFA3C67E137EA313FE5BA312 015BA312035BA31207EBE0FCEBE3FF9038E707C0390FFE03E09038F801F001F013F8EBE0 00485A15FC5BA2123F90C7FCA214015A127EA2140312FE4814F8A2140715F05AEC0FE0A2 15C0EC1F80143F00781400007C137E5C383C01F86C485A380F07C06CB4C7FCEA01FC1E3B 7CB924>II<163FED1FFFA3ED007F167EA216FEA216FCA21501A216F8A21503A216F0A2 1507A2027E13E0903803FF8790380FC1CF90381F00EF017EEB7FC049133F485A4848131F 000715805B000F143F485A1600485A5D127F90C7127EA215FE5A485CA21401A248ECF80C A21403161CEDF0181407007C1538007E010F1330003E131F027B13706C01E113E03A0F83 C0F9C03A03FF007F80D800FCEB1F00283B7DB92B>II103 DI<14E0EB03F8A21307A314F0EB01C090C7FCAB13F8EA03FEEA070F000E 1380121C121812381230EA701F1260133F00E0130012C05BEA007EA213FE5B1201A25B12 035BA20007131813E01438000F133013C01470EB806014E014C01381EB838038078700EA 03FEEA00F815397EB71D>I<150FED3F80A2157FA31600151C92C7FCABEC0F80EC3FE0EC F0F0903801C0F849487E14005B130E130C131CEB1801133801305BA2EB0003A25DA21407 A25DA2140FA25DA2141FA25DA2143FA292C7FCA25CA2147EA214FEA25CA21301001E5B12 3F387F83F0A238FF87E0495A00FE5BD87C1FC8FCEA707EEA3FF8EA0FC0214981B722>I< EB03F0EA01FFA3EA00075CA3130F5CA3131F5CA3133F91C8FCA35B017EEB07C0ED1FF0ED 783801FEEBE0F89039FC01C1FCEC0383EC07070001130ED9F81C13F891383803F0913870 01E0000349C7FCEBF1C0EBF38001F7C8FCEA07FEA2EBFFE0EBE7F8380FE0FEEBC07F6E7E 141F001F80D9800F1330A21670003F011F136001001380A216E04815C0007E1481020F13 80158300FE903807870048EB03FE0038EB00F8263B7CB92B>III II<90390F8003F090391FE00FFC903939F03C1F903A70F8700F8090 3AE0FDE007C09038C0FF80030013E00001491303018015F05CEA038113015CA2D8000314 07A25CA20107140FA24A14E0A2010F141F17C05CEE3F80131FEE7F004A137E16FE013F5C 6E485A4B5A6E485A90397F700F80DA383FC7FC90387E1FFCEC07E001FEC9FCA25BA21201 A25BA21203A25B1207B512C0A32C3583A42A>I<3903E001F83907F807FE390E3C1E0739 1C3E381F3A183F703F800038EBE07F0030EBC0FF00705B00601500EC007E153CD8E07F90 C7FCEAC07EA2120013FE5BA312015BA312035BA312075BA3120F5BA3121F5B0007C9FC21 267EA425>114 D<14FF010313C090380F80F090383E00380178131C153C4913FC000113 0113E0A33903F000F06D13007F3801FFE014FC14FF6C14806D13C0011F13E01303903800 3FF014071403001E1301127FA24814E0A348EB03C012F800E0EB07800070EB0F006C133E 001E13F83807FFE0000190C7FC1E267CA427>II<13F8D803FE1438D8070F147C000E6D13FC121C12180038140112 30D8701F5C12601503EAE03F00C001005B5BD8007E1307A201FE5C5B150F1201495CA215 1F120349EC80C0A2153F1681EE0180A2ED7F0303FF130012014A5B3A00F8079F0E90397C 0E0F1C90393FFC07F8903907F001F02A267EA430>I<01F816F0D803FE9138E001F8D807 0F903801F003000ED9800314FC121C12180038020713010030EDE000D8701F167C126003 0F143CD8E03F163800C001005B5BD8007E131F183001FE5C5B033F1470000117604991C7 FCA218E000034A14C049137E17011880170318005F03FE1306170E000101015C01F801BF 5B3B00FC039F8070903A7E0F0FC0E0903A1FFC03FFC0902703F0007FC7FC36267EA43B> 119 D E %EndDVIPSBitmapFont /Fn 105[42 28[37 37 55 37 42 23 32 32 1[42 42 42 60 23 2[23 42 42 23 37 42 37 42 42 9[69 2[46 3[51 1[55 1[46 2[28 26[21 1[21 40[42 42 2[{TeXBase1Encoding ReEncodeFont}33 83.022 /Times-Italic rf %DVIPSBitmapFont: Fo cmsy9 9 1 /Fo 1 14 df13 D E %EndDVIPSBitmapFont %DVIPSBitmapFont: Fp cmsy6 6 2 /Fp 2 122 df<136013701360A20040132000E0137038F861F0387E67E0381FFF803807 FE00EA00F0EA07FE381FFF80387E67E038F861F038E060700040132000001300A2137013 6014157B9620>3 D<136013F0A81360A4387C63E0B512F0A2387C63E038006000A313F0 B3A21360A7142F7CA31E>121 D E %EndDVIPSBitmapFont /Fq 104[83 42 1[37 37 24[37 42 42 60 42 42 23 32 28 42 42 42 42 65 23 42 23 23 42 42 28 37 42 37 42 37 3[28 1[28 51 2[78 60 60 51 46 55 1[46 60 60 74 51 1[32 28 60 60 46 51 60 55 55 60 5[23 23 42 42 42 42 42 42 42 42 42 42 23 21 28 21 2[28 28 28 1[69 33[46 46 2[{ TeXBase1Encoding ReEncodeFont}76 83.022 /Times-Roman rf /Fr 105[42 28[42 42 1[42 46 28 32 37 1[46 42 46 69 23 46 1[23 46 42 28 37 46 37 1[42 7[60 60 83 1[60 55 46 60 1[51 65 60 78 55 65 1[32 65 1[51 55 60 60 1[60 6[28 3[42 42 42 42 42 42 2[21 43[46 2[{TeXBase1Encoding ReEncodeFont}51 83.022 /Times-Bold rf /Fs 105[37 28[37 37 54 37 37 21 29 25 37 37 37 37 58 21 37 1[21 37 37 25 33 37 33 37 33 9[71 54 1[46 42 50 2[54 1[66 46 1[29 25 2[42 46 1[50 50 54 5[21 21 37 37 37 37 37 37 37 37 37 37 1[19 1[19 5[58 34[42 42 2[{TeXBase1Encoding ReEncodeFont}57 74.7198 /Times-Roman rf /Ft 166[43 1[56 3[33 40 2[43 3[43 5[37 43 68[{TeXBase1Encoding ReEncodeFont}8 59.7758 /Times-Roman rf /Fu 134[37 37 54 37 42 25 29 33 42 42 37 42 62 21 42 1[21 42 37 25 33 42 33 42 37 7[54 1[75 54 54 1[42 54 4[71 3[29 4[54 2[54 18[19 1[19 44[{TeXBase1Encoding ReEncodeFont}36 74.7198 /Times-Bold rf /Fv 75[25 58[33 1[50 33 37 21 29 29 1[37 37 37 54 21 1[21 21 1[37 21 33 37 33 1[37 11[54 1[37 46 4[62 42 2[25 4[54 2[46 12[37 1[37 37 37 21 19 1[19 44[{TeXBase1Encoding ReEncodeFont}36 74.7198 /Times-Italic rf %DVIPSBitmapFont: Fw cmsy8 8 2 /Fw 2 14 df<130C131EA50060EB01800078130739FC0C0FC0007FEB3F80393F8C7F0038 07CCF83801FFE038007F80011EC7FCEB7F803801FFE03807CCF8383F8C7F397F0C3F8000 FCEB0FC039781E078000601301000090C7FCA5130C1A1D7C9E23>3 D 13 D E %EndDVIPSBitmapFont /Fx 75[30 57[41 4[46 1[36 30 2[46 46 1[25 2[25 46 46 30 41 46 41 1[41 12[56 1[61 1[51 2[81 2[36 6[61 1[66 18[23 1[23 44[{TeXBase1Encoding ReEncodeFont}25 91.3242 /Times-Roman rf /Fy 134[75 3[83 50 58 66 1[83 75 83 124 42 2[42 83 75 50 66 83 66 83 75 31[108 19[50 45[{ TeXBase1Encoding ReEncodeFont}21 149.44 /Times-Bold rf /Fz 172[37 48 3[48 7[41 44 1[48 18[33 48[{TeXBase1Encoding ReEncodeFont} 7 66.4176 /Times-Bold rf /FA 75[22 58[29 29 44 29 33 18 26 26 33 33 33 33 48 18 29 18 18 33 33 18 29 33 29 33 33 11[48 37 33 41 1[41 48 44 55 37 1[29 22 2[41 41 48 44 41 41 6[22 33 33 33 3[33 33 3[17 22 17 4[22 36[33 2[{TeXBase1Encoding ReEncodeFont}54 66.4176 /Times-Italic rf /FB 75[22 28[66 33 27[29 33 33 48 33 33 18 26 22 1[33 33 33 52 18 33 18 18 33 33 22 29 33 29 33 29 3[22 1[22 41 48 48 63 48 48 41 37 44 1[37 48 48 59 41 48 26 22 48 48 37 41 48 44 44 48 61 4[18 18 33 33 33 33 33 33 33 33 33 33 18 17 22 17 2[22 22 22 52 20[18 14[37 2[{ TeXBase1Encoding ReEncodeFont}78 66.4176 /Times-Roman rf end %%EndProlog %%BeginSetup %%Feature: *Resolution 600dpi TeXDict begin %%PaperSize: A4 %%EndSetup %%Page: 1 1 1 0 bop 191 299 a FB(CONCURRENCY)-7 b(\227PRA)m(CTICE)18 b(AND)e(EXPERIENCE)191 378 y FA(Concurr)n(ency:)23 b(Pr)o(act.)e(Exper) -7 b(.)16 b FB(2001;)i Fz(00)p FB(:1\22600)p 191 482 2093 5 v 2682 1548 a currentpoint currentpoint translate 1.11214 1.11214 scale neg exch neg exch translate 2682 1548 a @beginspecial 56.689999 @llx 56.689999 @lly 153.440002 @urx 166.929993 @ury 967 @rwi @setspecial %%BeginDocument: cpelogol.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip068.wmf %%Creator: Windows NT 4.0 %%CreationDate: 15:32 2/24/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 153.44 166.93 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 166.957 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 403 459 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 129 147 24 387 406 462 157 0 false true 3 beginimage doNimage JcC<$JcG`LJcC<$JcG`L_Z0VqrmUl>JcC<$`rF$Xrr2o-rg*Q?^]4*rqZ-brqQKXrpKdbJcDqR_Z0VArf-p3m/R(afDkikrf@&arqH*crr2o;rkJHar= p]pch>dKRm/R(Urp9X[eGoOCrr)Nirr2okrpp'a_Z.LQrj;ZcrnR)ErqcW_rp9XUgAh/qrfd>= irqQ9grqucOrh07lrm:Z*rpTjaj8],I rm1T.o)J^Qrk8#Zrnd= Y=3Drq"tGrm(M.rjVn&rr;urrpg!Hrk&09rlb;qrnRM5rpo+LrmUk+rlG!:rr)iqrpg!(rgNh= rro!eDrqbINrmLe3rkA:0rqHEcrnIFNrhBD2_Z0VBrfI-8qu?Zorp]p%rhTP.rndY8= rp'L^i;`f'rfmDgrqZQnrq69Grl+lMrn@A5 ro*k3ro3qIj8],'rd"LTqu?ZirpKd6rj2U2rm^r+ro3qMh>dK'rgNi%qu?ZdroF'ori?%3rnI= GB`W*gTrjMfcrnIGPrqZQ[rm1SFrj2USro3q8rosF]i;`f,rfmD`rq69jroO-rrjMgTqr7M/r= oO.Nj8],-rdt-[rr;umrpTj:rk&0GrndY;rn[S4rq5+Irn@@NrlG*=3Drr2o^rl+lDrlkB%ro= a:L`W*gTrjMf[rm^rIrp0R3rj)OAro*kA ro*k5rp\bDrmq(4rhTPZrq??2rhob0ro!e4qq_81rp0RYj8],&rdXpPrqHEYrnIF\rj_sYroO= .9rnRM9rqbINrltG.rkAC-rp9X/rhTP1rndY8roj@Q`W*pWrqcVpre:@%rquc>rhKInrmq)5r= oO.;roF(Sh>dK#rfI,brpTj:rg3V[rn[S3rnRM-rndY?rqGIQrr2o5re:?`rr;uWrj)Nurl4i= qrnRM5rpneCrk\Sprl"g2rlkA*ri,nH roF(?rp]pd`W+$ZrosF$rf6u,rke[!rjMfjrl4rqro=3D"6ro3qJh>dK9riH*Krgs,6rkJH1r= l>$$qq_83rp0RYj8],XrndXZrfI,aroO.0riH+1rn@A3ro*k#Drj;[(rg= EbPriuIRrp]gKrp0RRrqHEfrqcWlrr2Bd rq??9rjMgFrk8<7rhTOqrm1T,qs"+JrqP=3DLrpp'0rk&09rhTOeriQ16rmh#2rosFT]`6:Wr= n7:HriuIPro=3D"+rhoaVrkSO.rp9XGro!e:rpp'fk5YG[rm(M)rj;[Zro=3D!prgs+krn[SM= rp'LOqsj[TrpKdOrp'LLrp]p[rr)`orr2oBri#h)qrIb$qk!fArq69Yrp9XWqtU0dqtU0dqu6= Tmqssabrq69+rhob6rndY)ricBrk&0mrp'L>ro3qCrnRLbri#h"rj;[Frl"f?rh]Ulri?%#qlg"#rhTOgrgs+Krf@= &trosFCrn[S7rosF4rk8<4ri5sqrjMgGrm^r(ro3q;ro!e0rm(MTri?$krfd>MrlG**roa1rn[J,rndY8rpKdOro*jprg!JproO%CrosF8= rjr*=3Dro!\5roa:GroO.?rpIu0i;`fUqu$Hlqu?Z3 rdOj9rmh#;roF'mrf6uSrn[S=3DrpTjPqr@\8ro=3D">roj@Cqr7V9rpTj]rp0QbrcnF@rnRM= BroO-grgWnmqs+1Irp]pUrp9XMroj@Erp'LNrosFBro*kIrq$,nrdt-HndJs46rhoaZric=3D!rdX= orrhKJAroa:HrosFDrp'L]qu?ZnrpTjNroO.J rqcNlrp9Wjrfd>drl+l9repc9rjMgZroa:Aqr@\DqtC$^rqHEerp]pKrp0RXrr;usrmh"srdt-Rroa9rrdk'>ro*kIroa:Ero=3D"Brqucqrn= [Rsrp0R`rr2oiq#C?drji#erhKJIrpg!( rg!Jaro3qGro!e4ro3q=3Drr;uXri#h"rpK[`rq??jqu?ZTrh07Rrk\Tprj;ZJri?%irpKdFr= nRM+rpg!driH)orc.`5rqQKcrr)irrr)i;rf6uNrmLf0ri,mHrj)Onrp]pNro3q1rq69jri?#= ^rb]aVfDkjGrkJGkrg`u;rp]p3ri?%;qs+1?ro=3D"=3DrqHElrp9WIr`oH9qu?Zlqu?Znrke= YorfmE.rosFMrmUkXrlP'!rnIG/ro3qIrr;u: r_rf*rmgoGrquZnrp0Qerepc]rndYArkJHuroO.Irm^q\rlP0"roF(6rndY;rq= ZQnrkSM'r`/sEqu?Zorr;uorj;Z`rhBDC rp'LErmh"brmh#0rn[S4ro3q8rqQKmrh]TWraPd)rquckqu?ZKrgEb@rk8$(rp'LN rosFCrqZQnrho`]ral!,rqcNlrpTiare19KroO.CrpKdSrlG)>rl>$-rqQBjrpTjbrr2npr^$= O)aT()rro*jPrepcaro!e>rpKdVrkSMnri#hVrp9XDrpfd`roj?3r^$Oeq#C?Tri#gTriuI]r= pTjJrpKdZrl+kmrgs,Nrquc\roa:Nqu?Z6r_WT"rm^rIrr)ihrm1J+rl+m$rp9XPrp0Qprdt-= XrqcWirq??Wroj7Zrh]TZrabp+rr2os rpKckreCEMro3qNroF(Frpp&preLK`p&G$Xrr)irri,l_rc-$Zi;`f?riQ0TriH+Qrp0RFrp9= XUrkJGfrhTPVrpg!Lrq6'drosE4r]^=3D[qu?Z[riQ0TrhobKrp]pProF(Brq??8rf$iMroj@= [rp'LKrqQBjrl"e3r`B*Frr;unrmh"7re:?`roj@JrosFJroO-frd"LOrr;uqrq69UrpKdcrr= 2nlr]U6err2fprpTirreUQDrnIGMrp'L@ roO.JrilBPrjhh(rqcW[qu?Yqr]gC!aT(<#rqZQ%re^WGrn7;8rp0RDrp0RZrlG(urh]VYrq$= -RrqZ?hrp9W8r]U7Vrr;ucriQ0Erf@')rp9XMroEt:rr2oHrfd>Wroa:Yrp'LRq#C?4r_WSrr= mLfGrn[R=3Drce@gr_i`Drr;ulrjMfBrd4XXrpp'Xro3h= 2roa:\rkSMlrkJ@1rqZQdqu?ZprilB1rf$jQbQ$i, rpfucrbVRqrnRMCrosFCroO.Kqu?Z?rfI,`rq$-hrqcNlrr)iOrgs*mr_rn[S/roa:Pqu?ZHrg!Jbrq$-hrr)`orqHEDrf[7]rd+R`rl+kcrc\:crp]pJrnIG-roa:Ur= r;uHreCEdqu?Zlqu?ZorlP.trau._rmUl#reCDgri#hVrp]pIroF(Erp9XXrr;u9rf-oqqu?Z= nqu?ZkrltG1rd+R7rndYJcN!//rj_qt r^?aorr;uorpTjPrq#pbrm(M)ric=3Dmq#C?irl"etrcA'PraGeFreCE;rj_sjrpKdHrn[S5r= q6'drn@@:riH+lq#C?arjMfardFcerbqd\repcIrm:Z6rpp'SroO.?rq60grn%.&rk8")rqHE= .re^W1rf-o/rdb!2rf-odro3qKqssa^rr)ilqu?Z;rf-oop&G$]rji#krf@&CrgNhfrl4s.dJ= rJ2rh]U$repd7rq??]rp]pbq#C?irltG' ri5tarqHEcrquc7rc%jirk\Tark&/Jr`/rdrqQKdrp]pOro=3D"BrqH3frn7:8rh]VWrr2omr= p9Wgrau/$rlP/irhTO'ral)4rr;lgrqQK\rosFQrr;usrmUjurjMh(rpg!_rq$,orcA((rlP/= mrjMfGr_WTprq$-crq69dqu?Zlrp]p]rr;u;rf$ierqucdqtL)\rc\:1rl+lXri5sWrdb!drq= ?6hqu5ORm/R([rndY*roF(Brlt>GrkABM rkSNOrkeZ/re^WPrm(Mlrm(MWreLK+rk&0prpp'XrlG(qrdb"!rlb;Srl4rarm(M^rkSEJri#= gWrhTPOqni?Qrm1ShrlP/4reUQXrmq(prlkAMrd4X+rltH= .rpKdArj)NJrgj&,rlG)Rrk8rilC\rp'LIrpg!Srk8= ;irf6thr`9#FrgNhGrb2:,r^d#Sr^m*0rg!J\rh]UWrc%j_rj_seroa:Grq$-LrjVljreUPXr= ^Qlqrf6uUreCDSr^-TbrdOj8rhoahre:>[rbDG.roa:FroO.Mroa9crgNh>raG[lr_i`$rd4X= =3Drf$h^r`B)Frhob$rhoa^rdOj+rkABk roj@JrpKd6rgj%JrcnECr]gBAr\OOWrilCul2U#JrqZQfrqcW_rkAARrau%Crb2:FrbDFCrd4= Xro*k5qrIakrgNhsrp'LGrltGErcJ-crl>$:rp]pOrp'Kord+R8rm^r(rmq(tq= p>>krnIG9rkSN$riuIgrq694reUPcrf[9BrqQKZrpTjFrhoa?ri?%Sro!e+rmptrrnIG.rk&/= prk\U*rn@@[rg*P&rdt.*rqHEXrp9XJ riQ0@rh]VNrosF8rmLeqrn@A&rn%/*rj2TnrlkB4rlP/*re^Vbri#hirqcWZrpKd=3DrgEb4r= kABppuVM?rpp'^rqc!]j8],XrqYgYrm1S3rjr+.rpp'1rkJH,r`];Hrl4rqrnIFXrd"KZrltH= rr2oqrqcWhrp]pJrltG5rc\:!rl+lkrmLf)roj?Lr`B)$rdk'= 3rc.pQri,\VrosFFroO.Crp'LBrm^qJre190rjr*UrlG)\rmq(8rb2:IreLK&raGeHrjVmrro= a:>roa:Froj@?rm:YSrf@%trh08Frm(MW roO.8rgEahrb_Xprdk&Jrau/>rpTjUro=3D"6ro3q@rp'LHrn7:bre^Vmrf$iTrhBD,rp9Wrr= cA'@rd"L/rd+QCrc8"orr;urrq69^rq??err)!ZcN!n)rkSN>ri,m^re^W8rjr*nqu?ZYrhBC= 'ra5YErepcbrosFIrndY4roF(Crpg!^ro=3D!orji$6rhTOTrdt-9rm(E@roO-Grb2:9rbVRq= rl4s.rp0R>rnRM6rp0RErl+lFrj;Ztrf$i4 rhKJ;rpTaaro3p@rau.=3Drb_Xfrk8=3D!rq69RrndY0ro!\:rlb;PriuHtrepbtrdFdLrqQB= jrk&/Fr`&l'rb_XmrlG*;rqcW`rpKdWrqbRQdJs4Drl"f0rl+m#rp'L+rg3VXrndYSqu6Tnrl= tG+rf$j)rr;ufqr.P2ro*kCrqZQerltG:rk\TmrpTj7rfmD;rl"U3rqQK%rdOj:roa:\rqHEP= ro!e4roa:Krmh"Grj_serosF=3DriH*`rl+d/ rq69jrpTierd4X8rpg!crq$-Troj@Aro!e9rp0Raqp#,hrk8<(rj;[crq69]rpg!ErjMg>qr.P= 0rn@@_re^W)rj)OLrkeZ]rndY)rl+lTrl4rOriQ1*ro!eArp]p[ro!derj_sdrosF=3DrnIFM= rd+R(rkABXrl"f\rnIG'rltGVri?%.rnRMB rp9XSrp0R#rjMgPrm^r$ro3q#rg*P-rfmE,rkeQNrl+l\qq(hdri,mcrlkB*rp9XTrpKd6rkJ= Hgroj@@ro!e#rg`t.rf@')rmUl5rpp']fDk=3D>rlkA&rcnElrdsfore18prf[9+qrn%BrosF= GrlG)@ql'Lnrgs+5r_NMdrc\:#reUQTrkAB8rf[87rdXotrgWo5roO.>roF(DrosF3rjMg$ri= 5srrgWn%r^QlhrdOj're19FrkAB=3Drg!J4 rf-p%rp'LDro=3D"ArpKd>rjMg!rgNhcriQ0[ra#Lkra#M[rdb!!re:?3rhTP/rj_rlre19Qr= n@A4ro=3D"@rp'L@rlkARri?$urhTOOra,Rer_i`Nrgs,Rrq??arr(RNo)J^aro*k#rl"fUqo= JcWrl+lRrlG)6rfd?"rp'LIrn@A1rpp'5riH+.rl+lRrm1SGra,R_reUR!rkABPrltG_rk8#`rkSMXr\XUSrl+= lVrkeZKrk&0Jrmh"trk&0#ri5tOrp'L>rnRM=3Droa:&rj2L?rltGZrd+Pur`B*?rn@AErpp'= YrqtLMo)J^brq??hq#C?lrquZgrr;uWrh07VrlkB0qsaUEqlTkProF(;rq??Gre18PriuJ$pu= q_;rndY7rp9XErj2Tfrlb<+rpp'^rnRLX ri#hIrp0RBrr)i0raPkJrm^rIrp0RHrp'LDrp0RCrjr*"rkABtrpKdSrp9Worh9>;rp0RErp9= XLrhBBnrd"M7rqZQbroj@CrosFIrosFBrl+l%rjr*jrp]pWroa:!rhob7rosFCrpp'Xri,m#r= e1:Hrr;ulrpTjVrr1XOn,NCbqu6KjrqcWhrqHEirr;urrj2TMrgj&8rp'LArji$"rkJHrroa:= @rpg!>rgWnArl4s.roF(Irp9XErndY; qtC$*rd+R8rmUl1rn7:Nrg!Jhrp0RJroO.Qrl"eorgs,Drq69Proj@LroF(Crpg!;rf6u@rl>= #uroF'prgWnmroF(Iroa:MrosEgreLKJrpKdSrp'LDroO.Frp'LIrp0R3rf6uErkeZproj@#r= h9=3Diro3qHroa:PrpTiurf$iVrpp'_rq$-[rqG%Em/R(arqcEarqQKhrr2osrq??"rdt-1ri= lC3ri#gfrk&0broa:Aro3qDrm:Y;rg!K( roj@:roj@BrndY8rpp'erpg!!rdt-6riQ1"rg*PIriuIVrp9XErosFMrkSN$ri?%Mroa:8rnd= P4rpKdYrn7:8reLKNrjVm+rgEbjrnRM@qrRhIro3p`rg!JeroF(- roO.Squ?ZEqjm`&ri#g@rdOjXroa:Lroj@Irp9XXrkJG_rf[91rpp'FrnIG4rq$-hrosEmrg`= tgrk&0'rcJ.0roO.NrosFAroa:ProF'Xrce@,rp'LIro=3D"6rndYXrqZQRrosFQroF(Wrk&/:rc%k`rr;uXro!eIrr;ulrjr)fri,nUrpf= usrcnFRrr)iXrn[J2rp9XGrgj$frcJ&+roO.9rp'CZrm:Y4rfd?&rpg!`riuHUrkAC1rpg!Pr= o!e1rp0RKrhKHordk(DbQ$2oro=3D!PreUQ`roO.Iro3p`rgWo4rp9XPrpg!Ero=3D"XrosE<= r`/s"rqZQQrndY?qu?Z[ri?$Sric=3Darq??9 rgj%lrnRM9ro3qFrosF=3Drr)i2rac"Lrm^rIroj@Hrr2osrlb;+rfd?+rpTjOrl"f#rk&0oq= q_81rndY?roa9Sr`K/Erpg!WroF(?rqZQnrndXKreLKaroj@Lrp9X"rh9>-rosFBroO.;rnIG= r`9$"rq= ZHPrqHElrq$,ure^WFrnIG=3Droa:,rkABW roO.Bro3q?ro*k4rr;u4rac"Mrmq)Krp9XTrr)iPrg3VErkJHurp9XBrm(MXrmq)4qqV2/rn[= SrosFBrnRMdKErjVl^rh]VGrp0RHro=3D"4rk8<;rn@A;ro*k5rn[S>rr;u_reUPOri?%urp= 'LLrr;uork&/frgWo6rpTjHrosF/rk\T[ ro=3D"=3DrndY5rn[S1rr;u7ra5YErn7;Nrq69\rndXMrf6ugroj@Iroa:Arm:YXrmLf-qqh>= .rnIG;rpKc]r_rf?rqcWfrpKd]rpTj"repcNro3qOroO.Frp9X0rji$SrosFFrp9XFrn@88ri= #g"rdt.IbQ$N#rqQK2rf-oJrm:Z1roO%;rnIFXrh08:roa::rnIG1rq$-hroj?7r^m*krr;uh= rqQKkrm:Y-rfmE'rpTjNroF(Hrlb;Crk8ro=3D"JrpTiprfd?)rosF;ro3qNqu?Z`rdt,7ri,nsrqQK>rf6u2rjV= merpTjNqrn%JrltG8ric=3DXrosF;ro!eEqu?Z9 r_rf,rndYSric<2re:?qrpp'Sro3q?rp'LCrk\Surk8=3D!ro*k3ro=3D"Pqu?Ynr^-Tqqu?Z= Brdt,qriuInrr)i\rnRM0ro3qArk&/urkSO$rosFBrn[Srn[S5roj@Irlb;(rkAC+roj@CrqQBjro!d9r_EHCrr;uQrcnEIrgWoGrqH= ETrn[S/rn[S3rpg!(rg3W#rqHE\roa:Hqu?Z[rhBC*rg!KVbQ$i,rmq'`r^-UWrqHEfrp'LGr= oj@Lrr)`orjVl_rmUlErpTj_rr;u_rlb;(ra,S(rhTPKrhKH\rdXplrpKdHro!e;rp'LPrr;u= NrgNhfrpKd`rpTjbrr;uhrmLe*r`&l9 ri,mmrce@;rp'LSro=3D"7rnRM3rpg!drmUk)rkAC3rpp']rr;ukrmUk>rbqd:rdt.$riH*!r= dXpsrqcW^ro3q?roq`.n,NC]rr;u= 3ra#M=3Drn7;NrqZH\rqQ0drjMfXrmh#Jrq??hro!dKrdXotrdk&irau.JrdOj+rnIGIrp9XB= ro*kBrqcNlrnIF;ri,nbrr;urrr;u`ri#gI re:?-rbML7rc8"FrqcWerpp'[rp0RDrp0I]rn7:&rjr+/rqcWnrp9Whrdb!$re^W&rc%j\reU= QIrn[SPrr2olrqcWhrpp'RrqHElrlb;$rkSF2rqZQkrji#_re:?UrndYI rpg!Urji#=3Drg!K.roj?nrc8!Krh]Virp9XQrpp'SroF(Brq69erlk@mrj2UsqsaTlrd+R!r= mLf-rm^q9r_NNEro!ePrpg!ZrqZQfrpp'SroF(Jrr;u6rf$idrq69[rpg!9rcA'erl"fqrn@@= ^rf@&)rk\U&rqcWgq"Xjdk5XoMqt9sfrr;umrk&/krfd>Orh9=3DfqksFirh9=3DMrf-oerlk= A`rjVldrhTPBrp9XUrpg!!rbqdJrkSN;ri,n1 rlP/Uric3sri?$]reCEKqoA]IriQ0\rdk'froO.LrpTj.rg*PBrlP/FrhKImrkJHWrk\T9rhK= IXre:?MrlG)ZrkJGqrfI,nrosFNrpg!ErfmD*riuI5rhKIcri,n!rj2U?rlb;SriQ0]reLKOr= l4rSrl+l.rdt-Oro=3D"Grp0RDrj;ZQrhTP#ri,miqkF(frl"g1l2U5PrqQK^rr2osrq688rZ= _=3Dfr\+7)q^qdur[Rn!r_rfJrgWn^rg`tE rf[9*roj@Croa:Mroj?Vr_NMar]C*LrcJ.!rd"KAr]U6=3Dr\4=3D-raPktrk&00rdk&\rdFd= Lrn@A2roF(Hroa9rrfd>)r_Tri#ghrf?r4rfI,1rdFdIro=3D"&re:>OrcA(3rpKd\roa:OrqucDrf-o#rfI,=3DrepcMrj= )O!rf?r2reUQZrn%.rriuHRrh]VUrqZHWrqucTrd+QXre194rf-o5repcBrilC,rgs+Yrf6u:= ri#h4rkAB=3Drd"L-rnRMNroj@;rp]pKrhTOB rf$i>repc3rdt-)riuItrr;unrqc3cm/R(_rq$-Zrq69aq"=3DXXrpg!Wrq69erp0QZre:@&r= r;u`rji#[rh08GrqcWcrp]pBrfmCjrkABtrp9XBrn@A)rnRM7rp]perl>"lri5t`rmLe-rdk'= %rbMM[rqZHaro*jMrbqe9rp0RRro=3D"9rnIG-rosFOrkSM_rk8=3D2roj?lrdk')rk\U1rqH= E[roj?drb2;#roF(Trpp'Lro3qVrc\:trqcWfrq69\rosFKrq$-PrhTO&rf= mE(rj;R-rf@&3ri?%4rjr)urau.Trlk9> rq69Yrpp'^rpKdOrosF.rdt,Srg!K)rj)O,rlb:bral(urmLf-rji#Ira,TMl2Ub\rqQKjo)I= >Arr2oprqQK^ro!dqri5sUrd4Wqre19Hro*kGrjMfOraPkCrc8!TrfI-0rp9XEroa:Froj@Hr= p9XGrlb;Hrg3VJrdFcIrb2;@rr;u^rilB9raGeNrcJ-Hrce@Trq69RrndY;qs47@rmLeTrf[8= ,rdOi^rce@\rpg!4rf$hgrbMLSrbVRZ rk\U%rq$-Qro!e4ro=3D"CroO.1rl"f3repc(rce?grg3W5rq69/rce?Arc8""rdk&lriQ1uq= #C?iq"aparqHEfrr2Kgo)J^gi;`fArl4rDrji$FrkJH'raPk_rp0R`rq??&rcnEIral)'ro3q= Urp'LCroO.Crp0RXrq???ri,n'rl+lgrjr)Wrd+RZqu?Zgrj;ZKra#MBrgj&=3DrqcWcro=3D= ":roO.Irp0R/qml^Brl+l=3Drb;@JrmL]DrmLe* rau.=3Dre:?srqucorpg!QroF(;ro=3D"@rn@@[rjVmCrm:Yirgs+6rgEcUrr2okrl4qnr`B(= _rbDGQrr2fprr2ofqsOIRrq$-^rqQKkn,N(\rqZQfrq??^rp0@Cq!%\>rlP/Drl+m$rquclro= F'HreUQjrpTjUrp9Wtrdt,rrl4s-rnIG(ro!e3rmh#"ro*k0rj)Nrrn@AErr)iormq(Mrj;[n= rqHprrh07SriQ1Xrp'L=3Dro!e:roj= ?dre19Iri#h*rgj$fr[n+prjr*-rj;[@rk8<3 rhoajrg*PFrj_sgro3q3ro*kArnRLfri5t)riQ15rdt,-r^?aNrkJH3riQ13rl4rKrhTO[rhB= D:rp0I>roO.JrmUk8rh9=3Dmrj)O(rbVQcr_*6rriQ1#ql0S#qo/Q)rp9X[rj)N4rep[Rrr)idrp0RMrpTjVrq$-_rqQKgrr)roa:OrpKd,riQ1>ro!= e1rq$,pr^d#erkJI+rosF8rmh#"rn7;&rl+l,riuI`rpKdKrq69Zrjr)qrltH'rp0RFrg!IAr= `]ra,S?rnRMQrqcNXroa:@rpp'Trh]U= Prj;[irpg!Hri5sWrjVn"rqZQmrr)htr_3<3q#C?_ros=3DHqs"+3rg!JLrl+m#rp0R%rgNhZ= roa:\rpg!Pro!ddrf[8ZrosFQrpg!Uqs=3D=3DN rp]pXrq69brqQKhrr)Efq#C?lrqZQirquZmrr)iorqHrqHENrf6tfrk&10qrdt>ro!e;rq$-_rnIFMrf-oOrj;[?riH*arhobGrq69OrndYQr= keYSre1:,rr;u\roj@Jro=3D"=3Drq$-Sri,mNrg3VtrkAB,re19EroF(RroO%Cri?$0reCFO= rqcW[ro*k;rp'LIroF(BrnRLDreUQMrk&05 rfmDQrm:ZErqHEProa:Ark\T-rj;[drp9XQrpK[MrpTjUrpp']rq??crqZQirr)Niq#C?mrqc= WirqH<`rq$-YrpKdSrqHGrh]USrcA("rl4s#rpKdBrnIG?rmq(=3DreCEhrpKd= Erp0REro=3D"Nrr2oYriuHdrj2UMri#gIreLKaroF(IroO.8rndYBrkSMnrh9>ErpKdBroa:B= roF(Orp]p-rgEbWrj2TnrcJ-mrk&0krqcWZ rnRM5ro*j^reUQJrp0RKqr%J5roF(Crp9XFrk8;srhob0rgEb0rg`uGqu?Z`ro*kBrp'L)ric= =3D;roa:FqsO@IrpKdTrpp']rq??crqZQirr)Nip&G$frqZQgrq69[qsOITrr)Wlrm^q.rfmE= ,rn[R=3Drc.qUrr;ufro3h2rp'L3ri5smrltH*rndY8ro3qHrr;ufrjVldrhTPSrr;uri5kqrp]pFro3qCro*jiri#h1ro=3D"7rnRM2ro*k?rq$-= Url"esrgj&=3Drq?>prd+RWqu?ZlroO.>rq$-YrlG)>rkJHorp'CKrp0RMrpTjVrq$$\rqQKh= rqucpp&F^brquckrqQKcrp]pUrq$-gq#C?Qrh07ErjVmtrquc"repd3rr;uYrn[S1ro!eBrmh= "Irh9>:rosF;rn[S:rr)iirkeYprfmE3rqQKm rn@@?rk\U0rq$-brmUk>ric=3D[rp'L>rp'L= Nro3qCrkeZ!ri#hQrq$-Kroj@Vrp'K^re^WRrosF]rq697rfI,prqHEQrnRM7rpp'_ro=3D!d= rg*Pcroa:Arn[S1rpKd\rn@@FreUQerp]p`rr)i5rg3W!rq69Zrp'L>ro3qJrp'Korf-oVrp9= XZrq$-Wrp9XQrpg!Yrq69arqQKhrr2Bdo)J^e rqQB]rquQkrpp&lre:?Ero!eLrp]pIrjMfsrm(N,roF(Arn[S3rqZQSrgj%;rltHBrpp'XrqH= EDrg*PCrkSO+rq??Nrp'L-riQ12rnIG6roa:Nrp9X?rq691repcLrosF^rq69\rp'KkreLKKr= o=3D"Urp]pIrlG)6rl"g#qq_8;rpp'[ro3p`repcRrq??[roF(Erq??NrhTOKrilCsrqucaro= j@"ri5t:ros=3DCrndY4rp9XJrjr)eri,nk rr;umrpTjQrpKdTrq$-`rqZQkrr)3`o)J^erqHE`rqZ?hrqHE-re19?rmq)Crp9XCrn7:brj;= [Zrp]pTrp0R>ro3qWrp9WLrb;AMqu?Ziro!dNrepccrpg!froF(6ro=3D"&rkSNYro3q?rp9X= XrosF;rpKcrrd"L7q#C?brp0RMrpg!ZrqHEfrqucpm/QYVrqucgrqH3frqu= c@rfI,>rlP02rpKdErnRM'rkeZNroO.Prpp'TrnRM:rr;uareLJIrj;S&rp'KareCEProO.Yr= pTjArndY7rltG_rmq)1rosFJrp]gErr;u>ra#M"prepd%rqcWhroroj@Aro!eKrr;ucrdk&4r= iH,!rp0QSrce@1rnIGFrpK[Dro*k;rm1S[rlkB#roEt9ro*kJrr;u=3Dr_rf)rnIGPrl>"]rd= 4XZqt'gMroO.Dro*k%rkeZbro*k3qr%J0 rqQKmri#f\raPd)rqHE!re193rn%/Lrr)i[ro3qFrosF.rk\T_roF(7rnRM-rn[JOrj2Smrc.= W2rqHE[rp9XRrpg!Yrq69crr)3rq$-5riH+Grr)ieroa:Trr;uZrj)NYrd"LArj;[_rq69\qs=3D=3DGro*k?rr;uArg!K(rr;urrq= ??jrl"f!re^W=3Drg3VLrhBD*rp/_HrqQKeo)ItSrm:X]r`oHCqu?Zirq$-ap&G$"re:@&rr;= uerr;ukrh]UCrfd>brh]U2r`&lNrpg!crqQK] roa:BrpKR]ro!d@ri#harr;llrltFcrf6udrl4r-qdKK&rr;uqrqZQirpTjIrpK[`rn7:(rkA= C3rq??err2o3rdOj)rjMg@rgWmqr`fB'rq5sarqucaroa:Rrr;uArf-olrr;uorqucTre18rr= iH+Brl+l9rf6u9rm(NAl2UbVrqH!`l2UbNrm1Sfrm(MWrj2U2rj_s@rl"]SrkSN$repclrn@@= urm1SPrdOj4rmgo8rlb;"rce@frmUba rm:YmrlP/XrlG)ariH*Wrh088rnIG$rk\T"rd"L[rosFXrp9Wpre:?2rnRLrrkJHRrm:Yorm(= Mdrl4rrl>#Trl+lVrlP/krq$-frqHEgo)IbMrq= ?>Jr[n+(ofE(4r\sg>ra5Y_rh07ergj%< rb;@mrltH2rp'LPrqQKArgEbHrcJ-?rbVRurg3V)r_3;Zr]gBNrcA(-riH*trf[8$rd"LOroa= :Groj@SrpTj&rf[86r`oFkr`oG]ri#gNr`&k[r`&lHrf6uBrgs+Prbqdcrji$prosFFrq??Ur= hKIJrcA'>q`b!SraPk^rh]UGr_retrd+R1rgj%]rgWn5rhKJErosFDrosFOrmh"@rf$hlr^co= Eq_J.^rmU-3j8],VrhKHuraYh?rau%< raPk8rb2:]rh]V(riuHdrbVRnrmUl:ro*k7rpp'Lricroj@Prm:Y/rb_XTrb_XVrfI,Rrf-nsraPk.rn@A,ro!e-rgs+CrlkB0rm(MIrepbiric=3Dqrpg!Orpp'Arg!J-r= kJHdrm^qjrlG)^rm(Mnro*jfrf@&crp9XBriuHjrdk&grn@ANqssaMriuHJrgWo;rn[S"qoo&= _rmh#%rjMfXriuIdrmq(grh07+reCF?rqZQVrpTjPri#g3rh9>Aro*k-qp,2frltGhrnRLVrf= I,orp9X6rjr)frbqeAqtU0Troa:#rdt-5 rl+llrn[S/rnIG+roO.Xl2U5Prr2olrq69]rq#:Prq$,ardFdjrq??,ri#gtraGeQrlk9&rn7= :Frb2;$rp]perqucarp0RQrqZHkrm:Y#rhobOrl+l0rjVm)r_NN[rmUl1ro*jdrd4W]rmpuHr= qcWcrp9XTrr2oprkSM[rj)Otrn@@erl+kgrac#8ro3q=3Drn[R^rbMLZrnRDNrr)ikrqcWbrp= 0RWrr2o,reCEarpg!0riQ1,rb;@Yrl+ls rndXgreCDZrkd(_o)J^frq69^rq69\roj@>rndP-rn[S3rosFGrlkA7rb;@;repcSrh08#roO= -YraYq5rf@&WrdOiCrbVS`roj7DroF(:ro3q?rn[S"rf@%erb;@^re^WSrpKdBrf6tRr`fA[r= f@%nrbMM5rpg!Nro*k@rp'LDro=3D"0rj;ZNr`];IriQ1/rkSO!rm1Rnr`&lArh07Nr_i_trj= 2Unrpg!IrnRM6rp'LDro=3D"4rjVlOr`];M rhBCbrjVmprjr)Kr`B)Crf6tura,SirqFh?o)J^arp]p\rr;urrpTjFptYl)roa:@rl4r;rhT= OtriH*Xrau.rrosF^rpKcorbVR7ral(Qrf[9"roa:>puDArn[S5roO.>rm1SUpp0mgrdb!>roEtVrmq(*raGe8rc8!= nrk8nrji%%rquccrp0RMrpTj^rr;udrj2Tqrm1SuroO.8r= ilBdrjV\&rq$-#rfI,[rorq??erq$-Up#l>*rilC=3Drn720rl"]# roO%WrqcWFrgWn3rh]VebQ$r/ro3p_rgWnTrh07krji$?rj_s6rhob$ro*kLrpg!YrpTj0rjV= mHrnRM)rmh"Qrd+Q[ri5tDrk&0JrmUkmrkJHHrkSN7rg3VqroO.GrpTj[roj@'rkAB[rmq(ir= kSN&rdOj-riQ1/ric=3D1rl>#arkJH:riQ1.rm^r8rp'LNrq$-Fqni?Vrl+lQrilBMr`K/Crj= )O$qk=3D"crj2LCrj2U#ric=3DProj@Hqssa; rj2U0rji$8rjVm-rd4W=3DrbMMSrqOe=3Dm/R(Jrh]LHrf-o@rh07drgWnGrf6uerosFNro*k= jro*kGro!e8rp0RSrmq(Irh9=3DcrhK= IXra5X]r_'rkAB,rfmDk ro*k>rndY8rq$-Url>#+rgj%XrhBC[raYpWr^m+&rqXk>m/R(_ro3q,rmh#!rm1SgrlkA]rj_= s#ri,nMroj@;ro3qBroO-nrhTG'rl+l4r`B(Srdk'criH+-rkABCric=3D&rh]UXrg3W4roj@= Arn[S6rp'L:rk&0^rn@= A@rpg!Prj;[!rlG**rp0R`roj?1r]U7Zrr;umroa17ro3qDrp]p:rhBC]rm1T*rp'LRrn[RYr= hTPHrquccrr;u>r_EGtrn@8Lrpp'Lro!e:rpTjErhTOarlkB1rpg!Srjr)nrj_t&rr2fpriH)= brbD-+rpp'QroO.Drp9X6rfmD]rn@A> rpp'PrkAAurl+R1rj)MmrcuTbgAh0Mrq$-_rr;uOrf[87rj2U\rmq(Xrf[8crpKd\rpp'grpf= uBr^Hgkqu?Z`qrRhBrq69irp0QbrdFd@rlbIrr;usroO.GrpKcYr_rg!K&rm^q1rc8"Vrr;umrp'L@ro*kVroO-5r_WTqrqucUroj= 7=3Drq$-crnRLKrepcerp'Kpre:?9rn@AOrr2o_ro*k5rr;u5raYqIrmLfEro3qCrosFDrpg!= Nrj;Zdrj)OVri?$6ri,\mrp9X@qrn$Rr`K/Eqsj[Groa:IrosFGrosF5rh9=3DVrl+lrrhKI7= ril1trqQKQrp'LIrhoa#re1:IbQ$W&rqHE] rq?6hrpKcdre:?Troa:IrhKIBrm:ZCrosF?rn[S:rr;u]reCDMri,njroF(Ero3qDrr2o]ric= roO.Lrn7:9re^WgrqHElrp= Tj&re:?Yrq$-Rro=3D"6rnRM:ro3pWrdk'?roO%8ro=3D"Hrp9WpreUQ>roF(Yrr)ijrjr)er= jVn#rqcWnrp0R>rosFFrilBJrgNiUrqt(Al2UbW rq$-grr;urrlb:trf-p!rquclrpg!Kri5sRrlG*(rnRM-ro*k>rqQKGrh07Orlbrn[S/rndY0rp0R!rfmD^rnRMBroF(Fro!dTreCE= Wrpp'grqQKVrkSMirj;[nroEt7ro3qArndXZrfmDdroa:>rndY?rpTj2qiLg&qu?Zirp]osrf= -odrpp'^rq69Oro3qFroO-jrfmDdrosFO rr(7Em/R(`rq69gqu?ZGrg!Jrqucorr;uYrgs+EriQ1arq69Urn[S4rp'LBrj;= Zrrmh#$%ro*b;ro=3D"U= rr;tjr]pHsrr;uqrn7:1rc\:8rpKdcrqQKV ro*k>roO.!rj2UMroj@:rn[S7ro#IrmUl3ro= 3h8rp'L\roO-Fra#MZrq$-RrfmCereUR( rqZQ]ro*k3ro*kCroj@*rk8<[roa18ro*kArqHEQrhoa=3DrgWoRrq60grqZQ_rpKdVrqQ9br= r2Bdl2UbSrepb-rb2;frqcW_roj@?rnRM9rpp'Prji$+rm^r3rn[S6rqcWirl4qgr_redrdb!= Srh]URrl4rtro3q9roj@Gro*k5rp9X1rj)OrqZQarjVlRr_WT'rfmDXrf[8ero= 3qCrndY0ro=3D"Broj@>rlP/@rlP0(qr%JE rqHEBrfd>#rac"Rrj;[?rc8!arkJ?uro=3D"9rndY4roO.Grk\T-rke[$roO.>rq$-_rm(M5r= dt,urg*Q&ro*kMq#C6frr)`orqucjrr)Efl2UbKrg!ImriuA#rqHE^rpp'dqu?Zprj2TZrltH= 4roEtMri#gErf-oQrg!Ifr_rrq$-= Trp9X=3DreCE(rjr*`rn7:drgs+BrkABlrp'CDroj@Hrp0RPqtU0ho)IbMrquc2rdt,qrdt-'= reLK3rf-o9reCDurdk'Frji$;rh]UFrepckrp'LPrq69Sri5sErj_s:ri5t)rl"fNriQ1!riu= I/rgs+Irgs,+rmUklrjVlfre19mrp'LSrq69E rhoaWrkAB;rhKIjrjVmHrkeZ?rhoa\rdt-Erl"]Srh9=3DFrh08LqsOISrlG(areLK7rdOi`r= c%j\rd"Ksrh07grfI,+rd+R-rhTOlri?$ZreUQ[ro!eBrpKdLrl4r$rgWnMrd"KWrbDFKrb_X= Lrc8"Trq5a[j8],Trg!IIr]'mCr^-TMr^-TMr]pHHr_3<%rce?mre18]r^-UJrosF]roO.?rq= QKOrhKI4r`fA"rbqdlrdk&Yr_*5Wr]gBG ra#MBrce?nrdk&Ur`/rrrpg!Yro=3D"HrqHEBrgs+0r`]:ir^m**rf6u5ra5Xjr^m*$rcA'^r= dt-"r`oGSrmh#Jrp'L=3Drq69briH**r_$6rhBC`rf-o,rc.pHrdOj9rh9=3Darc%jOric>#rq69Irp]pXrg`smreCEWrjVm4rj= Mg9rjr*CqnW2orc%k%qoA]Urc\9BrilD%rq69KrpTjIrhKI5rgs,!rj)O-riuI)ri5t$ro3;E= _Z0VFre1:$q#C>qr]U6rrn7;Drpp'Lri5s3 rgNiCrpp'TroF(?rpKdSrp'LNrk\Serg3W7rosFCrm(M'r\shGro=3D"Nrpp'>rg!Irri,n[r= qQKarp9XDroF(Hrpp'/rcnFErpp'Vrp]p&ra5Y'rkJ@#rp0R"raGeQro3)?rltG'rl=3Dg6rl= +jura#NOrqucdro!d^rb2:krp_Z0VNrfI-7q#C?brc7uirac#?rnRLLraGe?ro`GDroa9S= rjr+,q#C?Sr`9"WrdXpnrm(Lur`&l=3Drq5OU ro3p:rl+R1rhTNTr]^=3DTrn7:brbML3rjh(hrlP/&rl=3D^3rdk&(r`oH0rnRLSral(1rmK3= o_Z0VBreLL)rr;ugrqucqroO-&r[e%Jrdaudrc8"Squ?Znrpp'[rqZ6ern%.6ri5tfrr;ulqu= ?ZBr_NMQrbDFWr`oGHrm(<=3Drqucdrp'LOrr2osrm:Xrrjr+/rr)ikrr;uorhTNQr^?a0rc\= 9Jri,nin,NCcrpg!Vrr;u5re^Wdqu?Zjrr;ud rdOhtr_*6=3DrcJ-OriH+udJq)`rj;ZZrmh#JrpKdYqu?Zeri5rrr]:%DrpTaarqcW`rp0RPr= q69brquZnrmq(4rh]VXrquc^rq?6hrpKcKr]C*UriuIoq#C?hrpKdLroF(CrqHEkrlk@mrjMh= +rqZQarq??krqcW9rc.oora,TYrquHhrr2fkrqHEYrp0R[rk8;frjhq+rqcWfrr;ukrkAAHr\= jaorn[SMcMtc]riQ0Krmh#HrosFQq#C?T rce?$ri>qrrr)ibrp0RPrpp'[rq69crr2osrmh"2rhBDQrqQKWrp9X^qu?Z1r^m)irm1B>rqc= W_roa:Aro=3D"@rq69erlP.krjMh+rqZQarp0RVrr;urrgs*LraYO!rr2]grq?6UrqZQ*reLK= _q#C?grqHPrqQBTrq60grl4q9ra#NQ qu?Zorp]pNroO%#"rl=3DC*ric;lrcZB_VuQb[rdXo6ril;"rr'qqu= -Nlq#C?Bre^Wom/R']r^Hg%gAh08rmUl1 m/R'er^Zs0aT&1 endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 2682 1548 a currentpoint currentpoint translate 1 1.11214 div 1 1.11214 div scale neg exch neg exch translate 2682 1548 a 191 767 a Fy(An)37 b(order)-6 b(-based)39 b(algorithm)d(f)l(or)191 933 y(multiparty)g (synchr)m(onisation)191 1168 y Fx(Jos)5 b(\264)-35 b(e)21 b(A.)i(P)5 b(\264)-35 b(erez)687 1136 y Fw(\003)725 1168 y Fx(,)23 b(Raf)o(ael)f(Corchuelo)f(and)h(Miguel)g(T)-7 b(oro)191 1372 y Fv(Dep.)19 b(de)g(Lenguajes)h(y)f(Sistemas)g(Inform)6 b(\264)-31 b(aticos,)19 b(Univer)o(sidad)h(de)g(Se)o(villa,)191 1455 y(A)l(vda.)f(de)g(la)g(Reina)g(Mer)m(cedes,)h(s/n,)e(Se)o(villa)h (41012,)h(Spain)p 191 1624 3388 5 v 191 1932 a Fu(SUMMAR)m(Y)191 2064 y(Multiparty)c(interactions)i(ha)n(v)o(e)g(been)f(paid)g(much)g (attention)g(in)g(r)o(ecent)g(y)o(ears)i(because)f(they)f(pr)o(o)o (vide)g(the)h(user)f(with)g(a)191 2147 y(useful)d(mechanism)h(f)n(or)g (coordinating)g(a)g(number)f(of)i(entities)e(that)g(need)h(to)g (cooperate)h(in)e(order)h(to)g(achie)o(v)o(e)h(a)f(common)191 2230 y(goal.)24 b(In)f(this)f(article,)h(we)g(pr)o(esent)g(an)g (algorithm)h(f)n(or)f(implementing)g(them)g(that)g(impr)o(o)o(v)o(es)h (on)f(pr)o(e)o(vious)f(r)o(esults)h(in)191 2313 y(that)16 b(it)h(can)g(be)f(used)h(in)f(a)h(context)g(in)f(which)g(the)h(set)f (of)i(participants)d(in)i(an)f(interaction)h(cannot)g(be)f(kno)o(wn)g (at)h(compile)191 2396 y(time,)h(and)f(setting)g(up)g(communication)h (links)f(amongst)i(interaction)e(managers)i(is)f(costly)g(or)h (completely)f(impossible.)191 2479 y(W)-5 b(e)23 b(also)h(pr)o(esent)f (a)g(compr)o(ehensi)o(v)o(e)h(comparati)o(v)o(e)h(analysis)f(that)e (was)i(undertak)o(en)e(using)h(simulation)f(techniques,)191 2562 y(and)c(r)o(eport)h(on)f(the)h(perf)n(ormance)g(of)g(our)g(pr)o (ototype.)193 2753 y Ft(K)t(E)t(Y)j(W)s(O)t(R)t(D)t(S)t Fs(:)75 b(Multiparty)20 b(synchronisation;)g(coordination)h (algorithms;)e(dynamic)h(systems;)f(CORB)m(A)191 3203 y Fr(INTR)n(ODUCTION)191 3385 y Fq(Since)e(Hoare')-5 b(s)16 b(w)o(ork)g(on)g(coordinating)e(sequential)i(processes)h([13)n (],)g(interactions)f(ha)n(v)o(e)g(become)f(a)i(fundamental)191 3485 y(feature)26 b(in)h(man)o(y)f(languages)g(for)g(distrib)n(uted)g (computing.)f(Often,)h(the)o(y)g(are)h(bipartite)f(because)h(the)o(y)f (do)h(only)191 3584 y(in)m(v)n(olv)o(e)f(tw)o(o)h(entities)h(that)f (need)f(to)i(synchronise)d(before)h(e)o(xchanging)e(data,)j(b)n(ut)g (this)h(concept)d(can)i(be)h(easily)191 3684 y(e)o(xtended)g(to)i(an)g (arbitrary)e(number)g(of)i(entities)g(that)g(need)f(to)h(agree)f(and)h (cooperate)e(to)i(achie)n(v)o(e)e(a)j(common)191 3784 y(goal.)18 b(These)g(interactions)f(are)i(usually)f(said)g(to)h(be)f (multiparty)-5 b(,)17 b(and)h(the)o(y)f(pro)o(vide)g(a)i(higher)e(le)n (v)o(el)h(of)g(abstraction)191 3883 y(because)h(the)o(y)h(allo)n(w)g (to)g(e)o(xpress)g(comple)o(x)e(cooperations)g(as)j(atomic)f(units.)274 3991 y(A)e(taxonomy)c(of)j(languages)f(of)n(fering)f(linguistic)h (support)g(for)g(multiparty)g(interactions)g(can)h(be)g(found)e(in)i ([16)o(],)191 4091 y(and)j(one)h(of)f(the)h(recentest)g(ones)f(is)i(IP) f([12)o(].)g(It)g(has)g(also)g(attracted)g(the)g(attention)f(of)g(the)h (designers)f(of)h(the)g(well\226)191 4191 y(kno)n(wn)27 b(Catalysis)i(method)e([11)n(],)i(which)e(is)j(a)e(ne)o(xt)g (generation)e(approach)g(for)i(the)g(systematic)g(UML\226based,)191 4290 y(b)n(usiness\226dri)n(v)o(en)23 b(de)n(v)o(elopment)g(of)j (component\226based)c(systems.)k(Catalysis)h(has)f(been)f(used)h(by)f (F)o(ortune)g(500)191 4390 y(companies)d(in)i(\002elds)g(including)d (\002nance,)i(insurance,)f(manuf)o(acturing,)e(embedded)h(systems,)j (process)f(control,)p 191 4649 499 3 v 191 4731 a Fp(\003)227 4754 y FB(Correspondence)d(to:)e(jperez@lsi.us.es)195 4832 y(Contract/grant)26 b(sponsor:)c(Spanish)h(Interministerial)j (Commission)c(of)f(Science)j(and)e(T)-5 b(echnology;)24 b(contract/grant)i(number:)d(TIC\2262000\226)191 4907 y(1106\226C02\22601.)p 191 5006 3388 5 v 191 5189 a Fs(Cop)o(yright)534 5187 y(c)512 5189 y Fo(\015)18 b Fs(2001)j(John)e(W)m(ile)o(y)g(&)f (Sons,)h(Ltd.)p eop %%Page: 2 2 2 1 bop 191 299 a Fq(2)149 b FB(J.A.)16 b(P)552 285 y(\264)543 299 y(EREZ,)f(R.)h(CORCHUELO,)g(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(\003ight)24 b(simulation,)e(telecommunication,)f(systems)j (management)e(or)h(tra)n(v)o(el)h(and)f(transportation,)e(thus)j(pro)o (ving)191 706 y(the)c(adequac)o(y)e(of)i(this)h(no)o(v)o(el)e (interaction)f(model)i(in)g(so)h(dif)n(ferent)d(application)h(domains.) 274 807 y(In)i(this)h(article,)f(we)h(present)e(an)i(algorithm)d(that)j (deals)f(with)h(the)f(multiparty)f(synchronisation)f(problem.)g(Our)191 907 y(solution)d(impro)o(v)o(es)f(on)h(others)h(in)g(that)g(it)g(does)g (not)f(require)g(the)h(set)g(of)g(entities)g(participating)e(in)i(an)g (interaction)f(to)191 1007 y(be)f(de\002ned)f(at)i(compile)f(time,)g (there)g(is)h(no)f(need)f(for)h(communication)d(links)k(amongst)e (interaction)g(managers,)f(and)191 1106 y(entities)k(are)f(not)g (directly)f(dependent)f(on)i(each)g(other)m(,)e(which)i(mak)o(es)g(our) g(solution)f(suited)h(for)f(open)h(conte)o(xts.)f(W)-7 b(e)191 1206 y(also)21 b(present)g(the)g(results)g(of)g(an)g(e)o (xperimental)e(analysis)i(on)g(the)g(performance)d(of)j(the)g (algorithm,)e(and)h(compare)191 1306 y(it)28 b(with)g(tw)o(o)g (state-of-the-art)d(proposals.)h(The)i(e)o(xperiments)d(measured)i(a)h (number)d(of)j(metrics)f(as)h(a)g(result)g(of)191 1405 y(v)n(ariations)h(in)h(the)g(le)n(v)o(el)g(of)f(potential)g(or)h(run)f (time)h(con\003ict)g(and)f(sho)n(ws)h(that)g(it)h(performs)d(well)j (and)e(can)h(be)191 1505 y(applied)19 b(in)h(real\226w)o(orld)f (problems.)191 1814 y Fr(MUL)-8 b(TIP)i(AR)m(TY)22 b(INTERA)-5 b(CTIONS)22 b(IN)f(A)g(NUTSHELL)191 2009 y Fq(In)28 b(this)i(section,)e (we)h(introduce)e(the)h(main)h(features)f(of)g(the)h(multiparty)e (interaction)g(model)h(we)h(deal)g(with.)g(It)191 2109 y(is)j(quite)e(usual)h(in)g(the)f(languages)g(described)f(in)i([16)o (],)f(being)g(the)h(only)f(dif)n(ference)f(that)i(the)f(identity)g(of)h (the)191 2208 y(entities)h(that)f(can)g(participate)f(in)h(an)g (interaction)f(is)i(only)e(kno)n(wn)g(at)i(run)e(time.)h(W)-7 b(e)32 b(think)f(that)g(this)h(feature)191 2308 y(mak)o(es)22 b(the)g(model)g(more)f(general)h(and)f(introduces)g(a)i(number)d(of)i (problems)f(that)i(ha)n(v)o(e)e(not)h(been)g(addressed)f(by)191 2408 y(other)e(authors.)274 2509 y(In)h(this)i(conte)o(xt,)d(the)i (terms)f Fn(entity)h Fq(or)f Fn(participant)h Fq(refer)f(to)h(an)o(y)f (computing)e(artif)o(act)j(that)g(is)g(able)g(to)g(perform)191 2609 y(local)30 b(computations)e(and)h(decides)g(autonomously)e(when)j (it)g(is)h(interested)e(in)h(participating)f(in)h(a)g(number)e(of)191 2709 y(interactions.)19 b(Multiparty)g(interactions)g(are)h(usually)f (pro)o(vided)f(as)j(guards)e(in)h(multi-choice)e(commands,)g(so)j(that) 191 2808 y(an)31 b(entity)g(may)f(be)h(willing)g(to)g(participate)f(in) i(se)n(v)o(eral)e(interactions)g(at)i(the)f(same)g(time,)g(although)e (only)h(one)191 2908 y(shall)e(be)f(\002nally)g(e)o(x)o(ecuted.)e(This) j(model)e(is)i(thus)f(well-suited)g(to)h(coordinate)d(processes,)i (threads,)f(objects)h(or)191 3007 y(components,)18 b(as)j(well.)274 3109 y(Each)d(interaction)f(is)i(identi\002ed)f(by)g(an)g Fn(inter)o(action)f(name)p Fq(,)h(and)f(has)i(a)g(\002x)o(ed)f(number)e (of)i(participants)g(referred)191 3209 y(to)34 b(as)h(its)f Fn(car)m(dinality)p Fq(.)f(Often,)g(we)i(refer)e(to)h(interactions)f (with)h(cardinality)e Fm(n)i Fq(as)h Fm(n)p Fq(\226party)d (interactions.)h(In)191 3308 y(general,)25 b Fm(n)i Fq(can)g(be)g (assumed)f(to)h(be)g(greater)e(or)i(equal)f(than)g(tw)o(o,)h(although)e (the)i(results)g(we)g(sho)n(w)f(w)o(ork)g(well)191 3408 y(with)h(single-party)f(interactions.)g(F)o(or)g(an)h Fm(n)p Fq(\226party)f(interaction)g(to)h(become)f Fn(enabled)p Fq(,)g Fm(n)h Fq(participants)f(need)h(to)191 3508 y(be)f Fn(of)o(fering)g(participation)e Fq(in)j(it.)g(Once)f(se)n(v)o(eral)g (entities)g(ha)n(v)o(e)g(been)g(coordinated,)e(communication)f(depends) 191 3607 y(completely)35 b(on)i(the)f(constructs)g(pro)o(vided)f(by)h (the)h(language)e(under)g(consideration,)g(b)n(ut)h(most)h(ha)n(v)o(e)g (been)191 3707 y(designed)19 b(so)h(that)h(it)g(is)g(relati)n(v)o(ely)e (easy)h(to)g(determine)f(data)h(communication)e(requirements.)274 3809 y(Roughly)f(speaking,)f(a)j(multiparty)d(interaction)h(can)h(be)g (vie)n(wed)f(as)i(a)g(set)g(of)f(data)g(e)o(xchange)d(actions)j(that)h (need)191 3908 y(to)f(be)g(e)o(x)o(ecuted)e(jointly)h(and)h (coordinately)d(by)j(a)g(number)e(of)i(entities,)g(each)f(of)h(which)f (must)h(be)g(ready)f(to)h(e)o(x)o(ecute)191 4008 y(its)26 b(o)n(wn)f(action)g(so)h(that)f(the)g(interaction)f(can)h(occur)-5 b(.)25 b(An)g(attempt)g(to)h(participate)e(in)i(an)f(interaction)f (delays)h(an)191 4108 y(entity)i(until)g(all)h(other)f(participants)f (are)i(a)n(v)n(ailable,)e(and)h(after)g(an)g(interaction)g(is)h(e)o(x)o (ecuted,)d(the)j(participating)191 4207 y(entities)21 b(e)o(xchange)d(some)i(data)g(and)f(continue)g(their)h(local)g (computations)e(on)i(their)g(o)n(wn)g(accord.)274 4309 y(It)e(is)g(w)o(orth)f(noting)f(that)i(an)g(interaction)e(being)g (enabled)h(does)g(not)g(amount)f(to)i(its)g(e)o(x)o(ecution.)e(Figure)g (1)i(depicts)191 4408 y(a)23 b(simple)h(system)f(composed)e(of)i(four)f (participants,)g(a)h(tw)o(o\226party)f(interaction)g(and)g(a)i (three\226party)c(interaction.)191 4508 y(Notice)i(that)g(participant)e Fm(P)1012 4520 y Fl(1)1072 4508 y Fq(is)j(of)n(fering)d(participation)g (in)i Fm(I)2003 4520 y Fl(1)2041 4508 y Fq(,)g(whereas)g Fm(P)2432 4520 y Fl(3)2492 4508 y Fq(and)f Fm(P)2687 4520 y Fl(4)2747 4508 y Fq(are)h(of)n(fering)e(participation)191 4608 y(in)k Fm(I)316 4620 y Fl(2)354 4608 y Fq(,)g(and)g Fm(P)597 4620 y Fl(2)659 4608 y Fq(is)h(of)n(fering)d(participation)h (in)h(either)g Fm(I)1813 4620 y Fl(1)1875 4608 y Fq(or)g Fm(I)2005 4620 y Fl(2)2043 4608 y Fq(.)g(This)g(means)g(that)g(these)h (interactions)e(cannot)g(be)191 4707 y(e)o(x)o(ecuted)17 b(simultaneously)g(and)i(the)o(y)f(are)h(said)g(to)g(be)g Fn(con\003icting)e(ones)p Fq(.)i(Thus)g(an)f(election)h(under)e(them)i (needs)g(to)191 4807 y(be)k(held)f(to)h(decide)f(which)g(one)g(should)g (be)h(e)o(x)o(ecuted.)e(The)h(one)g(that)h(is)h(e)o(x)o(ecuted)d(is)i (referred)e(to)i(as)h(the)f Fn(winner)191 4907 y(inter)o(action)c Fq(and)g(the)i(other)e(as)i(the)f Fn(loser)h(inter)o(action)p Fq(.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f (Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 3 3 3 2 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1186 299 a FB(AN)16 b(ORDER-B)n(ASED)g(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)150 b Fq(3)p 191 473 3388 5 v 1038 1378 a @beginspecial 56.689999 @llx 56.689999 @lly 421.170013 @urx 197.830002 @ury 2032 @rwi @setspecial %%BeginDocument: simp-syst.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip028.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:3 2/12/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 421.17 197.83 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 197.855 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 sl n 312 149 M 318 148 L 324 146 L 329 142 L 333 137 L 335 131 L 336 125 L 336 54 L 335 48 L 333 42 L 329 38 L 324 34 L 318 31 L 312 31 L 183 31 L 177 31 L 171 34 L 166 38 L 162 42 L 160 48 L 159 54 L 159 125 L 160 131 L 162 137 L 166 142 L 171 146 L 177 148 L 183 149 L 312 149 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [58.602 0 0 -58.5 0 0]/Times-Roman MF (P)222 107 MS [38.648 0 0 -39 0 0]/Times-Roman MF (1)254 127 MS n 1177 149 M 1183 148 L 1189 146 L 1194 142 L 1197 137 L 1200 131 L 1200 125 L 1200 54 L 1200 48 L 1197 42 L 1194 38 L 1189 34 L 1183 31 L 1177 31 L 1047 31 L 1041 31 L 1035 34 L 1030 38 L 1026 42 L 1024 48 L 1023 54 L 1023 125 L 1024 131 L 1026 137 L 1030 142 L 1035 146 L 1041 148 L 1047 149 L 1177 149 L cp gs 1 g e gr s [58.602 0 0 -58.5 0 0]/Times-Roman MF (P)1086 107 MS [38.648 0 0 -39 0 0]/Times-Roman MF (2)1118 127 MS 1 j 1 setlinecap 6 sl n 336 90 M 519 90 L CM 0.496 0.5 scale s SM n 516 76 M 556 90 L 516 103 L 516 76 L cp e n 1023 90 M 827 90 L CM 0.496 0.5 scale s SM n 830 103 M 790 90 L 830 76 L 830 103 L cp e n 1112 149 M 1112 342 L CM 0.496 0.5 scale s SM n 1125 338 M 1112 379 L 1098 338 L 1125 338 L cp e 1 sl n 1650 565 M 1656 565 L 1662 562 L 1667 558 L 1670 554 L 1673 548 L 1674 542 L 1674 456 L 1673 450 L 1670 444 L 1667 439 L 1662 436 L 1656 433 L 1650 433 L 1520 433 L 1514 433 L 1508 436 L 1503 439 L 1500 444 L 1497 450 L 1496 456 L 1496 542 L 1497 548 L 1500 554 L 1503 558 L 1508 562 L 1514 565 L 1520 565 L 1650 565 L cp gs 1 g e gr s [58.602 0 0 -58.5 0 0]/Times-Roman MF (P)1559 516 MS [38.648 0 0 -39 0 0]/Times-Roman MF (3)1591 536 MS n 705 564 M 711 563 L 717 561 L 722 557 L 725 552 L 728 546 L 729 540 L 729 458 L 728 451 L 725 446 L 722 441 L 717 437 L 711 435 L 705 434 L 575 434 L 569 435 L 563 437 L 558 441 L 555 446 L 552 451 L 551 458 L 551 540 L 552 546 L 555 552 L 558 557 L 563 561 L 569 563 L 575 564 L 705 564 L cp gs 1 g e gr s [58.602 0 0 -58.5 0 0]/Times-Roman MF (P)614 516 MS [38.648 0 0 -39 0 0]/Times-Roman MF (4)646 536 MS 6 sl n 729 499 M 958 499 L CM 0.496 0.5 scale s SM n 955 485 M 996 499 L 955 512 L 955 485 L cp e n 1496 499 M 1266 499 L CM 0.496 0.5 scale s SM n 1270 512 M 1229 499 L 1270 485 L 1270 512 L cp e 1 sl n 586 90 M 587 77 L 590 64 L 594 52 L 601 40 L 609 30 L 619 21 L 629 14 L 641 8 L 654 4 L 667 2 L 680 2 L 693 4 L 705 8 L 717 14 L 728 21 L 737 30 L 745 40 L 752 52 L 757 64 L 760 77 L 760 90 L 760 103 L 757 115 L 752 128 L 745 139 L 737 149 L 728 158 L 717 165 L 705 171 L 693 175 L 680 177 L 667 177 L 654 175 L 641 171 L 629 165 L 619 158 L 609 149 L 601 139 L 594 128 L 590 115 L 587 103 L 586 90 L cp gs 1 g e gr s [58.602 0 0 -58.5 0 0]/Times-Roman MF (I)653 107 MS [38.648 0 0 -39 0 0]/Times-Roman MF (1)673 127 MS n 730 115 M 790 115 L 790 64 L 730 64 L 730 115 L cp gs 1 g e gr s n 556 115 M 616 115 L 616 64 L 556 64 L 556 115 L cp gs 1 g e gr s n 1024 499 M 1025 486 L 1028 473 L 1033 461 L 1039 450 L 1047 439 L 1057 431 L 1068 423 L 1079 418 L 1092 414 L 1105 412 L 1118 412 L 1131 414 L 1143 418 L 1155 423 L 1166 431 L 1175 439 L 1184 450 L 1190 461 L 1195 473 L 1198 486 L 1199 499 L 1198 512 L 1195 525 L 1190 537 L 1184 548 L 1175 558 L 1166 567 L 1155 575 L 1143 580 L 1131 584 L 1118 586 L 1105 586 L 1092 584 L 1079 580 L 1068 575 L 1057 567 L 1047 558 L 1039 548 L 1033 537 L 1028 525 L 1025 512 L 1024 499 L cp gs 1 g e gr s [58.602 0 0 -58.5 0 0]/Times-Roman MF (I)1092 516 MS [38.648 0 0 -39 0 0]/Times-Roman MF (2)1111 536 MS n 996 525 M 1056 525 L 1056 473 L 996 473 L 996 525 L cp gs 1 g e gr s n 1169 525 M 1229 525 L 1229 473 L 1169 473 L 1169 525 L cp gs 1 g e gr s n 1137 439 M 1137 379 L 1086 379 L 1086 439 L 1137 439 L cp gs 1 g e gr s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 653 1558 a Fs(Figure)19 b(1.)g(A)f(system)i(composed)g(of) f(four)g(participants)h(and)f(tw)o(o)g(con\003icting)h(interactions.) 274 1828 y Fq(In)33 b(order)f(to)h(implement)g(multiparty)e (interactions,)h(we)i(need)f(to)g(de)n(vise)g(an)g(algorithm)f(for)h (coordinating)191 1927 y(entities)21 b(such)e(that)i(the)f(follo)n (wing)f(properties)f(are)i(satis\002ed:)191 2111 y Fr(Exclusion:)41 b Fq(con\003icting)24 b(interactions,)g(i.e.,)g(interactions)g(with)i (a)f(common)e(participant,)h(cannot)g(be)h(e)o(x)o(ecuted)399 2211 y(simultaneously)-5 b(.)191 2378 y Fr(Pr)o(ogr)o(ess:)39 b Fq(if)21 b(an)f(interaction)f(is)i(enabled,)d(i.e.,)i(all)h(of)f(its) h(participants)f(are)g(of)n(fering)e(participation)g(in)j(it,)f(it)h (shall)399 2478 y(e)n(v)o(entually)e(become)h(disabled,)h(being)f(it)i (because)f(it)h(is)h(e)o(x)o(ecuted)c(or)i(an)h(entity)f(of)n(fering)e (participation)h(in)399 2577 y(it)g(commits)g(to)h(another)d (interaction.)191 2745 y Fr(Synchr)o(onisation:)39 b Fq(if)34 b(an)g(entity)g(e)o(x)o(ecutes)e(an)i(interaction,)e(the)i (rest)g(of)g(the)g(entities)g(participating)e(in)i(that)399 2845 y(interaction)18 b(shall)j(e)o(x)o(ecute)e(it.)191 3012 y Fr(Idleness:)42 b Fq(an)23 b(acti)n(v)o(e)f(entity)-5 b(,)21 b(i.e.,)i(an)f(entity)g(that)h(is)g(performing)d(local)i (computations,)f(cannot)g(commit)h(to)h(an)o(y)399 3112 y(interaction,)18 b(i.e.,)i(it)h(has)f(to)h(be)f(idle)g(to)h(commit)e (to)h(an)g(interaction.)191 3412 y Fr(OUR)g(PR)n(OPOSAL:)f Fm(\013)p Fr(\226cor)o(e)191 3611 y Fq(In)j(this)h(section)f(we)g (present)g(a)h(comprehensi)n(v)o(e)c(description)h(of)i(our)g (algorithm.)e(W)-7 b(e)24 b(call)f(it)g Fm(\013)p Fq(\226core,)e(and)h (it)h(has)191 3710 y(been)g(de)n(vised)g(to)i(detect)e(enabled)g (interactions)g(and)h(select)g(amongst)f(con\003icting)g(ones)h(in)g(a) g(simple,)g(ef)n(fecti)n(v)o(e)191 3810 y(w)o(ay)-5 b(.)24 b(It)h(considers)e(an)i(entity)f(that)g(of)n(fers)g(participation)f(in) h(more)g(than)g(one)g(interaction)f(as)i(a)g Fn(shar)m(ed)f(r)m(esour)m (ce)191 3910 y Fq(amongst)g(a)h(number)f(of)h(coordinators)d (responsible)i(for)g(managing)g(those)g(interactions.)g(F)o(or)h(an)g (interaction)f(to)191 4009 y(be)f(e)o(x)o(ecuted,)e(its)k (corresponding)20 b(coordinator)g(must)k(ensure)e(e)o(xclusi)n(v)o(e)g (access)i(to)g(all)g(of)f(its)h(participants,)e(i.e.,)191 4109 y(coordinators)i(must)i(compete)e(for)i(their)g(shared)f (participants)g(so)h(that)g(the)o(y)f(can)h(e)o(x)o(ecute)f(the)h (interaction)f(the)o(y)191 4209 y(manage.)191 4409 y Fr(The)c(o)o(v)o(erall)f(pictur)o(e)191 4608 y Fq(W)-7 b(e)42 b(assume)e(that)h(each)f(entity)h(participating)e(in)i(an)f (interaction)f(runs)i(independently)c(from)j(each)g(other)m(,)191 4707 y(and)33 b(that)h(each)f(interaction)g(is)h(managed)e(by)h(a)i (dif)n(ferent)d(independent)f Fn(coor)m(dinator)p Fq(.)g(The)j (communication)191 4807 y(between)26 b(coordinators)f(and)h (participants)h(is)h(modeled)d(by)i(means)g(of)f Fn(async)o(hr)l(onous) f(messa)o(g)o(es)j Fq(because)e(this)191 4907 y(communication)17 b(primiti)n(v)o(e)i(is)i(a)n(v)n(ailable)f(on)g(almost)g(e)n(v)o(ery)f (platform.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)d FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,) f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 4 4 4 3 bop 191 299 a Fq(4)149 b FB(J.A.)16 b(P)552 285 y(\264)543 299 y(EREZ,)f(R.)h(CORCHUELO,)g(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 274 606 a Fq(Before)h(presenting)f Fm(\013)p Fq(\226core)g(in)i(detail,)f (we)h(sk)o(etch)f(an)g(o)o(v)o(erall)g(picture)f(of)h(the)h(main)f (ideas)g(behind)f(it)i(by)f(means)191 706 y(of)k(a)h(simple)g(e)o (xample.)e(Figure)h(2)h(sho)n(ws)f(a)h(typical)g(scenario)f(for)g(the)g (system)h(depicted)f(in)g(Figure)g(1,)h(and)f(T)-7 b(able)191 805 y(I)20 b(describes)g(the)g(messages)h Fm(\013)p Fq(\226core)e (uses.)1366 1114 y Fs(T)-6 b(able)19 b(I.)f(Messages)i(used)g(by)f Fk(\013)p Fs(\226core.)p 302 1250 3166 5 v 352 1333 a Fu(Message)434 b(Description)p 302 1385 3166 3 v 352 1468 a Fk(AC)5 b(K)g(R)q(E)t(F)346 b Fs(Message)37 b(sent)e(from)h(a)f (coordinator)h(to)g(ackno)n(wledge)h(it)e(has)g(got)h(a)f Fk(R)q(E)t(F)11 b(U)d(S)t(E)1055 1551 y Fs(message)20 b(from)f(a)g(participant.)352 1634 y Fk(LO)r(C)5 b(K)466 b Fs(Message)29 b(sent)f(from)f(a)g(coordinator)i(to)e(a)h(shared)g (participant)g(to)f(request)h(e)o(xclusi)n(v)o(e)1055 1717 y(access)20 b(to)f(it.)352 1800 y Fk(O)r(F)11 b(F)g(E)t(R)404 b Fs(Message)33 b(sent)f(from)f(a)h(participant)g(to)f(a)h(number)g(of) g(coordinators)h(to)e(of)n(fer)h(them)1055 1883 y(participation)20 b(in)e(the)h(interactions)h(the)o(y)f(manage.)352 1966 y Fk(O)r(K)578 b Fs(Message)35 b(sent)f(from)f(a)g(participant)h(to)g (a)f(coordinator)i(to)e(notify)h(that)f(it)g(grants)h(it)1055 2049 y(e)o(xclusi)n(v)o(e)20 b(access.)f(This)g(message)h(is)e(sent)h (as)g(a)g(reply)g(to)g(a)g Fk(LO)r(C)5 b(K)25 b Fs(message.)352 2132 y Fk(P)11 b(AR)q(T)g(I)6 b(C)f(I)h(P)11 b(AT)g(E)99 b Fs(Message)25 b(sent)g(from)f(a)f(participant)i(to)f(only)g(one)h (coordinator)g(to)f(inform)g(it)f(that)h(it)g(is)1055 2215 y(only)c(interested)f(in)g(the)g(interaction)g(it)f(manages.)352 2298 y Fk(R)q(E)t(F)11 b(U)d(S)t(E)355 b Fs(Message)20 b(sent)f(from)g(a)g(participant)g(to)g(a)g(coordinator)h(to)f(cancel)h (an)f(of)n(fer)l(.)352 2381 y Fk(S)t(T)11 b(AR)q(T)434 b Fs(Message)30 b(sent)e(from)h(a)f(coordinator)i(to)e(a)h(lock)o(ed)g (participant)g(to)f(notify)h(it)f(that)g(the)1055 2464 y(interaction)19 b(it)g(manages)h(may)f(start.)352 2547 y Fk(U)8 b(N)g(LO)r(C)d(K)337 b Fs(Message)30 b(sent)e(from)g(a)g (coordinator)i(to)e(a)g(shared)h(participant)g(to)f(release)g(e)o (xclusi)n(v)o(e)1055 2631 y(access.)p 302 2684 3166 5 v 274 3006 a Fq(In)g(this)h(scenario,)f Fm(P)901 3018 y Fl(1)967 3006 y Fq(is)i(the)e(\002rst)i(entity)e(ready)f(to)i (participate)e(in)i Fm(I)2375 3018 y Fl(1)2413 3006 y Fq(.)g(Since)f(it)i(is)f(only)f(interested)g(in)g(this)191 3105 y(interaction,)21 b(it)h(noti\002es)h(its)g(of)n(fer)e(to)h (coordinator)d Fm(I)1737 3117 y Fl(1)1798 3105 y Fq(by)j(means)f(of)h (a)h Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)26 b Fq(message,)c(and)f(then)191 3205 y(w)o(aits)j(for)e(a)h Fm(S)5 b(T)12 b(AR)q(T)33 b Fq(message)23 b(before)e(be)o(ginning)f (the)j(e)o(x)o(ecution)e(of)h(this)i(interaction.)d(Assume)i(that)g Fm(P)3384 3217 y Fl(2)3445 3205 y Fq(gets)191 3304 y(then)c(ready)g(to) h(participate)f(in)h(either)g Fm(I)1346 3316 y Fl(1)1404 3304 y Fq(or)f Fm(I)1529 3316 y Fl(2)1567 3304 y Fq(.)h(Since)g(it)h (of)n(fers)e(participation)f(to)i(more)f(than)g(one)g(coordinator)m(,)e (it)191 3404 y(sends)i(tw)o(o)g Fm(O)r(F)12 b(F)g(E)5 b(R)21 b Fq(messages)e(by)g(means)g(of)f(which)h(the)g(coordinators)d (that)j(recei)n(v)o(e)f(them)h(can)g(infer)f(that)h(this)191 3504 y(participant)g(is)i(shared)e(with)i(others,)e(although)f(the)o(y) i(need)f(not)h(kno)n(w)f(each)h(other)g(directly)-5 b(.)274 3607 y(As)16 b(soon)f(as)h(coordinator)d Fm(I)1075 3619 y Fl(1)1129 3607 y Fq(recei)n(v)o(es)h(the)i(of)n(fers)e(from)h(its)h (tw)o(o)g(participants,)e(it)i(detects)g(that)f Fm(I)3059 3619 y Fl(1)3113 3607 y Fq(is)h(enabled)e(and)191 3707 y(tries)23 b(to)f(lock)g Fm(P)663 3719 y Fl(2)723 3707 y Fq(by)g(sending)f(it)h(a)h Fm(LO)r(C)6 b(K)29 b Fq(message.)21 b(There)h(is)h(no)e(need)h(to)g(lock)g Fm(P)2735 3719 y Fl(1)2795 3707 y Fq(because)g(this)g(participant)191 3807 y(is)h(interested)f(in)h(only)e(one)h(interaction;)f(thus)i(it)g (is)g(not)f(a)h(shared)f(participant.)f(Assume)h(that)h Fm(P)3045 3819 y Fl(3)3105 3807 y Fq(and)f Fm(P)3301 3819 y Fl(4)3362 3807 y Fq(decide)191 3906 y(then)f(to)h(participate)e (in)i Fm(I)938 3918 y Fl(2)998 3906 y Fq(and)f(send)h(a)g Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)25 b Fq(message)c(to)h (its)h(coordinator)-5 b(.)19 b(It)j(then)f(detects)h(that)191 4006 y(it)f(is)g(also)f(enabled,)f(and)h(tries)h(to)f(lock)g Fm(P)1395 4018 y Fl(2)1432 4006 y Fq(,)h(too.)274 4110 y(Unfortunately)-5 b(,)17 b(the)k Fm(LO)r(C)6 b(K)27 b Fq(message)21 b(sent)g(to)g Fm(P)1781 4122 y Fl(2)1840 4110 y Fq(by)g Fm(I)1981 4122 y Fl(1)2040 4110 y Fq(is)g(recei)n(v)o (ed)f(before)f(the)i Fm(LO)r(C)6 b(K)27 b Fq(from)20 b Fm(I)3276 4122 y Fl(2)3335 4110 y Fq(arri)n(v)o(es.)191 4209 y(Thus,)37 b Fm(P)469 4221 y Fl(2)544 4209 y Fq(noti\002es)g Fm(I)862 4221 y Fl(1)938 4209 y Fq(that)g(it)h(accepts)f(to)g(be)g (lock)o(ed)g(by)f(means)h(of)g(an)g Fm(O)r(K)44 b Fq(message,)37 b(b)n(ut)g(it)h(does)f(not)191 4309 y(ackno)n(wledge)17 b(the)j(lock)f(message)g(recei)n(v)o(ed)g(later)g(from)g(coordinator)e Fm(I)2320 4321 y Fl(2)2358 4309 y Fq(,)j(b)n(ut)f(records)g(it,)h(just) g(in)g(case)g Fm(I)3299 4321 y Fl(1)3357 4309 y Fq(cannot)191 4408 y(be)h(e)o(x)o(ecuted.)f(Coordinator)f Fm(I)1086 4420 y Fl(2)1145 4408 y Fq(w)o(aits)k(until)e(it)h(gets)g(an)f(answer)g (from)f Fm(P)2333 4420 y Fl(2)2393 4408 y Fq(before)g(going)g(on,)h (thus)g(it)h(cannot)e(lock)191 4508 y(a)25 b(participant)f(if)h (another)e(lock)h(is)i(still)g(pending.)c(When)j Fm(I)1956 4520 y Fl(1)2019 4508 y Fq(recei)n(v)o(es)f(the)h Fm(O)r(K)31 b Fq(message,)25 b(it)g(kno)n(ws)f(that)h(it)h(has)191 4608 y(e)o(xclusi)n(v)o(e)i(access)i(to)g(its)h(shared)e(participant,)f (and)h(thus)h(sends)f(a)h Fm(S)5 b(T)12 b(AR)q(T)40 b Fq(message)30 b(to)g Fm(P)3021 4620 y Fl(1)3088 4608 y Fq(and)f Fm(P)3291 4620 y Fl(2)3329 4608 y Fq(.)h(When)191 4707 y(the)g(shared)g(participant)e Fm(P)1009 4719 y Fl(2)1078 4707 y Fq(recei)n(v)o(es)h(the)h Fm(S)5 b(T)12 b(AR)q(T)41 b Fq(message)30 b(from)f Fm(I)2382 4719 y Fl(1)2420 4707 y Fq(,)h(it)h(kno)n(ws)f(that)g(it)h(can)f(e)o(x)o (ecute)f(that)191 4807 y(interaction)20 b(and)g(cancels)h(the)g(of)n (fer)e(made)i(to)g Fm(I)1602 4819 y Fl(2)1661 4807 y Fq(by)g(sending)e(it)j(a)f Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)26 b Fq(message)21 b(that)g(is)h(ackno)n(wledged)191 4907 y(by)e(means)g(of)g(an)g Fm(AC)6 b(K)g(R)q(E)f(F)32 b Fq(message.)p 191 5006 3388 5 v 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f (Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 5 5 5 4 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1186 299 a FB(AN)16 b(ORDER-B)n(ASED)g(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)150 b Fq(5)p 191 473 3388 5 v 699 1844 a @beginspecial 56.689999 @llx 56.689999 @lly 343.670013 @urx 192.419998 @ury 2845 @rwi @setspecial %%BeginDocument: simp-scen.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip029.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:6 2/12/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 343.67 192.42 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 192.469 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 j 1 setlinecap 6 sl n 202 96 M 202 559 L CM 0.246 0.25 scale s SM n 424 107 M 424 559 L CM 0.246 0.25 scale s SM n 648 96 M 647 563 L CM 0.246 0.25 scale s SM n 866 107 M 866 559 L CM 0.246 0.25 scale s SM n 1088 100 M 1088 561 L CM 0.246 0.25 scale s SM n 203 160 M 403 187 L CM 0.246 0.25 scale s SM n 402 180 M 422 190 L 401 194 L 402 180 L cp e %%IncludeFont: Times-Roman [24.777 3.348 3.352 -24.777 0 0]/Times-Roman MF (P)235 157 MS (A)248 159 MS (R)266 161 MS (T)282 164 MS (I)297 166 MS = (C)305 167 MS (I)321 169 MS (P)329 170 MS (A)343 172 MS (T)361 174 MS = (E)375 176 MS n 1088 146 M 884 216 L CM 0.246 0.25 scale s SM n 888 222 M 866 222 L 883 209 L 888 222 L cp e [23.656 -8.102 -8.098 -23.656 0 0]/Times-Roman MF (P)900 203 MS (A)913 198 MS (R)930 193 MS (T)945 187 MS (I)960 182 MS = (C)967 180 MS (I)983 175 MS (P)990 172 MS (A)1003 167 MS (T)1020 162 MS = (E)1034 157 MS n 424 216 M 630 249 L CM 0.246 0.25 scale s SM n 629 242 M 648 252 L 627 255 L 629 242 L cp e [24.695 3.91 3.914 -24.695 0 0]/Times-Roman MF (L)504 221 MS (O)518 224 MS (C)536 227 MS (K)552 229 MS n 865 257 M 665 301 L CM 0.246 0.25 scale s SM n 668 307 M 647 305 L 666 294 L 668 307 L cp e [24.438 -5.285 -5.281 -24.438 0 0]/Times-Roman MF (L)722 281 MS (O)736 278 MS (C)754 274 MS (K)770 270 MS n 647 263 M 442 302 L CM 0.246 0.25 scale s SM n 445 308 M 424 305 L 442 295 L 445 308 L cp e [24.578 -4.602 -4.598 -24.578 0 0]/Times-Roman MF (O)516 280 MS (K)534 277 MS n 648 399 M 848 437 L CM 0.246 0.25 scale s SM n 848 430 M 866 441 L 845 444 L 848 430 L cp e [24.57 4.641 4.645 -24.57 0 0]/Times-Roman MF (R)713 404 MS (E)729 407 MS (F)744 410 MS (U)758 413 MS (S)776 416 MS = (E)789 419 MS n 866 470 M 666 508 L CM 0.246 0.25 scale s SM n 669 515 M 648 512 L 667 501 L 669 515 L cp e [24.57 -4.645 -4.641 -24.57 0 0]/Times-Roman MF (A)707 493 MS (C)725 489 MS (K)741 486 MS (R)759 483 MS (E)776 480 MS = (F)790 477 MS n 648 145 M 442 200 L CM 0.246 0.25 scale s SM n 445 206 M 424 205 L 441 193 L 445 206 L cp e [24.184 -6.348 -6.344 -24.184 0 0]/Times-Roman MF (O)496 178 MS (F)514 173 MS (F)527 170 MS (E)540 166 MS (R)555 162 MS n 648 155 M 848 200 L CM 0.246 0.25 scale s SM n 848 193 M 866 205 L 845 207 L 848 193 L cp e [24.371 5.582 5.586 -24.371 0 0]/Times-Roman MF (O)721 164 MS (F)739 168 MS (F)752 171 MS (E)765 174 MS (R)780 177 MS n 424 323 M 223 377 L CM 0.246 0.25 scale s SM n 227 383 M 205 382 L 223 370 L 227 383 L cp e [24.141 -6.516 -6.512 -24.141 0 0]/Times-Roman MF (S)274 355 MS (T)288 352 MS (A)302 348 MS (R)320 343 MS (T)336 339 MS n 423 331 M 630 378 L CM 0.246 0.25 scale s SM n 630 371 M 648 382 L 627 384 L 630 371 L cp e [24.398 5.453 5.457 -24.398 0 0]/Times-Roman MF (S)498 340 MS (T)512 343 MS (A)527 347 MS (R)545 351 MS (T)561 354 MS 1 sl n 680 96 M 683 95 L 686 94 L 689 92 L 690 90 L 692 87 L 692 84 L 692 49 L 692 46 L 690 43 L 689 40 L 686 38 L 683 37 L 680 37 L 615 37 L 612 37 L 609 38 L 607 40 L 605 43 L 604 46 L 603 49 L 603 84 L 604 87 L 605 90 L 607 92 L 609 94 L 612 95 L 615 96 L 680 96 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (P)635 75 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (2)651 85 MS n 235 96 M 238 95 L 241 94 L 243 92 L 245 90 L 246 87 L 246 84 L 246 49 L 246 46 L 245 43 L 243 40 L 241 38 L 238 37 L 235 37 L 170 37 L 167 37 L 164 38 L 162 40 L 160 43 L 159 46 L 158 49 L 158 84 L 159 87 L 160 90 L 162 92 L 164 94 L 167 95 L 170 96 L 235 96 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (P)189 75 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (1)206 85 MS n 1121 100 M 1124 100 L 1127 98 L 1129 97 L 1131 94 L 1132 91 L 1133 88 L 1133 45 L 1132 42 L 1131 39 L 1129 37 L 1127 35 L 1124 34 L 1121 34 L 1056 34 L 1053 34 L 1050 35 L 1048 37 L 1046 39 L 1044 42 L 1044 45 L 1044 88 L 1044 91 L 1046 94 L 1048 97 L 1050 98 L 1053 100 L 1056 100 L 1121 100 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (P)1075 76 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (3)1092 85 MS 6 sl n 1307 98 M 1307 557 L CM 0.246 0.25 scale s SM 1 sl n 1340 98 M 1343 98 L 1345 97 L 1348 95 L 1350 92 L 1351 90 L 1351 87 L 1351 44 L 1351 41 L 1350 38 L 1348 35 L 1345 33 L 1343 32 L 1340 32 L 1275 32 L 1272 32 L 1269 33 L 1266 35 L 1264 38 L 1263 41 L 1263 44 L 1263 87 L 1263 90 L 1264 92 L 1266 95 L 1269 97 L 1272 98 L 1275 98 L 1340 98 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (P)1294 74 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (4)1310 84 MS 6 sl n 1307 161 M 888 240 L CM 0.246 0.25 scale s SM n 891 247 M 870 244 L 889 233 L 891 247 L cp e [24.57 -4.645 -4.641 -24.57 0 0]/Times-Roman MF /IsChar{exch/CharStrings get exch known}bd/MapCh{3 -1 roll/Encoding get = 3 1 roll put}bd/MapDegree{dup 16#b0 exch/degree IsChar{/degree}{/ring}ifelse = MapCh} bd/MapBB{dup 16#a6 exch/brokenbar IsChar{/brokenbar}{/bar}ifelse = MapCh}bd /reencode{findfont begin currentdict dup length dict begin{1 index/FID = ne{def} {pop pop}ifelse}forall/FontName exch def dup length 0 ne{/Encoding = Encoding 256 array copy def 0 exch{dup type/nametype eq{Encoding 2 index 2 index put = pop 1 add}{exch pop}ifelse}forall}if pop currentdict dup end end/FontName get = exch definefont dup MapDegree = MapBB}bd/LATENC[0/grave/acute/circumflex/tilde/macron /breve/dotaccent/dieresis/ring/cedilla/hungarumlaut/ogonek/caron/dotlessi= /fi/fl /Lslash/lslash/Zcaron/zcaron/minus/.notdef/.notdef/.notdef/.notdef/.notde= f /.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/space/exclam/quotedbl /numbersign/dollar/percent/ampersand/quotesingle/parenleft/parenright/ast= erisk /plus/comma/hyphen/period/slash/zero/one/two/three/four/five/six/seven/ei= ght /nine/colon/semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/= K/L/M /N/O/P/Q/R/S/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/asciicircum= /underscore/grave/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y/z/bra= celeft /bar/braceright/asciitilde/.notdef/.notdef/.notdef/quotesinglbase/florin /quotedblbase/ellipsis/dagger/daggerdbl/circumflex/perthousand/Scaron /guilsinglleft/OE/.notdef/.notdef/.notdef/.notdef/quoteleft/quoteright /quotedblleft/quotedblright/bullet/endash/emdash/tilde/trademark/scaron /guilsinglright/oe/.notdef/.notdef/Ydieresis/.notdef/exclamdown/cent/ster= ling /currency/yen/brokenbar/section/dieresis/copyright/ordfeminine/guillemotl= eft /logicalnot/hyphen/registered/macron/degree/plusminus/twosuperior/threesu= perior /acute/mu/paragraph/periodcentered/cedilla/onesuperior/ordmasculine /guillemotright/onequarter/onehalf/threequarters/questiondown/Agrave/Aacu= te /Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla/Egrave/Eacute/Ecircumflex= /Edieresis/Igrave/Iacute/Icircumflex/Idieresis/Eth/Ntilde/Ograve/Oacute /Ocircumflex/Otilde/Odieresis/multiply/Oslash/Ugrave/Uacute/Ucircumflex /Udieresis/Yacute/Thorn/germandbls/agrave/aacute/acircumflex/atilde/adier= esis /aring/ae/ccedilla/egrave/eacute/ecircumflex/edieresis/igrave/iacute /icircumflex/idieresis/eth/ntilde/ograve/oacute/ocircumflex/otilde/odiere= sis /divide/oslash/ugrave/uacute/ucircumflex/udieresis/yacute/thorn/ydieresis= ]def LATENC /_Times-Roman /Times-Roman reencode [24.57 -4.645 -4.641 -24.57 0 0]/_Times-Roman MF (\240)905 230 MS (\240)911 229 MS (\240)917 227 MS (\240)923 226 MS = (\240)929 225 MS (\240)934 224 MS (\240)940 223 MS (\240)946 222 MS = (\240)952 221 MS (\240)958 220 MS (\240)964 219 MS (\240)970 217 MS = (\240)976 216 MS (\240)982 215 MS (\240)987 214 MS (\240)993 213 MS (\240)999 212 MS (\240)1005 211 MS (\240)1011 210 MS (\240)1017 209 MS = (\240)1023 207 MS (\240)1029 206 MS (\240)1035 205 MS (\240)1041 204 MS = (\240)1046 203 MS (\240)1052 202 MS (\240)1058 201 MS (\240)1064 200 MS = (\240)1070 198 MS (\240)1076 197 MS (\240)1082 196 MS (\240)1088 195 MS (\240)1094 194 MS (\240)1099 193 MS (P)1105 192 MS (A)1119 189 MS = (R)1136 186 MS (T)1152 183 MS (I)1167 180 MS (C)1175 179 MS (I)1191 176 = MS (P)1199 174 MS (A)1213 172 MS (T)1230 168 MS (E)1245 165 MS 1 sl n 380 65 M 381 58 L 382 52 L 385 46 L 388 40 L 392 35 L 397 30 L 402 27 L 408 24 L 414 22 L 421 21 L 427 21 L 434 22 L 440 24 L 446 27 L 451 30 L 456 35 L 460 40 L 463 46 L 466 52 L 467 58 L 468 65 L 467 71 L 466 78 L 463 84 L 460 89 L 456 94 L 451 99 L 446 102 L 440 105 L 434 107 L 427 108 L 421 108 L 414 107 L 408 105 L 402 102 L 397 99 L 392 94 L 388 89 L 385 84 L 382 78 L 381 71 L 380 65 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (I)414 73 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (1)424 83 MS n 452 77 M 482 77 L 482 52 L 452 52 L 452 77 L cp gs 1 g e gr s n 365 77 M 395 77 L 395 52 L 365 52 L 365 77 L cp gs 1 g e gr s n 822 61 M 823 55 L 824 48 L 827 42 L 830 37 L 834 32 L 838 27 L 844 23 L 850 21 L 856 19 L 862 18 L 869 18 L 875 19 L 882 21 L 888 23 L 893 27 L 898 32 L 902 37 L 905 42 L 907 48 L 909 55 L 909 61 L 909 68 L 907 74 L 905 80 L 902 86 L 898 91 L 893 95 L 888 99 L 882 102 L 875 104 L 869 105 L 862 105 L 856 104 L 850 102 L 844 99 L 838 95 L 834 91 L 830 86 L 827 80 L 824 74 L 823 68 L 822 61 L cp gs 1 g e gr s [29.297 0 0 -29.262 0 0]/Times-Roman MF (I)856 70 MS [19.324 0 0 -19.508 0 0]/Times-Roman MF (2)866 80 MS n 808 74 M 838 74 L 838 48 L 808 48 L 808 74 L cp gs 1 g e gr s n 895 74 M 925 74 L 925 48 L 895 48 L 895 74 L cp gs 1 g e gr s n 879 31 M 879 1 L 853 1 L 853 31 L 879 31 L cp gs 1 g e gr s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 1044 2023 a Fs(Figure)19 b(2.)g(A)f(possible)i(scenario)f (for)g(the)g(system)g(in)g(Figure)g(1.)274 2316 y Fq(Therefore,)24 b(the)i(idea)h(behind)e Fm(\013)p Fq(\226core)g(consists)i(of)f (locking)f(shared)h(participants,)f(and)h(an)g(interaction)f(may)191 2415 y(be)d(e)o(x)o(ecuted)e(as)j(long)f(as)h(its)g(corresponding)c (coordinator)g(has)k(acquired)d(e)o(xclusi)n(v)o(e)h(access)i(to)g(all) f(of)g(its)i(shared)191 2515 y(participants.)18 b(The)h(problem)f(is)i (that)g(locks)f(need)g(to)g(be)h(carried)e(out)h(carefully)f(in)i (order)e(to)i(a)n(v)n(oid)f(deadlocks.)f(W)-7 b(e)191 2615 y(use)27 b(an)g(idea)f(proposed)f(in)i([6)o(]:)g Fm(\013)p Fq(\226core)f(assumes)h(that)g(coordinators)e(may)h(sort)h (their)f(participants)g(according)191 2714 y(to)21 b(a)h(gi)n(v)o(en)d (immutable)h(property)-5 b(,)19 b(e.g.,)h(their)h(net)g(address,)f (their)h(Uni)n(v)o(ersally)f(Unique)g(Identi\002er)g(\(UUID\))g([19)o (])191 2814 y(or)g(their)h(Uni)n(v)o(ersal/Uniform)d(Resource)i (Identi\002er)g(\(URI\))g([2)o(],)h(so)g(that)g(lock)g(attempts)f(are)h (made)f(in)h(increasing)191 2914 y(order)-5 b(.)19 b(This)h(idea)h(w)o (as)g(pro)o(v)o(en)c(not)j(to)h(produce)d(deadlocks)g(and)i(it)h(is)g (quite)f(ef)n(fecti)n(v)o(e.)274 3015 y(At)f(a)g(\002rst)h(glance,)d (one)h(might)g(think)g(that)h(a)g(solution)f(to)h(the)f(leader)n (-election)f(problem)g([12)o(])i(suf)n(\002ces)f(to)h(select)191 3115 y(amongst)h(con\003icting)g(coordinators,)f(b)n(ut)i(it)h(is)h (not)e(enough)e(because)i(the)g(set)h(of)f(con\003icting)g (interactions)f(is)i(not)191 3214 y(static,)d(b)n(ut)g(changes)f(as)h (ne)n(w)f(con\003icting)g(interactions)f(become)h(enabled.)f(Another)g (k)o(e)o(y)h(point)g(is)i(that)f(we)g(do)f(not)191 3314 y(w)o(ant)f(coordinators)e(to)i(kno)n(w)f(each)h(other)f(in)i(order)d (to)j(mak)o(e)e(our)h(solution)f(suitable)h(for)f(open)h(systems,)g(b)n (ut)g(usual)191 3414 y(solutions)k(to)h(the)g(leader)n(-election)e (problem,)f(e.g.,)i(or)o(ganising)e(entities)j(in)g(rings,)f(w)o(ould)g (require)f(neighbouring)191 3513 y(coordinators)e(to)i(kno)n(w)f(each)h (other)-5 b(.)191 3718 y Fr(Notation)19 b(and)h(assumptions)191 3916 y Fq(W)-7 b(e)50 b(describe)d(our)h(algorithms)f(by)i(means)f(of)g (state)h(transition)f(diagrams.)f(Such)i(diagrams)e(are)i(\002nite)191 4015 y(deterministic)27 b(automata)g(composed)f(of)h(a)h(\002nite)g (number)e(of)i(states)h(and)e(atomic)g(transitions)h(amongst)e(them.) 191 4115 y(The)19 b(initial)h(state)g(is)h(labeled)e(by)g(an)g(arro)n (w)g(without)g(origin,)f(and)h(e)n(v)o(ery)f(transition)h(is)i(labeled) d(by)i(a)g(speci\002cation)191 4215 y(of)g(the)g(follo)n(wing)f(form:) 1585 4457 y Fj([)p Fm(g)s(uar)r(d)p Fj(])i Fm(messag)s(e)p 1585 4494 599 4 v 1770 4570 a(action)274 4707 y(messag)s(e)j Fq(denotes)h(the)g(message)g(that)h(causes)f(a)h(transition)e(to)i (occur)e(if)i(the)f(guard)f(holds.)g(If)i(it)g(is)g(omitted,)191 4807 y(a)h(transition)e(depends)g(solely)h(on)g(its)i(guard.)c Fm(action)j Fq(is)g(the)f(list)i(of)e(sentences)g(to)g(be)h(e)o(x)o (ecuted)d(if)j(a)g(transition)191 4907 y(occurs.)19 b(W)-7 b(e)21 b(use)g(assignments,)e(and)g(sentences)h(of)g(the)g(form)f Fm(S)5 b(end)p Fj(\()p Fm(r)r(ecipient;)14 b(messag)s(e)p Fj(\))k Fq(to)i(send)g(messages.)p 191 5006 3388 5 v 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)c FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 6 6 6 5 bop 191 299 a Fq(6)149 b FB(J.A.)16 b(P)552 285 y(\264)543 299 y(EREZ,)f(R.)h(CORCHUELO,)g(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(The)26 b(w)o(ord)f Fm(S)5 b(ender)28 b Fq(refers)e(to)g(the)g (identi\002er)f(of)h(the)g(coordinator)d(or)j(participant)f(that)h (sent)g(the)g(message)g(that)191 706 y(caused)33 b(a)g(transition)f(to) i(occur)-5 b(.)32 b(Finally)-5 b(,)32 b Fm(g)s(uar)r(d)i Fq(is)g(a)g(boolean)d(e)o(xpression.)g(F)o(or)i(a)h(transition)e(to)h (occur)m(,)f(its)191 805 y(corresponding)19 b(message)j(must)g(be)g (recei)n(v)o(ed)f(and)h(the)g(guard)f(must)h(hold.)f(Otherwise)h(the)h (message)f(is)h(ignored.)191 905 y(If)d(a)h(guard)d(is)k(omitted)d(it)i (is)g(assumed)f(to)g(be)g Fm(tr)r(ue)h Fq(by)f(def)o(ault.)274 1010 y(W)-7 b(e)28 b(only)e(need)g(to)h(mak)o(e)f(three)g(assumptions)g (about)g(the)h(underlying)d(message)i(passing)g(system:)i(\(i\))e(e)n (v)o(ery)191 1109 y(message)38 b(must)g(be)g(recei)n(v)o(ed)e(sooner)h (or)g(later)m(,)h(\(ii\))g(messages)g(sent)g(from)f(the)h(same)g (origin)f(to)h(the)g(same)191 1209 y(destination)29 b(must)h(be)g (processed)g(in)g(the)g(same)g(order)f(the)o(y)h(were)g(sent,)g(and)g (\(iii\))g(messages)g(are)g(stored)g(in)g(a)191 1309 y(FIFO)21 b(queue)e(until)h(the)o(y)f(are)h(processed.)274 1413 y(State)25 b(diagrams)f(usually)g(rely)h(on)f(a)i(number)d(of)h (state)i(v)n(ariables)e(that)h(we)g(write)g(in)g(box)o(es.)f(These)h(v) n(ariables)191 1513 y(range)19 b(o)o(v)o(er)g(well\226kno)n(wn)f (domains)h(such)h(as)h(inte)o(gers,)e(sets,)i(or)f(entity)g (identi\002ers.)191 1728 y Fm(\013)p Fr(\226cor)o(e)f(in)i(a)f (participant)191 1922 y Fq(The)c(state)h(transition)e(diagram)g(for)h (participants)f(is)i(sho)n(wn)f(in)g(Figure)f(3,)i(and)e(a)i(short)f (description)e(of)i(its)i(v)n(ariables)191 2022 y(is)j(sho)n(wn)f(in)g (T)-7 b(able)20 b(II.)1138 2330 y Fs(T)-6 b(able)19 b(II.)f(V)-8 b(ariables)18 b(used)i(by)f Fk(\013)p Fs(\226core)h(in)f(participants.) p 350 2466 3069 5 v 400 2549 a Fu(V)-7 b(ariable)100 b(Description)p 350 2601 3069 3 v 490 2684 a Fk(I)6 b(S)194 b Fs(It)20 b(is)h(a)f(set)h(of)g(identi\002ers)f(that)h(allo)n(w)g(us)g (to)g(refer)f(to)h(each)h(coordinator)g(in)f(which)g(a)g(participant) 771 2767 y(is)d(interested.)431 2850 y Fk(l)q(ock)r(er)133 b Fs(It)25 b(identi\002es)g(the)g(coordinator)i(that)e(has)h(lock)o(ed) g(a)g(participant,)f(i.e.,)f(the)i Fv(curr)m(ent)g(pr)m(ospective)771 2933 y(winner)19 b(coor)m(dinator)p Fs(.)449 3016 y Fk(l)q(ock)r(s)150 b Fs(It)15 b(is)g(a)h(set)g(of)f(identi\002ers)h(that)f(allo)n(w)h(us)g (to)g(refer)f(to)h(each)g(coordinator)h(from)f(which)g(a)g(participant) 771 3099 y(has)29 b(recei)n(v)o(ed)g(a)f Fk(LO)r(C)5 b(K)34 b Fs(message)c Fv(after)g Fs(the)e(one)h(recei)n(v)o(ed)g(from)g (the)f(current)h(prospecti)n(v)o(e)771 3182 y(winner)19 b(coordinator)l(.)512 3265 y Fk(n)213 b Fs(It)20 b(is)g(a)g(counter)i (used)f(to)g(determine)g(when)g(e)n(v)o(ery)g(in)m(v)o(olv)o(ed)g (coordinator)h(has)f(ackno)n(wledged)i(a)771 3348 y Fk(R)q(E)t(F)11 b(U)d(S)t(E)22 b Fs(message)e(from)f(a)f(participant.)404 3431 y Fk(unl)q(ock)r(s)105 b Fs(It)17 b(is)h(a)g(set)f(of)h (identi\002ers)g(that)g(allo)n(w)f(us)i(to)e(refer)h(to)g(prospecti)n (v)o(e)h(winner)f(coordinators)i(that)d(had)771 3514 y(to)23 b(release)g(a)g(participant.)h(When)f(a)g(participant)h(recei)n (v)o(es)g(an)f Fk(U)8 b(N)g(LO)r(C)d(K)30 b Fs(message)24 b(from)g(its)771 3597 y(prospecti)n(v)o(e)c(winner)f(coordinator)m(,)h (it)e(is)h(said)g(that)g(it)f(has)h(been)h Fv(r)m(ejected)h Fs(by)f(the)f(coordinator)l(.)p 350 3651 3069 5 v 274 4005 a Fq(Initially)-5 b(,)20 b(participants)g(are)g(performing)e (local)j(computations)e(in)i(state)h Fm(AC)6 b(T)12 b(I)7 b(V)18 b(E)27 b Fq(until)21 b(the)o(y)f(assign)h(the)g(set)191 4104 y(of)g(interactions)g(in)g(which)g(the)o(y)g(are)g(interested)g (to)h(v)n(ariable)e Fm(I)7 b(S)e Fq(.)22 b(If)f Fi(j)p Fm(I)7 b(S)e Fi(j)25 b Fj(=3D)g(1)p Fq(,)c(a)h(participant)e(is)j(only)d (interested)191 4204 y(in)j(one)f(interaction)g(and)g(sends)h(a)g Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)27 b Fq(message)22 b(to)h(its)h(coordinator)c(\(transition)i(2\).)g(Since)h(the)191 4304 y(tar)o(get)g(state)i(of)f(this)h(transition)f(is)h Fm(LO)r(C)6 b(K)g(E)f(D)r Fq(,)25 b(this)g(means)f(that)g(the)g (participant)f(gets)i(lock)o(ed)e(automatically)191 4403 y(once)j(the)i(of)n(fer)e(is)i(made.)e(If)h Fi(j)p Fm(I)7 b(S)e Fi(j)36 b Fm(>)g Fj(1)p Fq(,)27 b(it)h(then)f(sends)g(an)g Fm(O)r(F)12 b(F)g(E)5 b(R)29 b Fq(message)e(to)h(each)f(coordinator)d (whose)191 4503 y(identi\002er)19 b(is)j(in)e Fm(I)7 b(S)e Fq(,)20 b(and)g(reaches)f(the)i Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)20 b Fq(state)h(\(transition)e(1\).)274 4608 y(In)24 b(the)h Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)24 b Fq(state,)h(a)g(participant)e(w)o(aits)i(to)g(be)f(lock)o(ed)g(and)g (lea)n(v)o(es)h(it)g(when)f(it)h(recei)n(v)o(es)e(a)i Fm(LO)r(C)6 b(K)191 4707 y Fq(message)18 b(from)g(a)h(coordinator)d (that)j(becomes)e(then)i(a)g Fn(pr)l(ospective)f(winner)j Fq(\(transition)c(3\).)h(On)h(reception)e(of)h(this)191 4807 y(message,)i(participants)g(ackno)n(wledge)e(with)j(an)f Fm(O)r(K)28 b Fq(message)20 b(and)g(reach)g(the)h(state)g Fm(LO)r(C)6 b(K)g(E)f(D)r Fq(.)21 b(Subsequent)191 4907 y Fm(LO)r(C)6 b(K)24 b Fq(messages)18 b(are)g(temporarily)d(stored)j (in)f Fm(l)r(ock)s(s)h Fq(without)f(ackno)n(wledging)e(reception)h (\(transition)g(4\).)i(This)p 191 5006 3388 5 v 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)e FB(2001)i(John)f(W) m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 7 7 7 6 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1186 299 a FB(AN)16 b(ORDER-B)n(ASED)g(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)150 b Fq(7)p 191 473 3388 5 v 191 3067 a @beginspecial 56.689999 @llx 56.689999 @lly 461.690002 @urx 337.079987 @ury 4064 @rwi @setspecial %%BeginDocument: std-part.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip063.wmf %%Creator: Windows NT 4.0 %%CreationDate: 11:53 2/22/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 461.69 337.08 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 337.039 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 sl n 306 612 M 416 612 L 421 612 L 426 610 L 431 608 L 435 605 L 439 602 L 442 597 L 444 593 L 445 588 L 446 583 L 446 553 L 445 548 L 444 543 L 442 538 L 439 534 L 435 530 L 431 527 L 426 525 L 421 524 L 416 524 L 306 524 L 300 524 L 295 525 L 291 527 L 287 530 L 283 534 L 280 538 L 278 543 L 276 548 L 276 553 L 276 583 L 276 588 L 278 593 L 280 597 L 283 602 L 287 605 L 291 608 L 295 610 L 300 612 L 306 612 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [20.57 0 0 -20.738 0 0]/Times-Roman MF (A)323 574 MS (C)337 574 MS (T)351 574 MS (I)364 574 MS (V)371 574 MS = (E)386 574 MS n 1575 618 M 1685 618 L 1691 618 L 1696 616 L 1700 614 L 1704 611 L 1708 607 L 1711 603 L 1713 599 L 1715 594 L 1715 588 L 1715 559 L 1715 554 L 1713 549 L 1711 544 L 1708 540 L 1704 536 L 1700 533 L 1696 531 L 1691 530 L 1685 529 L 1575 529 L 1570 530 L 1565 531 L 1560 533 L 1556 536 L 1552 540 L 1549 544 L 1547 549 L 1546 554 L 1545 559 L 1545 588 L 1546 594 L 1547 599 L 1549 603 L 1552 607 L 1556 611 L 1560 614 L 1565 616 L 1570 618 L 1575 618 L cp gs 1 g e gr s (L)1588 580 MS (O)1601 580 MS (C)1616 580 MS (K)1629 580 MS (E)1644 580 = MS (D)1657 580 MS n 926 157 M 1036 157 L 1041 157 L 1046 156 L 1051 153 L 1055 150 L 1059 147 L 1062 143 L 1064 138 L 1065 133 L 1066 128 L 1066 98 L 1065 93 L 1064 88 L 1062 84 L 1059 79 L 1055 76 L 1051 73 L 1046 71 L 1041 69 L 1036 69 L 926 69 L 920 69 L 915 71 L 911 73 L 907 76 L 903 79 L 900 84 L 898 88 L 897 93 L 896 98 L 896 128 L 897 133 L 898 138 L 900 143 L 903 147 L 907 150 L 911 153 L 915 156 L 920 157 L 926 157 L cp gs 1 g e gr s (W)935 119 MS (A)955 119 MS (I)970 119 MS (T)977 119 MS (I)990 119 MS = (N)997 119 MS (G)1012 119 MS n 167 642 M 167 638 L 169 635 L 171 632 L 173 629 L 177 628 L 180 627 L 184 627 L 187 628 L 190 629 L 193 632 L 195 635 L 196 638 L 197 642 L 196 645 L 195 648 L 193 651 L 190 654 L 187 655 L 184 656 L 180 656 L 177 655 L 173 654 L 171 651 L 169 648 L 167 645 L 167 642 L cp gs 0.102 g e gr s 1 j 1 setlinecap 6 sl n 264 567 M 259 567 L 254 567 L 248 568 L 243 569 L 238 570 L 233 572 L 229 574 L 224 576 L 220 578 L 216 581 L 212 585 L 208 588 L 204 592 L 200 597 L 197 601 L 194 606 L 190 612 L 187 617 L 184 623 L 182 630 L CM 0.246 0.246 scale s SM n 262 573 M 276 568 L 263 560 L 262 573 L cp e n 176 175 M 512 175 L 512 19 L 176 19 L 176 175 L cp e 1 sl n 158 157 M 494 157 L 494 1 L 158 1 L 158 157 L cp gs 1 g e gr s [24.938 0 0 -24.988 0 0]/Times-Roman MF (I)166 27 MS (S)174 27 MS (:)188 27 MS ( )195 27 MS (S)201 27 MS (e)215 = 27 MS (t)226 27 MS ( )233 27 MS (o)240 27 MS (f)252 27 MS ( )260 27 MS = (C)267 27 MS (o)283 27 MS (o)296 27 MS (r)308 27 MS (d)316 27 MS (i)329 27 MS (n)336 27 MS (a)348 27 MS (t)359 27 MS (o)366 27 MS (r)379 = 27 MS (l)166 57 MS (o)173 57 MS (c)186 57 MS (k)197 57 MS (s)209 57 MS (:)219 = 57 MS ( )226 57 MS (S)232 57 MS (e)246 57 MS (t)257 57 MS ( )264 57 MS = (o)271 57 MS (f)283 57 MS ( )291 57 MS (C)297 57 MS (o)314 57 MS (o)327 57 MS (r)339 57 MS (d)347 57 MS (i)360 57 MS (n)367 57 MS (a)379 = 57 MS (t)390 57 MS (o)397 57 MS (r)410 57 MS (l)166 87 MS (o)173 87 MS (c)186 87 MS (k)197 87 MS (e)209 87 MS (r)220 = 87 MS (:)229 87 MS ( )236 87 MS (C)242 87 MS (o)259 87 MS (o)271 87 MS = (r)283 87 MS (d)292 87 MS (i)304 87 MS (n)311 87 MS (a)324 87 MS (t)335 87 MS (o)342 87 MS (r)354 87 MS (u)166 117 MS (n)179 117 MS (l)191 117 MS (o)198 117 MS (c)211 117 MS = (k)222 117 MS (s)234 117 MS (:)244 117 MS ( )251 117 MS (S)257 117 MS = (e)271 117 MS (t)282 117 MS ( )289 117 MS (o)295 117 MS (f)308 117 MS ( = )316 117 MS (C)322 117 MS (o)339 117 MS (o)352 117 MS (r)364 117 MS (d)372 117 MS = (i)385 117 MS (n)392 117 MS (a)404 117 MS (t)415 117 MS (o)422 117 MS = (r)435 117 MS (n)166 147 MS (:)179 147 MS ( )186 147 MS (i)192 147 MS (n)199 147 MS = (t)212 147 MS (e)219 147 MS (g)230 147 MS (e)242 147 MS (r)253 147 MS n 689 984 M 800 984 L 805 983 L 810 982 L 815 980 L 819 977 L 822 973 L 825 969 L 828 964 L 829 959 L 829 954 L 829 925 L 829 920 L 828 915 L 825 910 L 822 906 L 819 902 L 815 899 L 810 897 L 805 896 L 800 895 L 689 895 L 684 896 L 679 897 L 675 899 L 670 902 L 667 906 L 664 910 L 662 915 L 660 920 L 660 925 L 660 954 L 660 959 L 662 964 L 664 969 L 667 973 L 670 977 L 675 980 L 679 982 L 684 983 L 689 984 L cp gs 1 g e gr s [20.57 0 0 -20.738 0 0]/Times-Roman MF (S)717 946 MS (Y)728 946 MS (N)743 946 MS (C)758 946 MS 6 sl n 878 116 M 859 119 L 840 123 L 821 127 L 803 131 L 785 135 L 768 140 L 751 145 L 734 150 L 717 156 L 701 162 L 686 168 L 670 175 L 655 181 L 640 189 L 626 196 L 612 204 L 598 212 L 585 220 L 572 229 L 559 238 L 547 247 L 535 256 L 523 266 L 512 276 L 501 286 L 490 297 L 480 308 L 470 319 L 460 331 L 451 343 L 442 355 L 433 367 L 425 380 L 417 393 L 409 406 L 402 420 L 395 434 L 389 448 L 382 463 L 376 477 L 371 492 L 366 508 L 361 524 L CM 0.246 0.246 scale s SM n 877 123 M 896 113 L 875 109 L 877 123 L cp e n 990 173 M 1001 190 L 1012 207 L 1024 224 L 1035 240 L 1047 255 L 1059 271 L 1072 286 L 1085 301 L 1098 315 L 1111 329 L 1125 343 L 1139 356 L 1153 369 L 1168 382 L 1183 395 L 1198 407 L 1214 418 L 1230 430 L 1246 441 L 1262 452 L 1279 462 L 1296 472 L 1314 482 L 1331 492 L 1349 501 L 1367 510 L 1386 518 L 1405 526 L 1424 534 L 1444 541 L 1463 548 L 1483 555 L 1504 562 L 1524 568 L 1545 574 L CM 0.246 0.246 scale s SM n 985 178 M 981 157 L 997 171 L 985 178 L cp e n 1620 514 M 1609 498 L 1598 482 L 1587 467 L 1575 451 L 1563 436 L 1550 422 L 1537 407 L 1524 393 L 1511 379 L 1497 365 L 1483 352 L 1468 339 L 1453 326 L 1438 313 L 1423 300 L 1407 288 L 1391 276 L 1374 265 L 1357 253 L 1340 242 L 1323 231 L 1305 221 L 1287 210 L 1268 200 L 1250 190 L 1230 181 L 1211 171 L 1191 162 L 1171 153 L 1151 145 L 1130 137 L 1109 128 L 1087 121 L 1066 113 L CM 0.246 0.246 scale s SM n 1625 509 M 1630 529 L 1614 516 L 1625 509 L cp e n 1630 618 M 1616 633 L 1602 647 L 1587 661 L 1572 675 L 1557 689 L 1542 702 L 1526 714 L 1510 727 L 1494 739 L 1477 751 L 1460 762 L 1443 773 L 1425 784 L 1408 794 L 1390 804 L 1371 813 L 1353 823 L 1334 832 L 1315 840 L 1295 848 L 1276 856 L 1256 864 L 1236 871 L 1215 878 L 1194 884 L 1173 890 L 1152 896 L 1130 901 L 1108 906 L 1086 911 L 1063 915 L 1041 919 L 1018 923 L 994 926 L 970 929 L 947 932 L 922 934 L 898 936 L 873 938 L 848 939 L CM 0.246 0.246 scale s SM n 849 932 M 829 940 L 850 946 L 849 932 L cp e n 1528 580 M 1501 590 L 1475 599 L 1448 608 L 1421 616 L 1395 624 L 1368 631 L 1341 638 L 1314 645 L 1287 651 L 1260 656 L 1234 661 L 1207 666 L 1179 671 L 1152 674 L 1125 678 L 1098 681 L 1071 683 L 1044 686 L 1017 687 L 989 688 L 962 689 L 935 690 L 907 690 L 880 689 L 852 688 L 825 687 L 797 685 L 770 683 L 742 680 L 714 677 L 686 673 L 659 669 L 631 665 L 603 660 L 575 655 L 547 649 L 519 642 L 491 636 L 463 629 L 435 621 L 407 613 L CM 0.246 0.246 scale s SM n 1529 587 M 1545 574 L 1524 575 L 1529 587 L cp e n 1722 591 M 1727 604 L 1732 617 L 1736 629 L 1741 641 L 1745 652 L 1749 663 L 1753 674 L 1757 684 L 1760 694 L 1763 703 L 1766 712 L 1769 721 L 1771 729 L 1774 737 L 1776 744 L 1778 751 L 1780 758 L 1781 764 L 1782 770 L 1784 775 L 1784 780 L 1785 785 L 1785 789 L 1786 792 L 1786 796 L 1786 799 L 1785 801 L 1785 803 L 1784 805 L 1783 806 L 1781 807 L 1780 807 L 1778 807 L 1776 807 L 1774 806 L 1772 805 L 1770 803 L 1767 801 L 1764 799 L 1761 796 L 1757 793 L 1754 789 L 1750 785 L 1746 781 L 1742 776 L 1737 770 L 1733 765 L 1728 759 L 1723 752 L 1718 745 L 1712 738 L 1707 730 L 1701 722 L 1695 713 L 1688 704 L 1682 695 L 1675 685 L 1668 675 L 1661 664 L 1654 654 L 1646 642 L 1638 630 L 1630 618 L CM 0.246 0.246 scale s SM n 1729 590 M 1715 574 L 1716 595 L 1729 590 L cp e n 1722 556 M 1727 543 L 1731 530 L 1736 518 L 1740 506 L 1745 494 L 1749 483 L 1752 472 L 1756 462 L 1759 452 L 1763 442 L 1766 433 L 1768 424 L 1771 416 L 1773 408 L 1775 400 L 1777 393 L 1779 386 L 1781 380 L 1782 374 L 1783 369 L 1784 363 L 1785 359 L 1785 354 L 1786 351 L 1786 347 L 1786 344 L 1785 341 L 1785 339 L 1784 337 L 1783 336 L 1782 335 L 1781 334 L 1779 334 L 1778 334 L 1776 335 L 1773 336 L 1771 337 L 1769 339 L 1766 341 L 1763 344 L 1760 347 L 1756 350 L 1753 354 L 1749 358 L 1745 363 L 1741 368 L 1736 374 L 1732 380 L 1727 386 L 1722 393 L 1717 400 L 1711 407 L 1706 415 L 1700 424 L 1694 432 L 1688 441 L 1681 451 L 1674 461 L 1668 471 L 1660 482 L 1653 493 L 1646 505 L 1638 517 L 1630 529 L CM 0.246 0.246 scale s SM n 1728 557 M 1715 574 L 1716 552 L 1728 557 L cp e n 660 940 M 645 937 L 630 935 L 616 932 L 602 929 L 589 926 L 575 923 L 563 919 L 550 916 L 538 912 L 527 907 L 516 903 L 505 898 L 494 893 L 484 888 L 475 883 L 465 877 L 456 871 L 448 865 L 440 859 L 432 853 L 424 846 L 417 839 L 411 832 L 404 825 L 398 817 L 393 809 L 388 801 L 383 793 L 379 784 L 375 776 L 371 767 L 368 758 L 365 748 L 362 739 L 360 729 L 358 719 L 357 708 L 356 698 L 355 687 L 355 676 L 355 665 L 356 654 L 357 642 L 358 630 L CM 0.246 0.246 scale s SM n 351 631 M 361 612 L 365 633 L 351 631 L cp e n 694 985 M 692 992 L 690 999 L 689 1005 L 688 1011 L 687 1017 L 686 1022 L 685 1027 L 685 1031 L 684 1035 L 684 1039 L 684 1042 L 684 1045 L 684 1048 L 685 1050 L 685 1052 L 686 1053 L 687 1054 L 688 1055 L 689 1055 L 691 1055 L 692 1054 L 694 1053 L 696 1052 L 698 1050 L 700 1048 L 702 1046 L 705 1043 L 708 1039 L 710 1036 L 713 1032 L 717 1027 L 720 1023 L 723 1017 L 727 1012 L 731 1006 L 735 1000 L CM 0.246 0.246 scale s SM n 740 1005 M 745 984 L 728 998 L 740 1005 L cp e 1 sl n 335 329 M 336 323 L 337 317 L 339 312 L 343 307 L 346 303 L 351 299 L 356 296 L 362 294 L 368 293 L 373 293 L 379 294 L 385 296 L 390 299 L 394 303 L 398 307 L 402 312 L 404 317 L 405 323 L 406 329 L 405 334 L 404 340 L 402 345 L 398 350 L 394 355 L 390 358 L 385 361 L 379 363 L 373 364 L 368 364 L 362 363 L 356 361 L 351 358 L 346 355 L 343 350 L 339 345 L 337 340 L 336 334 L 335 329 L cp gs 0.902 g e gr s %%IncludeFont: Helvetica [33.402 0 0 -33.234 0 0]/Helvetica MF (1)361 339 MS n 630 606 M 631 600 L 632 595 L 635 589 L 638 584 L 642 580 L 646 577 L 652 574 L 657 572 L 663 571 L 669 571 L 674 572 L 680 574 L 685 577 L 690 580 L 694 584 L 697 589 L 699 595 L 701 600 L 701 606 L 701 612 L 699 618 L 697 623 L 694 628 L 690 632 L 685 636 L 680 639 L 674 641 L 669 642 L 663 642 L 657 641 L 652 639 L 646 636 L 642 632 L 638 628 L 635 623 L 632 618 L 631 612 L 630 606 L cp gs 0.902 g e gr s (2)656 616 MS n 1238 134 M 1239 128 L 1240 122 L 1243 117 L 1246 112 L 1250 108 L 1254 104 L 1260 101 L 1265 99 L 1271 98 L 1277 98 L 1282 99 L 1288 101 L 1293 104 L 1298 108 L 1302 112 L 1305 117 L 1307 122 L 1309 128 L 1309 134 L 1309 140 L 1307 145 L 1305 151 L 1302 156 L 1298 160 L 1293 163 L 1288 166 L 1282 168 L 1277 169 L 1271 169 L 1265 168 L 1260 166 L 1254 163 L 1250 160 L 1246 156 L 1243 151 L 1240 145 L 1239 140 L 1238 134 L cp gs 0.902 g e gr s (3)1264 144 MS n 1634 358 M 1634 352 L 1636 347 L 1638 341 L 1641 336 L 1645 332 L 1650 328 L 1655 326 L 1661 324 L 1667 323 L 1672 323 L 1678 324 L 1684 326 L 1689 328 L 1693 332 L 1697 336 L 1701 341 L 1703 347 L 1704 352 L 1705 358 L 1704 364 L 1703 370 L 1701 375 L 1697 380 L 1693 384 L 1689 388 L 1684 391 L 1678 393 L 1672 393 L 1667 393 L 1661 393 L 1655 391 L 1650 388 L 1645 384 L 1641 380 L 1638 375 L 1636 370 L 1634 364 L 1634 358 L cp gs 0.902 g e gr s (4)1660 368 MS n 1634 777 M 1634 771 L 1636 766 L 1638 760 L 1641 755 L 1645 751 L 1650 748 L 1655 745 L 1661 743 L 1667 742 L 1672 742 L 1678 743 L 1684 745 L 1689 748 L 1693 751 L 1697 755 L 1701 760 L 1703 766 L 1704 771 L 1705 777 L 1704 783 L 1703 789 L 1701 794 L 1697 799 L 1693 803 L 1689 807 L 1684 810 L 1678 812 L 1672 813 L 1667 813 L 1661 812 L 1655 810 L 1650 807 L 1645 803 L 1641 799 L 1638 794 L 1636 789 L 1634 783 L 1634 777 L cp gs 0.902 g e gr s (5)1660 787 MS n 926 222 M 926 216 L 928 211 L 930 205 L 933 201 L 937 196 L 942 193 L 947 190 L 952 188 L 958 187 L 964 187 L 970 188 L 975 190 L 980 193 L 985 196 L 989 201 L 992 205 L 995 211 L 996 216 L 996 222 L 996 228 L 995 234 L 992 239 L 989 244 L 985 248 L 980 252 L 975 255 L 970 257 L 964 258 L 958 258 L 952 257 L 947 255 L 942 252 L 937 248 L 933 244 L 930 239 L 928 234 L 926 228 L 926 222 L cp gs 0.902 g e gr s (6)952 232 MS n 1250 895 M 1251 889 L 1252 884 L 1254 878 L 1258 874 L 1262 869 L 1266 866 L 1271 863 L 1277 861 L 1283 860 L 1289 860 L 1294 861 L 1300 863 L 1305 866 L 1310 869 L 1314 874 L 1317 878 L 1319 884 L 1321 889 L 1321 895 L 1321 901 L 1319 907 L 1317 912 L 1314 917 L 1310 921 L 1305 925 L 1300 928 L 1294 930 L 1289 931 L 1283 931 L 1277 930 L 1271 928 L 1266 925 L 1262 921 L 1258 917 L 1254 912 L 1252 907 L 1251 901 L 1250 895 L cp gs 0.902 g e gr s (7)1276 905 MS n 660 1132 M 660 1126 L 662 1120 L 664 1115 L 667 1110 L 671 1105 L 676 1102 L 681 1099 L 687 1097 L 692 1096 L 698 1096 L 704 1097 L 710 1099 L 715 1102 L 719 1105 L 723 1110 L 726 1115 L 729 1120 L 730 1126 L 731 1132 L 730 1137 L 729 1143 L 726 1148 L 723 1153 L 719 1158 L 715 1161 L 710 1164 L 704 1166 L 698 1167 L 692 1167 L 687 1166 L 681 1164 L 676 1161 L 671 1158 L 667 1153 L 664 1148 L 662 1143 L 660 1137 L 660 1132 L cp gs 0.902 g e gr s (8)686 1142 MS n 796 842 M 796 836 L 798 831 L 800 825 L 803 820 L 807 816 L 812 812 L 817 810 L 822 808 L 828 807 L 834 807 L 840 808 L 845 810 L 850 812 L 855 816 L 859 820 L 862 825 L 865 831 L 866 836 L 867 842 L 866 848 L 865 854 L 862 859 L 859 864 L 855 868 L 850 872 L 845 875 L 840 877 L 834 877 L 828 877 L 822 877 L 817 875 L 812 872 L 807 868 L 803 864 L 800 859 L 798 854 L 796 848 L 796 842 L cp gs 0.902 g e gr s (1)813 852 MS (0)831 852 MS 6 sl n 791 896 M 789 887 L 786 878 L 784 870 L 782 862 L 779 854 L 777 847 L 775 840 L 772 834 L 770 828 L 768 823 L 766 818 L 763 814 L 761 809 L 759 806 L 756 803 L 754 800 L 752 797 L 750 795 L 747 794 L 745 793 L 743 792 L 741 792 L 739 792 L 736 793 L 734 794 L 732 795 L 730 797 L 728 800 L 725 803 L 723 806 L 721 809 L 719 814 L 717 818 L 715 823 L 713 828 L 710 834 L 708 840 L 706 847 L 704 854 L 702 862 L 700 870 L 698 878 L CM 0.246 0.246 scale s SM n 692 875 M 694 896 L 705 878 L 692 875 L cp e 1 sl n 306 872 M 306 866 L 307 860 L 310 855 L 313 850 L 317 846 L 322 842 L 327 839 L 332 837 L 338 836 L 344 836 L 350 837 L 355 839 L 360 842 L 365 846 L 369 850 L 372 855 L 374 860 L 376 866 L 376 872 L 376 878 L 374 883 L 372 889 L 369 893 L 365 898 L 360 901 L 355 904 L 350 906 L 344 907 L 338 907 L 332 906 L 327 904 L 322 901 L 317 898 L 313 893 L 310 889 L 307 883 L 306 878 L 306 872 L cp gs 0.902 g e gr s (1)322 882 MS (1)341 882 MS n 227 238 M 501 238 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (O)415 264 MS (F)433 264 MS (F)446 264 MS (E)460 264 MS (R)475 264 MS = (\))492 264 MS (\()391 264 MS (i)399 264 MS (,)406 264 MS ( )386 264 MS (S)336 264 MS (e)350 264 MS (n)361 264 MS (d)373 264 MS (I)279 264 MS (S)287 264 MS (i)246 264 MS (1)390 228 MS (])402 228 MS ( )366 228 MS (|)363 228 MS (I)337 228 MS (S)345 228 MS ([)318 228 MS (|)326 228 MS %%IncludeFont: Symbol [24.988 0 0 -24.988 0 0]/Symbol MF (\256)306 264 MS (\316)257 264 MS (")228 264 MS gs n 14 29 372 205 CB (>)372 228 MS gr n 731 494 M 979 494 L s (\306)840 669 MS (=3D)820 669 MS (\306)816 632 MS (=3D)798 632 MS (=3D)803 595 MS (=3D)747 520 MS gs n 14 30 862 460 CB (=3D)862 484 MS gr [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)814 669 MS (u)732 669 MS (n)745 669 MS (l)757 669 MS (o)764 669 MS (c)777 669 MS = (k)788 669 MS (s)800 669 MS ( )811 632 MS (:)792 632 MS (l)735 632 MS (o)742 632 MS (c)754 632 MS (k)765 632 MS (s)778 632 MS (i)823 595 MS (:)797 595 MS (l)732 595 MS (o)739 595 MS (c)751 595 MS (k)762 595 MS (e)775 595 MS = (r)786 595 MS ( )794 595 MS (E)954 557 MS (\))969 557 MS (P)810 557 MS (A)824 557 MS (R)842 557 MS (T)859 557 MS (I)874 557 MS = (C)882 557 MS (I)899 557 MS (P)906 557 MS (A)920 557 MS (T)938 557 MS (\()786 557 MS (i)794 557 MS (,)801 557 MS ( )781 557 MS (S)731 557 MS (e)745 557 MS (n)756 557 MS (d)769 557 MS (\()856 520 MS (I)864 520 MS (S)872 520 MS (\))886 520 MS (E)768 520 MS (l)783 520 MS (e)790 520 MS (m)801 520 MS (e)821 520 MS = (n)832 520 MS (t)844 520 MS ( )851 520 MS (:)742 520 MS ( )738 520 MS (i)731 520 MS (1)880 484 MS (])892 484 MS ( )856 484 MS (|)853 484 MS (I)827 484 MS (S)835 484 MS ([)808 484 MS (|)817 484 MS n 1331 67 M 1510 67 L s (O)1464 205 MS (K)1482 205 MS (\))1500 205 MS (\()1386 205 MS (l)1394 205 MS (o)1401 205 MS (c)1414 205 MS (k)1425 205 = MS (e)1437 205 MS (r)1448 205 MS (,)1457 205 MS ( )1381 205 MS (S)1331 205 MS (e)1345 205 MS (n)1356 205 MS (d)1369 205 MS (:)1414 167 MS (u)1332 167 MS (n)1345 167 MS (l)1357 167 MS (o)1364 167 MS (c)1377 167 = MS (k)1388 167 MS (s)1400 167 MS (:)1389 130 MS (l)1332 130 MS (o)1339 130 MS (c)1351 130 MS (k)1362 130 MS (s)1375 130 = MS (S)1425 92 MS (e)1439 92 MS (n)1449 92 MS (d)1462 92 MS (e)1474 92 MS = (r)1485 92 MS (:)1399 92 MS (l)1332 92 MS (o)1339 92 MS (c)1351 92 MS (k)1362 92 MS (e)1375 92 MS = (r)1386 92 MS (L)1386 57 MS (O)1401 57 MS (C)1419 57 MS (K)1436 57 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\306)1440 167 MS (=3D)1420 167 MS (\306)1415 130 MS (=3D)1395 130 MS (=3D)1405 92 MS n 1580 273 M 1835 273 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF ({)1742 299 MS (S)1754 299 MS (e)1768 299 MS (n)1779 299 MS (d)1792 299 = MS (e)1804 299 MS (r)1815 299 MS (})1824 299 MS ( )1716 299 MS (l)1664 299 MS (o)1671 299 MS (c)1684 299 MS (k)1695 299 MS (s)1707 299 = MS (:)1639 299 MS (l)1582 299 MS (o)1589 299 MS (c)1601 299 MS (k)1612 299 MS (s)1625 299 = MS (L)1674 264 MS (O)1689 264 MS (C)1706 264 MS (K)1723 264 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\310)1721 299 MS (=3D)1644 299 MS n 1501 863 M 1805 863 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF ({)1712 1002 MS (S)1724 1002 MS (e)1738 1002 MS (n)1749 1002 MS (d)1762 = 1002 MS (e)1774 1002 MS (r)1785 1002 MS (})1794 1002 MS ( )1709 1002 MS ( )1686 1002 MS (u)1609 1002 MS (n)1621 1002 MS (l)1634 1002 MS (o)1641 1002 MS (c)1653 = 1002 MS (k)1664 1002 MS (s)1677 1002 MS ( )1603 1002 MS (:)1584 1002 MS (u)1502 1002 MS (n)1515 1002 MS (l)1527 1002 MS (o)1535 1002 MS (c)1547 = 1002 MS (k)1558 1002 MS (s)1570 1002 MS ({)1651 964 MS (l)1663 964 MS (o)1670 964 MS (c)1683 964 MS (k)1694 964 = MS (e)1706 964 MS (r)1717 964 MS (})1725 964 MS ( )1635 964 MS (\\)1641 964 MS ( )1647 964 MS (l)1583 964 MS (o)1590 964 MS (c)1603 964 MS (k)1614 964 MS (s)1626 964 = MS ( )1578 964 MS (:)1559 964 MS (l)1502 964 MS (o)1509 964 MS (c)1522 964 MS (k)1533 964 MS (s)1545 964 = MS (O)1637 927 MS (K)1655 927 MS (\))1673 927 MS ( )1631 927 MS (\()1556 927 MS (l)1565 927 MS (o)1572 927 MS (c)1584 927 MS (k)1595 927 = MS (e)1608 927 MS (r)1619 927 MS (,)1627 927 MS ( )1551 927 MS (S)1501 927 MS (e)1515 927 MS (n)1526 927 MS (d)1539 927 MS (\()1683 889 MS (l)1691 889 MS (o)1698 889 MS (c)1711 889 MS (k)1722 889 = MS (s)1734 889 MS (\))1744 889 MS (E)1595 889 MS (l)1611 889 MS (e)1618 889 MS (m)1629 889 MS (e)1648 889 = MS (n)1659 889 MS (t)1672 889 MS ( )1679 889 MS (:)1569 889 MS (l)1502 889 MS (o)1509 889 MS (c)1522 889 MS (k)1533 889 MS (e)1545 889 = MS (r)1556 889 MS ( )1654 854 MS (U)1661 854 MS (N)1679 854 MS (L)1697 854 MS (O)1711 854 = MS (C)1729 854 MS (K)1746 854 MS (])1648 854 MS ([)1540 854 MS (l)1548 854 MS (o)1555 854 MS (c)1568 854 MS (k)1579 854 = MS (s)1591 854 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\310)1691 1002 MS (=3D)1590 1002 MS (=3D)1565 964 MS (=3D)1575 889 MS gs n 21 30 1627 830 CB (\306)1627 854 MS gr gs n 14 30 1607 830 CB (\271)1607 854 MS gr n 617 303 M 1067 303 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (O)980 329 MS (F)998 329 MS (F)1012 329 MS (E)1026 329 MS (R)1041 329 MS = (\))1058 329 MS ( )975 329 MS (\()955 329 MS (i)963 329 MS (,)970 329 MS ( )949 329 MS (S)900 329 MS (e)914 329 MS (n)925 329 MS (d)937 329 MS ( )865 329 MS ({)774 329 MS (S)786 329 MS (e)800 329 MS (n)811 329 MS (d)824 329 MS = (e)836 329 MS (r)847 329 MS (})855 329 MS ( )771 329 MS ( )747 329 MS (u)671 329 MS (n)683 329 MS (l)696 329 MS (o)703 329 MS (c)715 329 MS = (k)726 329 MS (s)739 329 MS ( )646 329 MS (i)639 329 MS ( )634 329 MS ( )843 293 MS (U)849 293 MS (N)867 293 MS (L)885 293 MS (O)900 293 MS = (C)918 293 MS (K)935 293 MS (])837 293 MS ([)729 293 MS (l)738 293 MS (o)745 293 MS (c)757 293 MS (k)768 293 MS = (s)781 293 MS [24.988 0 0 -24.988 0 0]/Symbol MF (\256)870 329 MS (\310)753 329 MS (\316)649 329 MS (")618 329 MS gs n 21 29 816 270 CB (\306)816 293 MS gr gs n 14 29 796 270 CB (=3D)796 293 MS gr n 1048 958 M 1336 958 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (c)1152 1097 MS (k)1163 1097 MS (e)1176 1097 MS (r)1187 1097 MS (\))1195 = 1097 MS (e)1049 1097 MS (x)1060 1097 MS (e)1073 1097 MS (c)1084 1097 MS (u)1095 = 1097 MS (t)1107 1097 MS (e)1114 1097 MS (\()1125 1097 MS (l)1134 1097 MS = (o)1141 1097 MS (|)1129 1059 MS (|)1097 1059 MS ( )1086 1059 MS ( )1093 1059 MS (:)1068 1059 MS (n)1049 1059 MS (R)1233 1022 MS (E)1250 1022 MS (F)1265 1022 MS (U)1279 1022 MS (S)1297 = 1022 MS (E)1311 1022 MS (\))1326 1022 MS ( )1228 1022 MS (\()1207 1022 MS (i)1215 1022 MS (,)1222 1022 MS ( )1202 1022 MS (S)1152 1022 MS (e)1166 1022 MS (n)1177 1022 MS (d)1190 1022 MS ( )1117 1022 MS ( )1076 1022 MS (i)1070 1022 MS ( )1065 1022 MS ({)1228 984 MS (l)1240 984 MS (o)1247 984 MS (c)1259 984 MS (k)1270 984 = MS (e)1283 984 MS (r)1294 984 MS (})1302 984 MS (\\)1218 984 MS (u)1135 984 MS (n)1147 984 MS (l)1160 984 MS (o)1167 984 MS (c)1179 984 = MS (k)1190 984 MS (s)1203 984 MS (\\)1123 984 MS (I)1097 984 MS (S)1105 984 MS (:)1070 984 MS (S)1151 948 MS (T)1165 948 MS (A)1181 948 MS (R)1199 948 MS (T)1215 948 = MS [24.988 0 7.723 -24.988 0 0]/Symbol MF (a)1105 1059 MS (a)1099 1022 MS (a)1047 984 MS [24.988 0 0 -24.988 0 0]/Symbol MF (=3D)1074 1059 MS (\256)1122 1022 MS (\316)1080 1022 MS (")1049 1022 MS (=3D)1076 984 MS n 865 778 M 966 778 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (1)950 804 MS (n)914 804 MS (:)888 804 MS (n)871 804 MS (A)867 769 MS (C)885 769 MS (K)902 769 MS (R)920 769 MS (E)937 769 MS = (F)952 769 MS [24.988 0 0 -24.988 0 0]/Symbol MF (-)933 804 MS (=3D)894 804 MS n 605 1076 M 676 1076 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (L)607 1067 MS (O)621 1067 MS (C)639 1067 MS (K)656 1067 MS n 386 931 M 461 931 L s [24.988 0 0 -24.988 0 0]/Symbol MF (\306)439 957 MS (=3D)420 957 MS (=3D)417 921 MS [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)413 957 MS (I)388 957 MS (S)396 957 MS (0)437 921 MS (])449 921 MS ([)390 921 MS (n)399 921 MS n 162 540 M 229 540 L s [24.988 0 0 -24.988 0 0]/Symbol MF (\306)207 566 MS (=3D)187 566 MS [24.988 0 0 -24.988 0 0]/Times-Roman MF (:)182 566 MS (I)164 566 MS (S)172 566 MS 6 sl n 791 985 M 794 992 L 796 998 L 799 1005 L 801 1011 L 803 1016 L 804 1021 L 806 1026 L 807 1030 L 808 1034 L 809 1038 L 810 1041 L 811 1044 L 811 1047 L 811 1049 L 811 1051 L 810 1052 L 810 1054 L 809 1054 L 808 1055 L 807 1055 L 806 1054 L 804 1054 L 802 1053 L 800 1051 L 798 1049 L 796 1047 L 793 1045 L 790 1042 L 787 1038 L 784 1035 L 781 1031 L 777 1026 L 773 1022 L 769 1016 L 765 1011 L 760 1005 L 756 999 L CM 0.246 0.246 scale s SM n 751 1004 M 745 984 L 762 996 L 751 1004 L cp e 1 sl n 778 1126 M 778 1120 L 780 1114 L 782 1109 L 785 1104 L 789 1100 L 794 1096 L 799 1093 L 805 1091 L 810 1090 L 816 1090 L 822 1091 L 828 1093 L 833 1096 L 837 1100 L 841 1104 L 845 1109 L 847 1114 L 848 1120 L 849 1126 L 848 1131 L 847 1137 L 845 1142 L 841 1147 L 837 1152 L 833 1155 L 828 1158 L 822 1160 L 816 1161 L 810 1161 L 805 1160 L 799 1158 L 794 1155 L 789 1152 L 785 1147 L 782 1142 L 780 1137 L 778 1131 L 778 1126 L cp gs 0.902 g e gr s [33.402 0 0 -33.234 0 0]/Helvetica MF (9)804 1136 MS n 827 1076 M 935 1076 L s [24.988 0 0 -24.988 0 0]/Times-Roman MF (U)829 1067 MS (N)847 1067 MS (L)865 1067 MS (O)880 1067 MS (C)898 1067 = MS (K)915 1067 MS showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Helvetica %%+ Symbol %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 1177 3247 a Fs(Figure)19 b(3.)g Fk(\013)p Fs(\226core)h(state)e(diagram)i(for)f(participants.)191 3605 y Fq(beha)n(viour)24 b(allo)n(ws)j(the)f(prospecti)n(v)o(e)f (winner)g(to)i(ha)n(v)o(e)f(e)o(xclusi)n(v)o(e)f(access)i(to)f(a)h (shared)f(participant)f(until)h(it)h(can)191 3704 y(reach)19 b(a)i(decision)f(and)f(decide)h(whether)f(the)h(interaction)f(it)i (manages)e(may)h(start)g(or)g(not.)274 3811 y(In)30 b(the)g Fm(LO)r(C)6 b(K)g(E)f(D)33 b Fq(state,)d(a)h(participant)e(w)o(aits)i (for)f(the)g(prospecti)n(v)o(e)e(winner)h(coordinator)f(to)i(send)g(it) h(an)191 3910 y Fm(U)9 b(N)g(LO)r(C)d(K)31 b Fq(message,)25 b(indicating)f(it)h(is)h(a)g(loser)f(and)g(the)g(interaction)f(it)h (manages)g(shall)g(not)g(be)g(e)o(x)o(ecuted,)e(or)191 4010 y(a)k Fm(S)5 b(T)12 b(AR)q(T)37 b Fq(message,)26 b(indicating)f(it)i(is)h(the)f(winner)e(and)h(the)h(interaction)e(it)i (manages)f(can)g(start.)h(The)f(former)191 4110 y(case)e(has)g(to)g(be) g(dealt)g(with)g(depending)d(on)j(the)f(a)n(v)n(ailability)h(of)f (other)g(coordinators)f(in)i(the)f Fm(l)r(ock)s(s)h Fq(set.)h(If)e (there)191 4209 y(is)h(at)f(least)h(one)f(coordinator)d(in)j(this)h (set)f(\(transition)f(5\),)h(one)f(of)h(them)g(is)h(chosen)e (arbitrarily)f(and)i(becomes)f(the)191 4309 y(ne)n(w)k(prospecti)n(v)o (e)e(winner)-5 b(.)26 b(\(It)g(is)h(important)e(to)h(choose)g(randomly) e(because)i(if)g(it)h(is)g(not)f(the)h(case,)f(v)n(ariability)191 4408 y(amongst)20 b(consecuti)n(v)o(e)f(e)o(x)o(ecutions)g(shall)j (depend)d(only)h(on)h(netw)o(ork)f(latenc)o(y)-5 b(.\))19 b(Then,)h(an)h Fm(O)r(K)28 b Fq(message)21 b(is)h(sent)191 4508 y(to)k(it,)h(and)e(the)h(participant)f(remains)g(in)i(the)f Fm(LO)r(C)6 b(K)g(E)f(D)28 b Fq(state.)f(If)f Fm(unl)r(ock)s(s)32 b Fj(=3D)i Fi(;)26 b Fq(\(transition)f(6\),)h(this)g(means)191 4608 y(that)c(no)g(coordinator)e(can)i(be)g(elected)g(as)h(a)g(ne)n(w)f (prospecti)n(v)o(e)e(winner)i(for)f(the)i(time)f(being,)f(and)h(the)g (participant)191 4707 y(has)e(to)f(return)g(to)g(the)h Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)19 b Fq(state.)h(During)f(this)h (transition,)e(of)n(fers)h(are)g(re-sent)g(to)h(the)g(coordinators)d (that)191 4807 y(ha)n(v)o(e)22 b(already)g(rejected)h(the)g (participant)f(because)g(it)i(has)f(not)g(e)o(x)o(ecuted)e(an)o(y)i (interaction)f(and)g(is)i(still)g(interested)191 4907 y(in)c(them.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)c FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,) f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 8 8 8 7 bop 191 299 a Fq(8)149 b FB(J.A.)16 b(P)552 285 y(\264)543 299 y(EREZ,)f(R.)h(CORCHUELO,)g(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 274 606 a Fq(When)37 b(a)h Fm(S)5 b(T)12 b(AR)q(T)48 b Fq(message)38 b(is)g(recei)n(v)o(ed)e(from)h(the)h(current)e(prospecti)n(v)o(e)f (winner)i(coordinator)e(in)j(the)191 706 y Fm(LO)r(C)6 b(K)g(E)f(D)45 b Fq(state)e(\(transition)f(7\),)g(the)g(interaction)f (that)i(coordinator)d(manages)h(has)i(been)f(selected)g(for)191 805 y(e)o(x)o(ecution)31 b(and)i(it)h(may)e(start.)i(Ho)n(we)n(v)o(er)m (,)d(a)i Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)38 b Fq(message)33 b(has)h(to)f(be)g(sent)h(to)f(the)g(coordinators)e(of)191 905 y(the)j(interactions)e(in)i(set)g Fm(I)7 b(S)e Fq(,)34 b(e)o(xcept)f(for)g(the)g(winner)g(and)g(those)g(that)h(are)g(kno)n(wn) e(to)h(be)h(losers)g(\(the)f(ones)191 1005 y(that)i(sent)h(an)f Fm(U)9 b(N)g(LO)r(C)d(K)41 b Fq(message\),)34 b(in)h(order)f(to)i (inform)d(them)i(that)g(this)h(participant)e(is)i(not)e(interested)191 1104 y(in)28 b(them)g(an)o(ymore.)d(Notice)j(that)g(on)g(recei)n(ving)e (a)j Fm(S)5 b(T)12 b(AR)q(T)38 b Fq(message,)27 b(the)h(participant)f (cannot)g(return)g(to)h(the)191 1204 y Fm(AC)6 b(T)12 b(I)7 b(V)18 b(E)29 b Fq(state)24 b(immediately)e(because)g(it)i (\002rst)g(has)f(to)g(w)o(ait)h(for)e(the)h(coordinators)e(it)j(has)f (sent)h(a)f Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 1303 y Fq(message)27 b(to)g(ackno)n(wledge)d(its)k(receipt)f(by)f(means)h(of)g (an)f Fm(AC)6 b(K)g(R)q(E)f(F)40 b Fq(message.)26 b(This)h(is)h (essential,)f(because)191 1403 y(if)f(the)g(participant)e(e)o(x)o (ecuted)g(the)i(interaction)e(and)i(of)n(fered)e(participation)g(in)h (other)g(interactions)g(immediately)191 1503 y(after)m(,)19 b Fm(AC)6 b(K)g(R)q(E)f(F)31 b Fq(messages)20 b(from)e(the)i (coordinators)d(that)i(where)g(sent)h(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)24 b Fq(message)19 b(before)f(might)191 1602 y(be)27 b(misunderstood)d(if)j(another)f(interaction)f(w)o(as)j(e) o(x)o(ecuted)d(too)i(soon.)f(Consequently)-5 b(,)24 b(the)j (participant)f(has)h(to)191 1702 y(remain)32 b(in)g(an)h(intermediate)e (state)i(called)f Fm(S)5 b(Y)19 b(N)9 b(C)39 b Fq(until)32 b(e)n(v)o(ery)f(coordinator)f(that)j(w)o(as)g(sent)g(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 1802 y Fq(message)20 b(ackno)n(wledges)e(its)j(receipt.)274 1904 y Fm(LO)r(C)6 b(K)31 b Fq(and)23 b Fm(U)9 b(N)g(LO)r(C)d(K)31 b Fq(messages)24 b(may)g(also)h(be)f(recei)n(v)o(ed)f(in)h(state)h Fm(S)5 b(Y)18 b(N)9 b(C)d Fq(.)25 b(F)o(or)f(the)g(time)h(being,)e(it)i(is)191 2003 y(dif)n(\002cult)16 b(to)i(realise)f(the)g(reason)g(why)f(because) g(the)o(y)h(stem)g(from)f(some)h(intricacies)g(in)g(the)h(coordinators) c(that)j(shall)191 2103 y(become)i(clear)h(in)g(Section)g(.)191 2309 y Fm(\013)p Fr(\226cor)o(e)f(in)i(a)f(coordinator)191 2506 y Fq(Figure)g(4)h(sho)n(ws)h(the)f(state)g(transition)g(diagram)e (for)i(coordinators,)d(and)i(T)-7 b(able)21 b(III)g(gi)n(v)o(es)g(a)g (brief)f(e)o(xplanation)f(of)191 2606 y(its)i(v)n(ariables.)274 2708 y(A)f(coordinator)d(may)j(be)f(in)h(tw)o(o)h(dif)n(ferent)d (states)j(called)e Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)20 b Fq(and)g Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(,)20 b(and)f(accepts)191 2807 y(of)n(fers)24 b(from)f(participants)h(whilst)h(it)h(is)g(in)f (state)g Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(.)25 b(Those)f(of)n(fers)g(can)h(be)f(made)g(by)h(means)f(of)191 2907 y Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)33 b Fq(messages,)c(in)g(the)g(case)h(of)e(non\226shared)f(participants)h (\(transition)f(2\),)i(or)g(by)f(means)h(of)191 3007 y Fm(O)r(F)12 b(F)g(E)5 b(R)29 b Fq(messages,)e(in)h(the)f(case)h(of)f (shared)f(participants)g(\(transition)g(1\).)h(In)g(the)h(former)d (case,)j(since)f(non\226)191 3106 y(shared)i(participants)f (automatically)g(lock)h(themselv)o(es,)f(the)o(y)h(are)h(directly)e (stored)h(in)h(the)f Fm(l)r(ock)s(ed)h Fq(set.)g(In)f(the)191 3206 y(latter)m(,)20 b(the)h(participant)e(that)i(made)f(the)g(of)n (fer)g(is)h(w)o(aiting)g(to)f(be)h(lock)o(ed,)e(so)i(the)g(coordinator) d(stores)j(its)g(identi\002er)191 3305 y(in)f(the)h Fm(shar)r(ed)g Fq(set.)f(In)g(both)g(cases,)g(the)g(of)n(fer)f(counter)g Fm(n)i Fq(is)g(increased.)274 3407 y(The)i Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)24 b Fq(state)g(is)h(a)e(bit)h(more)f(comple)o(x)e (than)i(it)i(might)d(seem,)i(because)f(whilst)h(a)g(coordinator)191 3507 y(is)e(still)h(w)o(aiting)f(for)f(of)n(fers,)f(it)i(may)g(recei)n (v)o(e)e(a)i Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)26 b Fq(message)c(from)e(a)i (participant)f(that)g(w)o(ants)h(to)g(cancel)191 3607 y(its)27 b(of)n(fer)f(because)g(another)f(coordinator)f(in)i(which)g (it)h(w)o(as)h(interested)e(has)g(reacted)g(more)g(quickly)f (\(transition)191 3706 y(3\).)20 b(Since)g(this)g(participant)f(is)i (shared,)f(the)g(coordinator)d(needs)j(to)g(remo)o(v)o(e)e(it)j(from)e (the)i Fm(shar)r(ed)g Fq(set)g(set)f(because)191 3806 y(no)j Fm(LO)r(C)6 b(K)31 b Fq(message)23 b(has)h(been)f(sent)h(to)g (it.)h(An)f Fm(AC)6 b(K)g(R)q(E)f(F)36 b Fq(message)23 b(is)i(sent)f(in)g(order)f(to)g(ackno)n(wledge)f(the)191 3906 y Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)22 b Fq(message,)16 b(and)g(the)h(of)n(fer)f(counter)f Fm(n)i Fq(is)h(decreased.)e(The)g (reason)g(why)g Fm(n)i Fq(is)f(decreased)f(conditionally)191 4005 y(stems)21 b(from)e(an)h(intricac)o(y)f(of)h Fm(\013)p Fq(\226core)g(that)g(we)g(e)o(xplain)f(further)g(in)h(Section)g(.)274 4107 y(When)31 b Fm(n)h Fq(equals)g(the)f(cardinality)f(of)i(the)f (interaction)g(a)h(coordinator)c(manages)j(in)h(the)f Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)191 4207 y Fq(state,)28 b(it)g(gets)g(enabled)f(and)g(there)g(are)g(tw)o(o)h(possible)f (continuations)f(depending)f(on)i(the)g(e)o(xistence)g(of)h(shared)191 4306 y(participants.)22 b(If)i(the)f(coordinator)e(has)j(no)f(shared)g (participants)g(\(transition)f(4\),)h(it)h(has)g(not)f(to)h(compete)f (for)g(an)o(y)191 4406 y(of)h(them.)f(Thus,)g(it)i(can)e(send)h (immediately)e(a)j Fm(S)5 b(T)12 b(AR)q(T)34 b Fq(message)24 b(to)g(each)f(of)h(its)h(participants)d(to)i(notify)f(them)191 4506 y(that)d(the)o(y)e(can)i(start)g(the)f(interaction)g(it)h (manages.)e(Otherwise)i(\(transition)e(5\),)h(it)h(needs)g(to)f (carefully)f(lock)i(shared)191 4605 y(participants.)274 4707 y(The)36 b(solution)f(we)h(use)h(w)o(as)g(presented)d(in)j([6)o (],)f(and)g(it)g(consists)h(of)f(establishing)f(a)i(strict)f(partial)g (order)191 4807 y(relationship)23 b(amongst)h(shared)g(resources)g(so)h (that)g(the)o(y)f(ha)n(v)o(e)g(to)h(be)g(acquired)e(in)i(increasing)f (order)-5 b(.)23 b(Thus,)h(for)191 4907 y(a)g(coordinator)c(to)k(lock)e (a)i(participant)e Fm(P)12 b Fq(,)24 b(it)g(must)f(ha)n(v)o(e)g(lock)o (ed)f(pre)n(viously)f(e)n(v)o(ery)h(shared)h(participant)f Fm(Q)h Fq(such)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f (Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 9 9 9 8 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1186 299 a FB(AN)16 b(ORDER-B)n(ASED)g(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)150 b Fq(9)p 191 473 3388 5 v 191 3071 a @beginspecial 56.689999 @llx 56.689999 @lly 444.320007 @urx 305.140015 @ury 4064 @rwi @setspecial %%BeginDocument: std-coord.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip067.wmf %%Creator: Windows NT 4.0 %%CreationDate: 20:6 2/23/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 444.32 305.14 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 305.289 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 sl n 465 429 M 575 429 L 580 428 L 585 427 L 590 425 L 594 422 L 598 418 L 601 414 L 603 409 L 604 404 L 605 399 L 605 370 L 604 365 L 603 360 L 601 355 L 598 351 L 594 347 L 590 344 L 585 342 L 580 341 L 575 340 L 465 340 L 460 341 L 455 342 L 450 344 L 446 347 L 442 351 L 439 355 L 437 360 L 436 365 L 435 370 L 435 399 L 436 404 L 437 409 L 439 414 L 442 418 L 446 422 L 450 425 L 455 427 L 460 428 L 465 429 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [24.93 0 0 -24.984 0 0]/Times-Roman MF (A)450 392 MS (C)468 392 MS (C)485 392 MS (E)502 392 MS (P)517 392 MS = (T)531 392 MS (I)546 392 MS (N)554 392 MS (G)572 392 MS n 1480 429 M 1591 429 L 1596 428 L 1601 427 L 1605 425 L 1610 422 L 1613 418 L 1616 414 L 1618 409 L 1620 404 L 1620 399 L 1620 370 L 1620 365 L 1618 360 L 1616 355 L 1613 351 L 1610 347 L 1605 344 L 1601 342 L 1596 341 L 1591 340 L 1480 340 L 1475 341 L 1470 342 L 1465 344 L 1461 347 L 1458 351 L 1455 355 L 1452 360 L 1451 365 L 1451 370 L 1451 399 L 1451 404 L 1452 409 L 1455 414 L 1458 418 L 1461 422 L 1465 425 L 1470 427 L 1475 428 L 1480 429 L cp gs 1 g e gr s (L)1480 392 MS (O)1494 392 MS (C)1512 392 MS (K)1529 392 MS (I)1547 392 = MS (N)1555 392 MS (G)1573 392 MS n 185 591 M 185 587 L 186 584 L 188 581 L 191 579 L 194 577 L 198 577 L 201 577 L 205 577 L 208 579 L 210 581 L 212 584 L 213 587 L 214 591 L 213 595 L 212 598 L 210 601 L 208 603 L 205 605 L 201 606 L 198 606 L 194 605 L 191 603 L 188 601 L 186 598 L 185 595 L 185 591 L cp gs 0.102 g e gr s n 1250 1034 M 1681 1034 L 1681 857 L 1250 857 L 1250 1034 L cp e n 1232 1016 M 1663 1016 L 1663 839 L 1232 839 L 1232 1016 L cp gs 1 g e gr s (w)1240 875 MS (a)1258 875 MS (i)1269 875 MS (t)1276 875 MS (i)1283 875 = MS (n)1290 875 MS (g)1303 875 MS (:)1315 875 MS ( )1322 875 MS (S)1328 = 875 MS (e)1342 875 MS (t)1353 875 MS ( )1360 875 MS (o)1366 875 MS = (f)1379 875 MS ( )1387 875 MS (P)1393 875 MS (a)1407 875 MS (r)1418 875 MS (t)1426 875 MS (i)1433 875 = MS (c)1440 875 MS (i)1451 875 MS (p)1458 875 MS (a)1471 875 MS (n)1482 = 875 MS (t)1494 875 MS (l)1240 905 MS (o)1247 905 MS (c)1260 905 MS (k)1271 905 MS (e)1283 905 = MS (d)1294 905 MS (:)1307 905 MS ( )1314 905 MS (S)1320 905 MS (e)1334 = 905 MS (t)1345 905 MS ( )1352 905 MS (o)1358 905 MS (f)1371 905 MS ( = )1379 905 MS (P)1385 905 MS (a)1399 905 MS (r)1410 905 MS (t)1418 905 MS (i)1425 905 MS (c)1432 905 = MS (i)1443 905 MS (p)1450 905 MS (a)1463 905 MS (n)1474 905 MS (t)1486 = 905 MS (s)1240 935 MS (h)1250 935 MS (a)1262 935 MS (r)1273 935 MS (e)1282 935 = MS (d)1293 935 MS (:)1305 935 MS ( )1312 935 MS (S)1318 935 MS (e)1332 = 935 MS (t)1343 935 MS ( )1350 935 MS (o)1357 935 MS (f)1369 935 MS ( = )1377 935 MS (P)1384 935 MS (a)1397 935 MS (r)1408 935 MS (t)1417 935 MS (i)1424 935 MS (c)1431 935 = MS (i)1442 935 MS (p)1449 935 MS (a)1461 935 MS (n)1472 935 MS (t)1485 = 935 MS (c)1240 965 MS (u)1251 965 MS (r)1264 965 MS (r)1272 965 MS (e)1280 965 = MS (n)1291 965 MS (t)1304 965 MS (:)1311 965 MS ( )1318 965 MS (P)1324 = 965 MS (a)1338 965 MS (r)1349 965 MS (t)1357 965 MS (i)1364 965 MS = (c)1371 965 MS (i)1382 965 MS (p)1389 965 MS (a)1401 965 MS (n)1412 965 MS (t)1425 965 MS (n)1240 995 MS (:)1253 995 MS ( )1260 995 MS (i)1266 995 MS (n)1273 995 = MS (t)1285 995 MS (e)1292 995 MS (g)1303 995 MS (e)1316 995 MS (r)1327 = 995 MS 1 j 1 setlinecap 6 sl n 435 385 M 430 373 L 424 361 L 419 350 L 414 339 L 409 328 L 404 318 L 400 309 L 396 299 L 392 290 L 389 282 L 385 274 L 382 266 L 379 259 L 377 252 L 374 245 L 372 239 L 370 233 L 369 228 L 368 223 L 366 218 L 366 214 L 365 210 L 365 206 L 365 203 L 365 200 L 365 198 L 366 196 L 367 194 L 368 193 L 369 192 L 371 192 L 373 192 L 375 192 L 377 193 L 380 194 L 383 196 L 386 197 L 389 200 L 393 202 L 397 205 L 401 209 L 405 213 L 410 217 L 414 221 L 420 226 L 425 232 L 430 237 L 436 244 L 442 250 L 449 257 L 455 264 L 462 272 L 469 280 L 477 288 L 484 297 L 492 306 L 500 316 L 508 326 L CM 0.246 0.246 scale s SM n 502 329 M 520 340 L 512 320 L 502 329 L cp e n 435 385 M 430 396 L 425 408 L 420 419 L 415 429 L 410 440 L 406 450 L 402 459 L 398 468 L 395 477 L 391 485 L 388 493 L 385 501 L 383 508 L 380 515 L 378 521 L 376 527 L 375 533 L 373 538 L 372 543 L 371 547 L 371 551 L 370 555 L 370 558 L 370 561 L 371 564 L 371 566 L 372 568 L 373 569 L 374 570 L 376 571 L 378 571 L 380 571 L 382 571 L 384 570 L 387 569 L 390 567 L 393 565 L 397 562 L 400 560 L 404 556 L 408 553 L 413 549 L 418 544 L 422 540 L 428 535 L 433 529 L 439 523 L 445 517 L 451 510 L 457 503 L 464 496 L 470 488 L 478 480 L 485 471 L 492 462 L 500 453 L 508 443 L CM 0.246 0.246 scale s SM n 502 440 M 520 429 L 512 449 L 502 440 L cp e n 605 385 M 610 373 L 615 361 L 620 350 L 624 339 L 629 328 L 633 318 L 637 309 L 640 299 L 644 291 L 647 282 L 650 274 L 653 266 L 655 259 L 658 252 L 660 245 L 662 239 L 663 233 L 665 228 L 666 223 L 667 218 L 667 214 L 668 210 L 668 206 L 668 203 L 668 200 L 667 198 L 667 196 L 666 194 L 665 193 L 663 192 L 662 192 L 660 192 L 658 192 L 655 193 L 653 194 L 650 196 L 647 197 L 644 200 L 640 202 L 637 205 L 633 209 L 629 213 L 624 217 L 620 221 L 615 226 L 610 232 L 605 237 L 599 243 L 594 250 L 588 257 L 581 264 L 575 272 L 568 280 L 561 288 L 554 297 L 547 306 L 539 316 L 531 326 L CM 0.246 0.246 scale s SM n 538 328 M 520 340 L 527 320 L 538 328 L cp e n 1484 341 M 1481 330 L 1478 319 L 1475 308 L 1471 298 L 1466 288 L 1462 278 L 1457 269 L 1452 260 L 1446 251 L 1440 243 L 1434 235 L 1428 228 L 1421 221 L 1414 214 L 1406 207 L 1398 201 L 1390 195 L 1382 190 L 1373 184 L 1364 180 L 1354 175 L 1345 171 L 1335 167 L 1324 164 L 1313 161 L 1302 158 L 1291 156 L 1279 153 L 1267 152 L 1255 150 L 1242 149 L 1229 149 L 1215 148 L 1202 148 L 1188 149 L 1173 149 L 1159 150 L 1144 152 L 1128 153 L 1113 156 L 1097 158 L 1080 161 L 1064 164 L 1047 167 L 1029 171 L 1012 175 L 994 180 L 976 184 L 957 190 L 938 195 L 919 201 L 899 207 L 879 214 L 859 221 L 839 228 L 818 235 L 796 243 L 775 251 L 753 260 L 731 269 L 708 278 L 685 288 L 662 298 L 639 308 L 615 319 L 591 330 L 566 341 L CM 0.246 0.246 scale s SM n 1473 323 M 1484 341 L 1486 320 L 1473 323 L cp e n 605 385 M 610 396 L 615 408 L 620 419 L 625 429 L 629 440 L 633 450 L 637 459 L 641 468 L 644 477 L 648 485 L 651 493 L 653 501 L 656 508 L 658 515 L 660 521 L 662 527 L 664 533 L 665 538 L 666 543 L 667 547 L 668 551 L 668 555 L 668 558 L 668 561 L 668 564 L 667 566 L 666 568 L 665 569 L 664 570 L 662 571 L 661 571 L 659 571 L 656 571 L 654 570 L 651 569 L 648 567 L 645 565 L 642 562 L 638 560 L 634 556 L 630 553 L 626 549 L 621 544 L 616 540 L 611 535 L 606 529 L 600 523 L 595 517 L 589 510 L 582 503 L 576 496 L 569 488 L 562 480 L 555 471 L 547 462 L 540 453 L 532 443 L CM 0.246 0.246 scale s SM n 538 440 M 520 429 L 528 449 L 538 440 L cp e 1 sl n 276 201 M 276 196 L 278 190 L 280 185 L 283 180 L 287 175 L 292 172 L 297 169 L 302 167 L 308 166 L 314 166 L 320 167 L 325 169 L 331 172 L 335 175 L 339 180 L 342 185 L 345 190 L 346 196 L 347 201 L 346 207 L 345 213 L 342 218 L 339 223 L 335 227 L 331 231 L 325 234 L 320 236 L 314 237 L 308 237 L 302 236 L 297 234 L 292 231 L 287 227 L 283 223 L 280 218 L 278 213 L 276 207 L 276 201 L cp gs 0.902 g e gr s %%IncludeFont: Helvetica [33.395 0 0 -33.23 0 0]/Helvetica MF (1)302 211 MS n 648 154 M 648 148 L 649 143 L 652 137 L 655 132 L 659 128 L 664 125 L 669 122 L 674 120 L 680 119 L 686 119 L 692 120 L 697 122 L 702 125 L 707 128 L 711 132 L 714 137 L 716 143 L 718 148 L 718 154 L 718 160 L 716 166 L 714 171 L 711 176 L 707 180 L 702 184 L 697 187 L 692 189 L 686 189 L 680 189 L 674 189 L 669 187 L 664 184 L 659 180 L 655 176 L 652 171 L 649 166 L 648 160 L 648 154 L cp gs 0.902 g e gr s (2)674 164 MS n 293 591 M 294 585 L 295 580 L 298 574 L 301 569 L 305 565 L 310 562 L 315 559 L 320 557 L 326 556 L 332 556 L 338 557 L 343 559 L 348 562 L 353 565 L 357 569 L 360 574 L 362 580 L 364 585 L 364 591 L 364 597 L 362 602 L 360 608 L 357 613 L 353 617 L 348 621 L 343 623 L 338 625 L 332 626 L 326 626 L 320 625 L 315 623 L 310 621 L 305 617 L 301 613 L 298 608 L 295 602 L 294 597 L 293 591 L cp gs 0.902 g e gr s (3)320 601 MS n 636 641 M 636 635 L 638 630 L 640 624 L 643 619 L 647 615 L 652 612 L 657 609 L 663 607 L 668 606 L 674 606 L 680 607 L 686 609 L 691 612 L 695 615 L 699 619 L 702 624 L 705 630 L 706 635 L 707 641 L 706 647 L 705 653 L 702 658 L 699 663 L 695 667 L 691 671 L 686 674 L 680 676 L 674 677 L 668 677 L 663 676 L 657 674 L 652 671 L 647 667 L 643 663 L 640 658 L 638 653 L 636 647 L 636 641 L cp gs 0.902 g e gr s (4)662 651 MS n 1036 83 M 1036 77 L 1038 72 L 1040 66 L 1043 62 L 1047 57 L 1052 54 L 1057 51 L 1062 49 L 1068 48 L 1074 48 L 1080 49 L 1085 51 L 1090 54 L 1095 57 L 1099 62 L 1102 66 L 1105 72 L 1106 77 L 1106 83 L 1106 89 L 1105 95 L 1102 100 L 1099 105 L 1095 109 L 1090 113 L 1085 116 L 1080 118 L 1074 119 L 1068 119 L 1062 118 L 1057 116 L 1052 113 L 1047 109 L 1043 105 L 1040 100 L 1038 95 L 1036 89 L 1036 83 L cp gs 0.902 g e gr s (5)1062 93 MS 6 sl n 1484 430 M 1479 444 L 1473 458 L 1467 471 L 1460 484 L 1454 496 L 1447 508 L 1440 520 L 1433 531 L 1425 542 L 1418 553 L 1410 563 L 1402 572 L 1394 581 L 1385 590 L 1376 598 L 1367 606 L 1358 614 L 1349 621 L 1339 628 L 1329 634 L 1319 640 L 1309 645 L 1299 651 L 1288 655 L 1277 659 L 1266 663 L 1254 667 L 1243 670 L 1231 672 L 1219 675 L 1207 676 L 1194 678 L 1182 679 L 1169 679 L 1156 680 L 1142 679 L 1129 679 L 1115 677 L 1101 676 L 1087 674 L 1073 672 L 1058 669 L 1043 666 L 1028 662 L 1013 658 L 998 654 L 982 649 L 966 644 L 950 638 L 934 632 L 917 626 L 900 619 L 883 612 L 866 604 L 849 596 L 831 588 L 813 579 L 795 570 L 777 560 L 758 550 L 739 539 L 720 528 L 701 517 L 682 505 L 662 493 L 642 481 L 622 468 L 602 454 L 582 440 L CM 0.246 0.246 scale s SM n 587 436 M 566 430 L 579 447 L 587 436 L cp e 1 sl n 1567 562 M 1567 556 L 1569 550 L 1571 545 L 1574 540 L 1578 536 L 1583 532 L 1588 529 L 1594 527 L 1599 526 L 1605 526 L 1611 527 L 1617 529 L 1622 532 L 1626 536 L 1630 540 L 1633 545 L 1636 550 L 1637 556 L 1638 562 L 1637 567 L 1636 573 L 1633 579 L 1630 583 L 1626 587 L 1622 591 L 1617 594 L 1611 596 L 1605 597 L 1599 597 L 1594 596 L 1588 594 L 1583 591 L 1578 587 L 1574 583 L 1571 579 L 1569 573 L 1567 567 L 1567 562 L cp gs 0.902 g e gr s (6)1593 572 MS 6 sl n 1451 385 M 623 385 L CM 0.246 0.246 scale s SM n 625 378 M 605 385 L 625 391 L 625 378 L cp e 1 sl n 1325 334 M 1326 329 L 1327 323 L 1329 317 L 1333 313 L 1337 308 L 1341 305 L 1346 302 L 1352 300 L 1358 299 L 1364 299 L 1369 300 L 1375 302 L 1380 305 L 1385 308 L 1389 313 L 1392 317 L 1394 323 L 1396 329 L 1396 334 L 1396 340 L 1394 346 L 1392 351 L 1389 356 L 1385 360 L 1380 364 L 1375 367 L 1369 369 L 1364 370 L 1358 370 L 1352 369 L 1346 367 L 1341 364 L 1337 360 L 1333 356 L 1329 351 L 1327 346 L 1326 340 L 1325 334 L cp gs 0.902 g e gr s (7)1351 344 MS 6 sl n 1548 442 M 1558 452 L 1567 461 L 1576 470 L 1584 479 L 1593 487 L 1601 495 L 1608 502 L 1616 510 L 1623 516 L 1630 523 L 1637 529 L 1643 535 L 1649 540 L 1655 545 L 1660 550 L 1666 554 L 1670 558 L 1675 561 L 1680 565 L 1684 567 L 1688 570 L 1691 572 L 1694 574 L 1697 575 L 1700 576 L 1703 577 L 1705 577 L 1707 577 L 1708 577 L 1710 576 L 1711 575 L 1711 573 L 1712 571 L 1712 569 L 1712 567 L 1712 564 L 1711 560 L 1710 557 L 1709 553 L 1708 548 L 1706 544 L 1704 538 L 1702 533 L 1699 527 L 1696 521 L 1693 514 L 1690 507 L 1686 500 L 1682 492 L 1678 484 L 1673 476 L 1669 467 L 1663 458 L 1658 449 L 1652 439 L 1647 429 L 1640 418 L 1634 407 L 1627 396 L 1620 385 L CM 0.246 0.246 scale s SM n 1554 439 M 1535 429 L 1545 448 L 1554 439 L cp e 1 sl n 1301 556 M 1302 550 L 1303 544 L 1306 539 L 1309 534 L 1313 530 L 1317 526 L 1323 523 L 1328 521 L 1334 520 L 1340 520 L 1346 521 L 1351 523 L 1356 526 L 1361 530 L 1365 534 L 1368 539 L 1370 544 L 1372 550 L 1372 556 L 1372 562 L 1370 567 L 1368 573 L 1365 578 L 1361 582 L 1356 585 L 1351 588 L 1346 590 L 1340 591 L 1334 591 L 1328 590 L 1323 588 L 1317 585 L 1313 582 L 1309 578 L 1306 573 L 1303 567 L 1302 562 L 1301 556 L cp gs 0.902 g e gr s (8)1328 566 MS 6 sl n 419 393 M 406 400 L 393 407 L 381 414 L 369 421 L 357 428 L 346 435 L 335 442 L 325 449 L 315 455 L 305 462 L 296 469 L 288 476 L 279 482 L 271 489 L 264 496 L 257 502 L 250 509 L 244 515 L 238 522 L 232 528 L 227 535 L 222 541 L 218 547 L 214 554 L 211 560 L 208 566 L 205 573 L 203 579 L 201 585 L 199 591 L CM 0.246 0.246 scale s SM n 420 400 M 435 385 L 414 388 L 420 400 L cp e 1 sl n 162 390 M 284 390 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)209 491 MS (:)182 491 MS (n)164 491 MS (:)234 454 MS (s)163 454 MS (h)173 454 MS (a)185 454 MS (r)196 454 MS (e)204 454 MS = (d)215 454 MS (:)235 416 MS (l)163 416 MS (o)170 416 MS (c)183 416 MS (k)194 416 MS (e)206 416 MS = (d)217 416 MS %%IncludeFont: Symbol [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)189 491 MS (\306)261 454 MS (=3D)240 454 MS (\306)262 416 MS (=3D)241 416 MS n 201 54 M 483 54 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)390 117 MS (S)402 117 MS (e)416 117 MS (n)427 117 MS (d)440 117 MS = (e)452 117 MS (r)463 117 MS (})472 117 MS ( )386 117 MS ( )363 117 MS (s)298 117 MS (h)307 117 MS (a)320 117 MS (r)331 117 MS (e)339 117 MS = (d)350 117 MS ( )293 117 MS (:)273 117 MS (s)202 117 MS (h)212 117 MS (a)224 117 MS (r)235 117 MS (e)243 117 MS = (d)254 117 MS (1)282 80 MS (n)247 80 MS ( )241 80 MS (:)221 80 MS (n)203 80 MS ( )461 44 MS (O)383 44 MS (F)401 44 MS (F)414 44 MS (E)428 44 MS (R)443 44 MS ( )377 44 MS (y)359 44 MS (])371 44 MS (C)260 44 MS (a)276 44 MS (r)287 44 MS (d)296 44 MS (i)308 44 MS (n)315 = 44 MS (a)328 44 MS (l)339 44 MS (i)346 44 MS (t)353 44 MS ( )254 44 MS ( )236 44 MS ([)215 44 MS (n)224 44 MS [24.984 0 0 -24.984 0 0]/Symbol MF (\310)368 117 MS (=3D)279 117 MS (+)265 80 MS (=3D)227 80 MS (<)241 44 MS n 642 44 M 971 44 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)855 107 MS (S)867 107 MS (e)881 107 MS (n)892 107 MS (d)904 107 MS = (e)917 107 MS (r)928 107 MS (})936 107 MS ( )828 107 MS (l)762 107 MS (o)769 107 MS (c)782 107 MS (k)793 107 MS (e)805 107 MS = (d)816 107 MS ( )757 107 MS (:)738 107 MS (l)667 107 MS (o)674 107 MS (c)686 107 MS (k)697 107 MS (e)710 107 MS = (d)721 107 MS (1)744 70 MS (n)710 70 MS ( )704 70 MS (:)685 70 MS (n)667 70 MS (E)954 34 MS (P)810 34 MS (A)824 34 MS (R)842 34 MS (T)859 34 MS (I)874 34 MS (C)882 = 34 MS (I)898 34 MS (P)906 34 MS (A)920 34 MS (T)938 34 MS ( )804 34 MS (y)786 34 MS (])798 34 MS (C)687 34 MS (a)703 34 MS (r)714 34 MS (d)723 34 MS (i)735 34 MS (n)742 = 34 MS (a)755 34 MS (l)766 34 MS (i)773 34 MS (t)780 34 MS ( )681 34 MS ([)642 34 MS (n)651 34 MS ( )663 34 MS [24.984 0 0 -24.984 0 0]/Symbol MF (\310)834 107 MS (=3D)744 107 MS (+)728 70 MS (=3D)691 70 MS gs n 14 29 668 11 CB (<)668 34 MS gr n 261 669 M 526 669 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF ({)433 770 MS (S)445 770 MS (e)459 770 MS (n)470 770 MS (d)483 770 MS = (e)495 770 MS (r)506 770 MS (})515 770 MS ( )417 770 MS (\\)423 770 MS ( )430 770 MS (s)353 770 MS (h)362 770 MS (a)375 770 MS (r)386 770 MS (e)394 770 MS = (d)405 770 MS (:)350 770 MS (:)331 770 MS (s)261 770 MS (h)271 770 MS (a)284 770 MS (r)295 770 MS (e)303 770 MS = (d)314 770 MS (A)399 733 MS (C)417 733 MS (K)434 733 MS (R)452 733 MS (E)469 733 MS = (F)484 733 MS (\))498 733 MS ( )393 733 MS (r)380 733 MS (,)388 733 MS (S)261 733 MS (e)275 733 MS (n)286 733 MS (d)299 733 MS (\()311 733 MS = (S)319 733 MS (e)333 733 MS (n)344 733 MS (d)357 733 MS (e)369 733 MS (0)438 695 MS (\))450 695 MS ( )432 695 MS (:)428 695 MS ( )424 695 MS (1)415 695 MS (n)381 695 MS ( )375 695 MS (?)365 695 MS ( )360 695 MS (0)349 695 MS ( )344 695 MS (\()304 695 MS (n)313 695 MS ( )325 695 MS ( )299 695 MS (:)280 695 MS (n)262 695 MS (R)347 660 MS (E)364 660 MS (F)379 660 MS (U)393 660 MS (S)411 660 MS = (E)425 660 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)337 770 MS (-)399 695 MS (>)331 695 MS (=3D)286 695 MS n 660 727 M 981 727 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)706 866 MS (:)680 866 MS (n)662 866 MS (:)748 828 MS (:)731 828 MS (s)661 828 MS (h)671 828 MS (a)683 828 MS (r)694 828 MS (e)703 828 MS = (d)714 828 MS ( )777 791 MS ( )752 791 MS (:)733 791 MS (l)662 791 MS (o)669 791 MS (c)681 791 MS (k)692 791 MS (e)705 791 MS = (d)716 791 MS (S)891 753 MS (T)905 753 MS (A)921 753 MS (R)939 753 MS (T)955 753 MS = (\))971 753 MS ( )887 753 MS (\()866 753 MS (i)875 753 MS (,)882 753 MS ( )861 753 MS (S)811 753 MS (e)825 753 MS (n)836 753 MS (d)849 753 MS ( )807 753 MS ( )778 753 MS (l)712 753 MS (o)719 753 MS (c)731 753 MS (k)742 753 MS (e)755 753 MS = (d)766 753 MS ( )707 753 MS ( )689 753 MS (i)683 753 MS ( )678 753 MS (])962 718 MS ( )935 718 MS ( )917 718 MS (s)852 718 MS (h)862 718 MS (a)875 718 MS (r)886 718 MS (e)894 718 MS = (d)905 718 MS ( )847 718 MS (y)815 718 MS ( )827 718 MS (C)716 718 MS (a)732 718 MS (r)743 718 MS (d)752 718 MS (i)764 718 MS = (n)771 718 MS (a)784 718 MS (l)795 718 MS (i)802 718 MS (t)809 718 MS ( )710 718 MS ([)671 718 MS (n)679 718 MS ( )692 718 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)686 866 MS (\306)759 828 MS (=3D)737 828 MS (\306)757 791 MS (=3D)739 791 MS (\256)783 753 MS (\316)692 753 MS (")661 753 MS gs n 21 30 941 694 CB (\306)941 718 MS gr gs n 14 30 923 694 CB (=3D)923 718 MS gr gs n 15 30 833 694 CB (\331)833 718 MS gr gs n 14 30 697 694 CB (=3D)697 718 MS gr n 1127 34 M 1426 34 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (L)1280 135 MS (O)1294 135 MS (C)1312 135 MS (K)1329 135 MS (\))1347 135 = MS (\()1191 135 MS (c)1199 135 MS (u)1210 135 MS (r)1222 135 MS (r)1231 135 = MS (e)1239 135 MS (n)1250 135 MS (t)1262 135 MS (,)1269 135 MS ( )1185 135 MS (S)1136 135 MS (e)1150 135 MS (n)1161 135 MS (d)1173 135 MS ({)1322 97 MS (c)1334 97 MS (u)1345 97 MS (r)1358 97 MS (r)1366 97 MS = (e)1374 97 MS (n)1385 97 MS (t)1398 97 MS (})1405 97 MS (\\)1313 97 MS (s)1242 97 MS (h)1252 97 MS (a)1265 97 MS (r)1276 97 MS (e)1284 97 MS = (d)1295 97 MS (:)1217 97 MS (w)1137 97 MS (a)1155 97 MS (i)1166 97 MS (t)1173 97 MS (i)1180 97 MS = (n)1187 97 MS (g)1200 97 MS ( )1410 60 MS (\()1330 60 MS (s)1338 60 MS (h)1348 60 MS (a)1360 60 MS (r)1371 60 MS = (e)1380 60 MS (d)1390 60 MS (\))1403 60 MS ( )1324 60 MS (S)1239 60 MS (m)1253 60 MS (a)1273 60 MS (l)1284 60 MS (l)1291 60 MS = (e)1298 60 MS (s)1309 60 MS (t)1319 60 MS ( )1235 60 MS (:)1230 60 MS (:)1212 60 MS (c)1136 60 MS (u)1147 60 MS (r)1160 60 MS (r)1168 60 MS (e)1176 60 MS = (n)1187 60 MS (t)1200 60 MS (])1418 24 MS ( )1392 24 MS ( )1373 24 MS (s)1308 24 MS (h)1318 24 MS (a)1331 24 MS (r)1342 24 MS (e)1350 24 MS = (d)1361 24 MS ( )1303 24 MS (y)1271 24 MS ( )1283 24 MS (C)1172 24 MS (a)1188 24 MS (r)1199 24 MS (d)1208 24 MS (i)1220 24 MS = (n)1227 24 MS (a)1240 24 MS (l)1251 24 MS (i)1258 24 MS (t)1265 24 MS ( )1166 24 MS ([)1127 24 MS (n)1135 24 MS ( )1148 24 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1223 97 MS (=3D)1218 60 MS gs n 21 29 1397 1 CB (\306)1397 24 MS gr gs n 14 29 1379 1 CB (\271)1379 24 MS gr gs n 15 29 1289 1 CB (\331)1289 24 MS gr gs n 14 29 1153 1 CB (=3D)1153 24 MS gr n 1064 223 M 1384 223 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (0)1229 361 MS (:)1203 361 MS (n)1185 361 MS ( )1179 361 MS (;)1173 361 MS (:)1135 361 MS (s)1065 361 MS (h)1075 361 MS (a)1087 361 MS (r)1098 361 MS (e)1107 361 = MS (d)1118 361 MS (:)1273 324 MS ( )1186 324 MS (w)1193 324 MS (a)1211 324 MS (i)1222 324 MS (t)1229 324 = MS (i)1236 324 MS (n)1243 324 MS (g)1255 324 MS (;)1181 324 MS ( )1156 324 MS (:)1137 324 MS (l)1066 324 MS (o)1073 324 MS (c)1085 324 MS (k)1096 324 MS (e)1109 324 = MS (d)1120 324 MS (S)1295 286 MS (T)1309 286 MS (A)1324 286 MS (R)1342 286 MS (T)1359 286 = MS (\))1374 286 MS ( )1290 286 MS (\()1270 286 MS (i)1278 286 MS (,)1285 286 MS ( )1265 286 MS (S)1215 286 MS (e)1229 286 MS (n)1240 286 MS (d)1253 286 MS ( )1210 286 MS ( )1182 286 MS (l)1116 286 MS (o)1123 286 MS (c)1135 286 MS (k)1146 286 MS (e)1159 286 = MS (d)1170 286 MS ( )1110 286 MS ( )1093 286 MS (i)1087 286 MS ( )1082 286 MS ({)1252 249 MS (c)1264 249 MS (u)1275 249 MS (r)1287 249 MS (r)1296 249 = MS (e)1304 249 MS (n)1315 249 MS (t)1327 249 MS (})1334 249 MS ( )1248 249 MS ( )1225 249 MS (l)1159 249 MS (o)1166 249 MS (c)1179 249 MS (k)1190 249 MS (e)1202 249 = MS (d)1213 249 MS ( )1154 249 MS (:)1135 249 MS ( )1131 249 MS (l)1066 249 MS (o)1073 249 MS (c)1085 249 MS (k)1096 249 MS (e)1109 249 = MS (d)1120 249 MS (O)1275 213 MS (K)1293 213 MS ( )1269 213 MS (])1263 213 MS ( )1237 213 MS ( )1218 213 MS (a)1162 213 MS (i)1173 213 MS (t)1180 213 MS (i)1187 213 MS (n)1194 213 = MS (g)1206 213 MS ([)1135 213 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1209 361 MS (\306)1153 361 MS (=3D)1141 361 MS (\306)1299 324 MS (=3D)1279 324 MS (\306)1161 324 MS (=3D)1143 324 MS (\256)1187 286 MS (\316)1096 286 MS (")1065 286 MS (\310)1230 249 MS (=3D)1141 249 MS gs n 21 30 1242 189 CB (\306)1242 213 MS gr gs n 14 30 1224 189 CB (=3D)1224 213 MS gr NTPSOct95 /FontSV save put %%BeginFont: Times_New_Roman_Cursiva025 10 dict dup begin /FontType 3 def /FontMatrix [1 25 div 0 0 1 25 div 0 0] def /FontBBox [-5 -23 25 16] def /Encoding 256 array def 0 1 255 {Encoding exch /.notdef put} for /BuildGlyph {0 begin exch /CD get exch get /CI exch def CI 0 get 0 CI 1 4 getinterval aload pop setcachedevice CI 5 get CI 6 get true [1 0 0 -1 0 0] dup 4 CI 7 get put dup 5 CI 8 get put CI 9 get imagemask end}def /BuildGlyph load 0 5 dict put /BuildChar {1 index /Encoding get exch get 1 index /BuildGlyph get exec} bind def /CD 256 dict def CD /.notdef[.24 0 0 0 0 1 1 0 0 {<>}]put Encoding 90 /c90 put CD /c90 [16 0 11 16 0 16 11 0 11 <~0I-'s0OZs#).FLp)Ish$(iU=3D"&3p~>]put end /Times_New_Roman_Cursiva025 exch definefont pop %%EndFont [25 0 0 -25 0 0]/Times_New_Roman_Cursiva025 MF (Z)1145 213 MS n 1007 436 M 1427 436 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (|)1121 650 MS (|)1089 650 MS (n)1052 650 MS ( )1065 650 MS (:)1026 650 MS (n)1008 650 MS ( )1168 612 MS (\\)1175 612 MS ( )1181 612 MS (l)1103 612 MS (o)1110 612 MS (c)1122 612 MS (k)1133 612 MS (e)1146 612 = MS (d)1157 612 MS ( )1097 612 MS (:)1079 612 MS (l)1008 612 MS (o)1015 612 MS (c)1027 612 MS (k)1038 612 MS (e)1051 612 = MS (d)1062 612 MS (\\)1173 575 MS (s)1102 575 MS (h)1112 575 MS (a)1125 575 MS (r)1136 575 MS (e)1144 575 = MS (d)1155 575 MS (:)1077 575 MS (s)1007 575 MS (h)1017 575 MS (a)1030 575 MS (r)1041 575 MS (e)1049 575 = MS (d)1060 575 MS (A)1150 537 MS (C)1168 537 MS (K)1185 537 MS (R)1203 537 MS (E)1220 537 = MS (F)1235 537 MS (\))1249 537 MS ( )1144 537 MS (\()1062 537 MS (S)1070 537 MS (e)1084 537 MS (n)1095 537 MS (d)1108 537 = MS (e)1120 537 MS (r)1131 537 MS (,)1139 537 MS ( )1056 537 MS (S)1007 537 MS (e)1021 537 MS (n)1032 537 MS (d)1045 537 MS (U)1294 500 MS (N)1312 500 MS (L)1331 500 MS (O)1345 500 MS (C)1363 500 = MS (K)1380 500 MS (\))1398 500 MS (\()1268 500 MS (i)1277 500 MS (,)1284 500 MS ( )1263 500 MS (S)1213 500 MS (e)1227 500 MS (n)1238 500 MS (d)1251 500 MS (})1167 500 MS (S)1099 500 MS (e)1113 500 MS (n)1124 500 MS (d)1136 500 MS (e)1149 500 = MS (r)1160 500 MS ({)1088 500 MS (\\)1079 500 MS (i)1025 500 MS (S)1346 462 MS (e)1360 462 MS (n)1371 462 MS (d)1384 462 MS (e)1396 462 = MS (r)1407 462 MS (})1415 462 MS ( )1342 462 MS ({)1254 462 MS (c)1266 462 MS (u)1277 462 MS (r)1290 462 MS (r)1298 462 = MS (e)1306 462 MS (n)1317 462 MS (t)1330 462 MS (,)1337 462 MS (s)1156 462 MS (h)1166 462 MS (a)1178 462 MS (r)1189 462 MS (e)1197 462 = MS (d)1208 462 MS (\))1221 462 MS (\()1054 462 MS (l)1063 462 MS (o)1070 462 MS (c)1082 462 MS (k)1093 462 = MS (e)1106 462 MS (d)1117 462 MS (:)1029 462 MS (R)1170 427 MS (E)1187 427 MS (F)1202 427 MS (U)1216 427 MS (S)1234 427 = MS (E)1248 427 MS [24.984 0 7.723 -24.984 0 0]/Symbol MF (a)1097 650 MS (a)1185 612 MS (a)1182 575 MS (a)1055 500 MS (a)1006 462 MS [24.984 0 0 -24.984 0 0]/Symbol MF (-)1070 650 MS (=3D)1032 650 MS (=3D)1084 612 MS (=3D)1083 575 MS (\256)1184 500 MS (\316)1036 500 MS (")1007 500 MS (\310)1233 462 MS (\307)1133 462 MS (=3D)1034 462 MS n 1376 654 M 1669 654 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (L)1516 792 MS (O)1530 792 MS (C)1548 792 MS (K)1565 792 MS (\))1583 792 = MS (n)1486 792 MS (t)1498 792 MS (,)1505 792 MS (S)1377 792 MS (e)1391 792 MS (n)1402 792 MS (d)1414 792 MS (\()1427 792 = MS (c)1435 792 MS (u)1446 792 MS (r)1458 792 MS (r)1467 792 MS (e)1475 = 792 MS ({)1575 755 MS (c)1587 755 MS (u)1598 755 MS (r)1610 755 MS (r)1619 755 = MS (e)1627 755 MS (n)1638 755 MS (t)1650 755 MS (})1657 755 MS (\\)1565 755 MS (w)1485 755 MS (a)1503 755 MS (i)1514 755 MS (t)1521 755 MS (i)1528 755 = MS (n)1535 755 MS (g)1547 755 MS (:)1458 755 MS (w)1378 755 MS (a)1396 755 MS (i)1407 755 MS (t)1414 755 MS (i)1421 755 = MS (n)1428 755 MS (g)1441 755 MS (\()1569 717 MS (w)1577 717 MS (a)1595 717 MS (i)1606 717 MS (t)1613 717 = MS (i)1620 717 MS (n)1627 717 MS (g)1639 717 MS (\))1652 717 MS (S)1478 717 MS (m)1492 717 MS (a)1512 717 MS (l)1523 717 MS (l)1530 717 = MS (e)1537 717 MS (s)1548 717 MS (t)1557 717 MS ( )1564 717 MS (:)1453 717 MS (c)1378 717 MS (u)1389 717 MS (r)1401 717 MS (r)1409 717 MS (e)1418 717 = MS (n)1428 717 MS (t)1441 717 MS ({)1564 680 MS (c)1576 680 MS (u)1587 680 MS (r)1599 680 MS (r)1607 680 = MS (e)1616 680 MS (n)1627 680 MS (t)1639 680 MS (})1646 680 MS ( )1560 680 MS ( )1537 680 MS (l)1471 680 MS (o)1478 680 MS (c)1490 680 MS (k)1502 680 MS (e)1514 680 = MS (d)1525 680 MS ( )1466 680 MS (:)1447 680 MS ( )1443 680 MS (l)1378 680 MS (o)1385 680 MS (c)1397 680 MS (k)1408 680 MS (e)1421 680 = MS (d)1431 680 MS (O)1573 644 MS (K)1591 644 MS ( )1568 644 MS (])1562 644 MS ( )1535 644 MS ( )1516 644 MS (a)1460 644 MS (i)1471 644 MS (t)1478 644 MS (i)1485 644 MS (n)1492 644 = MS (g)1504 644 MS ([)1433 644 MS [24.984 0 0 -24.984 0 0]/Symbol MF (=3D)1464 755 MS (=3D)1459 717 MS (\310)1542 680 MS (=3D)1453 680 MS gs n 21 30 1540 620 CB (\306)1540 644 MS gr gs n 14 30 1522 620 CB (\271)1522 644 MS gr [25 0 0 -25 0 0]/Times_New_Roman_Cursiva025 MF (Z)1443 644 MS 6 sl n 566 341 M 564 333 L 561 325 L 558 317 L 555 309 L 553 303 L 550 296 L 547 290 L 544 284 L 542 279 L 539 274 L 537 270 L 534 266 L 531 262 L 529 259 L 527 256 L 524 254 L 522 252 L 519 251 L 517 250 L 514 249 L 512 249 L 510 249 L 508 249 L 505 250 L 503 252 L 501 254 L 499 256 L 497 259 L 494 262 L 492 265 L 490 269 L 488 273 L 486 278 L 484 283 L 482 289 L 480 295 L 479 301 L 477 308 L 475 315 L 473 323 L CM 0.246 0.246 scale s SM n 467 320 M 469 341 L 480 323 L 467 320 L cp e 1 sl n 492 236 M 531 236 L s [24.984 0 0 -24.984 0 0]/Times-Roman MF (O)494 226 MS (K)512 226 MS n 512 172 M 512 166 L 514 160 L 516 155 L 519 150 L 523 146 L 528 142 L 533 139 L 539 138 L 544 137 L 550 137 L 556 138 L 562 139 L 567 142 L 571 146 L 575 150 L 579 155 L 581 160 L 582 166 L 583 172 L 582 178 L 581 183 L 579 189 L 575 194 L 571 198 L 567 202 L 562 204 L 556 206 L 550 207 L 544 207 L 539 206 L 533 204 L 528 202 L 523 198 L 519 194 L 516 189 L 514 183 L 512 178 L 512 172 L cp gs 0.902 g e gr s [33.395 0 0 -33.23 0 0]/Helvetica MF (9)538 182 MS showpage FontSV restore PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Helvetica %%+ Symbol %%+ Times-Roman %%DocumentSuppliedFonts: %%+ Times_New_Roman_Cursiva025 end %%Pages: 1 %%EOF %%EndDocument @endspecial 1125 3251 a Fs(Figure)19 b(4.)g(State)f(transition)h (diagram)g(for)g(coordinators.)1113 3823 y(T)-6 b(able)19 b(III.)f(V)-8 b(ariables)18 b(used)i(by)f Fk(\013)p Fs(\226core)h(in)f (coordinators.)p 350 3959 3069 5 v 400 4042 a Fu(V)-7 b(ariable)100 b(Description)p 350 4094 3069 3 v 405 4177 a Fk(cur)r(r)r(ent)105 b Fs(It)18 b(is)g(the)g(participant)h(a)f (coordinator)h(is)f(currently)h(trying)g(to)f(lock,)h(i.e.,)e(a)h Fk(LO)r(C)5 b(K)24 b Fs(message)c(has)771 4260 y(been)g(sent)f(to)f (it,)g(b)o(ut)h(no)g(reply)h(has)f(arri)n(v)o(ed,)g(yet.)512 4343 y Fk(n)213 b Fs(It)20 b(is)g(an)h(of)n(fer)g(counter)m(,)g(and)g (is)g(used)g(to)g(detect)f(when)i(the)e(interaction)h(a)g(coordinator)h (manages)771 4426 y(is)c(enabled.)419 4509 y Fk(shar)r(ed)118 b Fs(It)18 b(is)h(the)g(set)f(of)h(participants)h(shared)f(with)g (other)g(coordinators.)404 4592 y Fk(w)r(aiting)106 b Fs(It)18 b(is)h(the)g(set)f(of)h(participants)h(not)f(lock)o(ed,)h (yet.)p 350 4646 3069 5 v 191 5006 3388 5 v 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)c FB(2001)i(John)f(W) m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 10 10 10 9 bop 191 299 a Fq(10)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(that)25 b Fm(Q)33 b(<)f(P)12 b Fq(.)26 b(If)f(it)h(cannot)f (lock)g(it,)h(i.e.,)f(it)h(recei)n(v)o(es)f(a)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)30 b Fq(message)25 b(from)g(it,)h(it)g(must)f (unlock)f(e)n(v)o(ery)191 706 y(preceding)14 b(participant.)h(This)i (algorithm)e(w)o(as)i(pro)o(v)o(en)d(not)i(to)g(produce)f(an)o(y)g (deadlocks,)g(and)h(it)h(is)g(quite)f(ef)n(fecti)n(v)o(e.)191 805 y(In)h(both)g(cases,)h(the)f(answer)g(may)g(be)h(delayed)e(for)h (some)g(time)g(if)h(the)g(participant)e(is)i(currently)e(lock)o(ed)g (by)h(another)191 905 y(coordinator)-5 b(.)274 1007 y(Therefore,)21 b(in)i(transition)f(5,)h(the)g(smallest)h(participant)e(in)h(the)g Fm(w)r(aiting)j Fq(set)e(is)g(remo)o(v)o(ed)d(from)h(it)h(and)g(sent)g (a)191 1106 y Fm(LO)r(C)6 b(K)27 b Fq(message.)21 b(This)g(participant) f(may)g(reply)h(with)g(an)g Fm(O)r(K)27 b Fq(message,)21 b(indicating)f(that)h(it)g(has)h(been)e(lock)o(ed,)191 1206 y(or)g(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)25 b Fq(message,)20 b(indicating)f(that)h(it)h(is)g(no)f(longer)f(interested)h(in)g(the)g (interaction)f(it)i(manages.)274 1308 y(Processing)d(an)h Fm(O)r(K)25 b Fq(message)19 b(depends)f(on)g(the)h(number)e(of)i (participants)e(w)o(aiting)i(to)g(be)g(lock)o(ed.)e(If)i(there)g(is)g (a)191 1407 y(participant)i(in)h(the)g Fm(w)r(aiting)j Fq(set)e(\(transition)d(6\),)i(the)g(participant)f(that)h(has)g(sent)h (the)f Fm(O)r(K)28 b Fq(message)22 b(is)h(stored)f(in)191 1507 y(the)f Fm(l)r(ock)s(ed)f Fq(set,)i(and)e(the)h(ne)o(xt)f(w)o (aiting)h(participant)e(in)i(the)g Fm(w)r(aiting)j Fq(set)d(is)h (selected)f(to)g(be)g(lock)o(ed.)e(Otherwise,)191 1606 y(e)n(v)o(ery)c(shared)h(participant)f(has)i(been)f(lock)o(ed.)f(Thus,) h(the)h(interaction)e(can)h(be)h(e)o(x)o(ecuted)d(and)i(a)h Fm(S)5 b(T)12 b(AR)q(T)27 b Fq(message)191 1706 y(is)21 b(sent)g(to)f(e)n(v)o(ery)f(participant)g(\(transition)g(7\).)274 1808 y(Processing)g(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)24 b Fq(message)19 b(is)i(quite)e(dif)n(ferent)e(\(transition)h(8\),)h (because)g(this)h(means)f(that)g(one)g(of)g(the)191 1907 y(shared)25 b(participants)g(that)h(ha)n(v)o(e)f(not)g(been)h(lock)o (ed)f(yet)g(cancels)h(its)h(of)n(fer)e(or)g(the)h(shared)f(participant) g(currently)191 2007 y(being)19 b(lock)o(ed)g(refuses)h(to)h(be)f(lock) o(ed)f(because)g(it)i(has)g(committed)e(to)h(another)f(interaction.)f (Thus,)i(all)g(the)h(shared)191 2107 y(participants)d(that)h(are)g (already)f(lock)o(ed)g(ha)n(v)o(e)h(to)g(be)g(unlock)o(ed)e(in)i(order) f(to)h(pre)n(v)o(ent)e(deadlocks.)h(The)h(coordinator)191 2206 y(then)c(sends)h(an)f Fm(U)9 b(N)g(LO)r(C)d(K)22 b Fq(message)15 b(to)h(e)n(v)o(ery)f(lock)o(ed)f(participant,)g(to)i (the)g(participant)e(currently)g(being)h(lock)o(ed)191 2306 y(\(unless)20 b(it)h(is)g(the)f(sender\),)f(and)g(an)h Fm(AC)6 b(K)g(R)q(E)f(F)33 b Fq(to)20 b(the)g(participant)f(that)h (sent)g(the)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)25 b Fq(message)20 b(before)191 2406 y(reaching)f(again)g(the)h Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)20 b Fq(state.)274 2507 y(In)f(the)h(preceding)d(discussion,)i(we)h(ha)n(v)o(e)f(intentionally) f(left)i(out)f(transition)g(9)h(and)f(some)g(details)h(of)g(transition) 191 2607 y(3)g(that)h(are)f(further)e(e)o(xplained)h(in)h(the)g(follo)n (wing)f(section.)191 2812 y Fr(Remarks)191 3010 y Fq(T)m(ransitions)30 b(8)h(and)g(9)g(in)g(participants,)f(as)i(well)f(as)h(transitions)f(3)g (and)f(9)i(in)f(coordinators)e(stem)i(from)f(some)191 3109 y(intricate)j(features)g(of)h(our)f(algorithm.)f(In)h(this)i (section,)e(we)h(justify)g(the)f(reason)g(why)g(such)h(transitions)f (are)191 3209 y(necessary)-5 b(.)274 3311 y(Figure)25 b(5)g(sho)n(ws)g(a)h(scenario)e(that)i(pro)o(v)o(es)d(that)j Fm(LO)r(C)6 b(K)32 b Fq(messages)25 b(may)g(be)g(recei)n(v)o(ed)f (whilst)h(a)h(participant)191 3410 y(is)f(in)f(state)g Fm(S)5 b(Y)18 b(N)9 b(C)31 b Fq(\(transition)22 b(8\).)i(Notice)f(that) h(once)f(coordinator)e Fm(I)2322 3422 y Fl(2)2384 3410 y Fq(has)j(recei)n(v)o(ed)f(the)g Fm(O)r(F)12 b(F)g(E)5 b(R)26 b Fq(message)191 3510 y(from)17 b Fm(P)424 3522 y Fl(2)479 3510 y Fq(and)h(the)f(proper)f Fm(P)c(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)22 b Fq(message)c(from)e Fm(P)2178 3522 y Fl(3)2216 3510 y Fq(,)i(it)g(sends)g(a)g Fm(LO)r(C)6 b(K)24 b Fq(message)18 b(to)g(try)f(to)h(lock)191 3609 y(its)j(\002rst)h(participant,)d(b)n(ut)h(this)h(message)f(may)g(tak)o (e)h(an)f(arbitrary)f(long)h(time)g(to)h(reach)f(its)h(recipient.)f (Thus,)f(when)191 3709 y Fm(P)244 3721 y Fl(2)303 3709 y Fq(recei)n(v)o(es)h(the)h Fm(S)5 b(T)12 b(AR)q(T)31 b Fq(message)21 b(from)f(coordinator)e Fm(I)1965 3721 y Fl(1)2003 3709 y Fq(,)j(it)g(enters)g(state)h Fm(S)5 b(Y)18 b(N)9 b(C)28 b Fq(and)20 b(sends)h(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 3809 y Fq(message)28 b(to)h(coordinator)d Fm(I)1043 3821 y Fl(2)1110 3809 y Fq(to)j(cancel)f(its)h(of)n(fer)-5 b(.)28 b(Notice)h(that)f(when)g Fm(P)2423 3821 y Fl(2)2490 3809 y Fq(sends)g(this)i(message,)e(the)g Fm(LO)r(C)6 b(K)191 3908 y Fq(message)29 b(from)f Fm(I)729 3920 y Fl(2)797 3908 y Fq(has)i(not)f(yet)g(arri)n(v)o(ed)f(to)h Fm(P)1614 3920 y Fl(2)1681 3908 y Fq(due)g(to)h(transmission)e(delays,) h(thus)g(pro)o(ving)e(that)j(a)f Fm(LO)r(C)6 b(K)191 4008 y Fq(message)21 b(may)f(be)h(recei)n(v)o(ed)e(whilst)i(a)g (participant)f(is)h(in)g(state)h Fm(S)5 b(Y)18 b(N)9 b(C)d Fq(.)21 b(Notice)g(also)g(that)g(such)f(a)i(message)e(may)191 4108 y(not)29 b(be)g(processed)e(after)i(the)g Fm(AC)6 b(K)g(R)q(E)f(F)41 b Fq(because)29 b(we)g(are)g(assuming)f(that)h (messages)g(sent)h(from)e(the)h(same)191 4207 y(origin)19 b(to)h(the)h(same)f(destination)f(are)h(processed)f(in)i(order)-5 b(.)274 4309 y(Figure)30 b(6)h(sho)n(ws)f(a)h(scenario)f(that)h(pro)o (v)o(es)e(that)h Fm(U)9 b(N)g(LO)r(C)d(K)37 b Fq(messages)31 b(may)f(also)h(be)f(recei)n(v)o(ed)f(whilst)i(a)191 4408 y(participant)17 b(is)j(in)f(state)h Fm(S)5 b(Y)18 b(N)9 b(C)26 b Fq(\(transition)17 b(9\).)i(Notice)f(that)h(once)g (coordinator)d Fm(I)2648 4420 y Fl(2)2705 4408 y Fq(has)j(recei)n(v)o (ed)e(the)i Fm(O)r(F)12 b(F)g(E)5 b(R)191 4508 y Fq(messages)16 b(from)f Fm(P)752 4520 y Fl(1)807 4508 y Fq(and)g Fm(P)996 4520 y Fl(2)1034 4508 y Fq(,)h(it)h(sends)f(a)h Fm(LO)r(C)6 b(K)22 b Fq(message)16 b(to)h(try)f(to)g(lock)g Fm(P)2452 4520 y Fl(1)2489 4508 y Fq(,)h(which)e(is)i(its)h(smallest)e (participant.)191 4608 y(Assume)24 b(that)f(this)h(message)g(tak)o(es)g (an)f(arbitrarily)f(long)h(time)h(to)f(reach)g(its)i(recipient.)d(In)i (this)g(conte)o(xt,)e(both)h Fm(I)3541 4620 y Fl(1)191 4707 y Fq(and)f Fm(I)370 4719 y Fl(3)432 4707 y Fq(might)g(succeed)g (in)i(locking)d(their)i(shared)f(participants,)g(and)h(the)o(y)f(w)o (ould)g(send)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)28 b Fq(messages)191 4807 y(to)18 b Fm(I)310 4819 y Fl(2)366 4807 y Fq(in)g(order)f(to)h (cancel)f(their)h(of)n(fers.)e(When)i Fm(I)1610 4819 y Fl(2)1666 4807 y Fq(recei)n(v)o(es)f(the)h(\002rst)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)22 b Fq(message)c(from)f Fm(P)3154 4819 y Fl(2)3191 4807 y Fq(,)h(it)h(e)o(x)o(ecutes)191 4907 y(transition)24 b(8)h(and)f(sends)h(an)g Fm(U)9 b(N)g(LO)r(C)d(K)31 b Fq(message)25 b(to)g Fm(P)1937 4919 y Fl(1)2000 4907 y Fq(and)f(an)h Fm(AC)6 b(K)g(R)q(E)f(F)37 b Fq(message)25 b(to)g Fm(P)3123 4919 y Fl(2)3161 4907 y Fq(.)g(Notice)g(that)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f (Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 11 11 11 10 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(11)p 191 473 3388 5 v 868 1875 a @beginspecial 56.689999 @llx 56.689999 @lly 291.160004 @urx 189.619995 @ury 2438 @rwi @setspecial %%BeginDocument: lock-scen.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip033.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:38 2/12/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 291.16 189.62 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 189.637 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 j 1 setlinecap 6 sl n 202 79 M 202 542 L CM 0.246 0.25 scale s SM n 424 90 M 424 542 L CM 0.246 0.25 scale s SM n 648 79 M 648 541 L CM 0.246 0.25 scale s SM n 866 90 M 866 542 L CM 0.246 0.25 scale s SM n 1088 83 M 1088 544 L CM 0.246 0.25 scale s SM n 203 143 M 403 170 L CM 0.246 0.25 scale s SM n 402 163 M 422 173 L 401 177 L 402 163 L cp e %%IncludeFont: Times-Roman [24.766 3.348 3.352 -24.766 0 0]/Times-Roman MF (P)235 140 MS (A)248 142 MS (R)266 144 MS (T)282 146 MS (I)297 148 MS = (C)305 149 MS (I)321 151 MS (P)329 153 MS (A)343 154 MS (T)361 157 MS = (E)375 159 MS n 1088 129 M 884 199 L CM 0.246 0.25 scale s SM n 888 205 M 866 205 L 883 192 L 888 205 L cp e [23.645 -8.098 -8.094 -23.645 0 0]/Times-Roman MF (P)900 186 MS (A)913 181 MS (R)930 175 MS (T)945 170 MS (I)960 165 MS = (C)967 163 MS (I)983 157 MS (P)990 155 MS (A)1003 150 MS (T)1020 144 MS = (E)1034 140 MS n 424 199 M 630 232 L CM 0.246 0.25 scale s SM n 629 225 M 648 235 L 627 238 L 629 225 L cp e [24.684 3.906 3.91 -24.684 0 0]/Times-Roman MF (L)504 204 MS (O)518 206 MS (C)536 209 MS (K)552 212 MS n 866 219 M 661 458 L CM 0.246 0.25 scale s SM n 667 461 M 649 472 L 657 452 L 667 461 L cp e [16.328 -18.922 -18.918 -16.328 0 0]/Times-Roman MF (L)730 366 MS (O)740 355 MS (C)751 341 MS (K)762 329 MS n 647 246 M 442 284 L CM 0.246 0.25 scale s SM n 445 291 M 424 288 L 442 277 L 445 291 L cp e [24.566 -4.602 -4.598 -24.566 0 0]/Times-Roman MF (O)516 263 MS (K)534 259 MS n 648 375 M 848 413 L CM 0.246 0.25 scale s SM n 848 406 M 867 416 L 845 419 L 848 406 L cp e [24.559 4.641 4.645 -24.559 0 0]/Times-Roman MF /IsChar{exch/CharStrings get exch known}bd/MapCh{3 -1 roll/Encoding get = 3 1 roll put}bd/MapDegree{dup 16#b0 exch/degree IsChar{/degree}{/ring}ifelse = MapCh} bd/MapBB{dup 16#a6 exch/brokenbar IsChar{/brokenbar}{/bar}ifelse = MapCh}bd /reencode{findfont begin currentdict dup length dict begin{1 index/FID = ne{def} {pop pop}ifelse}forall/FontName exch def dup length 0 ne{/Encoding = Encoding 256 array copy def 0 exch{dup type/nametype eq{Encoding 2 index 2 index put = pop 1 add}{exch pop}ifelse}forall}if pop currentdict dup end end/FontName get = exch definefont dup MapDegree = MapBB}bd/LATENC[0/grave/acute/circumflex/tilde/macron /breve/dotaccent/dieresis/ring/cedilla/hungarumlaut/ogonek/caron/dotlessi= /fi/fl /Lslash/lslash/Zcaron/zcaron/minus/.notdef/.notdef/.notdef/.notdef/.notde= f /.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/space/exclam/quotedbl /numbersign/dollar/percent/ampersand/quotesingle/parenleft/parenright/ast= erisk /plus/comma/hyphen/period/slash/zero/one/two/three/four/five/six/seven/ei= ght /nine/colon/semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/= K/L/M /N/O/P/Q/R/S/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/asciicircum= /underscore/grave/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y/z/bra= celeft /bar/braceright/asciitilde/.notdef/.notdef/.notdef/quotesinglbase/florin /quotedblbase/ellipsis/dagger/daggerdbl/circumflex/perthousand/Scaron /guilsinglleft/OE/.notdef/.notdef/.notdef/.notdef/quoteleft/quoteright /quotedblleft/quotedblright/bullet/endash/emdash/tilde/trademark/scaron /guilsinglright/oe/.notdef/.notdef/Ydieresis/.notdef/exclamdown/cent/ster= ling /currency/yen/brokenbar/section/dieresis/copyright/ordfeminine/guillemotl= eft /logicalnot/hyphen/registered/macron/degree/plusminus/twosuperior/threesu= perior /acute/mu/paragraph/periodcentered/cedilla/onesuperior/ordmasculine /guillemotright/onequarter/onehalf/threequarters/questiondown/Agrave/Aacu= te /Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla/Egrave/Eacute/Ecircumflex= /Edieresis/Igrave/Iacute/Icircumflex/Idieresis/Eth/Ntilde/Ograve/Oacute /Ocircumflex/Otilde/Odieresis/multiply/Oslash/Ugrave/Uacute/Ucircumflex /Udieresis/Yacute/Thorn/germandbls/agrave/aacute/acircumflex/atilde/adier= esis /aring/ae/ccedilla/egrave/eacute/ecircumflex/edieresis/igrave/iacute /icircumflex/idieresis/eth/ntilde/ograve/oacute/ocircumflex/otilde/odiere= sis /divide/oslash/ugrave/uacute/ucircumflex/udieresis/yacute/thorn/ydieresis= ]def LATENC /_Times-Roman /Times-Roman reencode [24.559 4.641 4.645 -24.559 0 0]/_Times-Roman MF (\240)676 372 MS (\240)682 373 MS (\240)689 375 MS (\240)695 376 MS = (\240)701 377 MS (\240)707 378 MS (\240)713 379 MS (\240)719 380 MS = (\240)725 382 MS (\240)732 383 MS (\240)738 384 MS (\240)744 385 MS = (R)750 386 MS (E)766 389 MS (F)781 392 MS (U)795 395 MS (S)813 398 MS (E)826 401 MS n 864 439 M 664 476 L CM 0.246 0.25 scale s SM n 667 483 M 646 480 L 665 469 L 667 483 L cp e [24.559 -4.645 -4.641 -24.559 0 0]/Times-Roman MF (A)705 461 MS (C)723 457 MS (K)739 454 MS (R)757 451 MS (E)774 448 MS = (F)788 445 MS n 648 128 M 442 183 L CM 0.246 0.25 scale s SM n 445 189 M 424 187 L 441 176 L 445 189 L cp e [24.176 -6.344 -6.34 -24.176 0 0]/Times-Roman MF (O)496 160 MS (F)514 156 MS (F)527 152 MS (E)540 149 MS (R)555 145 MS n 648 137 M 848 183 L CM 0.246 0.25 scale s SM n 848 176 M 866 187 L 845 189 L 848 176 L cp e [24.359 5.578 5.582 -24.359 0 0]/Times-Roman MF (O)721 146 MS (F)739 150 MS (F)752 153 MS (E)765 156 MS (R)780 160 MS n 424 305 M 223 360 L CM 0.246 0.25 scale s SM n 226 366 M 205 364 L 223 353 L 226 366 L cp e [24.129 -6.512 -6.508 -24.129 0 0]/Times-Roman MF (S)274 338 MS (T)288 334 MS (A)302 330 MS (R)320 326 MS (T)336 321 MS n 423 314 M 630 360 L CM 0.246 0.25 scale s SM n 630 353 M 648 364 L 627 367 L 630 353 L cp e [24.387 5.449 5.453 -24.387 0 0]/Times-Roman MF (S)498 323 MS (T)512 326 MS (A)527 329 MS (R)544 333 MS (T)561 337 MS 1 sl n 680 79 M 683 78 L 686 77 L 689 75 L 690 73 L 692 70 L 692 67 L 692 31 L 692 28 L 690 25 L 689 23 L 686 21 L 683 20 L 680 20 L 615 20 L 612 20 L 609 21 L 607 23 L 605 25 L 604 28 L 603 31 L 603 67 L 604 70 L 605 73 L 607 75 L 609 77 L 612 78 L 615 79 L 680 79 L cp gs 1 g e gr s [29.293 0 0 -29.25 0 0]/Times-Roman MF (P)635 58 MS [19.32 0 0 -19.5 0 0]/Times-Roman MF (2)651 68 MS n 235 79 M 238 78 L 241 77 L 243 75 L 245 73 L 246 70 L 246 67 L 246 31 L 246 28 L 245 25 L 243 23 L 241 21 L 238 20 L 235 20 L 170 20 L 167 20 L 164 21 L 162 23 L 160 25 L 159 28 L 158 31 L 158 67 L 159 70 L 160 73 L 162 75 L 164 77 L 167 78 L 170 79 L 235 79 L cp gs 1 g e gr s [29.293 0 0 -29.25 0 0]/Times-Roman MF (P)189 58 MS [19.32 0 0 -19.5 0 0]/Times-Roman MF (1)206 68 MS gs n 89 68 1044 16 CB n 1121 83 M 1124 82 L 1127 81 L 1129 79 L 1131 77 L 1132 74 L 1133 71 L 1133 28 L 1132 25 L 1131 22 L 1129 20 L 1127 18 L 1124 17 L 1121 16 L 1056 16 L 1053 17 L 1050 18 L 1048 20 L 1046 22 L 1044 25 L 1044 28 L 1044 71 L 1044 74 L 1046 77 L 1048 79 L 1050 81 L 1053 82 L 1056 83 L 1121 83 L cp gs 1 g e gr s gr [29.293 0 0 -29.25 0 0]/Times-Roman MF (P)1075 58 MS [19.32 0 0 -19.5 0 0]/Times-Roman MF (3)1092 68 MS 6 sl n 619 426 M 619 423 L CM 0.246 0.25 scale s SM n 619 420 M 619 417 L CM 0.246 0.25 scale s SM n 619 414 M 619 411 L CM 0.246 0.25 scale s SM n 619 408 M 619 405 L CM 0.246 0.25 scale s SM n 620 402 M 620 400 L CM 0.246 0.25 scale s SM n 620 400 M 620 399 L CM 0.246 0.25 scale s SM n 621 396 M 621 393 L CM 0.246 0.25 scale s SM n 622 390 M 622 387 L CM 0.246 0.25 scale s SM n 623 384 M 623 383 L CM 0.246 0.25 scale s SM n 623 383 M 623 381 L CM 0.246 0.25 scale s SM n 624 378 M 625 376 L CM 0.246 0.25 scale s SM n 625 376 M 625 375 L CM 0.246 0.25 scale s SM n 626 373 M 627 370 L CM 0.246 0.25 scale s SM n 628 367 M 629 364 L CM 0.246 0.25 scale s SM n 630 362 M 631 359 L CM 0.246 0.25 scale s SM n 632 356 M 634 354 L CM 0.246 0.25 scale s SM n 635 351 M 637 349 L CM 0.246 0.25 scale s SM n 639 347 M 641 344 L CM 0.246 0.25 scale s SM n 639 347 M 641 344 L CM 0.246 0.25 scale s SM n 643 343 M 644 342 L CM 0.246 0.25 scale s SM n 644 342 M 646 341 L CM 0.246 0.25 scale s SM n 649 340 M 651 340 L CM 0.246 0.25 scale s SM n 651 340 M 652 340 L CM 0.246 0.25 scale s SM n 655 341 M 658 342 L CM 0.246 0.25 scale s SM n 655 341 M 658 342 L CM 0.246 0.25 scale s SM n 660 344 M 661 344 L CM 0.246 0.25 scale s SM n 661 344 M 662 346 L CM 0.246 0.25 scale s SM n 664 348 M 666 350 L CM 0.246 0.25 scale s SM n 668 353 M 669 355 L CM 0.246 0.25 scale s SM n 671 358 M 672 361 L CM 0.246 0.25 scale s SM n 673 364 M 674 366 L CM 0.246 0.25 scale s SM n 675 369 M 676 372 L CM 0.246 0.25 scale s SM n 677 375 M 677 376 L CM 0.246 0.25 scale s SM n 677 376 M 678 378 L CM 0.246 0.25 scale s SM n 679 381 M 679 383 L CM 0.246 0.25 scale s SM n 679 383 M 679 384 L CM 0.246 0.25 scale s SM n 680 387 M 680 390 L CM 0.246 0.25 scale s SM n 681 393 M 681 396 L CM 0.246 0.25 scale s SM n 682 399 M 682 400 L CM 0.246 0.25 scale s SM n 682 400 M 682 402 L CM 0.246 0.25 scale s SM n 682 405 M 683 408 L CM 0.246 0.25 scale s SM n 683 411 M 683 414 L CM 0.246 0.25 scale s SM n 683 417 M 683 417 L CM 0.246 0.25 scale s SM n 683 417 M 683 420 L CM 0.246 0.25 scale s SM n 683 423 M 683 426 L CM 0.246 0.25 scale s SM n 683 429 M 683 432 L CM 0.246 0.25 scale s SM n 683 435 M 683 435 L CM 0.246 0.25 scale s SM n 683 435 M 683 438 L CM 0.246 0.25 scale s SM n 683 441 M 683 444 L CM 0.246 0.25 scale s SM n 683 447 M 682 450 L CM 0.246 0.25 scale s SM n 682 453 M 682 453 L CM 0.246 0.25 scale s SM n 682 453 M 681 456 L CM 0.246 0.25 scale s SM n 681 459 M 681 461 L CM 0.246 0.25 scale s SM n 681 461 M 681 462 L CM 0.246 0.25 scale s SM n 680 465 M 679 468 L CM 0.246 0.25 scale s SM n 679 471 M 678 474 L CM 0.246 0.25 scale s SM n 677 477 M 677 477 L CM 0.246 0.25 scale s SM n 677 477 M 677 480 L CM 0.246 0.25 scale s SM n 676 482 M 675 484 L CM 0.246 0.25 scale s SM n 675 484 M 675 485 L CM 0.246 0.25 scale s SM n 674 488 M 673 490 L CM 0.246 0.25 scale s SM n 673 490 M 673 491 L CM 0.246 0.25 scale s SM n 671 493 M 670 496 L CM 0.246 0.25 scale s SM n 671 493 M 670 496 L CM 0.246 0.25 scale s SM n 669 499 M 667 501 L CM 0.246 0.25 scale s SM n 665 504 M 664 505 L CM 0.246 0.25 scale s SM n 664 505 M 663 506 L CM 0.246 0.25 scale s SM n 661 508 M 661 508 L CM 0.246 0.25 scale s SM n 661 508 M 659 510 L CM 0.246 0.25 scale s SM n 656 511 M 654 512 L CM 0.246 0.25 scale s SM n 654 512 M 654 512 L CM 0.246 0.25 scale s SM n 651 513 M 648 512 L CM 0.246 0.25 scale s SM n 651 513 M 648 512 L CM 0.246 0.25 scale s SM n 645 511 M 644 511 L CM 0.246 0.25 scale s SM n 644 511 M 642 510 L CM 0.246 0.25 scale s SM n 640 508 M 638 505 L CM 0.246 0.25 scale s SM n 636 503 M 635 501 L CM 0.246 0.25 scale s SM n 635 501 M 634 501 L CM 0.246 0.25 scale s SM n 633 498 M 632 496 L CM 0.246 0.25 scale s SM n 632 496 M 632 495 L CM 0.246 0.25 scale s SM n 630 493 M 629 490 L CM 0.246 0.25 scale s SM n 629 490 M 629 490 L CM 0.246 0.25 scale s SM n 628 487 M 627 484 L CM 0.246 0.25 scale s SM n 626 482 M 625 479 L CM 0.246 0.25 scale s SM n 624 476 M 624 473 L CM 0.246 0.25 scale s SM n 623 470 M 623 470 L CM 0.246 0.25 scale s SM n 623 470 M 622 467 L CM 0.246 0.25 scale s SM n 622 464 M 621 461 L CM 0.246 0.25 scale s SM n 621 461 M 621 461 L CM 0.246 0.25 scale s SM n 621 458 M 620 455 L CM 0.246 0.25 scale s SM n 620 452 M 620 449 L CM 0.246 0.25 scale s SM n 619 446 M 619 444 L CM 0.246 0.25 scale s SM n 619 444 M 619 443 L CM 0.246 0.25 scale s SM n 619 440 M 619 437 L CM 0.246 0.25 scale s SM n 619 434 M 619 431 L CM 0.246 0.25 scale s SM n 619 428 M 619 426 L CM 0.246 0.25 scale s SM n 533 508 M 535 506 L CM 0.246 0.25 scale s SM n 537 504 M 540 502 L CM 0.246 0.25 scale s SM n 542 500 M 544 498 L CM 0.246 0.25 scale s SM n 546 496 M 548 494 L CM 0.246 0.25 scale s SM n 550 491 M 553 489 L CM 0.246 0.25 scale s SM n 555 487 M 557 485 L CM 0.246 0.25 scale s SM n 559 483 M 561 481 L CM 0.246 0.25 scale s SM n 563 479 M 566 477 L CM 0.246 0.25 scale s SM n 568 475 M 570 473 L CM 0.246 0.25 scale s SM n 572 471 M 574 469 L CM 0.246 0.25 scale s SM n 576 467 M 579 465 L CM 0.246 0.25 scale s SM n 581 462 M 583 460 L CM 0.246 0.25 scale s SM n 585 458 M 587 456 L CM 0.246 0.25 scale s SM n 589 454 M 592 452 L CM 0.246 0.25 scale s SM n 594 450 M 596 448 L CM 0.246 0.25 scale s SM n 598 446 M 600 444 L CM 0.246 0.25 scale s SM n 602 442 M 604 440 L CM 0.246 0.25 scale s SM n 607 438 M 609 436 L CM 0.246 0.25 scale s SM n 611 433 M 613 431 L CM 0.246 0.25 scale s SM n 615 429 M 617 427 L CM 0.246 0.25 scale s SM [24.93 0 0 -25 0 0]/Times-Roman MF (S)500 534 MS (Y)514 534 MS (N)532 534 MS (C)550 534 MS 1 sl n 381 45 M 381 38 L 383 32 L 385 26 L 388 20 L 392 15 L 397 11 L 402 7 L 408 4 L 415 2 L 421 1 L 428 1 L 434 2 L 440 4 L 446 7 L 452 11 L 456 15 L 460 20 L 464 26 L 466 32 L 468 38 L 468 45 L 468 51 L 466 58 L 464 64 L 460 69 L 456 75 L 452 79 L 446 83 L 440 86 L 434 87 L 428 88 L 421 88 L 415 87 L 408 86 L 402 83 L 397 79 L 392 75 L 388 69 L 385 64 L 383 58 L 381 51 L 381 45 L cp gs 1 g e gr s [29.293 0 0 -29.25 0 0]/Times-Roman MF (I)415 54 MS [19.32 0 0 -19.5 0 0]/Times-Roman MF (1)424 63 MS n 453 58 M 483 58 L 483 32 L 453 32 L 453 58 L cp gs 1 g e gr s n 366 58 M 396 58 L 396 32 L 366 32 L 366 58 L cp gs 1 g e gr s n 823 46 M 824 39 L 825 33 L 828 27 L 831 21 L 835 16 L 840 12 L 845 8 L 851 5 L 857 3 L 864 2 L 870 2 L 877 3 L 883 5 L 889 8 L 894 12 L 899 16 L 903 21 L 906 27 L 909 33 L 910 39 L 911 46 L 910 53 L 909 59 L 906 65 L 903 71 L 899 76 L 894 80 L 889 84 L 883 87 L 877 89 L 870 90 L 864 90 L 857 89 L 851 87 L 845 84 L 840 80 L 835 76 L 831 71 L 828 65 L 825 59 L 824 53 L 823 46 L cp gs 1 g e gr s [29.293 0 0 -29.25 0 0]/Times-Roman MF (I)857 55 MS [19.32 0 0 -19.5 0 0]/Times-Roman MF (2)867 64 MS n 895 59 M 925 59 L 925 33 L 895 33 L 895 59 L cp gs 1 g e gr s n 809 59 M 838 59 L 838 33 L 809 33 L 809 59 L cp gs 1 g e gr s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 2054 a Fs(Figure)19 b(5.)f(An)h(scenario)h(that)f(pro) o(v)o(es)g(that)g(a)g Fk(LO)r(C)5 b(K)25 b Fs(message)20 b(may)f(be)g(recei)n(v)o(ed)h(whilst)e(a)h(participant)g(is)g(in)g (state)f Fk(S)t(Y)f(N)8 b(C)d Fs(.)868 3496 y @beginspecial 56.689999 @llx 56.689999 @lly 289.200012 @urx 191.300003 @ury 2438 @rwi @setspecial %%BeginDocument: unlock-scen.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip034.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:40 2/12/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 289.20 191.30 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 191.336 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 j 1 setlinecap 6 sl n 203 89 M 203 541 L CM 0.246 0.25 scale s SM n 427 78 M 426 542 L CM 0.246 0.25 scale s SM n 646 89 M 646 541 L CM 0.246 0.25 scale s SM n 868 82 M 868 543 L CM 0.246 0.25 scale s SM n 203 199 M 408 209 L CM 0.246 0.25 scale s SM n 407 202 M 427 210 L 406 216 L 407 202 L cp e %%IncludeFont: Times-Roman [24.965 1.262 1.266 -24.965 0 0]/Times-Roman MF (L)282 195 MS (O)297 196 MS (C)314 197 MS (K)331 198 MS n 645 210 M 437 502 L CM 0.246 0.25 scale s SM n 444 504 M 426 517 L 433 496 L 444 504 L cp e [14.512 -20.348 -20.344 -14.512 0 0]/Times-Roman MF /IsChar{exch/CharStrings get exch known}bd/MapCh{3 -1 roll/Encoding get = 3 1 roll put}bd/MapDegree{dup 16#b0 exch/degree IsChar{/degree}{/ring}ifelse = MapCh} bd/MapBB{dup 16#a6 exch/brokenbar IsChar{/brokenbar}{/bar}ifelse = MapCh}bd /reencode{findfont begin currentdict dup length dict begin{1 index/FID = ne{def} {pop pop}ifelse}forall/FontName exch def dup length 0 ne{/Encoding = Encoding 256 array copy def 0 exch{dup type/nametype eq{Encoding 2 index 2 index put = pop 1 add}{exch pop}ifelse}forall}if pop currentdict dup end end/FontName get = exch definefont dup MapDegree = MapBB}bd/LATENC[0/grave/acute/circumflex/tilde/macron /breve/dotaccent/dieresis/ring/cedilla/hungarumlaut/ogonek/caron/dotlessi= /fi/fl /Lslash/lslash/Zcaron/zcaron/minus/.notdef/.notdef/.notdef/.notdef/.notde= f /.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/space/exclam/quotedbl /numbersign/dollar/percent/ampersand/quotesingle/parenleft/parenright/ast= erisk /plus/comma/hyphen/period/slash/zero/one/two/three/four/five/six/seven/ei= ght /nine/colon/semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/= K/L/M /N/O/P/Q/R/S/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/asciicircum= /underscore/grave/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y/z/bra= celeft /bar/braceright/asciitilde/.notdef/.notdef/.notdef/quotesinglbase/florin /quotedblbase/ellipsis/dagger/daggerdbl/circumflex/perthousand/Scaron /guilsinglleft/OE/.notdef/.notdef/.notdef/.notdef/quoteleft/quoteright /quotedblleft/quotedblright/bullet/endash/emdash/tilde/trademark/scaron /guilsinglright/oe/.notdef/.notdef/Ydieresis/.notdef/exclamdown/cent/ster= ling /currency/yen/brokenbar/section/dieresis/copyright/ordfeminine/guillemotl= eft /logicalnot/hyphen/registered/macron/degree/plusminus/twosuperior/threesu= perior /acute/mu/paragraph/periodcentered/cedilla/onesuperior/ordmasculine /guillemotright/onequarter/onehalf/threequarters/questiondown/Agrave/Aacu= te /Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla/Egrave/Eacute/Ecircumflex= /Edieresis/Igrave/Iacute/Icircumflex/Idieresis/Eth/Ntilde/Ograve/Oacute /Ocircumflex/Otilde/Odieresis/multiply/Oslash/Ugrave/Uacute/Ucircumflex /Udieresis/Yacute/Thorn/germandbls/agrave/aacute/acircumflex/atilde/adier= esis /aring/ae/ccedilla/egrave/eacute/ecircumflex/edieresis/igrave/iacute /icircumflex/idieresis/eth/ntilde/ograve/oacute/ocircumflex/otilde/odiere= sis /divide/oslash/ugrave/uacute/ucircumflex/udieresis/yacute/thorn/ydieresis= ]def LATENC /_Times-Roman /Times-Roman reencode [14.512 -20.348 -20.344 -14.512 0 0]/_Times-Roman MF (L)496 407 MS (O)504 394 MS (C)515 380 MS (K)524 366 MS (\240)535 352 MS = (\240)538 347 MS (\240)542 342 MS (\240)545 337 MS (\240)549 332 MS = (\240)552 328 MS (\240)556 323 MS (\240)559 318 MS n 427 219 M 222 258 L CM 0.246 0.25 scale s SM n 224 264 M 203 261 L 222 251 L 224 264 L cp e [24.566 -4.602 -4.598 -24.566 0 0]/Times-Roman MF (O)296 236 MS (K)313 233 MS n 427 298 M 628 368 L CM 0.246 0.25 scale s SM n 628 361 M 645 374 L 624 374 L 628 361 L cp e [23.602 8.219 8.223 -23.602 0 0]/Times-Roman MF LATENC /_Times-Roman /Times-Roman reencode [23.602 8.219 8.223 -23.602 0 0]/_Times-Roman MF (R)465 304 MS (E)481 309 MS (F)495 314 MS (U)508 319 MS (S)526 325 MS = (E)539 329 MS (\240)553 334 MS (\240)559 336 MS (\240)565 338 MS = (\240)571 340 MS (\240)577 342 MS (\240)583 344 MS (\240)588 346 MS = (\240)594 348 MS (\240)600 351 MS (\240)606 353 MS n 648 471 M 443 530 L CM 0.246 0.25 scale s SM n 446 536 M 425 535 L 443 523 L 446 536 L cp e [24.012 -6.934 -6.93 -24.012 0 0]/Times-Roman MF (A)487 509 MS (C)504 504 MS (K)520 500 MS (R)538 495 MS (E)554 490 MS = (F)568 486 MS n 427 128 M 221 182 L CM 0.246 0.25 scale s SM n 225 188 M 203 187 L 221 175 L 225 188 L cp e [24.176 -6.344 -6.34 -24.176 0 0]/Times-Roman MF (O)276 160 MS (F)293 155 MS (F)307 152 MS (E)320 148 MS (R)334 144 MS n 429 145 M 629 191 L CM 0.246 0.25 scale s SM n 629 184 M 647 195 L 626 197 L 629 184 L cp e [24.359 5.578 5.582 -24.359 0 0]/Times-Roman MF (O)502 154 MS (F)519 158 MS (F)533 161 MS (E)546 164 MS (R)561 167 MS n 202 272 M 408 287 L CM 0.246 0.25 scale s SM n 407 280 M 426 288 L 406 293 L 407 280 L cp e [24.93 1.742 1.746 -24.93 0 0]/Times-Roman MF (S)275 270 MS (T)289 271 MS (A)304 272 MS (R)322 273 MS (T)339 274 MS 1 sl n 460 78 M 463 78 L 465 77 L 468 75 L 470 72 L 471 69 L 471 66 L 471 31 L 471 28 L 470 25 L 468 23 L 465 21 L 463 20 L 460 19 L 395 19 L 392 20 L 389 21 L 386 23 L 384 25 L 383 28 L 383 31 L 383 66 L 383 69 L 384 72 L 386 75 L 389 77 L 392 78 L 395 78 L 460 78 L cp gs 1 g e gr s [29.301 0 0 -29.25 0 0]/Times-Roman MF (P)414 57 MS [19.324 0 0 -19.5 0 0]/Times-Roman MF (1)430 67 MS n 900 82 M 904 82 L 906 81 L 909 79 L 911 76 L 912 74 L 912 71 L 912 28 L 912 25 L 911 22 L 909 19 L 906 18 L 904 16 L 900 16 L 836 16 L 832 16 L 830 18 L 827 19 L 825 22 L 824 25 L 824 28 L 824 71 L 824 74 L 825 76 L 827 79 L 830 81 L 832 82 L 836 82 L 900 82 L cp gs 1 g e gr s [29.301 0 0 -29.25 0 0]/Times-Roman MF (P)855 58 MS [19.324 0 0 -19.5 0 0]/Times-Roman MF (2)871 68 MS 6 sl n 1082 92 M 1082 544 L CM 0.246 0.25 scale s SM n 868 136 M 1065 181 L CM 0.246 0.25 scale s SM n 1065 174 M 1084 185 L 1062 187 L 1065 174 L cp e [24.359 5.578 5.582 -24.359 0 0]/Times-Roman MF (O)940 145 MS (F)957 148 MS (F)970 152 MS (E)983 155 MS (R)998 158 MS n 868 127 M 662 181 L CM 0.246 0.25 scale s SM n 665 187 M 644 186 L 661 174 L 665 187 L cp e [24.176 -6.344 -6.34 -24.176 0 0]/Times-Roman MF (O)716 159 MS (F)734 155 MS (F)747 151 MS (E)760 148 MS (R)775 144 MS n 1080 196 M 886 215 L CM 0.246 0.25 scale s SM n 889 222 M 868 217 L 887 209 L 889 222 L cp e [24.875 -2.484 -2.48 -24.875 0 0]/Times-Roman MF (L)940 203 MS (O)955 201 MS (C)972 199 MS (K)989 198 MS n 1063 255 M 868 227 L CM 0.246 0.25 scale s SM n 1063 248 M 1082 257 L 1061 261 L 1063 248 L cp e [24.738 3.563 3.566 -24.738 0 0]/Times-Roman MF (O)958 232 MS (K)976 235 MS n 885 296 M 1082 268 L CM 0.246 0.25 scale s SM n 888 302 M 867 298 L 886 289 L 888 302 L cp e [24.75 -3.48 -3.477 -24.75 0 0]/Times-Roman MF (S)934 281 MS (T)948 279 MS (A)963 277 MS (R)981 274 MS (T)997 272 MS n 664 337 M 867 308 L CM 0.246 0.25 scale s SM n 667 343 M 646 340 L 665 330 L 667 343 L cp e [24.746 -3.523 -3.52 -24.746 0 0]/Times-Roman MF (R)709 323 MS (E)726 320 MS (F)741 318 MS (U)755 316 MS (S)773 314 MS = (E)786 312 MS n 645 347 M 441 517 L CM 0.246 0.25 scale s SM n 446 521 M 426 528 L 438 510 L 446 521 L cp e [19.23 -15.969 -15.965 -19.23 0 0]/Times-Roman MF (U)491 465 MS (N)505 454 MS (L)518 442 MS (O)530 433 MS (C)544 421 MS = (K)556 411 MS n 851 469 M 646 357 L CM 0.246 0.25 scale s SM n 852 463 M 867 478 L 846 474 L 852 463 L cp e [21.902 12.039 12.043 -21.902 0 0]/Times-Roman MF (A)717 387 MS (C)733 396 MS (K)747 404 MS (R)763 412 MS (E)778 421 MS = (F)791 428 MS n 395 413 M 395 410 L CM 0.246 0.25 scale s SM n 395 407 M 395 404 L CM 0.246 0.25 scale s SM n 395 401 M 395 398 L CM 0.246 0.25 scale s SM n 395 395 M 395 392 L CM 0.246 0.25 scale s SM n 395 389 M 396 386 L CM 0.246 0.25 scale s SM n 396 383 M 396 380 L CM 0.246 0.25 scale s SM n 396 377 M 396 374 L CM 0.246 0.25 scale s SM n 396 371 M 396 368 L CM 0.246 0.25 scale s SM n 397 365 M 397 362 L CM 0.246 0.25 scale s SM n 397 359 M 398 356 L CM 0.246 0.25 scale s SM n 398 353 M 398 350 L CM 0.246 0.25 scale s SM n 399 347 M 399 344 L CM 0.246 0.25 scale s SM n 399 344 M 399 344 L CM 0.246 0.25 scale s SM n 399 341 M 400 338 L CM 0.246 0.25 scale s SM n 400 335 M 400 334 L CM 0.246 0.25 scale s SM n 400 334 M 400 332 L CM 0.246 0.25 scale s SM n 401 329 M 401 326 L CM 0.246 0.25 scale s SM n 402 323 M 402 320 L CM 0.246 0.25 scale s SM n 403 317 M 403 315 L CM 0.246 0.25 scale s SM n 403 315 M 404 314 L CM 0.246 0.25 scale s SM n 404 311 M 405 308 L CM 0.246 0.25 scale s SM n 406 305 M 407 302 L CM 0.246 0.25 scale s SM n 407 299 M 407 299 L CM 0.246 0.25 scale s SM n 407 299 M 408 297 L CM 0.246 0.25 scale s SM n 409 294 M 410 292 L CM 0.246 0.25 scale s SM n 410 292 M 410 291 L CM 0.246 0.25 scale s SM n 411 288 M 412 286 L CM 0.246 0.25 scale s SM n 412 286 M 412 286 L CM 0.246 0.25 scale s SM n 413 283 M 414 281 L CM 0.246 0.25 scale s SM n 414 281 M 415 280 L CM 0.246 0.25 scale s SM n 416 278 M 417 276 L CM 0.246 0.25 scale s SM n 417 276 M 418 275 L CM 0.246 0.25 scale s SM n 420 273 M 422 271 L CM 0.246 0.25 scale s SM n 424 269 M 425 269 L CM 0.246 0.25 scale s SM n 425 269 M 427 268 L CM 0.246 0.25 scale s SM n 430 269 M 433 270 L CM 0.246 0.25 scale s SM n 435 272 M 435 273 L CM 0.246 0.25 scale s SM n 435 273 M 437 275 L CM 0.246 0.25 scale s SM n 438 277 M 440 280 L CM 0.246 0.25 scale s SM n 441 282 M 442 285 L CM 0.246 0.25 scale s SM n 444 288 M 445 291 L CM 0.246 0.25 scale s SM n 446 293 M 446 296 L CM 0.246 0.25 scale s SM n 447 299 M 448 302 L CM 0.246 0.25 scale s SM n 449 305 M 449 307 L CM 0.246 0.25 scale s SM n 449 307 M 450 308 L CM 0.246 0.25 scale s SM n 450 311 M 451 314 L CM 0.246 0.25 scale s SM n 452 317 M 452 320 L CM 0.246 0.25 scale s SM n 453 323 M 453 324 L CM 0.246 0.25 scale s SM n 453 324 M 453 326 L CM 0.246 0.25 scale s SM n 454 329 M 454 332 L CM 0.246 0.25 scale s SM n 455 335 M 455 338 L CM 0.246 0.25 scale s SM n 455 341 M 456 344 L CM 0.246 0.25 scale s SM n 456 347 M 457 350 L CM 0.246 0.25 scale s SM n 457 353 M 457 355 L CM 0.246 0.25 scale s SM n 457 355 M 457 356 L CM 0.246 0.25 scale s SM n 457 359 M 458 362 L CM 0.246 0.25 scale s SM n 458 365 M 458 366 L CM 0.246 0.25 scale s SM n 458 366 M 458 368 L CM 0.246 0.25 scale s SM n 458 371 M 459 374 L CM 0.246 0.25 scale s SM n 459 377 M 459 378 L CM 0.246 0.25 scale s SM n 459 378 M 459 380 L CM 0.246 0.25 scale s SM n 459 383 M 459 386 L CM 0.246 0.25 scale s SM n 459 389 M 459 389 L CM 0.246 0.25 scale s SM n 459 389 M 459 392 L CM 0.246 0.25 scale s SM n 459 395 M 460 398 L CM 0.246 0.25 scale s SM n 460 401 M 460 401 L CM 0.246 0.25 scale s SM n 460 401 M 460 404 L CM 0.246 0.25 scale s SM n 460 407 M 460 410 L CM 0.246 0.25 scale s SM n 460 413 M 460 413 L CM 0.246 0.25 scale s SM n 460 413 M 460 416 L CM 0.246 0.25 scale s SM n 460 419 M 460 422 L CM 0.246 0.25 scale s SM n 460 425 M 460 425 L CM 0.246 0.25 scale s SM n 460 425 M 460 428 L CM 0.246 0.25 scale s SM n 460 431 M 459 434 L CM 0.246 0.25 scale s SM n 459 437 M 459 437 L CM 0.246 0.25 scale s SM n 459 437 M 459 440 L CM 0.246 0.25 scale s SM n 459 443 M 459 446 L CM 0.246 0.25 scale s SM n 459 449 M 459 452 L CM 0.246 0.25 scale s SM n 458 455 M 458 458 L CM 0.246 0.25 scale s SM n 458 461 M 458 464 L CM 0.246 0.25 scale s SM n 458 467 M 457 470 L CM 0.246 0.25 scale s SM n 457 473 M 457 476 L CM 0.246 0.25 scale s SM n 456 479 M 456 482 L CM 0.246 0.25 scale s SM n 456 485 M 455 488 L CM 0.246 0.25 scale s SM n 455 491 M 455 492 L CM 0.246 0.25 scale s SM n 455 492 M 454 494 L CM 0.246 0.25 scale s SM n 454 497 M 453 500 L CM 0.246 0.25 scale s SM n 453 503 M 452 506 L CM 0.246 0.25 scale s SM n 452 509 M 451 511 L CM 0.246 0.25 scale s SM n 451 511 M 451 512 L CM 0.246 0.25 scale s SM n 451 515 M 450 518 L CM 0.246 0.25 scale s SM n 449 521 M 448 524 L CM 0.246 0.25 scale s SM n 448 527 M 447 527 L CM 0.246 0.25 scale s SM n 447 527 M 447 530 L CM 0.246 0.25 scale s SM n 446 532 M 445 534 L CM 0.246 0.25 scale s SM n 445 534 M 445 535 L CM 0.246 0.25 scale s SM n 444 538 M 443 541 L CM 0.246 0.25 scale s SM n 443 541 M 443 541 L CM 0.246 0.25 scale s SM n 441 544 M 440 546 L CM 0.246 0.25 scale s SM n 440 546 M 440 546 L CM 0.246 0.25 scale s SM n 439 549 M 438 550 L CM 0.246 0.25 scale s SM n 438 550 M 437 551 L CM 0.246 0.25 scale s SM n 435 554 M 433 556 L CM 0.246 0.25 scale s SM n 430 557 M 430 558 L CM 0.246 0.25 scale s SM n 430 558 M 428 558 L CM 0.246 0.25 scale s SM n 425 558 M 422 556 L CM 0.246 0.25 scale s SM n 420 554 M 419 554 L CM 0.246 0.25 scale s SM n 419 554 M 418 552 L CM 0.246 0.25 scale s SM n 416 549 M 415 547 L CM 0.246 0.25 scale s SM n 414 544 M 412 541 L CM 0.246 0.25 scale s SM n 411 539 M 410 536 L CM 0.246 0.25 scale s SM n 409 533 M 408 530 L CM 0.246 0.25 scale s SM n 407 527 M 407 524 L CM 0.246 0.25 scale s SM n 406 521 M 405 520 L CM 0.246 0.25 scale s SM n 405 520 M 405 518 L CM 0.246 0.25 scale s SM n 404 515 M 404 512 L CM 0.246 0.25 scale s SM n 403 509 M 402 506 L CM 0.246 0.25 scale s SM n 402 503 M 402 502 L CM 0.246 0.25 scale s SM n 402 502 M 401 500 L CM 0.246 0.25 scale s SM n 401 497 M 400 494 L CM 0.246 0.25 scale s SM n 400 491 M 400 488 L CM 0.246 0.25 scale s SM n 399 485 M 399 482 L CM 0.246 0.25 scale s SM n 399 479 M 398 476 L CM 0.246 0.25 scale s SM n 398 473 M 398 471 L CM 0.246 0.25 scale s SM n 398 471 M 398 470 L CM 0.246 0.25 scale s SM n 397 467 M 397 464 L CM 0.246 0.25 scale s SM n 397 461 M 397 460 L CM 0.246 0.25 scale s SM n 397 460 M 397 458 L CM 0.246 0.25 scale s SM n 396 455 M 396 452 L CM 0.246 0.25 scale s SM n 396 449 M 396 449 L CM 0.246 0.25 scale s SM n 396 449 M 396 446 L CM 0.246 0.25 scale s SM n 396 443 M 396 440 L CM 0.246 0.25 scale s SM n 395 437 M 395 437 L CM 0.246 0.25 scale s SM n 395 437 M 395 434 L CM 0.246 0.25 scale s SM n 395 431 M 395 428 L CM 0.246 0.25 scale s SM n 395 425 M 395 425 L CM 0.246 0.25 scale s SM n 395 425 M 395 422 L CM 0.246 0.25 scale s SM n 395 419 M 395 416 L CM 0.246 0.25 scale s SM n 395 413 M 395 413 L CM 0.246 0.25 scale s SM n 307 511 M 309 509 L CM 0.246 0.25 scale s SM n 312 508 M 314 506 L CM 0.246 0.25 scale s SM n 317 504 M 319 503 L CM 0.246 0.25 scale s SM n 322 501 M 324 500 L CM 0.246 0.25 scale s SM n 327 498 M 329 496 L CM 0.246 0.25 scale s SM n 332 495 M 334 493 L CM 0.246 0.25 scale s SM n 337 491 M 339 490 L CM 0.246 0.25 scale s SM n 342 488 M 344 487 L CM 0.246 0.25 scale s SM n 347 485 M 349 483 L CM 0.246 0.25 scale s SM n 352 482 M 354 480 L CM 0.246 0.25 scale s SM n 357 478 M 359 477 L CM 0.246 0.25 scale s SM n 362 475 M 364 474 L CM 0.246 0.25 scale s SM n 367 472 M 369 470 L CM 0.246 0.25 scale s SM n 372 469 M 374 467 L CM 0.246 0.25 scale s SM n 377 466 M 379 464 L CM 0.246 0.25 scale s SM n 382 462 M 384 461 L CM 0.246 0.25 scale s SM n 387 459 M 389 457 L CM 0.246 0.25 scale s SM n 392 456 M 394 454 L CM 0.246 0.25 scale s SM [24.938 0 0 -25 0 0]/Times-Roman MF (S)275 532 MS (Y)289 532 MS (N)307 532 MS (C)325 532 MS n 833 384 M 833 381 L CM 0.246 0.25 scale s SM n 833 378 M 833 375 L CM 0.246 0.25 scale s SM n 833 372 M 833 369 L CM 0.246 0.25 scale s SM n 833 366 M 833 364 L CM 0.246 0.25 scale s SM n 833 364 M 833 363 L CM 0.246 0.25 scale s SM n 834 360 M 834 357 L CM 0.246 0.25 scale s SM n 834 354 M 834 354 L CM 0.246 0.25 scale s SM n 834 354 M 834 351 L CM 0.246 0.25 scale s SM n 835 348 M 835 345 L CM 0.246 0.25 scale s SM n 835 342 M 836 339 L CM 0.246 0.25 scale s SM n 836 336 M 836 334 L CM 0.246 0.25 scale s SM n 836 334 M 837 333 L CM 0.246 0.25 scale s SM n 837 330 M 838 327 L CM 0.246 0.25 scale s SM n 838 324 M 839 321 L CM 0.246 0.25 scale s SM n 840 318 M 840 317 L CM 0.246 0.25 scale s SM n 840 317 M 840 315 L CM 0.246 0.25 scale s SM n 841 313 M 842 310 L CM 0.246 0.25 scale s SM n 843 307 M 843 304 L CM 0.246 0.25 scale s SM n 844 301 M 845 298 L CM 0.246 0.25 scale s SM n 847 296 M 847 295 L CM 0.246 0.25 scale s SM n 847 295 M 848 293 L CM 0.246 0.25 scale s SM n 849 290 M 849 290 L CM 0.246 0.25 scale s SM n 849 290 M 851 287 L CM 0.246 0.25 scale s SM n 852 285 M 854 282 L CM 0.246 0.25 scale s SM n 856 280 M 858 278 L CM 0.246 0.25 scale s SM n 858 278 M 858 278 L CM 0.246 0.25 scale s SM n 860 277 M 861 276 L CM 0.246 0.25 scale s SM n 861 276 M 863 276 L CM 0.246 0.25 scale s SM n 866 275 M 867 275 L CM 0.246 0.25 scale s SM n 867 275 M 869 276 L CM 0.246 0.25 scale s SM n 872 277 M 873 278 L CM 0.246 0.25 scale s SM n 873 278 M 874 279 L CM 0.246 0.25 scale s SM n 876 282 M 878 284 L CM 0.246 0.25 scale s SM n 880 286 M 881 289 L CM 0.246 0.25 scale s SM n 882 292 M 884 294 L CM 0.246 0.25 scale s SM n 885 297 M 886 300 L CM 0.246 0.25 scale s SM n 887 303 M 888 305 L CM 0.246 0.25 scale s SM n 889 308 M 889 309 L CM 0.246 0.25 scale s SM n 889 309 M 889 311 L CM 0.246 0.25 scale s SM n 890 314 M 891 317 L CM 0.246 0.25 scale s SM n 891 317 M 891 317 L CM 0.246 0.25 scale s SM n 892 320 M 892 323 L CM 0.246 0.25 scale s SM n 893 326 M 893 329 L CM 0.246 0.25 scale s SM n 894 332 M 894 334 L CM 0.246 0.25 scale s SM n 894 334 M 894 335 L CM 0.246 0.25 scale s SM n 895 338 M 895 341 L CM 0.246 0.25 scale s SM n 896 344 M 896 347 L CM 0.246 0.25 scale s SM n 896 350 M 897 353 L CM 0.246 0.25 scale s SM n 897 356 M 897 359 L CM 0.246 0.25 scale s SM n 897 362 M 897 364 L CM 0.246 0.25 scale s SM n 897 364 M 897 365 L CM 0.246 0.25 scale s SM n 897 368 M 897 371 L CM 0.246 0.25 scale s SM n 898 374 M 898 377 L CM 0.246 0.25 scale s SM n 898 380 M 898 383 L CM 0.246 0.25 scale s SM n 898 386 M 898 389 L CM 0.246 0.25 scale s SM n 898 392 M 898 395 L CM 0.246 0.25 scale s SM n 898 395 M 898 395 L CM 0.246 0.25 scale s SM n 897 398 M 897 401 L CM 0.246 0.25 scale s SM n 897 404 M 897 405 L CM 0.246 0.25 scale s SM n 897 405 M 897 407 L CM 0.246 0.25 scale s SM n 897 410 M 897 413 L CM 0.246 0.25 scale s SM n 897 416 M 896 419 L CM 0.246 0.25 scale s SM n 896 422 M 896 425 L CM 0.246 0.25 scale s SM n 896 425 M 896 425 L CM 0.246 0.25 scale s SM n 895 428 M 895 431 L CM 0.246 0.25 scale s SM n 894 434 M 894 434 L CM 0.246 0.25 scale s SM n 894 434 M 894 437 L CM 0.246 0.25 scale s SM n 893 440 M 893 443 L CM 0.246 0.25 scale s SM n 892 446 M 891 449 L CM 0.246 0.25 scale s SM n 891 452 M 890 455 L CM 0.246 0.25 scale s SM n 889 458 M 889 460 L CM 0.246 0.25 scale s SM n 889 460 M 889 461 L CM 0.246 0.25 scale s SM n 888 464 M 887 466 L CM 0.246 0.25 scale s SM n 886 469 M 885 472 L CM 0.246 0.25 scale s SM n 884 475 M 882 477 L CM 0.246 0.25 scale s SM n 881 480 M 880 483 L CM 0.246 0.25 scale s SM n 878 485 M 876 487 L CM 0.246 0.25 scale s SM n 874 490 M 873 491 L CM 0.246 0.25 scale s SM n 873 491 M 872 491 L CM 0.246 0.25 scale s SM n 869 493 M 867 494 L CM 0.246 0.25 scale s SM n 867 494 M 866 494 L CM 0.246 0.25 scale s SM n 863 493 M 861 493 L CM 0.246 0.25 scale s SM n 858 491 M 858 491 L CM 0.246 0.25 scale s SM n 858 491 M 856 489 L CM 0.246 0.25 scale s SM n 854 487 M 852 484 L CM 0.246 0.25 scale s SM n 851 482 M 849 479 L CM 0.246 0.25 scale s SM n 848 476 M 847 474 L CM 0.246 0.25 scale s SM n 846 471 M 845 468 L CM 0.246 0.25 scale s SM n 844 465 M 843 463 L CM 0.246 0.25 scale s SM n 842 460 M 841 457 L CM 0.246 0.25 scale s SM n 840 454 M 840 452 L CM 0.246 0.25 scale s SM n 840 452 M 840 451 L CM 0.246 0.25 scale s SM n 839 448 M 838 445 L CM 0.246 0.25 scale s SM n 838 442 M 837 439 L CM 0.246 0.25 scale s SM n 837 436 M 836 434 L CM 0.246 0.25 scale s SM n 836 434 M 836 433 L CM 0.246 0.25 scale s SM n 836 430 M 835 427 L CM 0.246 0.25 scale s SM n 835 424 M 835 421 L CM 0.246 0.25 scale s SM n 834 418 M 834 415 L CM 0.246 0.25 scale s SM n 834 415 M 834 415 L CM 0.246 0.25 scale s SM n 834 412 M 834 409 L CM 0.246 0.25 scale s SM n 833 406 M 833 405 L CM 0.246 0.25 scale s SM n 833 405 M 833 403 L CM 0.246 0.25 scale s SM n 833 400 M 833 397 L CM 0.246 0.25 scale s SM n 833 394 M 833 391 L CM 0.246 0.25 scale s SM n 833 388 M 833 385 L CM 0.246 0.25 scale s SM n 942 481 M 940 479 L CM 0.246 0.25 scale s SM n 939 476 M 937 474 L CM 0.246 0.25 scale s SM n 935 472 M 933 470 L CM 0.246 0.25 scale s SM n 931 467 M 929 465 L CM 0.246 0.25 scale s SM n 927 463 M 925 460 L CM 0.246 0.25 scale s SM n 923 458 M 921 456 L CM 0.246 0.25 scale s SM n 920 453 M 918 451 L CM 0.246 0.25 scale s SM n 916 449 M 914 446 L CM 0.246 0.25 scale s SM n 912 444 M 910 442 L CM 0.246 0.25 scale s SM n 908 440 M 906 437 L CM 0.246 0.25 scale s SM n 904 435 M 902 433 L CM 0.246 0.25 scale s SM n 900 430 M 899 428 L CM 0.246 0.25 scale s SM n 897 426 M 895 424 L CM 0.246 0.25 scale s SM (S)917 506 MS (Y)931 506 MS (N)949 506 MS (C)967 506 MS 1 sl n 602 46 M 603 39 L 604 33 L 607 27 L 610 21 L 614 16 L 619 12 L 624 8 L 630 5 L 636 3 L 643 2 L 649 2 L 656 3 L 662 5 L 668 8 L 673 12 L 678 16 L 682 21 L 685 27 L 688 33 L 689 39 L 690 46 L 689 52 L 688 59 L 685 65 L 682 70 L 678 76 L 673 80 L 668 84 L 662 86 L 656 88 L 649 89 L 643 89 L 636 88 L 630 86 L 624 84 L 619 80 L 614 76 L 610 70 L 607 65 L 604 59 L 603 52 L 602 46 L cp gs 1 g e gr s [29.301 0 0 -29.25 0 0]/Times-Roman MF (I)636 55 MS [19.324 0 0 -19.5 0 0]/Times-Roman MF (2)646 64 MS n 674 59 M 704 59 L 704 33 L 674 33 L 674 59 L cp gs 1 g e gr s n 588 59 M 617 59 L 617 33 L 588 33 L 588 59 L cp gs 1 g e gr s n 158 45 M 159 38 L 160 32 L 162 26 L 166 20 L 170 15 L 175 11 L 180 7 L 186 4 L 192 2 L 199 1 L 205 1 L 212 2 L 218 4 L 224 7 L 229 11 L 234 15 L 238 20 L 241 26 L 244 32 L 245 38 L 246 45 L 245 51 L 244 58 L 241 64 L 238 69 L 234 75 L 229 79 L 224 83 L 218 86 L 212 87 L 205 88 L 199 88 L 192 87 L 186 86 L 180 83 L 175 79 L 170 75 L 166 69 L 162 64 L 160 58 L 159 51 L 158 45 L cp gs 1 g e gr s [29.301 0 0 -29.25 0 0]/Times-Roman MF (I)192 54 MS [19.324 0 0 -19.5 0 0]/Times-Roman MF (1)202 63 MS n 230 58 M 260 58 L 260 32 L 230 32 L 230 58 L cp gs 1 g e gr s n 1037 50 M 1038 43 L 1039 37 L 1042 31 L 1045 25 L 1049 20 L 1054 16 L 1059 12 L 1065 9 L 1071 7 L 1078 6 L 1084 6 L 1091 7 L 1097 9 L 1103 12 L 1108 16 L 1113 20 L 1117 25 L 1120 31 L 1123 37 L 1124 43 L 1125 50 L 1124 56 L 1123 63 L 1120 69 L 1117 74 L 1113 79 L 1108 84 L 1103 88 L 1097 90 L 1091 92 L 1084 93 L 1078 93 L 1071 92 L 1065 90 L 1059 88 L 1054 84 L 1049 79 L 1045 74 L 1042 69 L 1039 63 L 1038 56 L 1037 50 L cp gs 1 g e gr s [29.301 0 0 -29.25 0 0]/Times-Roman MF (I)1071 58 MS [19.324 0 0 -19.5 0 0]/Times-Roman MF (3)1081 68 MS n 1023 63 M 1053 63 L 1053 37 L 1023 37 L 1023 63 L cp gs 1 g e gr s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 3634 a(Figure)29 b(6.)g(An)g(scenario)h(that)f(pro)o (v)o(es)g(that)g Fk(U)8 b(N)g(LO)r(C)d(K)36 b Fs(messages)30 b(may)g(be)f(recei)n(v)o(ed)h(whilst)e(a)h(participant)h(is)e(in)h (state)410 3717 y Fk(S)t(Y)17 b(N)8 b(C)d Fs(,)19 b(as)g(well)f(as)h Fk(R)q(E)t(F)11 b(U)d(S)t(E)22 b Fs(or)d Fk(O)r(K)24 b Fs(messages)c(whilst)f(a)g(coordinator)h(is)e(in)h(state)g Fk(AC)5 b(C)g(E)t(P)11 b(T)g(I)6 b(N)i(G)p Fs(.)191 4006 y Fq(the)25 b Fm(U)9 b(N)g(LO)r(C)d(K)32 b Fq(must)25 b(necessarily)g(arri)n(v)o(e)f(at)i Fm(P)1687 4018 y Fl(1)1751 4006 y Fq(after)f(the)h Fm(LO)r(C)6 b(K)31 b Fq(message,)26 b(and)e(that)i(the)o(y)f(both)f(must)i(be)191 4106 y(recei)n(v)o(ed)g(whilst)h Fm(P)780 4118 y Fl(1)846 4106 y Fq(is)h(in)f(state)h Fm(S)5 b(Y)19 b(N)9 b(C)34 b Fq(because)26 b(messages)i(sent)f(from)f(the)i(same)f(origin)f(are)h (processed)g(in)191 4206 y(order)19 b(and)h Fm(P)581 4218 y Fl(1)639 4206 y Fq(will)h(not)f(lea)n(v)o(e)g(state)h Fm(S)5 b(Y)18 b(N)9 b(C)27 b Fq(until)20 b(it)h(recei)n(v)o(es)e(an)h Fm(AC)6 b(K)g(R)q(E)f(F)33 b Fq(message.)274 4307 y(The)16 b(scenario)f(in)h(Figure)g(6)g(also)g(justi\002es)h(the)f(need)g(for)f (transitions)h(3)g(and)g(9)g(in)g(coordinators.)d(On)k(reception)d(of) 191 4407 y(the)21 b(\002rst)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)26 b Fq(message,)20 b Fm(I)1227 4419 y Fl(2)1286 4407 y Fq(immediately)g(reaches)g(state)h Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(.)21 b(Notice)g(that)g(on)f(reception)191 4506 y(of)j(a)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)28 b Fq(message)23 b(from)g Fm(P)1295 4518 y Fl(2)1332 4506 y Fq(,)h(coordinator)d Fm(I)1820 4518 y Fl(2)1881 4506 y Fq(does)j(not)f(kno)n(w)f(if)i (participant)e Fm(P)2901 4518 y Fl(1)2962 4506 y Fq(has)i(accepted)e (to)i(be)191 4606 y(lock)o(ed)19 b(or)h(not,)f(thus)h(its)h(answer)f (must)g(be)g(processed)f(in)h(state)h Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(,)20 b(which)g(justi\002es)h(the)f(need)f(for) 191 4706 y(transitions)h(3)g(and)g(9)g(in)g(coordinators.)274 4807 y(It)d(should)f(also)i(be)f(pointed)f(out)h(that)g(counter)e Fm(n)j Fq(is)g(decreased)e(in)h(transition)g(3)g(if)g(and)g(only)f(if)h (is)h(strictly)g(greater)191 4907 y(than)25 b(zero,)g(which)h(might)f (seem)h(super\003uous)e(as)i(long)f(as)i(we)f(ha)n(v)o(e)f(de\002ned)g Fm(n)h Fq(as)h(a)f(counter)e(that)i(records)f(the)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 12 12 12 11 bop 191 299 a Fq(12)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(number)d(of)i(of)n(fers)g(a)g(coordinator)e(has)j(got,)e(so)i (that)f(each)g(of)n(fer)f(should)h(be)g(cancelled)f(by)h(e)o(xactly)f (one)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 706 y Fq(message.)21 b(The)g(reason)g(is)i(that)e(if)h(transition)f(7)h(occurs)e(in)i(a)g (situation)f(in)h(which)f Fm(cur)r(r)r(ent)26 b Fi(6)p Fj(=3D)f Fm(S)5 b(ender)r Fq(,)22 b(then)f(the)191 805 y(answer)h(from)f(participant)f Fm(cur)r(r)r(ent)j Fq(has)f(not)g(been) f(processed,)g(yet.)h(Ho)n(we)n(v)o(er)m(,)e Fm(cur)r(r)r(ent)j Fq(is)g(remo)o(v)o(ed)c(from)i(set)191 905 y Fm(shar)r(ed)h Fq(and)f Fm(n)h Fq(is)g(decreased)e(as)i(if)g(the)f(answer)h(from)e Fm(cur)r(r)r(ent)i Fq(had)f(been)g(processed.)f(This)h(is)i(the)e (reason)g(why)191 1005 y(we)g(need)e(to)h(be)g(careful)g(before)e (updating)h(counter)g Fm(n)p Fq(.)274 1105 y(In)26 b(order)f(to)h(a)n (v)n(oid)g(these)g(set)h(of)f(intricate)g(transitions,)f(we)h(might)g (ha)n(v)o(e)f(added)g(a)i Fm(C)6 b(AN)j(C)d(E)f(L)27 b Fq(message)f(to)191 1204 y(sort)e(out)f(the)g(dif)n(ference)f (between)g(a)i Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)28 b Fq(message)c (indicating)e(that)h(a)h(participant)e(does)h(not)h(accept)f(to)191 1304 y(be)e(lock)o(ed)g(and)f(another)g(indicating)g(that)i(a)f (participant)f(autonomously)f(decides)i(to)g(cancel)g(an)g(of)n(fer)f (because)h(it)191 1404 y(commits)f(to)h(another)e(interaction.)h(The)g (problem)f(is)j(that)f(adding)e(this)i(message)g(leads)g(to)g(a)g (solution)f(with)h(more)191 1503 y(states)g(and)f(transitions,)f(which) h(is)h(clearly)f(undesirable.)191 1806 y Fr(CORRECTNESS)191 2003 y Fq(In)15 b(this)h(section,)f(we)h(pro)o(v)o(e)d(that)j(the)f (algorithm)f(we)i(ha)n(v)o(e)f(presented)f(is)i(correct,)f(i.e.,)g(it)h (guarantees)e(the)i(e)o(xclusion,)191 2103 y(progress,)26 b(synchronisation)e(and)j(idleness)g(properties)f(presented)g(in)h (Section)g(.)g(W)-7 b(e)29 b(be)o(gin)d(with)h(a)h(number)d(of)191 2203 y(preliminary)j(de\002nitions)h(and)g(lemmas,)g(and)g(then)h (present)f(and)g(pro)o(v)o(e)f(the)h(theorems)g(we)h(need)f(to)h(state) h(our)191 2302 y(algorithm)19 b(is)i(correct.)191 2504 y Fr(Pr)o(eliminaries)191 2702 y(De\002nition)f(1.)41 b Fn(Let)21 b Fi(f)p Fm(P)888 2714 y Fl(1)925 2702 y Fm(;)14 b(P)1015 2714 y Fl(2)1052 2702 y Fm(;)g(:)g(:)g(:)g(;)g(P)1290 2714 y Fh(n)1335 2702 y Fi(g)20 b Fn(be)g(a)h(set)f(of)h(participants.) d Fm(<)j Fn(is)g(a)f(strict)h(partial)f(or)m(der)g(o)o(ver)g(this)h (set,)f(or)191 2802 y(simply)g(an)g(or)m(der)-9 b(,)20 b(as)h(long)e(as)h Fm(<)h Fn(is)g(a)f(tr)o(ansitive)o(,)g(irr)m(e\003e) n(xive)h(binary)e(r)m(elation)h(o)o(ver)g(this)h(set.)191 2953 y Fr(De\002nition)f(2.)41 b Fn(W)-8 b(e)21 b(de\002ne)d(a)i(pr)m (edicate)f(that)h(is)g(denoted)e(by)i Fm(l)r(ock)s(s)p Fj(\()p Fm(I)7 b(;)14 b(P)e Fj(\))20 b Fn(and)f(holds)g(as)h(long)f(as) h(coor)m(dinator)e Fm(I)191 3053 y Fn(has)i(sent)h(a)f Fm(LO)r(C)6 b(K)26 b Fn(messa)o(g)o(e)21 b(to)f(participant)f Fm(P)32 b Fn(and)20 b(has)g(r)m(eceived)g(an)g Fm(O)r(K)26 b Fn(messa)o(g)o(e)21 b(fr)l(om)g(it.)191 3204 y Fr(De\002nition)f(3.) 41 b Fn(W)-8 b(e)20 b(de\002ne)d(a)i(pr)m(edicate)f(that)g(is)i (denoted)d(by)i Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)e Fj(\))19 b Fn(and)f(holds)g(as)h(long)f(as)h(coor)m(dinator)e Fm(I)191 3304 y Fn(has)i(sent)g(a)g Fm(LO)r(C)6 b(K)25 b Fn(messa)o(g)o(e)19 b(to)g(participant)e Fm(P)12 b Fn(,)19 b(b)n(ut)g(has)f(not)h(r)m(eceived)f(a)h(r)m(eply)-5 b(,)19 b(yet.)g(Notice)g(that)g Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)e Fj(\))191 3404 y Fn(holds)20 b(if)h Fm(P)32 b Fn(has)20 b(r)m(eplied,)g(b)n(ut)g(its)h(answer)g(has)f(not)g (been)f(r)m(eceived)h(by)g Fm(I)7 b Fn(,)21 b(yet.)191 3555 y Fr(De\002nition)f(4.)41 b Fn(W)-8 b(e)23 b(denote)e(the)h (number)g(of)g Fm(LO)r(C)6 b(K)29 b Fn(messa)o(g)o(es)22 b(sent)h(out)f(by)g(a)g(given)g(coor)m(dinator)e(since)i(it)h(left)191 3655 y(state)e Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)20 b Fn(for)h(the)f(last)h(time)f(as)h Fm(\021)1637 3667 y Fh(LO)r(C)t(K)1851 3655 y Fn(.)191 3806 y Fr(De\002nition)f(5.)41 b Fn(W)-8 b(e)22 b(denote)e(the)h(number)f(of)h Fm(O)r(K)28 b Fn(messa)o(g)o(es)21 b(r)m(eceived)g(by)g(a)g(given)f(coor)m(dinator) f(since)i(it)h(left)g(the)191 3906 y Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)21 b Fn(state)f(for)h(the)f(last)h(time)f(as)h Fm(\021)1637 3918 y Fh(O)r(K)1753 3906 y Fn(.)191 4057 y Fr(Lemma)g(1.)41 b Fm(\021)629 4069 y Fh(LO)r(C)t(K)865 4057 y Fj(=3D)23 b Fm(\021)994 4069 y Fh(O)r(K)1129 4057 y Fj(+)18 b(1)i Fn(is)h(an)f(in)m(variant)f(when)h(coor)m(dinator)e Fm(I)28 b Fn(is)21 b(in)g(state)f Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fn(.)191 4209 y(Pr)l(oof)o(.)40 b Fq(Pro)o(ving)56 b(it)j(when)e Fm(I)65 b Fq(enters)58 b(state)g Fm(LO)r(C)6 b(K)g(I)h(N)i(G)59 b Fq(after)e(lea)n(ving)g(state)i Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)58 b Fq(is)191 4308 y(straightforw)o(ard)33 b(if)k(we)f(analise)g(transition)f(5.)h Fm(I)43 b Fq(sends)36 b(out)g(its)h(\002rst)f Fm(LO)r(C)6 b(K)43 b Fq(message)35 b(during)g(this)h(state)191 4408 y(transition,)25 b(thus)i Fm(\021)759 4420 y Fh(LO)r(C)t(K)1007 4408 y Fj(=3D)35 b(1)26 b Fq(and)g Fm(\021)1363 4420 y Fh(O)r(K)1515 4408 y Fj(=3D)34 b(0)27 b Fq(by)f(de\002nition,)f(because)h(when)g Fm(I)34 b Fq(enters)26 b(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)191 4507 y Fq(for)20 b(the)g(\002rst)h(time)f(after)g(lea)n(ving)f(state)i Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)21 b Fq(it)g(has)f(not)g (recei)n(v)o(ed)f(an)h Fm(O)r(K)27 b Fq(message,)19 b(yet.)274 4608 y(From)32 b(no)n(w)g(on,)g(transition)f(6)i(is)g(the)g(only)e(one) h(that)h(k)o(eeps)f(coordinator)e Fm(I)40 b Fq(in)33 b(state)g Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(.)33 b(This)191 4707 y(transition)40 b(is)i(e)o(x)o(ecuted)d(on)h(reception)f(of)i(an)g Fm(O)r(K)47 b Fq(message,)41 b(b)n(ut)f(coordinator)e Fm(I)49 b Fq(sends)41 b(out)f(a)h Fm(LO)r(C)6 b(K)191 4807 y Fq(message)28 b(during)f(it.)i(Therefore,)d(each)j(time)f Fm(\021)1619 4819 y Fh(O)r(K)1765 4807 y Fq(increases,)g(so)h(does)f Fm(\021)2444 4819 y Fh(LO)r(C)t(K)2658 4807 y Fq(,)h(thus)f(k)o(eeping) f(the)i(property)191 4907 y Fm(\021)232 4919 y Fh(LO)r(C)t(K)469 4907 y Fj(=3D)22 b Fm(\021)597 4919 y Fh(O)r(K)732 4907 y Fj(+)c(1)j Fq(in)m(v)n(ariant.)d Fg(2)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)e FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 13 13 13 12 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(13)p 191 473 3388 5 v 191 606 a Fr(Lemma)21 b(2.)41 b Fm(\021)629 618 y Fh(LO)r(C)t(K)881 606 y Fj(+)c Fi(j)p Fm(w)r(aiting)s Fi(j)72 b Fj(=3D)g Fi(j)p Fm(shar)r(ed)p Fi(j)48 b Fn(is)g(an)f(in)m (variant)e(when)i(coor)m(dinator)e Fm(I)54 b Fn(is)48 b(in)f(state)191 706 y Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fn(.)191 864 y(Pr)l(oof)o(.)40 b Fq(According)35 b(to)i(the)f (de\002nition)g(of)g(transition)g(5,)g(it)i(is)f(clear)g(that)f Fm(\021)2554 876 y Fh(LO)r(C)t(K)2821 864 y Fj(=3D)53 b(1)37 b Fq(and)f Fm(w)r(aiting)56 b Fj(=3D)191 963 y Fm(shar)r(ed)p Fi(nf)p Fm(cur)r(r)r(ent)p Fi(g)37 b Fq(when)g Fm(I)45 b Fq(enters)38 b(state)g Fm(LO)r(C)6 b(K)g(I)h(N)i(G)38 b Fq(after)f(lea)n(ving)g(state)h Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)38 b Fq(\(being)191 1063 y Fm(cur)r(r)r(ent)28 b Fq(its)h(smallest)f(shared)e(participant\).)g(Consequently)-5 b(,)25 b Fi(j)p Fm(w)r(aiting)s Fi(j)35 b Fj(=3D)h Fi(j)p Fm(shar)r(ed)p Fi(j)24 b(\000)g Fj(1)j Fq(in)h(this)f(situation,)191 1163 y(so)21 b Fi(j)p Fm(w)r(aiting)s Fi(j)h Fj(=3D)g Fi(j)p Fm(shar)r(ed)p Fi(j)d(\000)f Fm(\021)1168 1175 y Fh(LO)r(C)t(K)1403 1163 y Fq(and)h Fm(\021)1584 1175 y Fh(LO)r(C)t(K)1817 1163 y Fj(+)f Fi(j)p Fm(w)r(aiting)s Fi(j)k Fj(=3D)h Fi(j)p Fm(shar)r(ed)p Fi(j)p Fq(.)274 1265 y(From)d(no)n(w)g(on,)f(transition) h(6)g(is)i(the)e(only)g(that)g(k)o(eeps)g(coordinator)e Fm(I)28 b Fq(in)20 b(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(.)21 b(This)g(transition)191 1365 y(sends)26 b(out)g(a)g Fm(LO)r(C)6 b(K)33 b Fq(message)25 b(and)h(also)g(remo)o(v)o(es)f(a)h (participant)f(from)g(set)i Fm(w)r(aiting)s Fq(.)e(Therefore)f Fi(j)p Fm(w)r(aiting)s Fi(j)191 1464 y Fq(decreases)16 b(by)g(one)f(and)h Fm(\021)940 1476 y Fh(LO)r(C)t(K)1171 1464 y Fq(increases)g(by)g(one,)f(thus)h(k)o(eeping)f Fm(\021)2224 1476 y Fh(LO)r(C)t(K)2442 1464 y Fj(+)t Fi(j)p Fm(w)r(aiting)s Fi(j)22 b Fj(=3D)h Fi(j)p Fm(shar)r(ed)p Fi(j)17 b Fq(in)m(v)n(ariant.)191 1564 y Fg(2)191 1722 y Fr(Lemma)k(3.)41 b Fn(The)30 b(maximum)f(number)g(of)i Fm(O)r(K)36 b Fn(messa)o(g)o(es)31 b(r)m(eceived)f(by)g(coor)m(dinator) e Fm(I)38 b Fn(befor)m(e)29 b(leaving)g(state)191 1822 y Fm(LO)r(C)6 b(K)g(I)h(N)i(G)21 b Fn(is)g Fm(\021)780 1792 y Fh(max)777 1845 y(O)r(K)940 1822 y Fj(=3D)h Fi(j)p Fm(shar)r(ed)p Fi(j)d(\000)f Fj(1)p Fn(.)191 1980 y(Pr)l(oof)o(.)40 b Fq(According)35 b(to)h(lemmas)g(1)h(and)f(2,)g(we)h(can)f(infer)f (that)i Fm(\021)2238 1992 y Fh(O)r(K)2385 1980 y Fj(+)30 b(1)g(+)g Fi(j)p Fm(w)r(aiting)s Fi(j)52 b Fj(=3D)g Fi(j)p Fm(shar)r(ed)p Fi(j)p Fq(,)37 b(so)191 2080 y Fm(\021)232 2092 y Fh(O)r(K)405 2080 y Fj(=3D)56 b Fi(j)p Fm(shar)r(ed)p Fi(j)32 b(\000)f(j)p Fm(w)r(aiting)s Fi(j)g(\000)h Fj(1)p Fq(.)38 b(Gi)n(v)o(en)f(that)i Fm(shar)r(ed)g Fq(does)f(not)f(change)g (in)i(state)g Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(,)191 2179 y Fm(\021)232 2191 y Fh(O)r(K)381 2179 y Fq(reaches)31 b(its)i(maximum)e(v)n(alue)g(when)g Fm(w)r(aiting)48 b Fj(=3D)c Fi(;)32 b Fq(and)g Fm(I)39 b Fq(lea)n(v)o(es)32 b(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(.)32 b(Therefore,)191 2279 y Fm(\021)232 2291 y Fh(O)r(K)372 2279 y Fj(=3D)22 b Fi(j)p Fm(shar)r(ed)p Fi(j)d(\000)f Fj(1)i Fq(in)h(this)f(situation.) g Fg(2)191 2437 y Fr(Lemma)h(4.)41 b Fn(Let)25 b Fm(<)g Fn(be)g(an)g(or)m(der)g(o)o(ver)g(the)g(participants)f(of)h(our)g (system,)g(and)f(let)i Fm(I)33 b Fn(be)25 b(a)g(coor)m(dinator)e(whose) 191 2537 y(set)e(of)g(shar)m(ed)f(participants)g(is)i Fi(f)p Fm(P)1229 2549 y Fl(1)1266 2537 y Fm(;)14 b(P)1356 2549 y Fl(2)1393 2537 y Fm(;)g(:)g(:)g(:)g(;)g(P)1631 2549 y Fh(k)1672 2537 y Fi(g)21 b Fj(\()p Fm(k)27 b Fi(\025)c Fj(1\))p Fn(.)e(W)-5 b(ithout)21 b(loss)g(of)g(g)o(ener)o(ality)-5 b(,)20 b(we)h(can)f(assume)h(that)191 2636 y Fm(P)244 2648 y Fl(1)305 2636 y Fm(<)h(P)445 2648 y Fl(2)506 2636 y Fm(<)g Fi(\001)14 b(\001)g(\001)23 b Fm(<)g(P)854 2648 y Fh(k)895 2636 y Fn(.)e(In)f(this)g(conte)n(xt,)g(if)h Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)1882 2648 y Fh(i)1910 2636 y Fj(\))p Fn(,)21 b(then)f Fi(8)p Fj(1)h Fi(\024)i Fm(j)28 b(<)22 b(i)d Fi(\001)f Fm(l)r(ock)s(s)p Fj(\()p Fm(I)7 b(;)14 b(P)2937 2648 y Fh(j)2972 2636 y Fj(\))p Fn(.)191 2794 y(Pr)l(oof)o(.)40 b Fm(LO)r(C)6 b(K)38 b Fq(messages)32 b(are)g(sent)g(out)f(during)f(transitions)h(5)h(and)f (6.)h(In)f(the)h(former)e(case,)i(the)g(recipient)191 2894 y(is)g(the)f(smallest)h(participant)e(in)i(set)g Fm(w)r(aiting)s Fq(.)e(Notice)h(that)h(each)f(time)g(an)g Fm(O)r(F)12 b(F)g(E)5 b(R)33 b Fq(message)e(is)h(recei)n(v)o(ed)191 2993 y(in)e(state)g Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(,)30 b(its)h(sender)e(is)h(added)f(to)h(set)g Fm(shar)r(ed)p Fq(.)h(Thus,)e(when)g(coordinator)e Fm(I)37 b Fq(lea)n(v)o(es)30 b(state)191 3093 y Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)23 b Fq(during)d(transition)i(5,)g(the)g(smallest)h (participant)e(in)i(set)g Fm(shar)r(ed)g Fq(\()p Fm(P)2799 3105 y Fl(1)2836 3093 y Fq(\))g(is)g(set)g(as)g(the)g Fm(cur)r(r)r(ent)191 3193 y Fq(participant,)29 b(and)i(a)h Fm(LO)r(C)6 b(K)37 b Fq(message)31 b(is)h(sent)f(to)h(it.)f(The)g(rest) h(of)f(the)g(participants)f(in)h(the)g(set)h Fm(shar)r(ed)g Fq(are)191 3292 y(stored)j(in)h(the)g(set)h Fm(w)r(aiting)s Fq(.)e(Therefore,)f(when)h(coordinator)e Fm(I)43 b Fq(enters)36 b(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)36 b Fq(after)f(lea)n(ving)191 3392 y(state)j Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(,)36 b(this)i(lemma)e(holds)g(because)h(before)e(recei)n(ving)g(an)i (answer)g(from)e Fm(P)3178 3404 y Fl(1)3216 3392 y Fq(,)i(predicate)191 3492 y Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)559 3504 y Fl(1)597 3492 y Fj(\))21 b Fq(holds)e(and)h(there)g(is)h(not)f(a)g (participant)f Fm(P)1867 3504 y Fl(0)1925 3492 y Fq(such)h(that)g Fm(P)2296 3504 y Fl(0)2357 3492 y Fm(<)j(P)2498 3504 y Fl(1)2535 3492 y Fq(,)e(i.e.,)f Fi(8)p Fj(1)h Fi(\024)i Fm(j)28 b(<)23 b Fj(1)17 b Fi(\001)i Fm(bl)r(ock)s Fj(\()p Fm(I)7 b(;)14 b(P)3519 3504 y Fh(i)3546 3492 y Fj(\))191 3591 y Fq(holds.)274 3694 y(In)25 b(the)h(latter)f(case,)h(the)g (recipient)e(is)j(also)e(the)h(smallest)g(participant)e(in)i(set)g Fm(w)r(aiting)s Fq(,)f(b)n(ut)h(notice)f(that)g(each)191 3793 y(time)e(transition)e(5)i(or)f(transition)g(6)h(are)f(e)o(x)o (ecuted,)f(the)h(smallest)i(participant)d(in)i(set)g Fm(w)r(aiting)i Fq(is)f(remo)o(v)o(ed)c(from)191 3893 y(it.)i(Also)h(notice)e(that)i(a)f(ne)n(w)g Fm(LO)r(C)6 b(K)28 b Fq(message)22 b(is)h(not)f(sent)g(unless)g(an)g Fm(O)r(K)29 b Fq(message)22 b(has)g(been)f(recei)n(v)o(ed)g(from)191 3993 y(the)27 b(participant)e(that)i(w)o(as)h(sent)f(the)g(pre)n(vious) e Fm(LO)r(C)6 b(K)33 b Fq(message.)26 b(Let)h Fm(P)2422 4005 y Fh(i)2478 3993 y Fq(be)f(the)h(smallest)h(participant)d(in)i (set)191 4092 y Fm(w)r(aiting)k Fq(before)d(transition)g(6)g(is)i(e)o (x)o(ecuted.)c(Consequently)-5 b(,)27 b(on)h(reception)f(of)i(an)f Fm(O)r(K)35 b Fq(message,)29 b(if)g(there)f(is)191 4192 y(at)c(least)g(one)f(participant)f(in)i(set)g Fm(w)r(aiting)s Fq(,)f(coordinator)e Fm(I)31 b Fq(sends)23 b(a)h(ne)n(w)g Fm(LO)r(C)6 b(K)30 b Fq(message)23 b(and)g Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)3518 4204 y Fh(i)3546 4192 y Fj(\))191 4292 y Fq(holds)19 b(until)f(it)i(recei)n(v)o(es)f(an)g (answer)f(from)g Fm(P)1503 4304 y Fh(i)1531 4292 y Fq(,)i(as)g(well)f (as)h Fm(l)r(ock)s(s)p Fj(\()p Fm(I)7 b(;)14 b(P)2265 4304 y Fl(1)2302 4292 y Fj(\))p Fm(;)g(l)r(ock)s(s)p Fj(\()p Fm(I)7 b(;)14 b(P)2724 4304 y Fl(2)2761 4292 y Fj(\))p Fm(;)g(:)g(:)g(:)g(;)g(l)r(ock)s(s)p Fj(\()p Fm(I)7 b(;)14 b(P)3331 4304 y Fh(i)p Ff(\000)p Fl(1)3444 4292 y Fj(\))p Fq(.)19 b Fg(2)191 4450 y Fr(Lemma)i(5.)41 b Fn(Let)j Fm(P)56 b Fn(be)43 b(a)h(participant)e(that)h(has)g(of)o (fer)m(ed)g(participation)f(to)h(a)h(number)f(of)g(coor)m(dinator)o(s) 191 4549 y Fi(f)p Fm(I)269 4561 y Fl(1)306 4549 y Fm(;)14 b(I)379 4561 y Fl(2)417 4549 y Fm(;)g(:)g(:)g(:)f(;)h(I)637 4561 y Fh(n)683 4549 y Fi(g)31 b Fj(\()p Fm(n)43 b Fi(\025)f Fj(1\))31 b Fn(and)f(r)m(eceives)h(its)h(\002r)o(st)g Fm(LO)r(C)6 b(K)37 b Fn(messa)o(g)o(e)31 b(since)g(it)h(left)f(state)g Fm(AC)6 b(T)12 b(I)7 b(V)19 b(E)36 b Fn(fr)l(om)191 4649 y(coor)m(dinator)18 b Fm(I)641 4661 y Fh(i)690 4649 y Fj(\(1)23 b Fi(\024)g Fm(i)f Fi(\024)h Fm(n)p Fj(\))p Fn(.)e(In)f(this)g(conte)n(xt,)g Fm(P)32 b Fn(shall)21 b(e)o(ventually)d(send)i(an)g Fm(O)r(K)27 b Fn(messa)o(g)o(e)20 b(to)h Fm(I)3138 4661 y Fh(i)3166 4649 y Fn(.)191 4807 y(Pr)l(oof)o(.)40 b Fq(This)17 b(lemma)f(follo)n(ws)f(directly)h(from)f (transition)g(3.)i(If)f(participant)f Fm(P)28 b Fq(is)17 b(willing)f(to)h(participate)e(in)h(se)n(v)o(eral)191 4907 y(interactions,)k(it)i(has)f(reached)f(state)i Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)21 b Fq(in)g(transition)g(1,)g(and)f(it)i (k)o(eeps)f(in)g(that)h(state)g(until)f(it)h(recei)n(v)o(es)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.) 1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 14 14 14 13 bop 191 299 a Fq(14)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(a)26 b Fm(LO)r(C)6 b(K)31 b Fq(message)26 b(from)e(a)i (coordinator)-5 b(.)22 b(Let)k(this)g(coordinator)c(be)k Fm(I)2357 618 y Fh(i)2411 606 y Fj(\(1)32 b Fi(\024)g Fm(i)g Fi(\024)g Fm(n)p Fj(\))p Fq(.)26 b(On)f(reception)f(of)h(this) 191 706 y(message,)f Fm(P)36 b Fq(lea)n(v)o(es)24 b(state)h Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)24 b Fq(immediately)e(and)i(sends)g (an)g Fm(O)r(K)31 b Fq(message)23 b(to)i Fm(I)2971 718 y Fh(i)3023 706 y Fq(during)e(transition)191 805 y(3.)d(Consequently)-5 b(,)18 b Fm(P)32 b Fq(e)n(v)o(entually)19 b(replies,)g(and)h Fm(I)1655 817 y Fh(i)1704 805 y Fq(shall)h(e)n(v)o(entually)d(get)i(an) g Fm(O)r(K)27 b Fq(message.)20 b Fg(2)191 969 y Fr(Lemma)h(6.)41 b Fn(Let)28 b Fm(I)35 b Fn(be)27 b(a)h(coor)m(dinator)d(that)j(sends)f (a)h Fm(LO)r(C)6 b(K)34 b Fn(messa)o(g)o(e)27 b(to)h(participant)e Fm(P)12 b Fn(,)28 b(and)e(let)i Fm(<)g Fn(be)f(an)191 1069 y(or)m(der)22 b(o)o(ver)f(the)h(set)g(of)g(participants)f(of)h (our)f(system.)h(In)g(this)g(conte)n(xt,)f(coor)m(dinator)f Fm(I)29 b Fn(shall)21 b(e)o(ventually)g(r)m(eceive)191 1169 y(a)f Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)25 b Fn(or)c(an)e Fm(O)r(K)27 b Fn(messa)o(g)o(e)21 b(fr)l(om)g Fm(P)12 b Fn(.)191 1333 y(Pr)l(oof)o(.)40 b Fq(Gi)n(v)o(en)i(that)h(we)g(are)f (assuming)g(that)h(the)g(underlying)d(netw)o(ork)h(is)i(reliable)g(and) f(e)n(v)o(ery)f(message)191 1432 y(e)n(v)o(entually)30 b(reaches)h(its)i(recipient,)d(if)i(coordinator)e Fm(I)39 b Fq(does)31 b(not)h(recei)n(v)o(e)f(an)g(answer)h(from)e Fm(P)45 b Fq(after)31 b(sending)191 1532 y(it)d(a)g Fm(LO)r(C)6 b(K)33 b Fq(message,)27 b(it)h(implies)g(that)f Fm(P)40 b Fq(has)27 b(recei)n(v)o(ed)f(this)i(message)f(whilst)h(it)g(w)o(as)g (in)f(state)h Fm(LO)r(C)6 b(K)g(E)f(D)191 1632 y Fq(and)32 b(remains)g(in)h(that)g(state)h(eternally)-5 b(,)31 b(i.e,)i(it)g(does) g(not)f(recei)n(v)o(e)g(an)o(y)g Fm(U)9 b(N)g(LO)r(C)d(K)39 b Fq(messages.)33 b(\(Otherwise,)191 1731 y(lemma)19 b(5)h(guarantees)e(that)i(a)g(participant)f(in)g(state)i Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)19 b Fq(replies)h(in)g(\002nite)g (time.\))f(W)-7 b(e)21 b(pro)o(v)o(e)d(that)i(this)g(is)191 1831 y(impossible)g(by)f Fn(r)m(eductio)h(ad)f(absur)m(dum)p Fq(.)274 1935 y(If)30 b Fm(P)42 b Fq(does)30 b(not)g(answer)f(in)i (\002nite)f(time,)g(then)f(there)h(must)g(be)g(a)h(coordinator)c Fm(I)2724 1947 y Fl(1)2792 1935 y Fq(such)j(that)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)3386 1947 y Fl(1)3423 1935 y Fm(;)14 b(P)e Fj(\))p Fq(.)191 2035 y(If)28 b Fm(I)311 2047 y Fl(1)377 2035 y Fq(does)f(not)g(release)h(its)h(lock)e(in)h(\002nite)g(time,)g (that)g(implies)g(that)f(there)h(e)o(xists)g(a)g(participant)e Fm(P)3207 2047 y Fl(1)3273 2035 y Fq(such)i(that)191 2135 y Fm(w)r(aits)p Fj(\()p Fm(I)462 2147 y Fl(1)500 2135 y Fm(;)14 b(P)590 2147 y Fl(1)627 2135 y Fj(\))p Fq(,)27 b(and)f Fm(P)907 2147 y Fl(1)971 2135 y Fq(does)g(not)g(send)g (an)h(answer)f(to)g Fm(I)1957 2147 y Fl(1)2021 2135 y Fq(in)h(\002nite)f(time.)h(Consequently)-5 b(,)23 b(we)k(can)f(infer)g (that)191 2234 y(there)d(e)o(xists)h(a)f(coordinator)e Fm(I)1096 2246 y Fl(2)1158 2234 y Fq(and)h(a)i(participant)e Fm(P)1794 2246 y Fl(2)1856 2234 y Fq(such)h(that)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2436 2246 y Fl(2)2474 2234 y Fm(;)14 b(P)2564 2246 y Fl(1)2601 2234 y Fj(\))24 b Fq(and)f Fm(w)r(aits)p Fj(\()p Fm(I)3072 2246 y Fl(2)3110 2234 y Fm(;)14 b(P)3200 2246 y Fl(2)3238 2234 y Fj(\))p Fq(.)24 b(In)f(other)191 2334 y(w)o(ords,)d(there)f(is)i(an)g(in\002nite)f(w)o(ait)g(chain)g(of) g(the)g(follo)n(wing)f(form:)1378 2593 y Fm(w)r(aits)p Fj(\()p Fm(I)7 b(;)14 b(P)e Fj(\))19 b Fi(^)f Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2138 2605 y Fl(1)2176 2593 y Fm(;)c(P)e Fj(\))18 b Fi(^)1239 2692 y(^)84 b Fm(w)r(aits)p Fj(\()p Fm(I)1649 2704 y Fl(1)1687 2692 y Fm(;)14 b(P)1777 2704 y Fl(1)1814 2692 y Fj(\))19 b Fi(^)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2195 2704 y Fl(2)2232 2692 y Fm(;)14 b(P)2322 2704 y Fl(1)2360 2692 y Fj(\))k Fi(^)1239 2792 y(^)84 b Fm(w)r(aits)p Fj(\()p Fm(I)1649 2804 y Fl(2)1687 2792 y Fm(;)14 b(P)1777 2804 y Fl(2)1814 2792 y Fj(\))19 b Fi(^)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2195 2804 y Fl(3)2232 2792 y Fm(;)14 b(P)2322 2804 y Fl(2)2360 2792 y Fj(\))k Fi(^)1239 2892 y(^)84 b Fm(:)14 b(:)g(:)1239 2991 y Fi(^)84 b Fm(w)r(aits)p Fj(\()p Fm(I)1649 3003 y Fh(i)1677 2991 y Fm(;)14 b(P)1767 3003 y Fh(i)1795 2991 y Fj(\))19 b Fi(^)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2176 3003 y Fh(i)p Fl(+1)2287 2991 y Fm(;)14 b(P)2377 3003 y Fh(i)2405 2991 y Fj(\))19 b Fi(^)1239 3091 y(^)84 b Fm(:)14 b(:)g(:)274 3267 y Fq(Gi)n(v)o(en)23 b(that)h(the)g(number)e(of)h(coordinators)f (and)h(participants)g(in)h(a)g(system)g(is)h(\002nite,)f(this)g (sequence)f(must)h(be)191 3366 y(circular)m(,)c(i.e,)h(the)g(must)h(e)o (xist)f(a)h Fm(k)28 b Fi(\025)c Fm(i)e Fq(such)f(that)g Fm(w)r(aits)p Fj(\()p Fm(I)1952 3378 y Fh(k)1994 3366 y Fm(;)14 b(P)e Fj(\))19 b Fi(^)h Fm(l)r(ock)s(s)p Fj(\()p Fm(I)2478 3378 y Fh(k)2519 3366 y Fm(;)14 b(P)2609 3378 y Fh(k)q Ff(\000)p Fl(1)2735 3366 y Fj(\))p Fq(.)21 b(According)f(to)h (lemma)g(4,)191 3466 y(we)g(can)e(infer)h(the)g(follo)n(wing)f (properties:)1063 3725 y Fm(w)r(aits)p Fj(\()p Fm(I)1334 3737 y Fl(1)1372 3725 y Fm(;)14 b(P)1462 3737 y Fl(1)1499 3725 y Fj(\))19 b Fi(^)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)1880 3737 y Fl(1)1917 3725 y Fm(;)14 b(P)e Fj(\))p Fq(,)20 b(then)g Fm(P)35 b(<)23 b(P)2485 3737 y Fl(1)1063 3824 y Fm(w)r(aits)p Fj(\()p Fm(I)1334 3836 y Fl(2)1372 3824 y Fm(;)14 b(P)1462 3836 y Fl(2)1499 3824 y Fj(\))19 b Fi(^)g Fm(l)r(ock)s(s)p Fj(\()p Fm(I)1880 3836 y Fl(2)1917 3824 y Fm(;)14 b(P)2007 3836 y Fl(1)2044 3824 y Fj(\))p Fq(,)21 b(then)f Fm(P)2335 3836 y Fl(1)2396 3824 y Fm(<)i(P)2536 3836 y Fl(2)1063 3924 y Fm(:)14 b(:)g(:)1063 4024 y(w)r(aits)p Fj(\()p Fm(I)1334 4036 y Fh(k)1375 4024 y Fm(;)g(P)e Fj(\))19 b Fi(^)f Fm(l)r(ock)s(s)p Fj(\()p Fm(I)1857 4036 y Fh(k)1898 4024 y Fm(;)c(P)1988 4036 y Fh(k)q Ff(\000)p Fl(1)2114 4024 y Fj(\))p Fq(,)21 b(then)f Fm(P)2405 4036 y Fh(k)q Ff(\000)p Fl(1)2554 4024 y Fm(<)j(P)274 4199 y Fq(This)g(is)g(absurd)e(because)h(we)g(assume)h(that)f Fm(<)h Fq(is)g(an)f(order)f(amongst)h(the)g(participants)f(of)i(our)e (system.)h(Thus,)191 4299 y(there)e(cannot)f(e)o(xists)h(a)h Fm(P)33 b Fq(such)20 b(that)g Fm(P)35 b(<)22 b(P)12 b Fq(.)21 b Fg(2)191 4513 y Fr(Exclusion)g(pr)o(operty)191 4707 y(Theor)o(em)f(1.)41 b Fn(Let)22 b Fi(f)p Fm(I)843 4719 y Fl(1)880 4707 y Fm(;)14 b(I)953 4719 y Fl(2)991 4707 y Fm(;)g(:)g(:)g(:)f(;)h(I)1211 4719 y Fh(n)1257 4707 y Fi(g)21 b Fn(be)g(a)h(set)g(of)f(con\003icting)e(coor)m(dinator) o(s,)h(and)g(let)i Fi(f)p Fm(P)2870 4719 y Fl(1)2907 4707 y Fm(;)14 b(P)2997 4719 y Fl(2)3035 4707 y Fm(;)g(:)g(:)g(:)f(;)h (P)3272 4719 y Fh(k)3313 4707 y Fi(g)22 b Fn(be)f(the)191 4807 y(set)k(of)f(participants)f(that)h(ar)m(e)g(inter)m(ested)g(in)g (the)g(inter)o(actions)f(the)n(y)h(mana)o(g)o(e)o(.)e Fm(\013)p Fn(\226cor)m(e)i(guar)o(antees)e(that)i(for)h(all)191 4907 y Fj(1)e Fi(\024)f Fm(i;)14 b(j)28 b Fi(\024)22 b Fm(n;)14 b(i)23 b Fi(6)p Fj(=3D)f Fm(j)5 b Fn(,)21 b Fm(I)901 4919 y Fh(i)950 4907 y Fn(and)e Fm(I)1131 4919 y Fh(j)1187 4907 y Fn(cannot)g(e)n(xecute)h(simultaneously)-5 b(.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f (Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 15 15 15 14 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(15)p 191 473 3388 5 v 191 606 a Fn(Pr)l(oof)o(.)40 b Fq(In)19 b(short,)f(what)h(we)g(ha)n (v)o(e)f(to)h(pro)o(v)o(e)e(is)j(that)f(if)g(coordinator)d Fm(I)2219 618 y Fh(i)2266 606 y Fq(\002nds)j(itself)h(enabled,)d (succeeds)h(in)h(locking)191 706 y(its)31 b(shared)e(participants)g (and)h(e)o(x)o(ecutes)f(transition)g(7,)h(another)e(enabled,)h (con\003icting)g(coordinator)e Fm(I)3291 718 y Fh(j)3357 706 y Fq(cannot)191 805 y(e)o(x)o(ecute)18 b(this)i(transition)f (simultaneously)-5 b(.)18 b(W)-7 b(e)21 b(pro)o(v)o(e)c(that)j(this)g (cannot)f(be)h(possible)f(by)g Fn(r)m(eductio)g(ad)g(absur)m(dum)p Fq(.)274 923 y(Let)24 b Fm(S)29 b Fq(be)24 b(the)g(set)h(of)e (participants)g(shared)g(between)g Fm(I)1918 935 y Fh(i)1971 923 y Fq(and)g Fm(I)2151 935 y Fh(j)2187 923 y Fq(.)h(If)g(both)f (coordinators)e(e)o(x)o(ecute)i(transition)g(7)191 1023 y(simultaneously)-5 b(,)21 b(e)n(v)o(ery)h(shared)h(participant)f(in)i Fm(S)29 b Fq(must)23 b(ha)n(v)o(e)g(sent)h(an)f Fm(O)r(K)30 b Fq(message)24 b(to)f(both)g Fm(I)3118 1035 y Fh(i)3170 1023 y Fq(and)g Fm(I)3350 1035 y Fh(j)3386 1023 y Fq(.)h(This)191 1123 y(is)h(not)e(possible)g(because)g(a)h(participant)e Fm(P)36 b Fq(cannot)23 b(dispatch)g(tw)o(o)h(messages)f(at)h(the)g (same)g(time.)f(Furthermore,)191 1222 y(we)k(can)f(assume)g(that)h(the) f Fm(LO)r(C)6 b(K)33 b Fq(message)27 b(from)e Fm(I)1832 1234 y Fh(i)1887 1222 y Fq(is)j(dispatched)d(before)g(the)h Fm(LO)r(C)6 b(K)33 b Fq(message)26 b(from)g Fm(I)3543 1234 y Fh(j)191 1322 y Fq(without)19 b(loss)i(of)f(generality)-5 b(.)274 1440 y(No)n(w)g(,)30 b(we)g(can)h(sort)f(out)g(tw)o(o)h(cases.) g(On)f(the)g(one)g(hand,)f(if)i Fm(P)43 b Fq(had)30 b(been)f(in)i (state)g Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)30 b Fq(when)g(it)191 1540 y(recei)n(v)o(ed)25 b(this)i(message,)g(it)g(w)o(ould)f(ha)n(v)o (e)h(left)g(this)g(state,)g(it)h(w)o(ould)e(ha)n(v)o(e)g(sent)h(an)g Fm(O)r(K)33 b Fq(message)27 b(to)g Fm(I)3309 1552 y Fh(i)3337 1540 y Fq(,)g(and)f(it)191 1639 y(w)o(ould)g(ha)n(v)o(e)g(dispatched)f (the)i Fm(LO)r(C)6 b(K)33 b Fq(message)26 b(from)g Fm(I)1941 1651 y Fh(j)2004 1639 y Fq(in)g(state)i Fm(LO)r(C)6 b(K)g(E)f(D)r Fq(.)27 b(In)f(this)h(state,)g(this)g Fm(LO)r(C)6 b(K)191 1739 y Fq(w)o(ould)25 b(not)h(ha)n(v)o(e)g(been)g(answered)f(with)h(an) h Fm(O)r(K)33 b Fq(message)26 b(unless)g Fm(I)2289 1751 y Fh(i)2344 1739 y Fq(had)g(unlock)o(ed)e Fm(P)12 b Fq(,)26 b(b)n(ut,)g(in)h(this)g(case,)f Fm(I)3550 1751 y Fh(i)191 1838 y Fq(w)o(ould)19 b(ha)n(v)o(e)h(not)g(e)o(x)o(ecuted,)e(which)i (contradicts)f(our)g(hypothesis.)274 1957 y(On)25 b(the)f(other)g (hand,)f(if)i Fm(P)37 b Fq(had)24 b(been)g(in)g(state)i Fm(LO)r(C)6 b(K)g(E)f(D)27 b Fq(when)d(it)h(recei)n(v)o(ed)e(the)i Fm(LO)r(C)6 b(K)30 b Fq(message)25 b(from)191 2056 y Fm(I)227 2068 y Fh(i)255 2056 y Fq(,)e(the)f(answer)g(w)o(ould)g(ha)n (v)o(e)g(been)f(delayed)g(until)h(the)h(current)e(lock)o(er)g(w)o(ould) h(ha)n(v)o(e)g(released)g(its)h(lock,)f(being)f(it)191 2156 y(because)k(of)g(a)h Fm(S)5 b(T)12 b(AR)q(T)36 b Fq(message)26 b(or)f(an)h Fm(U)9 b(N)g(LO)r(C)d(K)32 b Fq(message.)25 b(In)g(the)h(former)e(case,)i(participant)e Fm(P)39 b Fq(w)o(ould)191 2255 y(ha)n(v)o(e)22 b(sent)h Fm(I)561 2267 y Fh(i)613 2255 y Fq(and)f Fm(I)792 2267 y Fh(j)851 2255 y Fq(a)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)28 b Fq(message,)22 b(which)h(contradicts)f(the)g(hypothesis)g(because)g Fm(I)3082 2267 y Fh(i)3133 2255 y Fq(and)h Fm(I)3313 2267 y Fh(j)3372 2255 y Fq(w)o(ould)191 2355 y(not)18 b(ha)n(v)o(e)g(been)g(able)g(to)h(e)o(x)o(ecute)e(in)h(this)h(case.)g (In)f(the)h(latter)f(case,)h Fm(P)31 b Fq(w)o(ould)18 b(ha)n(v)o(e)f(selected)i(another)e(prospecti)n(v)o(e)191 2455 y(winner)23 b(coordinator)-5 b(.)21 b(If)j(neither)f Fm(I)1240 2467 y Fh(i)1292 2455 y Fq(nor)h Fm(I)1464 2467 y Fh(j)1523 2455 y Fq(had)g(been)f(selected,)g(the)h(situation)g (w)o(ould)f(ha)n(v)o(e)g(been)g(the)h(same)g(as)191 2554 y(the)j(one)g(described)f(in)h(the)g(pre)n(vious)f(scenario.)g(If)h Fm(I)1791 2566 y Fh(i)1846 2554 y Fq(had)g(been)g(selected,)f(it)i(w)o (ould)f(ha)n(v)o(e)f(been)h(sent)g(an)g Fm(O)r(K)191 2654 y Fq(message,)g(b)n(ut,)h(in)g(that)g(case,)g(when)f Fm(I)1357 2666 y Fh(i)1414 2654 y Fq(had)g(sent)h(an)g Fm(S)5 b(T)12 b(AR)q(T)38 b Fq(message,)27 b(recall)h(that)g(we)g(are)g (assuming)f(that)191 2754 y(both)i Fm(I)405 2766 y Fh(i)464 2754 y Fq(and)h Fm(I)651 2766 y Fh(j)717 2754 y Fq(e)o(x)o(ecute)e (simultaneously)-5 b(,)28 b Fm(P)43 b Fq(w)o(ould)29 b(ha)n(v)o(e)h(e)o(x)o(ecuted)e(transition)h(7)h(and)g(w)o(ould)f(ha)n (v)o(e)h(sent)g(a)191 2853 y Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)28 b Fq(message)23 b(to)h Fm(I)1027 2865 y Fh(j)1062 2853 y Fq(,)g(which)f(contradicts)f(our)h(hypothesis)f(because,)g(in)i(that) f(case,)h Fm(I)3004 2865 y Fh(j)3064 2853 y Fq(w)o(ould)e(not)h(ha)n(v) o(e)191 2953 y(e)o(x)o(ecuted.)18 b Fg(2)191 3207 y Fr(Pr)o(ogr)o(ess)h (pr)o(operty)191 3388 y(Theor)o(em)h(2.)41 b Fn(Let)19 b Fm(I)26 b Fn(be)18 b(a)g(coor)m(dinator)f(that)h(\002nds)f(itself)j (enabled.)c Fm(\013)p Fn(\226cor)m(e)i(guar)o(antees)f(that)h(it)h (shall)f(e)o(ventually)191 3488 y(become)h(disabled.)191 3693 y(Pr)l(oof)o(.)40 b Fq(An)d(enabled)f(coordinator)d(may)k(become)e (disabled)h(because)g(it)i(e)o(x)o(ecutes)d(in)i(mutual)f(e)o(xclusion) f(or)191 3792 y(because)19 b(one)h(of)g(its)h(participants)e(commits)h (to)h(another)d(interaction.)h(When)h(a)h(coordinator)c(\002nds)j (itself)h(enabled)191 3892 y(and)28 b(it)h(has)g(no)f(shared)f (participants)h(\(set)h Fm(shar)r(ed)g Fq(is)g(empty\))f(it)h (immediately)e(sends)h Fm(S)5 b(T)12 b(AR)q(T)39 b Fq(messages)29 b(to)191 3992 y(its)i(participants)d(and)i(then)f(becomes)g(disabled)g (\(transition)f(4\).)i(Otherwise,)f(if)h(the)g(enabled)f(coordinator)e (has)191 4091 y(shared)17 b(participants,)g(it)h(enters)g(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)18 b Fq(\(transition)f(5\),)g(and)g(it)i (remains)e(enabled)g(until)h(it)g(lea)n(v)o(es)g(this)191 4191 y(state,)j(being)e(it)h(because)g(it)h(recei)n(v)o(es)e(an)h Fm(O)r(K)27 b Fq(message)20 b(from)f(each)g(of)h(its)h(shared)f (participants)f(or)h(a)g Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 4290 y Fq(message.)20 b(Roughly)f(speaking,)f(we)j(need)e(to)i(pro)o(v) o(e)d(that)i Fm(\013)p Fq(\226core)g(does)g(not)g(deadlock.)274 4408 y(The)f(proof)e(follo)n(ws)h(directly)h(from)f(lemmas)g(3)h(and)g (6.)g(Each)f(time)h(coordinator)e Fm(I)26 b Fq(enters)19 b(state)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(,)191 4508 y(being)16 b(it)i(because)e(it)i(e)o(x)o(ecutes)e(transition)g(5)i(or)e (6,)h(it)h(sends)f(a)h Fm(LO)r(C)6 b(K)23 b Fq(message)17 b(to)g(a)h(shared)e(participant.)g(Lemma)191 4608 y(6)21 b(guarantees)e(that)h(coordinator)e Fm(I)28 b Fq(shall)21 b(recei)n(v)o(e)f(an)g(answer)g(in)h(\002nite)g(time.)f(Thus,)g(if)h (it)g(recei)n(v)o(es)f(a)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 4707 y Fq(message,)26 b(it)i(e)o(x)o(ecutes)e(transition)g(8)h(and)f (returns)g(to)h(state)g Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)28 b Fq(immediately;)d(if)i(it)h(recei)n(v)o(es)e(an)191 4807 y Fm(O)r(K)e Fq(message,)17 b(it)i(remains)e(in)g(state)i Fm(LO)r(C)6 b(K)g(I)h(N)i(G)p Fq(,)18 b(b)n(ut)f(this)h(cannot)f (happen)f(more)g(than)i Fm(\021)2909 4777 y Fh(max)2906 4830 y(O)r(K)3069 4807 y Fj(=3D)k Fi(j)p Fm(shar)r(ed)p Fi(j)9 b(\000)g Fj(1)191 4907 y Fq(times)21 b(according)d(to)i(lemma)g (3.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)c FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f (Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 16 16 16 15 bop 191 299 a Fq(16)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 274 606 a Fq(Therefore,)39 b(once)i(coordinator)d Fm(I)49 b Fq(\002nds)41 b(itself)h(enabled)e(and)h(enters)g(the)h Fm(LO)r(C)6 b(K)g(I)h(N)i(G)42 b Fq(state,)f(it)h(shall)191 706 y(e)n(v)o(entually)18 b(abandon)g(this)j(state)g(and)f(shall)g (thus)g(become)f(disabled)h(in)g(a)h(\002nite)f(time.)g Fg(2)191 928 y Fr(Synchr)o(onisation)f(pr)o(operty)191 1120 y(Theor)o(em)h(3.)41 b Fm(\013)p Fn(\226cor)m(e)29 b(guar)o(antees)e(that)h(if)i(participant)d Fm(P)41 b Fn(e)n(xecutes)29 b(inter)o(action)f Fm(I)7 b Fn(,)29 b(then)f(all)i(of)f(the)f(entities)191 1219 y(participating)18 b(in)j(this)f(inter)o(action)f(e)n(xecute)h(it.)191 1392 y(Pr)l(oof)o(.)40 b Fq(If)26 b(participant)f Fm(P)39 b Fq(e)o(x)o(ecutes)25 b(interaction)g Fm(I)7 b Fq(,)26 b(the)h(reason)e(is)i(that)g(is)g(has)f(recei)n(v)o(ed)f(a)h Fm(S)5 b(T)12 b(AR)q(T)37 b Fq(message)191 1492 y(from)17 b(coordinator)e Fm(I)7 b Fq(.)19 b(This)f(coordinator)d(sent)j(this)h (message)f(whilst)g(it)h(w)o(as)g(e)o(x)o(ecuting)d(transition)h(7)h (or)g(transition)191 1591 y(4,)i(and)g(it)h(sent)f(the)g(same)h (message)f(to)g(e)n(v)o(ery)f(participant)g(in)h(set)h Fm(l)r(ock)s(ed)p Fq(.)274 1699 y(Whilst)47 b(coordinator)d Fm(I)54 b Fq(is)47 b(in)g(state)g Fm(AC)6 b(C)g(E)f(P)12 b(T)g(I)7 b(N)i(G)p Fq(,)47 b(it)g(stores)f(each)g(participant)f(that)i (sends)f(it)h(a)191 1798 y Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)32 b Fq(message)c(in)h(set)g Fm(l)r(ock)s(ed)p Fq(,)f(and)g(each)g(participant)f(that)h(sends)h(it)g(an)f Fm(O)r(F)12 b(F)g(E)5 b(R)30 b Fq(message)191 1898 y(set)20 b Fm(shar)r(ed)p Fq(.)g(On)g(reception)e(of)h(the)g Fm(n)1307 1868 y Fh(th)1395 1898 y Fm(O)r(F)12 b(F)g(E)5 b(R)22 b Fq(or)d Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)23 b Fq(message,)c(being)g Fm(n)h Fq(the)f(cardinality)191 1998 y(of)32 b(interaction)f Fm(I)7 b Fq(,)32 b(transition)f(4)i(can)f (be)g(e)o(x)o(ecuted)e(as)j(long)e(as)i(no)f(shared)f(participant)g(e)o (xists.)h(In)g(this)h(case,)191 2097 y Fm(l)r(ock)s(ed)20 b Fq(contains)f(the)h(whole)g(set)h(of)f(participants)f(in)h (interaction)f Fm(I)7 b Fq(,)20 b(and)g(the)o(y)f(are)h(sent)g(a)h Fm(S)5 b(T)12 b(AR)q(T)30 b Fq(message.)20 b(If)191 2197 y(there)30 b(e)o(xists)g(at)h(least)g(a)f(shared)f(participant,)g (transition)g(5)h(is)h(e)o(x)o(ecuted)e(and,)g(after)h(a)g(number)e(of) i(transitions)191 2296 y(o)o(v)o(er)40 b(state)i Fm(LO)r(C)6 b(K)g(I)h(N)i(G)42 b Fq(\(possibly)f(none\),)e(transition)i(7)h(is)g (\002nally)f(e)o(x)o(ecuted.)f(Notice)h(that)h(each)f(time)191 2396 y(transition)29 b(6)g(is)i(e)o(x)o(ecuted,)c(the)i(participant)g (that)g(has)h(just)g(been)f(lock)o(ed)f(is)j(added)d(to)i(set)g Fm(l)r(ock)s(ed)f Fq(and)g(a)h(ne)n(w)191 2496 y(participant)17 b(is)j(remo)o(v)o(ed)c(from)h(set)j Fm(w)r(aiting)h Fq(and)d(assigned)g (to)h Fm(cur)r(r)r(ent)p Fq(.)g(Thus,)f(when)g(transition)g(7)g(is)i(e) o(x)o(ecuted,)191 2595 y Fm(w)r(aiting)35 b Fj(=3D)d Fi(;)25 b Fq(and)g Fm(l)r(ock)s(ed)g Fq(contains)f(the)i(whole)e(set)i(of)f (shared)g(participants)f(e)o(xcept)g(for)h Fm(cur)r(r)r(ent)p Fq(,)h(which)f(is)191 2695 y(added)19 b(immediately)g(before)g(the)h Fm(S)5 b(T)12 b(AR)q(T)30 b Fq(messages)21 b(are)f(sent)g(out.)274 2802 y(Consequently)-5 b(,)25 b(if)j(participant)f Fm(P)40 b Fq(recei)n(v)o(es)27 b(a)h Fm(S)5 b(T)12 b(AR)q(T)39 b Fq(message)27 b(and)g(e)o(x)o(ecutes)g(interaction)g Fm(I)7 b Fq(,)28 b(all)g(of)g(the)191 2902 y(participants)d(interested) h(in)g Fm(I)34 b Fq(shall)26 b(e)n(v)o(entually)e(recei)n(v)o(e)h(a)i Fm(S)5 b(T)12 b(AR)q(T)36 b Fq(message)26 b(and)g(e)o(x)o(ecute)f(this) h(interaction,)191 3002 y(too.)20 b Fg(2)191 3224 y Fr(Idleness)i(pr)o (operty)191 3416 y(Theor)o(em)e(4.)41 b Fm(\013)p Fn(\226cor)m(e)27 b(guar)o(antees)e(that)i(a)h(participant)e(can)g(commit)h(to)h(an)f (inter)o(action)e(as)j(long)e(as)i(it)g(is)g(not)191 3515 y(doing)19 b(local)h(computation.)191 3688 y(Pr)l(oof)o(.)40 b Fq(Although)19 b(pro)o(ving)f(this)j(property)e(may)h(be)g(quite)g (subtle)h(in)f(other)g(algorithms,)f(it)i(is)h(straightforw)o(ard)c(in) 191 3787 y(our)j(case.)i(A)f(participant)f(can)h(do)g(its)h(local)f (computation)e(whilst)i(it)h(is)g(in)g(state)f Fm(AC)6 b(T)12 b(I)7 b(V)19 b(E)5 b Fq(.)22 b(On)h(completing)d(its)191 3887 y(local)i(acti)n(vities,)g(it)g(assigns)h(the)f(set)g(of)g (interactions)f(in)h(which)f(it)i(is)g(interested)e(to)h(set)g Fm(I)7 b(S)e Fq(,)22 b(and)g(transits)g(to)g(state)191 3987 y Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)24 b Fq(or)g Fm(LO)r(C)6 b(K)g(E)f(D)r Fq(.)24 b(A)h Fm(S)5 b(T)12 b(AR)q(T)35 b Fq(message)24 b(can)g(only)f(be)h(recei)n(v)o(ed)f(from)g (a)i(coordinator)c(in)j(which)191 4086 y(this)i(participant)e(w)o(as)i (interested,)e(and)h(this)h(message)f(must)g(be)g(recei)n(v)o(ed)f(in)i (state)g Fm(LO)r(C)6 b(K)g(E)f(D)r Fq(.)25 b(The)g(theorem)191 4186 y(follo)n(ws)19 b(from)g(the)h(f)o(act)h(that)f(a)g(participant)f (cannot)g(be)h(e)o(x)o(ecuting)d(local)j(computations)e(in)j(state)f Fm(AC)6 b(T)12 b(I)7 b(V)19 b(E)25 b Fq(and)191 4286 y(interacting)19 b(during)f(transition)i(7)g(simultaneously)-5 b(.)18 b Fg(2)191 4623 y Fr(COMP)-6 b(ARISON)191 4807 y Fq(Se)n(v)o(eral)24 b(solutions)f(to)i(implement)e(multiparty)g (interactions)g(ha)n(v)o(e)h(been)g(proposed)e(in)j(the)f(literature.)g (W)-7 b(e)25 b(ha)n(v)o(e)191 4907 y(found)f(a)h(v)n(ariety)g(of)g (centralised)f(and)h(distrib)n(uted)f(techniques)g(for)h(dealing)f (with)i(multiparty)d(synchronisation)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 17 17 17 16 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(17)p 191 473 3388 5 v 191 606 a(and)39 b(e)o(xclusion.)f(F)o(or)h(instance,)g (synchronisation)d(may)j(be)h(solv)o(ed)e(by)h(means)g(of)h(polling)e ([7)o(],)h(message\226)191 706 y(counts)25 b([1)o(],)h(or)g(auxiliary)e (resources)h(such)h(as)h(tok)o(ens)e([5)o(];)h(the)g(e)o(xclusion)f (problem)f(may)h(be)h(solv)o(ed)f(by)g(using)191 805 y(time)37 b(stamps,)g(auxiliary)f(resources)g([1)o(],)h(probabilistic)e (techniques)h([15)n(,)i(17)o(],)f(and)f(so)h(on.)g Fm(\013)p Fq(\226core)f(solv)o(es)191 905 y(synchronisation)22 b(by)i(means)g(of)h(message\226counts)d(and)j(e)o(xclusion)e(by)h (locking)f(participants)h(in)h(a)g(gi)n(v)o(en)e(order)-5 b(.)191 1005 y(This)26 b(idea)f(w)o(as)h(presented)e(in)i([6)o(])g(in)f (the)h(conte)o(xt)e(of)h(operating)f(systems.)i(Although)d(it)k(did)e (not)g(w)o(ork)g(well)h(in)191 1104 y(this)19 b(\002eld,)f(because)g (resources)f(of)h(an)g(operating)f(system)h(are)h(dif)n(\002cult)e(to)i (sort)f(and)g(usually)g(cannot)f(be)h(requested)191 1204 y(in)i(increasing)f(order)m(,)g(it)i(has)f(been)f(successfully)h (applied)f(in)i Fm(\013)p Fq(\226core.)274 1320 y(In)k(this)h(section)f (we)h(compare)e(our)h(solution)f(with)i(other)e(authors')h(w)o(ork.)f (Most)i(of)f(the)g(ar)o(guments)f(we)i(gi)n(v)o(e)191 1420 y(during)18 b(this)j(discussion)f(are)g(corroborated)d(with)j(the) h(results)f(of)g(the)g(e)o(xperimental)e(study)i(sho)n(wn)f(in)i (Section)e(.)274 1536 y(The)f(simplest)g(algorithm)e(can)i(be)g(found)f (in)h([12)n(],)g(for)g(instance,)f(and)h(it)g(consists)h(of)f(using)f (a)i(central)e(scheduler)191 1636 y(responsible)30 b(for)h(e)n(v)o(ery) f(interaction.)g(Each)h(participant)f(sends)h(it)h(a)g Fm(R)q(E)5 b(AD)r(Y)51 b Fq(message)31 b(when)g(it)h(arri)n(v)o(es)e (at)191 1735 y(a)h(point)g(where)f(it)i(needs)f(to)g(coordinate)e(its)j (acti)n(vities)f(with)g(others,)g(and)f(the)h(manager)f(uses)h(a)h (counter)d(per)191 1835 y(interaction)22 b(to)h(determine)f(if)i(the)o (y)e(become)g(enabled)g(on)h(reception)f(of)h(a)h Fm(R)q(E)5 b(AD)r(Y)42 b Fq(message.)23 b(If)g(se)n(v)o(eral)g(ones)191 1934 y(become)e(enabled)h(by)g(the)g(a)h Fm(R)q(E)5 b(AD)r(Y)42 b Fq(message)23 b(and)f(the)o(y)g(are)g(con\003icting,)f(a)i(random)e (v)n(ariable)g(may)i(be)f(used)191 2034 y(to)28 b(select)g(one)f(of)g (them.)g(Although)f(this)i(algorithm)e(may)h(be)g(suitable)h(for)f (certain)g(systems,)g(the)h(concerns)e(of)191 2134 y(performance)17 b(and)j(reliability)f(ar)o(gue)g(for)h(a)g(distrib)n(uted)g(solution.) 274 2250 y(In)i([10)n(],)g(a)h(slightly)f(modi\002ed)f(v)o(ersion)f(of) i(the)g(basic)h(algorithm)d(w)o(as)j(presented.)d(In)i(this)h (solution,)e(there)g(is)i(a)191 2350 y(manager)c(per)i(interaction)f (responsible)g(for)g(detecting)g(enablement,)g(b)n(ut)h(also)g(a)h (central)e(scheduler)g(responsible)191 2449 y(for)26 b(umpiring)e(amongst)h(con\003icting)g(managers.)g(Although)g(this)i (solution)e(is)j(suitable)e(for)g(some)g(problems)f(in)191 2549 y(the)k(traf)n(\002c)f(control)g(arena,)g(and)g(also)h(in)g(the)g (conte)o(xt)e(of)h(multiparty)g(cryptography)c([3)o(],)29 b(the)g(central)f(con\003ict)191 2648 y(resolutor)19 b(is)i(problematical)d(in)j(the)f(general)f(case.)274 2765 y(The)g(\002rst)i(distrib)n(uted)e(algorithms)f(for)i (coordination)d(were)i(produced)f(in)i(the)f(conte)o(xt)g(of)g(CSP)-9 b(,)21 b(b)n(ut)f(the)o(y)f(were)191 2864 y(restricted)e(to)h(tw)o (o\226party)e(interactions.)g(Later)m(,)h(the)g(problem)f(became)h(of)g (great)g(interest,)g(and)g(Chandy)g(and)g(Misra)191 2964 y([5)o(])22 b(de)n(v)o(eloped)d(tw)o(o)j(algorithms)f(that)h(are)g(the) f(basis)i(of)e(Bagrodia')-5 b(s)21 b(MEM)h(algorithm)e([1)o(].)i (Currently)-5 b(,)20 b(it)j(is)f(one)191 3064 y(of)i(the)g(most)g (cited)h(in)f(this)h(\002eld)f(because)g(it)h(can)f(be)g(con\002gured)e (so)j(as)g(to)f(achie)n(v)o(e)f(optimal)h(performance)d(in)j(a)191 3163 y(particular)19 b(system.)274 3279 y(Bagrodia)24 b(\002rst)i(de)n(vised)f(a)g(distrib)n(uted)g(v)o(ersion)f(of)h(the)g (basic)h(centralised)e(algorithm)g(called)h(EM.)g(It)h(uses)f(a)191 3379 y(number)e(of)h(interaction)f(managers,)g(each)h(one)g (responsible)f(for)h(managing)e(a)j(subset)g(of)f(interactions.)f (\(Notice)191 3479 y(that)36 b(these)h(subsets)g(need)e(not)i(be)f (disjoint.\))f(When)i(a)f(participant)f(w)o(ants)i(to)g(participate)e (in)i(a)g(number)d(of)191 3578 y(interactions,)20 b(it)j(sends)f Fm(R)q(E)5 b(AD)r(Y)41 b Fq(messages)22 b(to)f(the)h(corresponding)c (managers,)j(which)g(use)h(a)g(message\226count)191 3678 y(technique)d(for)h(detecting)g(enablement;)f(mutual)h(e)o(xclusion)f (is)j(achie)n(v)o(ed)d(by)h(means)h(of)f(a)h(circulating)f(tok)o(en)g (that)191 3778 y(allo)n(ws)g(the)h(manager)d(ha)n(ving)h(it)i(to)g(e)o (x)o(ecute)d(as)j(man)o(y)e(non\226con\003icting)e(interactions)i(as)i (possible.)274 3894 y(Ha)n(ving)27 b(a)h(circulating)f(tok)o(en)f(has)i (se)n(v)o(eral)g(dra)o(wbacks)e(because)h(it)h(amounts)f(to)h (additional)e(netw)o(ork)h(load,)191 3993 y(e)n(v)o(en)d(if)i(no)f (interaction)f(is)i(enabled,)e(which)h(may)g(be)g(quite)g (problematical)f(in)h(b)n(us)h(netw)o(orks.)e(The)h(tok)o(en)g(also)191 4093 y(needs)h(to)g(circulate)g(amongst)f(managers)g(in)i(a)f(gi)n(v)o (en)f(order)m(,)g(thus)h(or)o(ganising)e(them)i(in)g(a)h (unidirectional)d(ring,)191 4193 y(which)d(may)g(lead)h(to)g(a)g (situation)f(in)h(which)f(a)h(manager)e(can)i(ne)n(v)o(er)e(e)o(x)o (ecute)g(one)i(of)f(the)h(interactions)e(for)h(which)191 4292 y(it)g(is)g(responsible,)e(because)g(it)i(ne)n(v)o(er)e(gets)h(to) h(ha)n(v)o(e)e(the)i(tok)o(en)e(at)i(the)f(right)f(moment.)274 4408 y(In)e Fm(\013)p Fq(\226core,)f(there)g(is)i(a)f(coordinator)m(,)d (i.e.,)i(a)h(manager)m(,)e(per)i(interaction)e(and)h(e)o(xclusion)g(is) i(achie)n(v)o(ed)d(by)h(locking)191 4508 y(participants)29 b(in)h(a)g(gi)n(v)o(en)f(order)-5 b(.)29 b Fm(\013)p Fq(\226core)g(reduces)g(the)h(possibility)f(of)h(an)g(interaction)e(ne) n(v)o(er)h(being)g(e)o(x)o(ecuted)191 4608 y(because)17 b(when)g(a)g(participant)f(is)j(in)e(state)i Fm(LO)r(C)6 b(K)g(E)f(D)20 b Fq(and)c(it)j(is)f(unlock)o(ed)e(by)h(a)g(coordinator) m(,)e(it)j(selects)g(the)g(ne)o(xt)191 4707 y(prospecti)n(v)o(e)e (winner)i(coordinator)e(randomly)-5 b(,)16 b(thus)i(introducing)e(some) i(additional)g(v)n(ariability)f(in)i(the)f(e)o(xclusion)191 4807 y(problem.)f(In)h(the)h(e)o(xperimental)e(analysis,)h(we)h(sho)n (w)g(that)g(EM)g(produces)e(the)h(highest)h(e)o(x)o(ecution)d(de)n (viation,)h(and)191 4907 y(that)j Fm(\013)p Fq(\226core)g(reduces)f (it.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)d FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f (Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 18 18 18 17 bop 191 299 a Fq(18)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 274 606 a Fq(F)o(or)21 b(these)g(problems,)f(Bagrodia)g(de)n(vised)g(a)i (modi\002ed)d(v)o(ersion)h(of)h(EM)h(that)f(w)o(as)h(called)f(MEM.)g (It)g(combines)191 706 y(the)36 b(synchronisation)d(technique)h(used)i (in)g(EM)g(with)g(the)g(idea)f(of)h(using)f(auxiliary)g(resources)g(to) h(arbitrate)191 805 y(between)17 b(con\003icting)f(interactions.)g(The) h(e)o(xclusion)f(problem)g(is)i(solv)o(ed)e(by)h(mapping)f(the)h (multiparty)f(e)o(xclusion)191 905 y(problem)i(onto)g(the)i (well\226kno)n(wn)d(dining)h(philosophers)f(problem)h(or)h(onto)g(the)g (drinking)e(philosophers)h(problem)191 1005 y([4)o(].)28 b(Thus,)g(con\003icting)f(managers)g(are)h(considered)f(to)h(be)g (philosophers)f(that)h(need)g(to)g(acquire)f(shared)h(forks)191 1104 y(placed)19 b(between)h(them)g(in)g(mutual)f(e)o(xclusion.)274 1205 y(MEM)e(has)h(an)f(important)f(dra)o(wback)f(because)h(the)i (number)d(of)i(forks)g(a)g(manager)f(has)i(to)f(acquire)f(to)i (guarantee)191 1305 y(mutual)e(e)o(xclusion)g(increases)h(steadily)g (as)h(the)f(number)f(of)h(potentially)f(con\003icting)g(interactions)g (increases.)h(This)191 1404 y(implies)24 b(that)g(the)f(probability)f (of)h(acquiring)f(all)i(the)g(forks)f(decreases)g(accordingly)-5 b(,)21 b(e)n(v)o(en)i(if)h(the)f(managers)g(are)191 1504 y(not)d(con\003icting)f(at)i(run\226time.)d(In)i Fm(\013)p Fq(\226core,)g(there)g(is)h(no)f(need)g(for)f(virtual)h(resources.)f (Instead,)h(shared)f(processes)191 1604 y(are)33 b(considered)f(to)h (be)g(resources)f(that)i(coordinators)d(need)h(to)i(acquire.)e(Thus,)g (the)h(probability)f(of)h(gaining)191 1703 y(mutual)22 b(e)o(xclusion)e(decreases)i(as)i(the)e(number)f(of)h(shared)f (participants)h(increases,)g(b)n(ut,)g(in)g(general,)f(this)i(is)h (less)191 1803 y(problematical)15 b(because)i(most)g(practical)g (multiparty)f(interactions)g(are)h(three\227,)f(four)n(\226)g(or)h (\002)n(v)o(e\226party)-5 b(,)3254 1773 y Ff(y)3306 1803 y Fq(whereas)191 1902 y(the)20 b(number)f(of)g(potentially)g (con\003icting)g(interactions)g(may)h(be)g(greater)f(in)i(typical)f (applications.)274 2003 y(A)36 b(technique)d(kno)n(wn)h(as)i(synchron)o (y)c(loosening)i([12)n(])i(w)o(as)g(proposed)d(to)i(reduce)f(the)h (cardinality)f(of)h(an)191 2103 y(interaction)e(at)j(compile)d(time.)i (In)g(general,)e(the)i(speed)f(at)h(which)g(a)g(system)g(may)f(run)g (should)g(increase)g(as)191 2203 y(the)29 b(cardinality)e(of)h(its)i (interactions)d(decreases,)h(b)n(ut,)h(unfortunately)-5 b(,)25 b(it)k(is)g(not)g(the)f(case)h(if)g(we)g(use)g(MEM)g(to)191 2302 y(implement)j(multiparty)g(interactions.)h(The)g(reason)g(is)h (that)g(when)f(synchron)o(y)d(loosening)i(is)j(applied,)d(some)191 2402 y(interactions)18 b(are)i(split)f(into)h(a)f(number)f(of)h (interactions)f(with)i(smaller)f(cardinality)f(\(typically)-5 b(,)18 b(the)o(y)g(are)i(bipartite)191 2501 y(interactions\).)28 b(The)i(problem)e(is)i(that)g(the)g(resulting)f(interactions)f(share)i (common)e(participants,)g(so)i(that)g(this)191 2601 y(technique)e (increases)i(the)g(de)o(gree)e(of)i(potential)f(con\003ict.)g(As)i(sho) n(wn)e(in)h(our)f(comparati)n(v)o(e)f(study)h(in)h(Section)191 2701 y(,)f(both)e(EM)i(and)e(MEM)i(are)f(quite)g(sensiti)n(v)o(e)g(to)g (increases)h(in)f(the)g(de)o(gree)f(of)h(potential)g(con\003ict,)f (which)h(may)191 2800 y(sharply)c(af)n(fect)g(the)i(performance)c(of)i (a)i(system.)f(On)g(the)g(contrary)-5 b(,)23 b Fm(\013)p Fq(\226core)h(is)i(completely)e(insensiti)n(v)o(e)g(to)h(this)191 2900 y(parameter)m(,)18 b(which)i(mak)o(es)g(synchron)o(y)d(loosening)i (the)h(best)g(choice)g(to)g(optimise)g(a)h(system.)274 3001 y(A)d(dif)n(\002culty)e(also)i(arises)g(in)g(both)f(EM)h(and)f (MEM)g(because)g(between)g(enablement)e(detection)i(and)g(acquisition) 191 3101 y(of)27 b(the)h(tok)o(en)f(or)h(the)f(forks,)g(a)h (con\003icting)f(interaction)f(may)h(ha)n(v)o(e)g(started)h(e)o(x)o (ecuting.)d(The)j(comple)o(x)e(part)h(of)191 3200 y(both)22 b(algorithms)g(is)h(the)g(w)o(ay)g(the)o(y)f(use)i(the)e(information)f (communicated)f(during)h(mutual)i(e)o(xclusion)e(to)i(detect)191 3300 y(that)i(an)g(enablement)f(is)i(no)e(longer)g(current.)g(This)h (implies)g(that)g(each)g(tok)o(en)g(or)f(fork)g(needs)h(to)g(carry)g (an)g(array)191 3399 y(with)c(information)e(about)i(the)g(processes,)g (which)f(mak)o(es)i(messages)f(bigger)f(and)h(dif)n(\002cult)g(to)g (re\226adapt)f(if)h(a)h(ne)n(w)191 3499 y(interaction)d(or)h (participant)f(sprouts)g(at)i(run)e(time.)274 3600 y(An)24 b(additional)e(problem)g(with)i(EM)f(and)h(MEM)f(is)i(that)e(the)h (technique)e(the)o(y)h(use)h(for)f(detecting)g(enablement)191 3700 y(uses)h(message-counters)d(that)j(need)f(to)h(be)f(reset)h (periodically)e(so)i(that)f(the)o(y)g(do)g(not)h(o)o(v)o(er\003o)n(w)-5 b(.)21 b(In)i(EM,)g(when)g(a)191 3799 y(manager)15 b(detects)i(that)f (the)h(message)f(counters)g(are)g(about)g(to)h(o)o(v)o(er\003o)n(w)-5 b(,)14 b(it)j(becomes)f(an)g(initiator)g(that)h(sends)g(e)o(xtra)191 3899 y(messages)i(to)f(all)i(of)e(the)h(processes)f(in)h(the)f(system)h (so)g(that)g(the)o(y)f(reset)h(their)f(counters)f(and)h(inform)f(the)i (managers)191 3998 y(that)k(coordinate)d(the)j(interactions)e(in)i (which)f(the)o(y)g(participate)g(about)g(the)g(f)o(act)h(the)o(y)f(ha)n (v)o(e)g(reset)h(their)f(counters.)191 4098 y(The)i(initiator)g(cannot) g(forw)o(ard)f(the)h(tok)o(en)g(until)g(e)n(v)o(ery)g(process)g(and)g (manager)f(has)h(reset)h(its)h(counters.)d(As)i(for)191 4198 y(MEM,)19 b(the)g(procedure)e(is)j(similar)g(b)n(ut)f(an)g (additional)f(interaction)g Fm(I)2214 4210 y Fh(R)2289 4198 y Fq(needs)h(to)h(be)f(added)f(to)i(the)f(system)g(to)h(stop)191 4297 y(it)28 b(and)f(reset)h(counters)e(when)h(the)o(y)g(are)h(about)e (to)i(o)o(v)o(er\003o)n(w)-5 b(.)25 b Fm(I)2090 4309 y Fh(R)2173 4297 y Fq(is)j(con\003icting)f(with)g(e)n(v)o(ery)f(other)h (interaction)191 4397 y(so)c(that)f(when)g(it)h(e)o(x)o(ecutes,)e(no)h (other)g(interaction)f(may)h(be)g(e)o(x)o(ecuting)e(at)j(the)g(same)f (time.)h(It)f(remains)g(to)h(ensure)p 191 4649 499 3 v 191 4734 a Fp(y)224 4757 y FB(See)18 b([12],)f(for)g(instance.)i(The) e(authors)i(sho)n(w)e(more)h(than)g(\002fty)f(applications)k(of)d (multiparty)h(interactions,)i(b)o(ut)c(none)h(of)f(them)h(has)f(a)h (greater)191 4832 y(cardinality)l(,)h(e)o(xcept)f(for)e(the)h(case)g (of)f(the)g(leader)i(election)h(problem)e(in)g(which)g(an)f (interaction)k(may)c(coordinate)j(an)d(arbitrarily)j(lar)o(ge)e(number) 191 4907 y(of)g(participants)j(that)f(need)f(to)f(elect)i(a)e(leader)l (.)p 191 5006 3388 5 v 191 5193 a(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)f FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f (Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 19 19 19 18 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(19)p 191 473 3388 5 v 191 606 a(that)24 b Fm(I)376 618 y Fh(R)455 606 y Fq(shall)g(be)g(e)o(x)o(ecuted)e(within)h(a)i(\002nite)f(time)f(from)g (the)h(instant)g(a)g(counter)e(is)j(about)e(to)h(o)o(v)o(er\003o)n(w)-5 b(.)21 b(F)o(or)i(this)191 706 y(purpose,)h(MEM)j(introduces)d(a)j (special)f(process)g(for)g(each)g(interaction)f Fm(I)7 b Fq(,)26 b(so)h(that)f(the)o(y)g(participate)f(in)i(both)e Fm(I)191 805 y Fq(and)j Fm(I)376 817 y Fh(R)431 805 y Fq(,)g(i.e.,)g(only)g(special)g(processes)g(can)g(participate)f(in)h Fm(I)2066 817 y Fh(R)2121 805 y Fq(.)h(In)f(general,)f(a)h(special)h (process)e(is)j(willing)e(to)191 905 y(participate)f(in)h(its)g(tw)o(o) h(interactions;)d(ho)n(we)n(v)o(er)m(,)g(if)i(the)f(counter)g(reset)h (procedure)d(needs)i(to)h(be)g(e)o(x)o(ecuted,)e(the)191 1005 y(special)19 b(processes)f(w)o(ait)i(to)e(e)o(x)o(ecute)g(only)g Fm(I)1497 1017 y Fh(R)1571 1005 y Fq(so)h(that)g(it)g(becomes)f(the)h (only)e(enabled)h(interaction)f(in)i(the)g(system.)191 1104 y(Gi)n(v)o(en)k(that)i(the)f(set)h(of)f(interactions)f(for)h (which)g(managers)f(are)h(responsible)f(need)g(not)h(be)g(disjoint,)g (additional)191 1204 y(care)j(must)h(be)f(tak)o(en)g(so)h(as)g(to)g (pre)n(v)o(ent)d(dif)n(ferent)h(managers)g(that)i(coordinate)d Fm(I)2650 1216 y Fh(R)2733 1204 y Fq(from)i(starting)g(the)g(counter) 191 1303 y(reset)20 b(procedure)e(simultaneously)-5 b(.)274 1440 y(Clearly)g(,)30 b(both)h(EM)g(and)f(MEM)h(require)f(the)h (initiator)g(manager)e(to)i(kno)n(w)f(e)n(v)o(ery)g(process)h(in)g(the) g(system,)191 1540 y(which)g(is)i(an)f(important)e(dra)o(wback)g(in)i (open)e(systems)j(where)e(ne)n(w)h(interactions)e(or)i(processes)f(may) h(sprout)191 1639 y(une)o(xpectedly)-5 b(.)24 b Fm(\013)p Fq(\226core)j(neither)f(requires)h(the)g(set)i(of)e(participants)f(to)i (be)f(kno)n(wn)f(in)i(adv)n(ance,)e(nor)g(the)i(set)g(of)191 1739 y(coordinators)18 b(to)i(kno)n(w)f(each)h(other)f(or)h(the)h (whole)e(set)i(of)f(processes,)g(which)f(is)j(an)e(important)e(adv)n (antage.)274 1875 y(An)39 b(additional)f(dra)o(wback)g(that)h(EM,)g (MEM)g(and)g Fm(\013)p Fq(\226core)g(share)g(is)h(that)f(the)o(y)g (cannot)f(guarantee)g(that)191 1975 y(an)g(interaction)g(that)g(is)i (permanently)c(or)i(in\002nitely)g(often)g(enabled)f(shall)i(be)g(e)o (x)o(ecuted,)d(i.e,)j(the)o(y)f(cannot)191 2075 y(guarantee)30 b(f)o(airness.)h(Unfortunately)-5 b(,)28 b(gi)n(v)o(en)j(that)g(a)h (process)g(may)f(decide)f(autonomously)f(when)i(it)h(is)h(ready)191 2174 y(for)24 b(interaction)g(with)h(others,)f(and)h(a)g(process)f (being)g(ready)g(for)h(interaction)e(cannot)h(be)h(kno)n(wn)e(by)i(a)g (manager)191 2274 y(instantaneously)-5 b(,)23 b(f)o(airness)i(cannot)f (be)h(implemented)f(by)h(a)g(deterministic)g(algorithm)f(unless)h (arbitrarily)f(lar)o(ge)191 2373 y(delays)e(are)g(introduced)e(before)h (deciding)f(which)i(interaction)f(should)g(be)h(e)o(x)o(ecuted)f(out)h (of)f(a)i(set)g(of)f(con\003icting)191 2473 y(ones)e([14)o(,)g(20)o(].) 274 2610 y(V)-9 b(ery)38 b(recently)-5 b(,)37 b(tw)o(o)i(ne)n(w)g (algorithms)e(called)i(TB)g(and)g(SM)g(ha)n(v)o(e)f(been)g(presented)g (in)h([15)n(].)g(Both)g(are)191 2709 y(equi)n(v)n(alent,)27 b(being)h(the)h(dif)n(ference)e(that)i(TB)g(uses)g(message\226passing)f (primiti)n(v)o(es,)f(whereas)i(SM)g(uses)h(shared)191 2809 y(memory)14 b(primiti)n(v)o(es.)h(Both)h(ha)n(v)o(e)f(been)g(pro)o (v)o(en)f(to)i(schedule)f(multiparty)f(interactions)h(in)h(a)h (strongly)d(f)o(air)i(manner)191 2908 y(with)29 b(probability)e(one,)i (i.e.,)g(the)o(y)f(are)h(probabilistic)f(algorithms.)g(Both)h(impro)o (v)o(e)e(on)i(a)g(pre)n(vious)f(result)h([17)o(])191 3008 y(in)k(that)f(the)h(time)f(a)h(process)f(spends)g(doing)f(local)h (computation)f(or)h(the)g(transmission)g(delays)g(need)g(not)g(be)191 3108 y(bounded)23 b(by)i(an)o(y)g(predetermined)e(constant,)i(although) e(the)o(y)i(cannot)g(deal)g(with)h(systems)g(in)g(which)f(a)h(process) 191 3207 y(monotonically)13 b(increases)i(the)h(time)g(it)h(spends)e (at)h(doing)e(local)i(computation.)d(Both)j(algorithms)f(are)g(based)g (on)h(the)191 3307 y(idea)h(of)g(\223attempt,)g(w)o(ait,)h(and)f (check\224)f(to)h(establish)h(an)f(interaction.)f(F)o(or)h(e)o(xample,) f(if)h(participant)f Fm(P)30 b Fq(is)18 b(interested)191 3407 y(in)i Fm(I)312 3419 y Fl(1)350 3407 y Fm(;)14 b(I)423 3419 y Fl(2)461 3407 y Fm(;)g(:)g(:)g(:)f(;)h(I)681 3419 y Fh(n)727 3407 y Fq(,)21 b(it)g(selects)g(one)f(of)g(them)g(randomly) -5 b(,)17 b(and)j(w)o(aits)h(for)f(some)g(time.)h(If)f(after)g(that)g Fm(P)33 b Fq(has)21 b(detected)191 3506 y(that)d(the)g(other)g (participants)f(are)h(also)g(ready)g(for)f(that)h(interaction,)f(it)i (may)f(start)g(immediately;)f(otherwise,)g(a)i(ne)n(w)191 3606 y(random)f(attempt)i(is)h(made.)274 3742 y(Although)29 b(TB)j(and)e(SM)h(can)g(schedule)f(interactions)f(in)i(a)h(strongly)d (f)o(air)i(manner)m(,)e(the)i(cost)g(of)f(a)i(random)191 3842 y(attempt\226w)o(ait\226check)d(c)o(ycle)i(may)f(be)i (considerably)d(high.)h(The)h(e)o(xpected)f(time)h(it)h(tak)o(es)g(for) f(an)g(participant)191 3941 y(in)c(an)f(enabled)g(interaction)f Fm(I)35 b Fq(to)26 b(start)i(it)f(is)h(no)e(greater)g(than)2269 3904 y Fh(m\021)p 2093 3922 447 4 v 2093 3927 a Fe(Q)2156 3989 y Fd(p)2187 4002 y(i)2213 3989 y Fc(2P)t Fb(\()p Fd(I)s Fb(\))2386 3970 y Fh( )2430 3978 y Fd(p)2461 3991 y(i)2487 3978 y(;I)2573 3941 y Fj(+)d(\()p Fm(m)g Fi(\000)g Fj(1\))p Fm(\021)j Fj(+)d Fm(\017)p Fq(,)k(being)f Fm(m)h Fq(its)191 4073 y(cardinality)-5 b(,)29 b Fm( )647 4085 y Fh(p)681 4093 y Fd(i)708 4085 y Fh(;I)798 4073 y Fq(the)i (probability)f(that)h(participant)f Fm(p)1913 4085 y Fh(i)1973 4073 y Fq(chooses)g Fm(I)40 b Fq(in)31 b(its)i(random)c(dra)o (w)-5 b(,)30 b Fi(P)7 b Fj(\()p Fm(I)g Fj(\))32 b Fq(the)g(set)g(of)191 4172 y(participants)21 b(interested)h(that)h(interaction,)e(and)h Fm(\021)h Fi(\000)d Fm(\017)p Fq(,)j Fm(\021)31 b(>)c(\017)g(>)g Fj(0)22 b Fq(the)h(length)f(of)g(a)h(monitoring)d(windo)n(w)-5 b(.)21 b(The)191 4272 y(time)g(comple)o(xity)d(increases)j(sharply)f (as)h Fm(m)g Fq(increases)g(and)f(mak)o(es)g(it)i(impractical)e(for)g (applications)f(with)i(four)n(\226)191 4372 y(or)e(\002)n(v)o (e\226party)f(interactions)h(or)g(applications)g(in)h(which)f (participants)g(of)n(fer)f(more)h(than)h(three)f(interactions)g(at)h (the)191 4471 y(same)g(time.)274 4608 y(Finally)-5 b(,)33 b(neither)g(EM,)h(MEM,)g(TB)g(or)g(SM)g(are)g(ready)f(to)h(deal)g(with) g(systems)g(in)g(which)g(an)g(entity)f(may)191 4707 y(loop)26 b(for)h(e)n(v)o(er)f(whilst)i(doing)e(local)h(computation)e(or)h (\002nish.)h(Since)h Fm(\013)p Fq(\226core)e(does)h(only)f(require)g (coordinators)191 4807 y(to)f(communicate)f(with)h(those)g (participants)f(that)i(are)f(interested)f(in)i(them,)e(it)i(can)f(deal) h(with)f(both)f(terminating)191 4907 y(and)c(non\226terminating)c (systems.)p 191 5006 3388 5 v 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)g FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,) f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 20 20 20 19 bop 191 299 a Fq(20)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 1038 1408 a @beginspecial 0 @llx 0 @lly 363 @urx 147 @ury 2032 @rwi @setspecial %%BeginDocument: sync-patt-a.eps %!PS-Adobe-3.0 EPSF-3.0 %%Creator: ImageMark Software Labs %%For: () () %%Title: F:\usr\Corchu\Articulos\AOP\journal\pattern.eps %%CreationDate: () () %%BoundingBox: 0 0 363 147 %%DocumentProcessColors: Black %%ColorUsage:Color %%DocumentFonts: Helvetica %%+Helvetica-Bold %%+Helvetica-Oblique %%+Helvetica-BoldOblique %%+Times-Roman %%+Times-Bold %%+Times-Italic %%+Times-BoldItalic %%+Courier %%+Courier-Bold %%+Courier-Oblique %%+Courier-BoldOblique %%+Symbol %%DocumentSuppliedResources: procset Adobe_level2_AI5 1.2 0 %%+ procset Adobe_screens_AI5 1.0 0 %%+ procset Adobe_typography_AI5 1.0 0 %%+ procset Adobe_ColorImage_AI6 1.1 0 %%+ procset Adobe_blend_AI5 1.0 0 %%+ procset Adobe_pattern_AI5 1.0 0 %%+ procset Adobe_Illustrator_AI5 1.0 0 %AI5_FileFormat 3.0 %AI3_ColorUsage: Color %AI3_TemplateBox: 0 0 363 147 %AI3_TileBox: 0 0 363 147 %AI3_DocumentPreview: None %%Template: %%PageOrigin:0.0000 0.0000 %AI7_GridSettings: 72 8 72 8 1 0 0.8 0.8 0.8 0.9 0.9 0.9 %%EndComments %%BeginProlog %%BeginResource: procset Adobe_level2_AI5 1.2 0 %%Title: (Adobe Illustrator (R) Version 5.0 Level 2 Emulation) %%Version: 1.2 0 %%CreationDate: (04/10/93) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) userdict /Adobe_level2_AI5 25 dict dup begin put /packedarray where not { userdict begin /packedarray { array astore readonly } bind def /setpacking /pop load def /currentpacking false def end 0 } if pop userdict /defaultpacking currentpacking put true setpacking /initialize { Adobe_level2_AI5 begin } bind def /terminate { currentdict Adobe_level2_AI5 eq { end } if } bind def mark /setcustomcolor where not { /findcmykcustomcolor { 0 6 packedarray } bind def /findrgbcustomcolor { 1 5 packedarray } bind def /setcustomcolor { exch=20 aload pop=20 0 eq { pop 4 { 4 index mul 4 1 roll } repeat 5 -1 roll pop setcmykcolor } { pop 3 { 1 exch sub 3 index mul=20 1 exch sub 3 1 roll } repeat 4 -1 roll pop setrgbcolor } ifelse } def } if =09 /gt38? mark {version cvr cvx exec} stopped {cleartomark true} {38 gt = exch pop} ifelse def userdict /deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch = dup mul add sqrt put userdict /level2? systemdict /languagelevel known dup { pop systemdict /languagelevel get 2 ge } if put /level2ScreenFreq { begin 60 HalftoneType 1 eq { pop Frequency } if HalftoneType 2 eq { pop GrayFrequency } if HalftoneType 5 eq { pop Default level2ScreenFreq } if end } bind def userdict /currentScreenFreq =20 level2? {currenthalftone level2ScreenFreq} {currentscreen pop pop} = ifelse put level2? not { /setcmykcolor where not { /setcmykcolor { exch .11 mul add exch .59 mul add exch .3 mul add 1 exch sub setgray } def } if /currentcmykcolor where not { /currentcmykcolor { 0 0 0 1 currentgray sub } def } if /setoverprint where not { /setoverprint /pop load def } if /selectfont where not { /selectfont { exch findfont exch dup type /arraytype eq { makefont } { scalefont } ifelse setfont } bind def } if /cshow where not { /cshow { [ 0 0 5 -1 roll aload pop ] cvx bind forall } bind def } if } if cleartomark /anyColor? { add add add 0 ne } bind def /testColor { gsave setcmykcolor currentcmykcolor grestore } bind def /testCMYKColorThrough { testColor anyColor? } bind def userdict /composite? level2? { gsave 1 1 1 1 setcmykcolor currentcmykcolor grestore add add add 4 eq } { 1 0 0 0 testCMYKColorThrough 0 1 0 0 testCMYKColorThrough 0 0 1 0 testCMYKColorThrough 0 0 0 1 testCMYKColorThrough and and and } ifelse put composite? not { userdict begin gsave /cyan? 1 0 0 0 testCMYKColorThrough def /magenta? 0 1 0 0 testCMYKColorThrough def /yellow? 0 0 1 0 testCMYKColorThrough def /black? 0 0 0 1 testCMYKColorThrough def grestore /isCMYKSep? cyan? magenta? yellow? black? or or or def /customColor? isCMYKSep? not def end } if end defaultpacking setpacking %%EndResource %%BeginResource: procset Adobe_typography_AI5 1.0 1 %%Title: (Typography Operators) %%Version: 1.0=20 %%CreationDate:(03/26/93) () %%Copyright: ((C) 1987-1993 Adobe Systems Incorporated All Rights = Reserved) currentpacking true setpacking userdict /Adobe_typography_AI5 54 dict dup begin put /initialize { begin begin Adobe_typography_AI5 begin Adobe_typography_AI5 { dup xcheck { bind } if pop pop } forall end end end Adobe_typography_AI5 begin } def /terminate { currentdict Adobe_typography_AI5 eq { end } if } def /modifyEncoding { /_tempEncode exch ddef /_pntr 0 ddef { counttomark -1 roll dup type dup /marktype eq { pop pop exit } { /nametype eq { _tempEncode /_pntr dup load dup 3 1 roll 1 add ddef 3 -1 roll put } { /_pntr exch ddef } ifelse } ifelse } loop _tempEncode } def /TE { StandardEncoding 256 array copy modifyEncoding /_nativeEncoding exch def } def % /TZ { dup type /arraytype eq { /_wv exch def } { /_wv 0 def } ifelse /_useNativeEncoding exch def pop pop findfont _wv type /arraytype eq { _wv makeblendedfont } if dup length 2 add dict begin mark exch { 1 index /FID ne { def } if cleartomark mark } forall pop /FontName exch def counttomark 0 eq { 1 _useNativeEncoding eq { /Encoding _nativeEncoding def } if cleartomark } { /Encoding load 256 array copy modifyEncoding /Encoding exch def } ifelse FontName currentdict end definefont pop } def /tr { _ax _ay 3 2 roll } def /trj { _cx _cy _sp _ax _ay 6 5 roll } def /a0 { /Tx { dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss } ddef /Tj { dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss } ddef } def /a1 { /Tx { dup currentpoint 4 2 roll gsave dup currentpoint 3 2 roll tr _psf newpath moveto tr _ctm _pss grestore 3 1 roll moveto tr sp } ddef /Tj { dup currentpoint 4 2 roll gsave dup currentpoint 3 2 roll trj _pjsf newpath moveto trj _ctm _pjss grestore 3 1 roll moveto tr jsp } ddef } def /e0 { /Tx { tr _psf } ddef /Tj { trj _pjsf } ddef } def /e1 { /Tx { dup currentpoint 4 2 roll gsave tr _psf grestore 3 1 roll moveto tr sp } ddef /Tj { dup currentpoint 4 2 roll gsave trj _pjsf grestore 3 1 roll moveto tr jsp } ddef } def /i0 { /Tx { tr sp } ddef /Tj { trj jsp } ddef } def /i1 { W N } def /o0 { /Tx { tr sw rmoveto } ddef /Tj { trj swj rmoveto } ddef } def /r0 { /Tx { tr _ctm _pss } ddef /Tj { trj _ctm _pjss } ddef } def /r1 { /Tx { dup currentpoint 4 2 roll currentpoint gsave newpath moveto tr _ctm _pss grestore 3 1 roll moveto tr sp } ddef /Tj { dup currentpoint 4 2 roll currentpoint gsave newpath moveto trj _ctm _pjss grestore 3 1 roll moveto tr jsp } ddef } def /To { pop _ctm currentmatrix pop } def /TO { iTe _ctm setmatrix newpath } def /Tp { pop _tm astore pop _ctm setmatrix _tDict begin /W { } def /h { } def } def /TP { end iTm 0 0 moveto } def /Tr { _render 3 le { currentpoint newpath moveto } if dup 8 eq { pop 0 } { dup 9 eq { pop 1 } if } ifelse dup /_render exch ddef _renderStart exch get load exec } def /iTm { _ctm setmatrix _tm concat 0 _rise translate _hs 1 scale } def /Tm { _tm astore pop iTm 0 0 moveto } def /Td { _mtx translate _tm _tm concatmatrix pop iTm 0 0 moveto } def /iTe { _render -1 eq { } { _renderEnd _render get dup null ne { load exec } { pop } ifelse } ifelse /_render -1 ddef } def /Ta { pop } def /Tf { dup 1000 div /_fScl exch ddef % selectfont } def /Tl { pop 0 exch _leading astore pop } def /Tt { pop } def /TW { 3 npop } def /Tw { /_cx exch ddef } def /TC { 3 npop } def /Tc { /_ax exch ddef } def /Ts { /_rise exch ddef currentpoint iTm moveto } def /Ti { 3 npop } def /Tz { 100 div /_hs exch ddef iTm } def /TA { pop } def /Tq { pop } def /Th { pop pop pop pop pop } def /TX { pop } def /Tk { exch pop _fScl mul neg 0 rmoveto } def /TK { 2 npop } def /T* { _leading aload pop neg Td } def /T*- { _leading aload pop Td } def /T- { _hyphen Tx } def /T+ { } def /TR { _ctm currentmatrix pop _tm astore pop iTm 0 0 moveto } def /TS { currentfont 3 1 roll /_Symbol_ _fScl 1000 mul selectfont =09 0 eq { Tx } { Tj } ifelse setfont } def /Xb { pop pop } def /Tb /Xb load def /Xe { pop pop pop pop } def /Te /Xe load def /XB { } def /TB /XB load def currentdict readonly pop end setpacking %%EndResource %%BeginResource: procset Adobe_screens_AI5 1.2 0 %%Title: (Adobe Illustrator (R) Version 5.0 Custom Halftone Screens = ProcSet) %%Version: 1.2 0 %%CreationDate: (03/24/93) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) userdict /defaultpacking currentpacking put true setpacking systemdict begin userdict /Adobe_screens_AI5 15 dict dup begin put /initialize { Adobe_screens_AI5 begin /screenid deviceDPI 600 gt composite? not or { -1 } { deviceDPI currentScreenFreq=20 dup dup 60 ge exch 150 le and deviceDPI 300 le and { pop 60 } if div 1.41421 div 0.5 add cvi } ifelse def =09 2 screenid eq { /customsize 16 def /customdata /customdata2 def setcustomscreen } if =09 3 screenid eq { /customsize 24 def /customdata /customdata3 def setcustomscreen } if =09 4 screenid eq { /customsize 16 def /customdata /customdata4 def setcustomscreen } if =09 5 screenid eq { /customsize 20 def /customdata /customdata5 def setcustomscreen } if =09 6 screenid eq { /customsize 24 def /customdata /customdata6 def setcustomscreen } if =09 7 screenid eq { /customsize 28 def /customdata /customdata7 def setcustomscreen } if =09 8 screenid eq { /customsize 16 def /customdata /customdata8 def setcustomscreen } if } def /terminate { currentdict Adobe_screens_AI5 eq { end } if } def /setcustomscreen { deviceDPI customsize div 0 { 1 add 2 div customsize mul cvi exch 1 add 2 div customsize mul cvi exch customsize mul add customdata load exch get 256 div } setscreen } def /customdata2 28 28 mul string def currentfile customdata2 readhexstring 4180E8694988E2634382EA6B4B8AE061A01939C8A81737C2A21B3BCAAA1636C0 F8795998F6775796FA7B5B9AF57656952ED8B80727D6B60F2FDABA0626D5B50E 4E8DE6674786EE6F4F8EE5664685ED6EAD1434C6A61F3FCEAE1232C5A51E3ECD F3745493FE7F5F9EF1725291FD7E5E9D24D3B30C2CDEBE0222D1B10A2ADDBD04 4483EB6C4C8BE1624281E96A4A89E364A31C3CCBAB1535C1A11A3AC9A91838C3 FB7C5C9BF4755594F97A5A99F778589730DBBB0525D4B40D2DD9B90828D7B710 508FE4654584EC6D4D8CE7684887EF70AF1131C4A41D3DCCAC1333C7A72040CF F0715190FC7D5D9CF2735392FF80609F21D0B00929DCBC0323D2B20B2BDFBF01 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop /customdata3 28 28 mul string def currentfile customdata3 readhexstring 011DC7F5E73D0421CBF3E43A021EC8F6E83E0522CCF2E43A2B648BC4A0762F68 8AC39E732C658CC5A177306989C29D72D5B6521A6192D9B55219608FD6B6531B 6193DAB451185F8FFCEE440C28D2FCED430B27D1FDEF450C29D3FBEC420A26D0 BEA77D366F83BCA77C356E87BFA87E377082BBA67B346D86145B99E0AE4A1259 98DFB14E155C9AE1AD4A115897DEB04D0623CDF4E63C0420CAF8EA400723CDF4 E53B031FC9F7E93F316988C19F752E678EC6A378326A88C09F742D668DC6A278 DBB350175E91D8B8551C6395DCB24F165D90D7B7541C6294FAEC420925CFFFF1 470E2BD5F9EB410824CEFEF0460D2AD4BAA57A336C85BEAA80397180B9A47933 6B84BDA97F387181105797DDAF4C145A9CE3AB480F5696DDAE4B13599BE2AC49 021EC8F6E83E0522CCF2E43A011DC7F5E73D0421CBF3E43A2C658CC5A1773069 89C29D722B648BC4A0762F688AC39E73D6B6531B6193DAB451185F8FD5B6521A 6192D9B55219608FFDEF450C29D3FBEC420A26D0FCEE440C28D2FCED430B27D1 BFA87E377082BBA67B346D86BEA77D366F83BCA77C356E87155C9AE1AD4A1158 97DEB04D145B99E0AE4A125998DFB14E0723CDF4E53B031FC9F7E93F0623CDF4 E63C0420CAF8EA40326A88C09F742D668DC6A278316988C19F752E678EC6A378 DCB24F165D90D7B7541C6294DBB350175E91D8B8551C6395F9EB410824CEFEF0 460D2AD4FAEC420925CFFFF1470E2BD5B9A479336B84BDA97F387181BAA57A33 6C85BEAA803971800F5696DDAE4B13599BE2AC49105797DDAF4C145A9CE3AB48 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop /customdata4 28 28 mul string def currentfile customdata4 readhexstring 1139B8E0FAD2531B133BBAE2F8D05119417180A6AE9A7B4B437382A5AD987949 C08867272F6F92CAC28A66262E6E90C8E8DE5F070F37B6F2EADD5E060E36B5F0 FED6571F173FBEE6FDD5561E163EBDE5AB9E7F4F477786A1A99D7E4E467685A3 2C6C96CEC68E62222A6A95CDC58D64240C34B3F6EED95A020A32B1F5EDDB5C04 143CBBE3F9D1521A123AB9E1FBD3541C447483A4AC997A4A427281A7AF9B7C4C C38B65252D6D91C9C1896828307093CBEBDC5D050D35B4F1E9DF60081038B7F3 FCD4551D153DBCE4FFD758201840BFE7A89C7D4D457584A2AA9F8050487887A0 296994CCC48C63232B6B97CFC78F61210931B0F4ECDA5B030B33B2F7EFD85901 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop /customdata5 28 28 mul string def currentfile customdata5 readhexstring 010B34C3EBFCF7CE3F16020C35C4EDFBF6CD3E15102552A4D6EADDB5632B1126 54A5D5EADCB3622A3958768499C19E8C7C5E3A59778498C19D8B7B5DC8A99370 47334C7587AFC9AA936F46324B7485AEF1E5BC6B1E0A2351A3D8F2E4BC6A1E09 2351A2D7FFF9D14219050F38C6EFFEF9D04118040E37C6EFE8E0B7662D142856 A8D3E7DFB7652D132856A7D4BF9C8E7F603D5B7A8195BE9A8E7E603C5B798297 314A7389B2CCAD906D442F497289B1CBAC926E4508214FA1DBF4E2B9671B0720 4EA0DAF4E3BA691C030D36C5EDFBF6CD3F16010C34C3ECFDF8CF4017122654A6 D4E9DDB4622A112553A5D6EBDEB5642C3B59788397C09C8B7C5D3A58778599C2 9E8C7D5FCAAB926E46314B7486AFC8AA947048334D7587B0F2E4BB691D082250 A1D8F1E6BD6B1F0A2452A3D9FDF8CF4118030E36C5EEFFFAD1421A050F38C7F0 E6DFB6642C132755A7D3E8E1B8662E152957A8D2BE9A8D7E5F3B5A798296BF9B 8F80613D5C7B80952F487188B1CAAC916D443049728AB3CCAE906C43061F4D9F DAF3E2BA681C07214FA0DBF5E1B8671A00000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop /customdata6 28 28 mul string def currentfile customdata6 readhexstring 081A44B6E0F2FDECC150250C091B45B6E1F3FCEBC04F240C1D336199C7D8DCD3 A56C37221E33619AC8D7DBD2A46B36214864798091AEB1958C7E694C49657A81 90ADB0948B7D684BB99D8475593C405C7888A1BEBA9E8574583B3F5B7888A0BD E4CBAA712E1215326098CFE8E4CCA9712D1114315F97CEE7F5F1C6552B040719 43B5DFFAF6F0C6542A03061842B4DEF9FFEDC352270E0B1C47B8E3F4FEECC251 260D0A1C46B7E2F4DAD5A76E39232035639CCAD5D9D4A66D38231F34629BC9D6 AF938E806A4E4A677C838FABAE928D7F694D4A667B828FAC3E5A778AA3BFBC9F 8772563A3D597689A2BEBB9F8673573A14305E97D1EAE6CDA76F2B0F132F5D96 D0E9E5CDA8702C10051742B3DDFCF8EEC4522801041641B2DDFBF7EFC5532902 091B45B6E1F3FCEBC04F240C081A44B6E0F2FDECC150250C1E33619AC8D7DBD2 A46B36211D336199C7D8DCD3A56C372249657A8190ADB0948B7D684B48647980 91AEB1958C7E694CBA9E8574583B3F5B7888A0BDB99D8475593C405C7888A1BE E4CCA9712D1114315F97CEE7E4CBAA712E1215326098CFE8F6F0C6542A030618 42B4DEF9F5F1C6552B04071943B5DFFAFEECC251260D0A1C46B7E2F4FFEDC352 270E0B1C47B8E3F4D9D4A66D38231F34629BC9D6DAD5A76E39232035639CCAD5 AE928D7F694D4A667B828FACAF938E806A4E4A677C838FAB3D597689A2BEBB9F 8673573A3E5A778AA3BFBC9F8772563A132F5D96D0E9E5CDA8702C1014305E97 D1EAE6CDA76F2B0F041641B2DDFBF7EFC5532902051742B3DDFCF8EEC4522801 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop /customdata7 28 28 mul string def currentfile customdata7 readhexstring 01061B44B7E1F5FEFBE6BD4A210C01071B45B8E1F6FDFBE6BC4A200B09132A54 A7D1EAF5EED9B05D331609142B55A8D2EAF4EED9AF5C32161D2D3D6993C1CBE0 CEC59B7140301E2E3D6A93C0CADFCDC49A713F3047576C7B828DA2B6A48F867E 6F5A48576C7C828CA1B6A38F867E6E59BAAA958A78634E4451667A8498ADBAAB 968977624E4350657A8398ADE3D4C99F7539251A273C6892C2D7E4D4C89E7539 241A273B6891C1D6F8F2DDB460371005122A53A7D0ECF9F2DDB360360F051229 53A6D0EBFFFDE8BE4C220D03081D46B9E3F7FFFCE7BD4B210D02071C46B8E2F7 F3F0DBB15E34180B152C56A9D3E8F3EFDAB05D34170A142C55A9D2E9DFCCC69C 7341321F2F3F6B94BFC9DECCC59C7241311F2E3E6A94BFCAB5A38E8780705B49 596D7D808BA0B4A28D877F6F5B48586D7C818BA043506479859AAFBCAC978876 614C424F64798499AEBBAB968977624D19263B6791C3D8E5D6C79D7337231825 3A6690C3D7E5D5C79E74382304112952A5CFEDFAF0DBB25E350E03102851A5CE ECF9F1DCB25F360E01071B45B8E1F6FDFBE6BC4A200B01061B44B7E1F5FEFBE6 BD4A210C09142B55A8D2EAF4EED9AF5C321609132A54A7D1EAF5EED9B05D3316 1E2E3D6A93C0CADFCDC49A713F301D2D3D6993C1CBE0CEC59B71403048576C7C 828CA1B6A38F867E6E5947576C7B828DA2B6A48F867E6F5ABAAB968977624E43 50657A8398ADBAAA958A78634E4451667A8498ADE4D4C89E7539241A273B6891 C1D6E3D4C99F7539251A273C6892C2D7F9F2DDB360360F05122953A6D0EBF8F2 DDB460371005122A53A7D0ECFFFCE7BD4B210D02071C46B8E2F7FFFDE8BE4C22 0D03081D46B9E3F7F3EFDAB05D34170A142C55A9D2E9F3F0DBB15E34180B152C 56A9D3E8DECCC59C7241311F2E3E6A94BFCADFCCC69C7341321F2F3F6B94BFC9 B4A28D877F6F5B48586D7C818BA0B5A38E8780705B49596D7D808BA0424F6479 8499AEBBAB968977624D43506479859AAFBCAC978876614C18253A6690C3D7E5 D5C79E74382319263B6791C3D8E5D6C79D73372303102851A5CEECF9F1DCB25F 360E04112952A5CFEDFAF0DBB25E350E pop pop /customdata8 28 28 mul string def currentfile customdata8 readhexstring 050F2747B6D6EEF8FEF4DCBC4D2D1507111D375F9EC6E0E9EBE6CCA4653D1F13 2939556F8EA8C1D1D3C3AE9475573B2B4961717D808999B1B39B8B867F73634B B8A090827A6A5A42445C6C7C8492A2BAD8C8AA97785232222434546E8DACCADA F0E2CFA768401A0A0C1C365E9DC5E4F2FAF7DFBF50301802040E2646B5D5EDFC FFF5DDBD4E2E160806102848B7D7EFF9EAE7CDA5663E2014121E38609FC7E1E8 D2C2AF9576583C2C2A3A56708FA9C0D0B29A8A878074644C4A62727E818898B0 435B6B7B8593A3BBB9A19183796959412333536D8CADCBDBD9C9AB9677513121 0B1B355D9CC4E5F3F1E3CEA6673F1909030D2545B4D4ECFDFBF6DEBE4F2F1701 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 0000000000000000000000000000000000000000000000000000000000000000 00000000000000000000000000000000 pop pop end end defaultpacking setpacking %%EndResource %%BeginResource: procset AGM_Gradient_Sep 1.0 0 %%Title: (AGM Gradient Procset) %%Version: 1.0 0 %%CreationDate: (4/26/96) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) userdict /defaultpacking currentpacking put true setpacking userdict /AGM_Gradient_Sep 5 dict dup begin put /AGM_Gradient_Sep_private 100 dict def /initialize{ AGM_Gradient_Sep begin AGM_Gradient_Sep_private begin _compositeJob{ initializeSinglePassSeps }{ initializeMultiPassSeps }ifelse initializeSeps AGM_Gradient_private begin /_fillSD newSpotDict def /_rampSD newSpotDict def /_nCustomColorSD nd end AGM_Gradient_Sep_private=20 { dup xcheck 1 index type /arraytype eq and { bind }if pop pop }forall AGM_Gradient_Sep { dup xcheck 1 index type /arraytype eq and { bind }if pop pop }forall end =09 currentdict readonly pop=09 end }def /terminate{ currentdict AGM_Gradient_Sep eq{ end }if }def =20 AGM_Gradient_Sep_private begin /initializeSeps{ _noImage not _level2PS not and{ /_whiteBytes 1 makeByte8 pt /knockOut{ 8 setImageParms _whiteBytes /_image load 5 execImage }def /linealFill{ mySave 8 setImageParms _color{ _nCustomColorSD begin cyan magenta yellow black _spotColor{ spot1 begin /tintImage tintValue 1 exch sub makeByte8 def end spot2 begin /tintImage tintValue 1 exch sub makeByte8 def end }if end 4{ makeByte8 4 1 roll }repeat true 4 _nCustomColorSD ncolorimage }{ _nCustomColorSD/black get 1 exch sub makeByte8=20 _nCustomColorSD bwImage }ifelse myRestore }def }{ /knockOut{ gsave false setoverprint 1 setgray=20 0 0 1 1 rectfill grestore }def }ifelse /newSpotDict{ 11 dict dup begin /nSpots 2 def /spot1 7 dict def /spot2 7 dict def end }def /initSpotData { begin /name nd /tintImage nd /tintValue nd /spot_C nd /spot_M nd /spot_Y nd /spot_K nd end }def /initSpotDict{ begin /cyanInk false def /magentaInk false def /yellowInk false def /blackInk false def /cyan nd /magenta nd /yellow nd /black nd spot1 initSpotData spot2 initSpotData end }def /copySpotDict{ /_dst xp begin cyanInk magentaInk yellowInk blackInk cyan magenta yellow black spot1 spot2 end _dst begin /spot1 spot1 maxlength dict def /spot2 spot2 maxlength dict def spot2 copy pop spot1 copy pop /black xd /yellow xd /magenta xd /cyan xd /blackInk xd /yellowInk xd /magentaInk xd /cyanInk xd end }def /setCustomColor { 1 index /Black eq{ 6 1 roll 5 npop 1 exch sub setgray }{ 6 1 roll _ccAry1 astore exch dup null eq{ pop 0 }if setcustomcolor }ifelse }def /setCStop{ /_colorStyle exch pt =09 _colorStyle 0 eq{ 0 0 0 4 -1 roll 1 exch sub _spotColor{ /_colorStyle 3 pt /Black 1 index 1 exch sub }if }if _colorStyle 2 eq{ 3 npop }if _rampSD _fillSD copySpotDict =09 _colorStyle 4 eq{=20 pop 9 2 roll 3 npop 6 -2 roll } if =09 _colorStyle 3 eq _colorStyle 4 eq or{ =09 _fillSD begin exch dup spot1/name get eq{ spot1 spot2 }{ spot2 spot1 }ifelse begin begin /name xd 1 exch sub /tintValue xd 4{ tintValue mul 4 1 roll }repeat _spotColor not{ /tintValue null def }if end /tintValue 0 def end end }if _fillSD nsetcustomcolor }def /renderCMYK{ spot1/name get null eq spot2/name get null eq and dup not{ pop spot1 spotConverted }if dup not{ pop spot2 spotConverted }if }def /fill_ /fill load def /fillOvp{ currentoverprint{ _inRipSep{ currentcolorspace 0 get dup /DeviceGray eq 1 index /DeviceCMYK eq or{ pop currentcmykcolor add add add 0 eq{ newpath }if }{ /Separation eq{ currentcolor 0 eq{ newpath }if }if }ifelse }{ currentgray 1 eq{ newpath }if }ifelse }if fill_ }def /fill{ _nCustomColorSD begin renderCMYK { fillOvp }{ spot1 begin gsave name null ne{ spot_C spot_M spot_Y spot_K name tintValue setCustomColor }{ 1 setgray }ifelse fillOvp=20 grestore end spot2 begin name null ne{ gsave true setoverprint spot_C spot_M spot_Y spot_K name tintValue setCustomColor fillOvp grestore }if end newpath }ifelse end }def /expandSpot{ _spotColor{ /_len xp _rampSD begin spot1 begin tintImage null ne{ tintImage _len expandOne /tintImage xd }if end spot2 begin tintImage null ne{ tintImage _len expandOne /tintImage xd }if end end }{ pop }ifelse }def /rampImage{ _rampSD begin _color{ /cyanInk _cyanData 0 ne def /magentaInk _magentaData 0 ne def /yellowInk _yellowData 0 ne def /blackInk _blackData 0 ne def _nSamples setImageParms _nSamples expandSpot _cyanData _magentaData _yellowData _blackData _nSamples 4 = expandColor true 4 _rampSD ncolorimage }{ /cyanInk false def /magentaInk false def /yellowInk false def /blackInk true def _nSamples setImageParms=20 _blackData _rampSD bwImage }ifelse end }def /nsetcustomcolor where{ pop }{ /nsetcustomcolor { /_nCustomColorSD xp _nCustomColorSD begin 4 copy /black xd /yellow xd /magenta xd /cyan xd 4 copy 0 ne /blackInk xd 0 ne /yellowInk xd 0 ne /magentaInk xd 0 ne /cyanInk xd end setcmykcolor }def }ifelse /nsetcustomcolorend where{ pop }{ /nsetcustomcolorend { /_nCustomColorSD null pt }def }ifelse }def /initializeSinglePassSeps{ /_decodeNorm [0 1] pt /_decodeInvert [1 0] pt /spotConverted { begin name null eq{ false }{ tintValue null eq tintImage null eq and{ true }{ false currentpagedevice/SeparationOrder get{name eq or}forall not }ifelse }ifelse end }def /dictImage { 20 dict dup begin /Dict xd /Decode xd /DataSource xd /ImageMatrix xd /BitsPerComponent xd /Height xd /Width xd /ImageType 1 def Dict end /_image load 1 execImage }def /bwImage{ begin gsave currentoverprint{ blackInk{ [/Separation /Black /DeviceGray{}] setcolorspace _decodeInvert dictImage }{ 5 npop }ifelse }{ /DeviceGray setcolorspace _decodeNorm dictImage }ifelse grestore end }def /ncolorimage where{ pop }{ /ncolorimage{ begin renderCMYK { cyanInk=20 magentaInk and yellowInk and blackInk and not currentoverprint=20 and { pop pop gsave cyanInk{ 8 copy [/Separation /Cyan /DeviceGray{}] setcolorspace 3 npop _decodeNorm dictImage }if magentaInk{ 8 copy [/Separation /Magenta /DeviceGray{}] setcolorspace 4 -1 roll 3 npop _decodeNorm dictImage }if yellowInk{ 8 copy [/Separation /Yellow /DeviceGray{}] setcolorspace 4 -2 roll 3 npop _decodeNorm dictImage }if blackInk{ 4 -3 roll [/Separation /Black /DeviceGray{}] setcolorspace 3 npop _decodeNorm dictImage }{ 8 npop }ifelse grestore }{ /_colorimage load 10 execImage }ifelse }{ 6 npop gsave spot1 begin name null ne tintImage null ne and{ [/Separation name /DeviceGray{}] setcolorspace 4 copy tintImage=20 name /Black eq{ _decodeNorm }{ _decodeInvert }ifelse=20 dictImage }{ 1 setgray fill }ifelse end spot2 begin true setoverprint name null ne tintImage null ne and{ [/Separation name /DeviceGray{}] setcolorspace tintImage=20 name /Black eq{ _decodeNorm }{ _decodeInvert }ifelse=20 dictImage }{ 4 npop 1 setgray fill }ifelse end grestore }ifelse end }def }ifelse }def /initializeMultiPassSeps{ /_isCMYKSep _cyanPlate _magentaPlate or _yellowPlate or _blackPlate or pt /invertXfer{ [ { 1 exch sub }/exec load systemdict /currenttransfer get exec /exec load ] cvx systemdict /settransfer get exec }def /ccThrough{ gsave 1 setCustomColor currentcmykcolor grestore add add add 0 ne }def /spotConverted { begin _isCMYKSep not{ false }{ name null eq{ false }{ tintValue null eq tintImage null eq and{ true }{ spot_C spot_M spot_Y spot_K name ccThrough }ifelse }ifelse }ifelse end }def /spotChannel { _isCMYKSep{ pop false }{ begin name null eq{ false }{ spot_C spot_M spot_Y spot_K name ccThrough=20 }ifelse end }ifelse }def /getChannelData { _isCMYKSep dup{ pop renderCMYK }if { _blackPlate{ 4 1 roll 3 npop blackInk }{ _yellowPlate{ 4 2 roll 3 npop yellowInk }{ _magentaPlate{ 4 3 roll 3 npop magentaInk }{ 3 npop cyanInk }ifelse }ifelse }ifelse { true /nonZeroData }{ true /zeroData }ifelse }{ 4 npop spot1/name get null ne=20 spot1 spotChannel and{ spot1/tintImage get dup null ne{ false /nonZeroData }{ pop false /noData }ifelse }{ spot2/name get null ne=20 spot2 spotChannel and{ spot2/tintImage get dup null ne{ false /nonZeroData }{ pop false /noData }ifelse }{ false /noData }ifelse }ifelse }ifelse }def /renderChannelData { /_tmp xp _tmp /nonZeroData ne currentoverprint and{ pop _tmp /zeroData eq{pop}if 4 npop }{ _tmp /nonZeroData eq{ { invertXfer }if systemdict/image get 5 execImage }{ pop _tmp /zeroData eq{pop}if 4 npop knockOut }ifelse }ifelse }def /bwImage{ begin gsave dup dup dup getChannelData exch pop false exch renderChannelData grestore end }def /ncolorimage{ begin pop pop gsave spot2/name get null ne spot2 spotChannel and{ true setoverprint }if getChannelData=20 renderChannelData grestore end }def }def end end defaultpacking setpacking %%EndResource %%BeginResource: procset AGM_Gradient 1.0 0 %%Title: (AGM Gradient Procset) %%Version: 1.0 0 %%CreationDate: (4/26/96) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) userdict /defaultpacking currentpacking put true setpacking userdict /AGM_Gradient 20 dict dup begin put /AGM_Gradient_private 200 dict def /initialize { AGM_Gradient begin AGM_Gradient_private begin initializeVars =09 /bd systemdict/mark get def /ed _level2PS=20 { (>>) }{ (counttomark 2 idiv dup dict begin {def} repeat pop currentdict end) } ifelse cvx def =09 _level2PS{ initializeLev2 }{ initializeLev1 }ifelse =09 queryDevice =09 initializeShading initializeOps _producingSeps{ AGM_Gradient_Sep/initialize get exec }{ initializeComposite }ifelse _illustrator{ /f{}def /F{}def /s{}def /S{}def /b{}def /B{}def }if /image where{ /image get /_image xd }if /colorimage where{ /colorimage get /_colorimage xd }if /rectfill where dup{ exch pop not _producingSeps or }{ not }ifelse { /rectfill{ gsave newpath 4 2 roll moveto 1 index 0 rlineto 0 1 index rlineto 1 index neg 0 rlineto pop pop closepath fill grestore }def }if /linealImage _noImage{ /rectImage load }{ _producingSeps{ AGM_Gradient_Sep/AGM_Gradient_Sep_private get begin /rampImage load end }{ /rampImage load }ifelse }ifelse def AGM_Gradient_private { dup xcheck 1 index type /arraytype eq and { bind }if pop pop }forall AGM_Gradient { dup xcheck 1 index type /arraytype eq and { bind }if pop pop }forall end =09 currentdict readonly pop end }def /initializeAI { pop pop=20 AGM_Gradient/AGM_Gradient_private get /_illustrator true put AGM_Gradient/initialize get exec AGM_Gradient begin }def /unload{ systemdict/languagelevel known{ systemdict/languagelevel get 2 ge{ userdict/AGM_Gradient_Sep 2 copy known{ undef }{ pop pop }ifelse userdict/AGM_Gradient 2 copy known{ undef }{ pop pop }ifelse }if }if }def /terminate{ currentdict AGM_Gradient eq{ end }if }def =20 AGM_Gradient_private begin /initializeVars{ /_d255 256 array def 0 1 255{ _d255 exch dup 255 div put }bind for /_d255- 256 array def 0 1 255{ _d255- exch 1 _d255 2 index get sub put }bind for /_sSave nd /_dUserSpace matrix defaultmatrix def /_bUMatrix matrix def /_imageMatrix matrix def /_saveMatrix matrix def /_xm matrix def /_ccAry1 5 array def /_level2PS=20 systemdict/languagelevel known dup{ pop systemdict/languagelevel get 2 ge }if def /_level3PS _level2PS systemdict/shfill known and def currentdict /_illustrator known not{ /_illustrator false def }if =09 }def /initializeOps { AGM_Gradient begin currentdict/Bc known not{ /Bc{ =09 _renderFlag 2 eq{ 6 npop }{ pushBSpace _rampIndex 0 eq{ pop pop setCStop }if linealFill popBSpace }ifelse =09 }def }if =09 currentdict/Bg known not{ /Bg{ 10 npop /_gradName xp /_renderFlag xp =09 _renderFlag 2 ne{ =09 _illustrator{ _of setoverprint }if =09 _illustrator _eo and _renderFlag 3 eq or{ eoclip }{ clip }ifelse =09 _gradNames _gradName 2 copy known{ get mark exch aload pop /_gradType xp 1 sub dup /_rampIndex xp /_maxRampIndex xp mark exch aload pop 0 0 }if pop pop getRampData }{ mark mark }ifelse }def }if =09 currentdict/Bm known not{ /Bm{ _renderFlag 2 ne{ _gradType 0 eq{ linealRamp }{ radialGrad }ifelse }{ 6 npop }ifelse }def }if =09 currentdict/Bh known not{ /Bh{ 2 npop /_yHi xp /_xHi xp /_radHilite _xHi 0 ne _yHi 0 ne or pt }def }if =09 currentdict/Bn known not{ /Bn{ AGM_Gradient_private begin dict /_gradNames xp end }def }if =09 currentdict/Bd known not{ /Bd{ AGM_Gradient begin AGM_Gradient_private begin /_nColorsBd xp /_gradType xp /_gradName xp }def }if =09 currentdict/BD known not{ /BD{ currentdict/_gradNames known not{ /_gradNames 20 dict def }if ] _nColorsBd _gradType ] _gradName exch /_gradNames xput end end }def }if =09 currentdict/Bb known not{ /Bb{ =09 AGM_Gradient begin AGM_Gradient_private begin _producingSeps{ AGM_Gradient_Sep/AGM_Gradient_Sep_private get begin }if mySave }def }if =09 currentdict/BB known not{ /BB{ =09 /_tmp xp cleartomark cleartomark =09 _tmp dup _renderFlag =09 myRestore =09 _producingSeps{ end }if =09 _illustrator end end =09 { 2 ne exch 0 gt and{ 2 eq{ s }{ S }ifelse }{ pop newpath }ifelse }{ pop newpath }ifelse =09 =09 }def }if =09 currentdict/Xm known not{ /Xm{ _xm astore pop }def }if =09 end }def /queryDevice{ /_inRipSep _level2PS{ currentpagedevice/Separations 2 copy known{ get }{ pop pop false }ifelse }{ false }ifelse def /_noImage /lv1Fix where{ pop lv1Fix }{ false }ifelse def /_useShells where{ pop }{ /_useShells true def }ifelse =09 /_useSmoothShade where{ pop }{ /_useSmoothShade false def=20 }ifelse /_cyanPlate 1 0 0 0 testCMYKColorThrough def /_magentaPlate 0 1 0 0 testCMYKColorThrough def /_yellowPlate 0 0 1 0 testCMYKColorThrough def /_blackPlate 0 0 0 1 testCMYKColorThrough def /_compositeJob _cyanPlate _magentaPlate and _yellowPlate and _blackPlate and def /_compositeSpotDevice where{ pop }{ /_compositeSpotDevice _compositeJob not _inRipSep or{ 1 }{ 0 }ifelse def }ifelse /_producingSeps _compositeSpotDevice 0 ne def /_deviceDPI 72 0 matrix defaultmatrix dtransform dup mul exch dup mul = add sqrt def /_dpiThreshold where{ pop }{ /_dpiThreshold 600 def }ifelse /_screenFreqThreshold where{ pop }{ /_screenFreqThreshold 150 def }ifelse /_contoneDevice where{ pop }{ /_contoneDevice false def }ifelse /_subSampleOK=20 _deviceDPI _dpiThreshold le=20 currentScreenFreq _screenFreqThreshold le and=20 _contoneDevice not and=20 _producingSeps not and def }def /initializeLev1{ /makeByte8{ /_tmp 0 pt 255 mul cvi 8 string 8{ dup _tmp 3 index put=20 /_tmp _tmp 1 add pt }repeat exch pop }def /currentScreenFreq{ currentscreen pop pop }def /_byte 1 string def /colorimage where{ pop }{ /colorimage{ pop pop /_blackTmp xp /_yellowTmp xp /_magentaTmp xp /_cyanTmp xp /_cnt 0 pt [ _byte dup 0 _cyanTmp=20 /_cnt cvx /get cvx _d255 /exch cvx /get cvx .3 /mul cvx _magentaTmp /_cnt cvx /get cvx _d255 /exch cvx /get cvx .59 /mul cvx _yellowTmp /_cnt cvx /get cvx _d255 /exch cvx /get cvx .11 /mul cvx _blackTmp=20 /_cnt cvx /get cvx _d255 /exch cvx /get cvx /add cvx /add cvx /add cvx 1 /exch cvx /sub cvx /dup cvx 0 /lt cvx{ pop 0 }/if cvx /dup cvx 1 /gt cvx{ pop 1 }/if cvx 255 /mul cvx /cvi cvx 256 /mod cvx /dup cvx 0 /lt cvx{ pop 0 }/if cvx /put cvx /_cnt dup cvx 1 /add cvx /pt cvx ] cvx bind /_image load 5 execImage }def }ifelse }def /initializeLev2{ /level2ScreenFreq{ begin 60 HalftoneType 1 eq{ pop Frequency }if HalftoneType 2 eq{ pop GrayFrequency }if HalftoneType 5 eq{ pop Default level2ScreenFreq }if end }def /currentScreenFreq{ currenthalftone level2ScreenFreq }def }def /initializeShading{ _useSmoothShade _level3PS and{ /_usingSmoothShade true pt initializeLev3_Ops }{ /_usingSmoothShade false pt }ifelse }def /initializeLev3_Ops { /initShFill{ /_index _gradType 0 eq {0}{_maxRampIndex 1 sub} ifelse pt /_rampFuncsArray _maxRampIndex array pt /_boundsArray _maxRampIndex 1 sub array pt /_encodeArray _maxRampIndex 2 mul array pt /_beginCoord _rampPoint pt /_colorSpace null pt /_firstFill _rampIndex _maxRampIndex eq pt /_lastFill false pt }def /getRampColorSpace{ _nSamples 1 gt{=20 /_ndx 0 pt [blendColor] cvx exec }if /_C0 [currentcolor] pt /_C0_Space currentcolorspace pt =09 _nSamples 1 gt{=20 /_ndx _nSamples 1 sub pt [blendColor] cvx exec }if /_C1 [currentcolor] pt /_C1_Space currentcolorspace pt =09 _C0_Space _C1_Space eq{ /_rampColorSpace _C0_Space pt }{ (colorspace conflict!) =3D=3D showpage stop }ifelse =09 _spotColor{ nsetcustomcolorend }if }def /linealShFill{ popBSpace _xm aload pop pushBSpace =09 /_size _index 1 add pt _size _maxRampIndex lt { /_rampFuncsArray _rampFuncsArray 0 _size getinterval pt /_boundsArray _boundsArray 0 _size 1 sub getinterval pt /_encodeArray _encodeArray 0 _size 2 mul getinterval pt }if =09 bd /ShadingType 2 /ColorSpace _colorSpace /Function=20 bd /FunctionType 3 /Domain [0 1] /Functions _rampFuncsArray /Bounds _boundsArray /Encode _encodeArray ed /Extend [_firstFill _lastFill] /Domain [0 1]=20 /Coords [_beginCoord 0 _endCoord 0] ed shfill }def =09 /radialShFill{ /_size _maxRampIndex _index sub pt _size _maxRampIndex lt { /_rampFuncsArray _rampFuncsArray _index _size getinterval pt /_boundsArray _boundsArray _index _size 1 sub getinterval pt /_encodeArray _encodeArray _index 2 mul _size 2 mul getinterval pt }if =09 /_rampLen _beginCoord _endCoord sub pt bd /ShadingType 3 /ColorSpace _colorSpace /Function=20 bd /FunctionType 3 /Domain [0 1] /Functions _rampFuncsArray /Bounds _boundsArray /Encode _encodeArray ed /Extend [_lastFill _firstFill] /Domain [0 1]=20 /Coords [_xHi _rampLen mul _yHi _rampLen mul _endCoord 0 0 = _beginCoord]=20 ed shfill =09 _radHilite{ _xHi _rampLen mul _yHi _rampLen mul translate }if }def =09 /fillRamp{=20 =09 =09 /_invert _midPoint 0.5 lt pt _rampIndex _maxRampIndex eq { initShFill }if =09 getRampColorSpace =09 _colorSpace null eq{ /_colorSpace _rampColorSpace pt }{ _colorSpace _rampColorSpace ne{ /_index _index 1=20 _gradType 0 eq{ sub pt linealShFill }{ add pt radialShFill }ifelse initShFill /_colorSpace _rampColorSpace pt } if }ifelse /_endCoord _endPoint pt=09 _rampFuncsArray _index bd /FunctionType 2 /Domain [0 1] /N 0.5 log _invert{1 _midPoint sub}{_midPoint}ifelse log div _gradType 0 eq{ _invert{/C1}{/C0}ifelse _C0 _invert{/C0}{/C1}ifelse _C1 }{ _invert{/C0}{/C1}ifelse _C1 _invert{/C1}{/C0}ifelse _C0 }ifelse ed put =09 _rampIndex 1 ne{ _boundsArray _index _gradType 1 eq{1 sub}if _endCoord put } if =09 0 1 _invert {exch}if _encodeArray _index 2 mul 1 add 3 -1 roll put _encodeArray _index 2 mul 3 -1 roll put _rampIndex 1 eq { /_lastFill true pt _gradType 0 eq{ linealShFill }{ radialShFill }ifelse }if /_index _index 1=20 _gradType 0 eq{ add pt }{ sub pt }ifelse }def =09 /radialRamp /fillRamp load def =09 /rampImage /fillRamp load def =09 AGM_Gradient begin /Bc{ 6 npop }def =09 end =09 =09 }def /initializeComposite{ /bwImage{ pop /_image load 5 execImage=20 }def currentdict/rampImage known not{ /rampImage{ _color{ _nSamples setImageParms =09 =09 _rgbRamp{ _redData _greenData _blueData _nSamples 3 expandColor true 3 null ncolorimage }{ _cyanData _magentaData _yellowData _blackData _nSamples 4 = expandColor true 4 null ncolorimage }ifelse }{ _nSamples setImageParms _blackData null bwImage }ifelse }def }if /setCStop{ /_colorStyle exch pt _colorStyle 0 eq{ 1 exch sub 0 0 0 4 -1 roll }if =09 _colorStyle 2 eq{ setrgbcolor 4 npop }if =09 _colorStyle 3 eq{ 1 exch sub /_tmp xp pop 4{ _tmp mul 4 1 roll }repeat }if =09 _colorStyle 4 eq{ 3 -1 roll pop pop 1 exch sub /_tmp xp 3{ 1 exch sub _tmp mul 1 exch sub 3 1 roll }repeat setrgbcolor=20 4 npop }if _colorStyle 2 ne _colorStyle 4 ne and{ null nsetcustomcolor }if }def /nsetcustomcolor { pop setcmykcolor }def /nsetcustomcolorend { }def /ncolorimage{ pop=20 /_colorimage load 10 execImage }def _noImage not _level2PS not and{ /linealFill{ 8 setImageParms _color{ currentcmykcolor 4{ makeByte8 4 1 roll }repeat true 4 null ncolorimage }{ currentgray makeByte8 null bwImage }ifelse }def }if }def /npop{ {pop}repeat }def /xd{ exch def }def /nd{ null def }def /pt{ AGM_Gradient_private 3 1 roll put }def /xp{ exch pt }def /xput{ dup load dup length exch maxlength eq{ dup dup load dup length 2 mul dict copy def }if load begin def end }def /mySave{ save /_sSave xp }def /myRestore{ _sSave type /savetype eq{ _sSave restore }if }def /gMark{ counttomark 2 add -1 roll }def /execImage{ /_tmp xp { exec }stopped{ $error /errorname get /undefinedresult ne{ stop }{ _tmp npop }ifelse }if }def /pushBSpace{ newpath gsave _bUMatrix astore concat=20 }def /popBSpace{ grestore }def /setImageParms{ 1 8 2 index 0 0 1 0 0 _imageMatrix astore }def /linealFill{ 0 0 1 1 rectfill }def /testCMYKColorThrough{ gsave setcmykcolor currentcmykcolor grestore add add add 0 ne }def /expandOne { /_tmp xp dup type /stringtype ne{ _tmp string exch dup 0 ne{ 255 mul cvi 0 1 _tmp 1 sub{ 3 copy exch put pop }for }if pop }if }def /expandColor{ /_channels xp /_len xp _channels{ _len expandOne _channels 1 roll }repeat }def /blendColor{ =09 _color{ _rgbRamp _producingSeps not and{ _redData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if _greenData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if _blueData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if /setrgbcolor cvx }{ _cyanData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if _magentaData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if _yellowData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if _blackData dup type /stringtype eq{ /_ndx cvx /get cvx _d255 /exch cvx /get cvx }if =09 _spotColor{ _rampSD begin /_rampSD cvx /begin cvx =09 spot1 begin tintImage dup type /stringtype eq{ /_ndx cvx /get cvx _d255- /exch cvx /get cvx }{ dup null ne{ name type /nametype ne{ 1 exch sub }if }if }ifelse end /spot1 cvx /tintValue 3 -1 /roll cvx /put cvx =09 spot2 begin tintImage dup type /stringtype eq{ /_ndx cvx /get cvx _d255- /exch cvx /get cvx }{ dup null ne{ name type /nametype ne{ 1 exch sub }if }if }ifelse end /spot2 cvx /tintValue 3 -1 /roll cvx /put cvx /end cvx end /_rampSD cvx /nsetcustomcolor cvx }{ /setcmykcolor cvx }ifelse }ifelse }{ _blackData /_ndx cvx /get cvx _d255 /exch cvx /get cvx =09 _usingSmoothShade{ 1 /exch cvx /sub cvx 0 0 0 4 -1 /roll cvx /setcmykcolor cvx }{ /setgray cvx }ifelse }ifelse }def /linealRamp{ pushBSpace _ramp{ linealImage }{ linealFill }ifelse popBSpace /_rampIndex _rampIndex 1 sub pt _rampIndex 0 gt{ getRampData }if }def /radialGrad{ /_firstShell true pt _usingSmoothShade not{ fill }if pushBSpace =09 _radHilite{ _xHi _yHi _bUMatrix idtransform /_yHi xp /_xHi xp _rampPoint 1 lt{ 1 _rampPoint sub dup _xHi mul exch _yHi mul translate }if }if _rampIndex{ radialRamp /_rampIndex _rampIndex 1 sub pt _rampIndex 0 gt{ getRampData }if }repeat =09 popBSpace =09 }def /getNSamples{ 0 exch { dup type /stringtype eq{ length exch pop exit }if pop }forall dup 0 eq{ pop 1 }if }def /getRampData{ /_rampType gMark pt /_color _rampType 0 gt pt /_ccRGB _rampType 5 eq _rampType 6 eq or pt /_rgbRamp _rampType 4 eq _ccRGB or pt /_ccProcess _rampType 2 eq _rampType 3 eq or pt _producingSeps{ _rampSD initSpotDict /_spotColor _ccProcess _ccRGB or pt }{ /_spotColor false pt }ifelse /_ramp true pt 100 div /_rampPoint xp 100 div /_midPoint xp =09 dup /_colorStyle xp _colorStyle 0 eq{=20 2 }{ _colorStyle 1 eq{=20 5 }{ _colorStyle 2 eq{ 8 }{ _colorStyle 3 eq{ _producingSeps{ _rampSD begin spot1 begin /name 3 index def /spot_K 4 index def /spot_Y 5 index def /spot_M 6 index def /spot_C 7 index def end end }if 7 }{ _producingSeps{ _rampSD begin spot1 begin /name 4 index def /spot_K 8 index def /spot_Y 9 index def /spot_M 10 index def /spot_C 11 index def end end }if 11 } ifelse }ifelse }ifelse }ifelse /_tmp xp _tmp index 100 div /_endPoint xp =09 _gradType 1 eq{ _tmp 1 add index 100 div /_midPoint xp }if =09 _producingSeps{ _tmp 2 add index /_nextColorStyle xp _nextColorStyle 3 eq{ /_tmp _tmp 4 add pt _tmp index dup _rampSD begin spot1 /name get ne{ spot2 begin /name xd /spot_K _tmp 2 add index def /spot_Y _tmp 3 add index def /spot_M _tmp 4 add index def /spot_C _tmp 5 add index def end }{ pop }ifelse end }if _nextColorStyle 4 eq{ /_tmp _tmp 5 add pt _tmp index dup _rampSD begin spot1 /name get ne{ spot2 begin /name xd /spot_K _tmp 5 add index def /spot_Y _tmp 6 add index def /spot_M _tmp 7 add index def /spot_C _tmp 8 add index def end }{ pop }ifelse end }if }if _rampType 3 eq _rampType 6 eq or{ /_tint2Data gMark pt }if _ccProcess _ccRGB or{ /_tint1Data gMark pt }if _rgbRamp{ /_blueData gMark pt /_greenData gMark pt /_redData gMark pt }if =09 _producingSeps{ _rampSD begin _ccProcess _ccRGB or{ _rampType 3 eq _rampType 6 eq or{ spot2 begin /tintImage _gradType 0 eq{ _tint2Data }{ _tint1Data }ifelse def name null eq{ /name /Black def }if end }if spot1 begin /tintImage _gradType 0 eq _rampType 2 eq or _rampType 5 eq or{ _tint1Data }{ _tint2Data }ifelse def _rampType 2 eq _rampType 5 eq or{ name null eq{ /name spot2 /name get def spot2 /name null put }if }{ name null eq{ /name /Black def }if }ifelse end }if end }if /_blackData gMark pt _rampType 0 gt{ counttomark 4 add -3 roll /_yellowData xp /_magentaData xp /_cyanData xp }if _ramp{ /_nSamples [ _rampType 0 eq {_blackData}if _rampType 1 eq {_cyanData _magentaData _yellowData _blackData}if _rampType 2 eq {_cyanData _magentaData _yellowData _blackData = _tint1Data}if _rampType 3 eq {_cyanData _magentaData _yellowData _blackData = _tint1Data _tint2Data}if _rampType 4 eq {_cyanData _magentaData _yellowData _blackData = _redData _greenData _blueData}if _rampType 5 eq {_cyanData _magentaData _yellowData _blackData = _redData _greenData _blueData _tint1Data}if _rampType 6 eq {_cyanData _magentaData _yellowData _blackData = _redData _greenData _blueData _tint1Data _tint2Data}if ] getNSamples pt _usingSmoothShade not {/_ramp _nSamples 1 gt pt} if } if =09 setCStop }def /rectImage{ gsave /_sInc 1 pt /_bInc 1 _nSamples div pt /_uRampLen 1 0 dtransform _dUserSpace idtransform dup mul exch dup mul = add sqrt pt /_pChange _uRampLen 0 eq{0}{_nSamples _uRampLen div}ifelse pt 0 _nSamples [ /dup cvx /_ndx /exch cvx /pt cvx blendColor 0 0 _bInc 1 /rectfill cvx _bInc 0 /translate cvx _sInc /add cvx ] cvx bind repeat pop _spotColor{ nsetcustomcolorend }if grestore }def /radialInit{ /_nRadSamples _nSamples dup 0 eq{pop 1}if pt /_sInc -1 pt /_rampLen _rampPoint _endPoint sub pt /_bInc _rampLen _nSamples div neg pt /_optimize false pt _subSampleOK{ /_uRampLen _rampLen 0 dtransform _dUserSpace idtransform dup mul exch dup mul = add sqrt 0 _rampLen dtransform _dUserSpace idtransform dup mul exch dup mul = add sqrt 2 copy lt{ exch }if pop pt /_pChange=20 _uRampLen 0 eq{ 0 }{ _nSamples _uRampLen div }ifelse pt _pChange .5 gt dup /_optimize xp{ /_nRadSamples _uRampLen 2 div round cvi dup 1 le{pop 2}if pt /_bInc _rampLen _nRadSamples div neg pt /_sInc _nSamples 1 sub _nRadSamples 1 sub div neg pt }if }if _radHilite{ /_xBCInc _xHi _rampLen mul _nRadSamples div pt /_yBCInc _yHi _rampLen mul _nRadSamples div pt }if }def currentdict/radialRamp known not{ /radialRamp{ =09 /_saveMatrix _saveMatrix currentmatrix def =09 radialInit =09 _rampPoint =09 _nSamples 1 sub =09 _nRadSamples=20 [ /dup cvx =09 _optimize{ /round cvx /cvi cvx }if =09 /_ndx /exch cvx /pt cvx =09 _useShells{ /_firstShell cvx{ /_firstShell false pt }{ 0 0 3 index 360 0 arcn fill }/ifelse cvx }if =09 blendColor =09 _useShells{ 0 0 3 /index cvx 0 360 /arc cvx=20 }{ 0 0 3 /index cvx 0 360 /arc cvx /fill cvx }ifelse =09 /exch cvx _bInc /add cvx /exch cvx =09 _sInc /add cvx =09 _radHilite{ _xBCInc _yBCInc /translate cvx }if ] cvx bind repeat =09 pop pop =09 _saveMatrix setmatrix =09 _radHilite{ _xHi _rampLen mul _yHi _rampLen mul translate }if =09 _useShells _rampIndex 1 eq and{ fill }if _spotColor{ nsetcustomcolorend }if =09 =09 }def }if end end defaultpacking setpacking %%EndResource %%BeginProcSet: Adobe_ColorImage_AI6 1.1 0 userdict /Adobe_ColorImage_AI6 known not { userdict /Adobe_ColorImage_AI6 24 dict put=20 } if userdict /Adobe_ColorImage_AI6 get begin /initialize {=20 Adobe_ColorImage_AI6 begin Adobe_ColorImage_AI6 { dup type /arraytype eq { dup xcheck { bind } if } if pop pop } forall } def /terminate { end } def currentdict /Adobe_ColorImage_AI6_Vars known not { /Adobe_ColorImage_AI6_Vars 15 dict def } if Adobe_ColorImage_AI6_Vars begin /channelcount 0 def /sourcecount 0 def /sourcearray 4 array def /plateindex -1 def /XIMask 0 def /XIBinary 0 def /XIChannelCount 0 def /XIBitsPerPixel 0 def /XIImageHeight 0 def /XIImageWidth 0 def /XIImageMatrix null def /XIBuffer null def /XIDataProc null def /XIVersion 6 def end /WalkRGBString null def /WalkCMYKString null def /StuffRGBIntoGrayString null def /RGBToGrayImageProc null def /StuffCMYKIntoGrayString null def /CMYKToGrayImageProc null def /ColorImageCompositeEmulator null def /SeparateCMYKImageProc null def /FourEqual null def /TestPlateIndex null def currentdict /_colorimage known not { /colorimage where { /colorimage get /_colorimage exch def } { /_colorimage null def } ifelse } if /_currenttransfer systemdict /currenttransfer get def /colorimage null def /XI null def /WalkRGBString { 0 3 index dup length 1 sub 0 3 3 -1 roll { 3 getinterval { } forall 5 index exec 3 index } for =09 5 { pop } repeat } def /WalkCMYKString { 0 3 index dup length 1 sub 0 4 3 -1 roll { 4 getinterval { } forall =09 6 index exec =09 3 index =09 } for =09 5 { pop } repeat =09 } def /StuffRGBIntoGrayString { .11 mul exch =09 .59 mul add exch =09 .3 mul add =09 cvi 3 copy put =09 pop 1 add } def /RGBToGrayImageProc {=09 Adobe_ColorImage_AI6_Vars begin=20 sourcearray 0 get exec dup length 3 idiv string dup 3 1 roll=20 =09 /StuffRGBIntoGrayString load exch WalkRGBString end } def /StuffCMYKIntoGrayString { exch .11 mul add =09 exch .59 mul add =09 exch .3 mul add =09 dup 255 gt { pop 255 } if =09 255 exch sub cvi 3 copy put =09 pop 1 add } def /CMYKToGrayImageProc {=09 Adobe_ColorImage_AI6_Vars begin sourcearray 0 get exec dup length 4 idiv string dup 3 1 roll=20 =09 /StuffCMYKIntoGrayString load exch WalkCMYKString end } def /ColorImageCompositeEmulator { pop true eq { Adobe_ColorImage_AI6_Vars /sourcecount get 5 add { pop } repeat } { Adobe_ColorImage_AI6_Vars /channelcount get 1 ne { Adobe_ColorImage_AI6_Vars begin sourcearray 0 3 -1 roll put =09 channelcount 3 eq=20 {=20 /RGBToGrayImageProc=20 } {=20 /CMYKToGrayImageProc } ifelse load end } if image } ifelse } def /SeparateCMYKImageProc {=09 Adobe_ColorImage_AI6_Vars begin sourcecount 0 ne { sourcearray plateindex get exec } { =09 sourcearray 0 get exec =09 dup length 4 idiv string =09 0 2 index =09 plateindex 4 2 index length 1 sub { get 255 exch sub =09 3 copy put pop 1 add =09 2 index } for pop pop exch pop } ifelse end } def =09 /FourEqual { 4 index ne { pop pop pop false } { 4 index ne { pop pop false } { 4 index ne { pop false } { 4 index eq } ifelse } ifelse } ifelse } def /TestPlateIndex { Adobe_ColorImage_AI6_Vars begin /plateindex -1 def /setcmykcolor where { pop gsave 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub grestore 1 0 0 0 FourEqual=20 {=20 /plateindex 0 def } { 0 1 0 0 FourEqual {=20 /plateindex 1 def } { 0 0 1 0 FourEqual { /plateindex 2 def } { 0 0 0 1 FourEqual {=20 /plateindex 3 def } { 0 0 0 0 FourEqual { /plateindex 5 def } if } ifelse } ifelse } ifelse } ifelse pop pop pop pop } if plateindex end } def /colorimage { Adobe_ColorImage_AI6_Vars begin /channelcount 1 index def /sourcecount 2 index 1 eq { channelcount 1 sub } { 0 } ifelse def 4 sourcecount add index dup=20 8 eq exch 1 eq or not end =09 { /_colorimage load null ne { _colorimage } { Adobe_ColorImage_AI6_Vars /sourcecount get 7 add { pop } repeat } ifelse } { dup 3 eq TestPlateIndex dup -1 eq exch 5 eq or or { /_colorimage load null eq { ColorImageCompositeEmulator } { dup 1 eq { pop pop image } { Adobe_ColorImage_AI6_Vars /plateindex get 5 eq { gsave =09 0 _currenttransfer exec 1 _currenttransfer exec eq { 0 _currenttransfer exec 0.5 lt } { 0 _currenttransfer exec 1 _currenttransfer exec gt } ifelse =09 { { pop 0 } } { { pop 1 } } ifelse systemdict /settransfer get exec } if =09 _colorimage =09 Adobe_ColorImage_AI6_Vars /plateindex get 5 eq { grestore } if } ifelse } ifelse } { dup 1 eq { pop pop image } { pop pop Adobe_ColorImage_AI6_Vars begin sourcecount -1 0 { =09 exch sourcearray 3 1 roll put } for /SeparateCMYKImageProc load end systemdict /image get exec } ifelse } ifelse } ifelse } def /XG { pop pop } def /XF { 13 {pop} repeat } def /Xh { Adobe_ColorImage_AI6_Vars begin gsave /XIMask exch 0 ne def /XIImageHeight exch def /XIImageWidth exch def /XIImageMatrix exch def 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale =09 XIMask { /_lp /null ddef _fc /_lp /imagemask ddef } if /XIVersion 7 def end } def /XH { Adobe_ColorImage_AI6_Vars begin /XIVersion 6 def grestore end } def /XI { Adobe_ColorImage_AI6_Vars begin gsave /XIMask exch 0 ne def /XIBinary exch 0 ne def pop pop /XIChannelCount exch def /XIBitsPerPixel exch def /XIImageHeight exch def /XIImageWidth exch def pop pop pop pop /XIImageMatrix exch def XIBitsPerPixel 1 eq { XIImageWidth 8 div ceiling cvi } { XIImageWidth XIChannelCount mul } ifelse /XIBuffer exch string def XIBinary { /XIDataProc { currentfile XIBuffer readstring pop } def XIVersion 6 le { currentfile 128 string readline pop pop } if } { /XIDataProc { currentfile XIBuffer readhexstring pop } def } ifelse =09 XIVersion 6 le { 0 0 moveto XIImageMatrix concat XIImageWidth XIImageHeight scale XIMask { /_lp /null ddef _fc /_lp /imagemask ddef } if } if =09 XIMask { XIImageWidth XIImageHeight false [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] /XIDataProc load imagemask } { XIImageWidth XIImageHeight XIBitsPerPixel [ XIImageWidth 0 0 XIImageHeight neg 0 0 ] /XIDataProc load =09 XIChannelCount 1 eq { gsave 0 setgray image grestore } { false XIChannelCount colorimage } ifelse } ifelse grestore end } def end %%EndProcSet %%BeginResource: procset Adobe_Illustrator_AI5 1.1 0 %%Title: (Adobe Illustrator (R) Version 5.0 Full Prolog) %%Version: 1.1 0 %%CreationDate: (3/7/1994) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) currentpacking true setpacking userdict /Adobe_Illustrator_AI5_vars 81 dict dup begin put /_eo false def /_lp /none def /_pf { } def /_ps { } def /_psf { } def /_pss { } def /_pjsf { } def /_pjss { } def /_pola 0 def /_doClip 0 def /cf currentflat def /_tm matrix def /_renderStart [ /e0 /r0 /a0 /o0 /e1 /r1 /a1 /i0 ] def /_renderEnd [ null null null null /i1 /i1 /i1 /i1 ] def /_render -1 def /_rise 0 def /_ax 0 def /_ay 0 def /_cx 0 def /_cy 0 def /_leading [ 0 0 ] def /_ctm matrix def /_mtx matrix def /_sp 16#020 def /_hyphen (-) def /_fScl 0 def /_cnt 0 def /_hs 1 def /_nativeEncoding 0 def /_useNativeEncoding 0 def /_tempEncode 0 def /_pntr 0 def /_tDict 2 dict def /_wv 0 def /Tx { } def /Tj { } def /CRender { } def /_AI3_savepage { } def /_gf null def /_cf 4 array def /_if null def /_of false def /_fc { } def /_gs null def /_cs 4 array def /_is null def /_os false def /_sc { } def /_pd 1 dict def /_ed 15 dict def /_pm matrix def /_fm null def /_fd null def /_fdd null def /_sm null def /_sd null def /_sdd null def /_i null def /discardSave null def /buffer 256 string def /beginString null def /endString null def /endStringLength null def /layerCnt 1 def /layerCount 1 def /perCent (%) 0 get def /perCentSeen? false def /newBuff null def /newBuffButFirst null def /newBuffLast null def /clipForward? false def end userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 91 dict put } if userdict /Adobe_Illustrator_AI5 get begin /initialize { Adobe_Illustrator_AI5 dup begin Adobe_Illustrator_AI5_vars begin discardDict { bind pop pop } forall dup /nc get begin { dup xcheck 1 index type /operatortype ne and { bind } if pop pop } forall end newpath } def /terminate { end end } def /_ null def /ddef { Adobe_Illustrator_AI5_vars 3 1 roll put } def /xput { dup load dup length exch maxlength eq { dup dup load dup length 2 mul dict copy def } if load begin def end } def /npop { { pop } repeat } def /sw { dup length exch stringwidth exch 5 -1 roll 3 index mul add 4 1 roll 3 1 roll mul add } def /swj { dup 4 1 roll dup length exch stringwidth exch 5 -1 roll 3 index mul add 4 1 roll 3 1 roll mul add 6 2 roll /_cnt 0 ddef { 1 index eq { /_cnt _cnt 1 add ddef } if } forall pop exch _cnt mul exch _cnt mul 2 index add 4 1 roll 2 index add 4 1 roll = pop pop } def /ss { 4 1 roll { 2 npop (0) exch 2 copy 0 exch put pop gsave false charpath currentpoint 4 index setmatrix stroke grestore moveto 2 copy rmoveto } exch cshow 3 npop } def /jss { 4 1 roll { 2 npop (0) exch 2 copy 0 exch put gsave _sp eq { exch 6 index 6 index 6 index 5 -1 roll widthshow currentpoint } { false charpath currentpoint 4 index setmatrix stroke } ifelse grestore moveto 2 copy rmoveto } exch cshow 6 npop } def /sp { { 2 npop (0) exch 2 copy 0 exch put pop false charpath 2 copy rmoveto } exch cshow 2 npop } def /jsp { { 2 npop (0) exch 2 copy 0 exch put _sp eq { exch 5 index 5 index 5 index 5 -1 roll widthshow } { false charpath } ifelse 2 copy rmoveto } exch cshow 5 npop } def /pl { transform 0.25 sub round 0.25 add exch 0.25 sub round 0.25 add exch itransform } def /setstrokeadjust where { pop true setstrokeadjust /c { curveto } def /C /c load def /v { currentpoint 6 2 roll curveto } def /V /v load def /y { 2 copy curveto } def /Y /y load def /l { lineto } def /L /l load def /m { moveto } def } { /c { pl curveto } def /C /c load def /v { currentpoint 6 2 roll pl curveto } def /V /v load def /y { pl 2 copy curveto } def /Y /y load def /l { pl lineto } def /L /l load def /m { pl moveto } def } ifelse /d { setdash } def /cf { } def /i { dup 0 eq { pop cf } if setflat } def /j { setlinejoin } def /J { setlinecap } def /M { setmiterlimit } def /w { setlinewidth } def /XR { 0 ne /_eo exch ddef } def /H { } def /h { closepath } def /N { _pola 0 eq { _doClip 1 eq { _eo {eoclip} {clip} ifelse /_doClip 0 ddef } if newpath } { /CRender { N } ddef } ifelse } def /n { N } def /F { _pola 0 eq { _doClip 1 eq { gsave _pf grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef = _fc /_doClip 0 ddef } { _pf } ifelse } { /CRender { F } ddef } ifelse } def /f { closepath F } def /S { _pola 0 eq { _doClip 1 eq { gsave _ps grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef = _sc /_doClip 0 ddef } { _ps } ifelse } { /CRender { S } ddef } ifelse } def /s { closepath S } def /B { _pola 0 eq { _doClip 1 eq gsave F grestore { gsave S grestore _eo {eoclip} {clip} ifelse newpath /_lp /none ddef = _sc /_doClip 0 ddef } { S } ifelse } { /CRender { B } ddef } ifelse } def /b { closepath B } def /W { /_doClip 1 ddef } def /* { count 0 ne { dup type /stringtype eq { pop } if } if newpath } def /u { } def /U { } def /q { _pola 0 eq { gsave } if } def /Q { _pola 0 eq { grestore } if } def /*u { _pola 1 add /_pola exch ddef } def /*U { _pola 1 sub /_pola exch ddef _pola 0 eq { CRender } if } def /D { pop } def /*w { } def /*W { } def /` { /_i save ddef clipForward? { nulldevice } if 6 1 roll 4 npop concat pop userdict begin /showpage { } def 0 setgray 0 setlinecap 1 setlinewidth 0 setlinejoin 10 setmiterlimit [] 0 setdash /setstrokeadjust where {pop false setstrokeadjust} if newpath 0 setgray false setoverprint } def /~ { end _i restore } def /O { 0 ne /_of exch ddef /_lp /none ddef } def /R { 0 ne /_os exch ddef /_lp /none ddef } def /g { /_gf exch ddef /_fc { _lp /fill ne { _of setoverprint _gf setgray /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc ashow } ddef /_pjsf { _fc awidthshow } ddef /_lp /none ddef } def /G { /_gs exch ddef /_sc { _lp /stroke ne { _os setoverprint _gs setgray /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /k { _cf astore pop /_fc { _lp /fill ne { _of setoverprint _cf aload pop setcmykcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc ashow } ddef /_pjsf { _fc awidthshow } ddef /_lp /none ddef } def /K { _cs astore pop /_sc { _lp /stroke ne { _os setoverprint _cs aload pop setcmykcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /x { /_gf exch ddef findcmykcustomcolor /_if exch ddef /_fc { _lp /fill ne { _of setoverprint _if _gf 1 exch sub setcustomcolor /_lp /fill ddef } if } ddef /_pf { _fc _eo {eofill} {fill} ifelse } ddef /_psf { _fc ashow } ddef /_pjsf { _fc awidthshow } ddef /_lp /none ddef } def /X { /_gs exch ddef findcmykcustomcolor /_is exch ddef /_sc { _lp /stroke ne { _os setoverprint _is _gs 1 exch sub setcustomcolor /_lp /stroke ddef } if } ddef /_ps { _sc stroke } ddef /_pss { _sc ss } ddef /_pjss { _sc jss } ddef /_lp /none ddef } def /A { pop } def /annotatepage { userdict /annotatepage 2 copy known {get exec} {pop pop} ifelse } def /XT { pop pop } def /discard { save /discardSave exch store discardDict begin /endString exch store gt38? { 2 add } if load stopped pop end discardSave restore } bind def userdict /discardDict 7 dict dup begin put /pre38Initialize { /endStringLength endString length store /newBuff buffer 0 endStringLength getinterval store /newBuffButFirst newBuff 1 endStringLength 1 sub getinterval store /newBuffLast newBuff endStringLength 1 sub 1 getinterval store } def /shiftBuffer { newBuff 0 newBuffButFirst putinterval newBuffLast 0 currentfile read not { stop } if put } def 0 { pre38Initialize mark currentfile newBuff readstring exch pop { { newBuff endString eq { cleartomark stop } if shiftBuffer } loop } { stop } ifelse } def 1 { pre38Initialize /beginString exch store mark currentfile newBuff readstring exch pop { { newBuff beginString eq { /layerCount dup load 1 add store } { newBuff endString eq { /layerCount dup load 1 sub store layerCount 0 eq { cleartomark stop } if } if } ifelse shiftBuffer } loop } if } def 2 { mark { currentfile buffer readline not { stop } if endString eq { cleartomark stop } if } loop } def 3 { /beginString exch store /layerCnt 1 store mark { currentfile buffer readline not { stop } if dup beginString eq { pop /layerCnt dup load 1 add store } { endString eq { layerCnt 1 eq { cleartomark stop } { /layerCnt dup load 1 sub store } ifelse } if } ifelse } loop } def end userdict /clipRenderOff 15 dict dup begin put { /n /N /s /S /f /F /b /B } { { _doClip 1 eq { /_doClip 0 ddef _eo {eoclip} {clip} ifelse } if newpath } def } forall /Tr /pop load def /Bb {} def /BB /pop load def /Bg {12 npop} def /Bm {6 npop} def /Bc /Bm load def /Bh {4 npop} def end /Lb { 4 npop 6 1 roll pop 4 1 roll pop pop pop 0 eq { 0 eq { (%AI5_BeginLayer) 1 (%AI5_EndLayer--) discard } { =09 /clipForward? true def =09 /Tx /pop load def /Tj /pop load def =09 currentdict end clipRenderOff begin begin } ifelse } { 0 eq { save /discardSave exch store } if } ifelse } bind def /LB { discardSave dup null ne { restore } { pop clipForward? { currentdict end end begin =09 /clipForward? false ddef } if } ifelse } bind def /Pb { pop pop 0 (%AI5_EndPalette) discard } bind def /Np { 0 (%AI5_End_NonPrinting--) discard } bind def /Ln /pop load def /Ap /pop load def /Ar { 72 exch div 0 dtransform dup mul exch dup mul add sqrt dup 1 lt { pop 1 } if setflat } def /Mb { q } def /Md { } def /MB { Q } def /nc 3 dict def nc begin /setgray { pop } bind def /setcmykcolor { 4 npop } bind def /setcustomcolor { 2 npop } bind def currentdict readonly pop end end setpacking %%EndResource %%BeginResource: procset Adobe_blend_AI5 1.4 0 %%Title: (Adobe Illustrator (R) Version 5.0 Blend ProcSet) %%Version: 1.4 0 %%CreationDate: (11/19/93) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) userdict /defaultpacking currentpacking put true setpacking userdict /Adobe_blend_AI5 70 dict dup begin put /bd { bind def } bind def /xs { exch store } bd /nullProc { { } } def /initialize { pop pop Adobe_blend_AI5 begin Adobe_blend_AI5_vars begin /_contoneDevice where { pop } { /_contoneDevice false def=09 } ifelse =09 /_dpiThreshold where { pop } {=09 /_dpiThreshold 600 def } ifelse =09 /_screenFreqThreshold where { pop } {=09 /_screenFreqThreshold 150 def } ifelse =09 /tRectOK? deviceDPI _dpiThreshold le currentScreenFreq = _screenFreqThreshold le and _contoneDevice not and def /invertXfer { [ { 1 exch sub } /exec load systemdict/currenttransfer get exec /exec load ] cvx systemdict/settransfer get exec } bd /spotDict 3 dict dup begin /nSpots 2 def /spot1 7 dict def /spot2 7 dict def end def composite? { /_setgray_ /setgray load def /_fill_ /fill load def /_image_ /image load def } { /_setgray_ systemdict/setgray get def /_fill_ systemdict/fill get def /_image_ systemdict/image get def } ifelse } bd /terminate { currentdict Adobe_blend_AI5_vars eq { end currentdict Adobe_blend_AI5 eq { end } if } if } bd /_compositeSpotDevice where { begin _compositeSpotDevice 0 ne {userdict /composite? true put} if end } { /_compositeSpotDevice 0 def=09 } ifelse =09 /nullString () def /d255 256 array def 0 1 255 { d255 exch dup 255 div put } bind for /d255- 256 array def 0 1 255 { d255- exch 1 d255 2 index get sub put } bind for /dUserSpace matrix defaultmatrix def currentdict /Adobe_blend_AI5_vars 89 dict dup begin put { /f /F /s /S /b /B } { null def } bind forall /byte 1 string def /sSave null def /setSSave { save /sSave exch store } bind def /Bm null def /doBlend null def /startC? false def /endC? false def /fCMYK? null def /startTint 0 def /endTint 0 def /bSMatrix matrix def /bUMatrix matrix def /dMatrix matrix def /inLine? true def /pTState? false def /bHi? false def /yHi 0 def /xHi 0 def /noImg /lv1Fix where { pop lv1Fix } { false } ifelse def /ccAry1 5 array def /ccTint 0 def /spotColor? false def /colorimage? true def [ /tint1Data /tint2Data /spotDict /bAxis /ubAxis /pChange /optimize? /nSamples /sInc /blendProc /_bn /xBCInc /yBCInc /bInc /bRender /cBName /cBType /nColors /color? /blend? /colorType /cData /cDataLen /bDataLen /rampPoint /midPoint /endPoint /blendLength /blackData /yeData /mgData /cyData /cnt1 /ndx /_fill /tmp counttomark { null def } bind repeat pop currentdict end currentdict end exch begin begin /unitSq { 0 0 moveto 0 1 lineto 1 1 lineto 1 0 lineto closepath } bd /gMark { counttomark 2 add -1 roll } bd /setCustomColor { dup /ccTint exch store 1 exch sub 6 1 roll ccAry1 astore exch setcustomcolor } bd /currentCustomColor { ccAry1 aload pop ccTint } bd /nsetcustomcolor where=20 { pop } { /nsetcustomcolor { pop setcmykcolor=09 } bd } ifelse /nsetcustomcolorend where=20 { pop } { /nsetcustomcolorend { } bd } ifelse /setBSpace { newpath bUMatrix astore concat unitSq } bd /setCStop { dup 0 eq { pop =09 spotColor? { dup 1 exch sub /ccTint exch def ccAry1 4 /Black put } if setgray } { 1 eq { setcmykcolor } { composite? not colorType 2 lt and { forceCMYK } { setCustomColor } ifelse } ifelse } ifelse } bd /makeByte { /tmp 0 store 255 mul cvi 8 string 8 { dup tmp 3 index put /tmp tmp 1 add store } repeat exch pop } bd /setImgSpace { cDataLen 1 8 2 index 0 0 1 0 0 dMatrix astore } bd /bwImage { setImgSpace cData /_image_ load { exec } stopped { $error /errorname get /undefinedresult ne { stop } { pop pop pop pop pop } ifelse } if } bd level2? { /bFill { _fill } def /bCImg { /cDataLen bDataLen store setImgSpace setSSave expandSpot cyData mgData yeData cData expandCMYK true 4 spotDict { ncolorimage } stopped { $error /errorname get /undefinedresult ne { stop } { 10 { pop } repeat } ifelse } if sSave restore } bd } if /expandOne { dup type /stringtype ne { cDataLen string exch dup 0 ne { 255 mul cvi 0 1 cDataLen 1 sub { 3 copy exch put pop } for } if pop } if } bd /expandSpot { spotColor? { spotDict begin spot1 begin tintImage type /nulltype ne { tintImage expandOne /tintImage exch def } if end spot2 begin tintImage type /nulltype ne { tintImage expandOne /tintImage exch def } if end end } if } bd /expandCMYK { 4 { expandOne 4 1 roll } repeat } bd /colorimage where dup { exch pop =09 /ncolorimage where { pop } { /ncolorimage {pop colorimage} bd } ifelse } if not { /ncolorimage where=20 { pop } { /colorimage? false store /ncolorimage { pop pop pop =09 setSSave /blackData xs /yeData xs /mgData xs /cyData xs /cnt1 0 store [ byte dup 0 cyData dup type /stringtype eq { /cnt1 cvx /get cvx d255 /exch cvx /get cvx .3 /mul cvx } { .3 mul } ifelse mgData dup type /stringtype eq { /cnt1 cvx /get cvx d255 /exch cvx /get cvx .59 /mul cvx } { .59 mul } ifelse yeData dup type /stringtype eq { /cnt1 cvx /get cvx d255 /exch cvx /get cvx .11 /mul cvx } { .11 mul } ifelse blackData dup type /stringtype eq { /cnt1 cvx /get cvx d255 /exch cvx /get cvx } if /add cvx /add cvx /add cvx 1 /exch cvx /sub cvx /dup cvx 0 /lt cvx { pop 0 } /if cvx /dup cvx 1 /gt cvx { pop 1 } /if cvx 255 /mul cvx /cvi cvx 256 /mod cvx /dup cvx 0 /lt cvx { pop 0 } /if cvx /put cvx /cnt1 dup cvx 1 /add cvx /store cvx ] cvx bind _image_=20 sSave restore } bd } ifelse } if level2? not { /bCImg { /cDataLen bDataLen store setImgSpace setSSave expandSpot cyData mgData yeData cData colorimage?=20 { expandCMYK } if true 4 spotDict { ncolorimage } stopped { $error /errorname get /undefinedresult ne { stop } { 10 { pop } repeat } ifelse } if sSave restore } bd /bwFill { setSSave /cDataLen 8 store /cData currentgray makeByte store bwImage sSave restore } bd /c1ImgFill { setSSave /cDataLen 8 store setImgSpace spotColor? { spotDict begin spot1 begin currentCustomColor makeByte /tintImage exch def /name exch def /spot_K exch def /spot_Y exch def /spot_M exch def /spot_C exch def end spot2 initSpotData end } if currentcmykcolor 4 { makeByte 4 1 roll } repeat true 4 spotDict { ncolorimage } stopped { $error /errorname get /undefinedresult ne { stop } { 10 { pop } repeat } ifelse } if sSave restore } bd /bFill noImg { { _fill } } { { color? { c1ImgFill } { bwFill } ifelse } } ifelse bd } if composite? { /bCFun { color? { cyData dup type /stringtype eq { /ndx cvx /get cvx d255 /exch cvx /get cvx } if mgData dup type /stringtype eq { /ndx cvx /get cvx d255 /exch cvx /get cvx } if yeData dup type /stringtype eq { /ndx cvx /get cvx d255 /exch cvx /get cvx } if cData dup type /stringtype eq { /ndx cvx /get cvx d255 /exch cvx /get cvx } if spotColor? { spotDict begin /spotDict cvx /begin cvx spot1 begin tintImage dup type /stringtype eq { /ndx cvx /get cvx d255- /exch cvx /get cvx } { dup type /nulltype ne=20 { name type /nametype ne {1 exch sub} if } if } ifelse end /spot1 cvx /tintValue 3 -1 /roll cvx /put cvx spot2 begin tintImage dup type /stringtype eq { /ndx cvx /get cvx d255- /exch cvx /get cvx } { dup type /nulltype ne=20 { name type /nametype ne {1 exch sub} if } if } ifelse end /spot2 cvx /tintValue 3 -1 /roll cvx /put cvx /end cvx end /spotDict cvx /nsetcustomcolor cvx } { /setcmykcolor cvx } ifelse } { cData /ndx cvx /get cvx d255 /exch cvx /get cvx /setgray cvx } ifelse } bd /Bc { newpath gsave setBSpace nColors 1 eq { pop pop setCStop } if bFill grestore } bd /linealBm { /nColors dup load 1 sub store newpath gsave setBSpace blend? { linImg } { bFill } ifelse grestore nColors 1 gt { getRData } if } bd /rdBm { /nColors dup load 1 sub store _fill gsave bUMatrix astore concat bHi? { xHi yHi bUMatrix idtransform /yHi exch store /xHi exch store rampPoint 1 lt { 1 rampPoint sub dup xHi mul exch yHi mul translate } if } if nColors { 0 0 rampPoint 0 360 arc _fill blend? bHi? or { rdBlend } if nColors 1 gt { getRData } if /nColors dup load 1 sub store } repeat /nColors 1 store grestore } bd /cGetRData { setCStop /blend? cData type /stringtype eq dup not color? and { pop cyData type /stringtype eq mgData type /stringtype eq yeData type /stringtype eq or or } if store } def /cGetRData } if /eCStop { mark 1 index 3 mul 3 add dup 8 gt { pop 8 } if 1 roll cleartomark } bd composite? not { /knockOut level2? { { 0 0 0 0 setcmykcolor _fill } } { /bFill noImg { { _fill } } { { _of true eq { currentgray 1 ne { bwFill } if } { bwFill } ifelse } } ifelse def /whiteByte 1 makeByte def noImg { { 0 0 0 0 setcmykcolor _fill } } { { cBType 0 eq { setSSave /cData whiteByte store /cDataLen 8 store bwImage sSave restore } { _fill } ifelse } } ifelse } ifelse bd /bCFun { cData dup type /stringtype ne { color? { 1 exch sub } if } { /ndx cvx /get cvx color? customColor? not and { d255- } { d255 } ifelse /exch cvx /get cvx } ifelse /_setgray_ cvx } bd /eCCBlend { dup 3 eq { pop mark 7 1 roll 6 copy ccThrough? dup /blend? xs { /startC? true store setCustomColor customColor? { /cData tint1Data store setCDataLen } if /endC? 3 index 3 eq { 4 index 1 ne } { false } ifelse store } if cleartomark stop } if 1 eq { pop pop pop } if pop /startC? false store 6 { 8 index } repeat ccThrough? dup /blend? xs { /endC? true store blend? not { stop } if customColor? { /cData tint1Data store setCDataLen } if } if } bd /handleOP { _of not { knockOut } if } bd /handleROP { _of not { 0 0 0 0 setcmykcolor _fill } { newpath=09 } ifelse } bd /rdBm { /nColors dup load 1 sub store blend?=20 { _fill } { handleROP } ifelse gsave bUMatrix astore concat bHi? { xHi yHi bUMatrix idtransform /yHi exch store /xHi exch store rampPoint 1 lt { 1 rampPoint sub dup xHi mul exch yHi mul translate } if } if nColors { 0 0 rampPoint 0 360 arc blend? { cData type /stringtype ne bHi? not and { cData color? { 1 exch sub } if _setgray_=20 _fill_=20 } { cData type /stringtype ne { /cDataLen 1 store /bDataLen 1 store } if rdBlend } ifelse } { =09 handleROP =09 pTState? { /bAxis rampPoint endPoint sub store xHi bAxis mul yHi bAxis mul translate } if } ifelse =09 nColors 1 gt { getRData } if /nColors dup load 1 sub store } repeat /nColors 1 store grestore } bd /ccThrough? { gsave pop 0 setCustomColor currentcmykcolor grestore anyColor? } bd /forceCMYK { exch pop 1 exch sub 5 1 roll 4 { 4 index mul 4 1 roll } repeat 0 cCMYKData dup /cData ne { dup /yeData eq { pop 1 add } { /mgData eq { 2 } { 3 } ifelse add } ifelse 0 } if pop index 0 eq { pop pop pop pop 0 0 0 0 } if setcmykcolor pop /fCMYK? true store } bd /endCapSepBc { pop pop dup 0 eq { pop setgray } { 1 eq { setcmykcolor } { colorType 1 eq { forceCMYK } { fCMYK? { forceCMYK } { setCustomColor } ifelse } ifelse } ifelse } ifelse currentcmykcolor anyColor?=20 blend? and { bFill } { handleOP } ifelse =09 } bd } if /cCMYKData 0 def composite? dup not { pop customColor? } if not { /cCMYKData /cyData /mgData /yeData /cData black? not { yellow? { exch } { magenta? { 3 } { 4 } ifelse -1 roll } ifelse } if 4 1 roll pop pop pop store /Bc { gsave setBSpace nColors 1 gt { =09 blend? currentcmykcolor anyColor? and { bFill } { handleOP } ifelse } { endCapSepBc } ifelse grestore newpath } bd /linealBm { /nColors dup load 1 sub store newpath gsave setBSpace blend? { cCMYKData load dup type /stringtype eq { dup length /cDataLen xs /cData xs gsave colorType 0 ne noImg not and { invertXfer } if linImg grestore } { pop bFill } ifelse } { handleOP } ifelse grestore nColors 1 gt { getRData } if } bd /cmykGetRData { /fCMYK? false store blend? { { cmykDataProcs colorType get exec } stopped pop blend? { /cData cCMYKData load store setCDataLen } if } if } def /cmykDataProcs [ { pop black? dup /blend? xs { setgray 0 } if pop } { cCMYKData load dup type /stringtype ne { 0 0 0 cyan? not { 4 magenta? { 1 } { yellow? { 2 } { 3 } ifelse } ifelse roll } if 4 copy add add add 0 eq { /blend? false store } if =09 setcmykcolor /startC? true store /endC? true store eCStop stop } if pop dup 0 eq { pop setgray } { 1 eq { setcmykcolor } { forceCMYK } ifelse } ifelse } bind /eCCBlend load { cBType 1 eq { tint1Data tint2Data /tint1Data xs /tint2Data xs } if 0 eq { black? { setgray } { 0 0 0 4 -1 roll 1 exch sub setcmykcolor } ifelse black? { /blend? true store } if 6 { 8 index } repeat ccThrough? { /blend? true store } { black? { /cData tint1Data store setCDataLen } { /blend? false store } ifelse } ifelse } { mark 7 1 roll 6 copy ccThrough? { forceCMYK pop stop } if 9 index 0 eq { black? dup /blend? xs { pop 1 setgray /cData tint2Data store setCDataLen 0 } if pop } { /blend? 6 { 16 index } repeat ccThrough? store blend? { forceCMYK } if } ifelse cleartomark } ifelse } bind ] def /cmykGetRData } if composite? dup not { pop isCMYKSep? } if not { /endCapSepBc { /white? false store pop pop dup 0 eq { pop /white? 1 index 1 eq store setgray } { 1 eq { setcmykcolor } { setCustomColor } ifelse } ifelse % currentcmykcolor anyColor? endC? or blend? and { bFill } { handleOP } ifelse } bd /Bc { gsave setBSpace nColors 1 gt { blend? startC? and { bFill } { handleOP } ifelse } { endCapSepBc } ifelse grestore newpath } bd /linealBm { /nColors dup load 1 sub store newpath gsave setBSpace blend? { cData type /stringtype eq { linImg } { bFill } ifelse } { handleOP } ifelse grestore nColors 1 gt { getRData } if } bd /discardCMY { counttomark 4 add -3 roll pop pop pop } bd /testTopCC { 6 copy ccThrough? } bd /getCRamp { { ccDataProcs colorType 2 sub get exec } stopped pop blend? cDataLen 0 eq and { /cDataLen bDataLen store } if } bd /ccGetRData { /fCMYK? false store /startC? false store /endC? false store colorType 2 lt { /blend? false def } if blend? { getCRamp } { setCStop } ifelse blend? { /blend? cData 1 ne store blend? { cData dup type /stringtype ne { 1 exch sub /cData xs 0 } if pop } if } if } def /ccDataProcs [ /eCCBlend load { cBType 1 eq { tint1Data tint2Data /tint1Data xs /tint2Data xs } if 0 eq { /blend? false store pop } { mark 7 1 roll testTopCC { /blend? 1 index 1 ne store /startC? blend? store /endC? false store blend? not { cleartomark stop } if /cData tint1Data store setCDataLen setCustomColor pop stop } if cleartomark } ifelse 2 index 0 eq { /blend? false store } { mark 6 { 9 index } repeat testTopCC dup /blend? xs { /blend? 1 index 1 ne store /endC? blend? store /startC? false store blend? not { cleartomark stop } if /cData tint2Data store setCDataLen } if cleartomark } ifelse } bind ] def /ccGetRData } if load Adobe_blend_AI5_vars /getData 3 -1 roll put /setCDataLen { /cDataLen 0 cData dup type /stringtype eq { length exch } if pop store } bd /initSpotData { begin /name null def /tintImage null def /tintValue null def /spot_C null def /spot_M null def /spot_Y null def /spot_K null def end } bd /getRData { /colorType gMark store _compositeSpotDevice 0 ne { spotDict begin spot1 initSpotData spot2 initSpotData end /spotColor? colorType 2 eq colorType 3 eq or def }=20 { /spotColor? false store } ifelse /blend? true store 0 0 0 0 setcmykcolor 100 div /rampPoint xs % (between 13 and 87%)=20 100 div /midPoint xs dup 0 eq { 2 } { dup 1 eq { 5 } { _compositeSpotDevice 0 ne { spotDict begin spot1 begin /name 3 index def /spot_K 4 index def /spot_Y 5 index def /spot_M 6 index def /spot_C 7 index def end end } if 7 } ifelse } ifelse /tmp exch def tmp index 100 div /endPoint xs _compositeSpotDevice 0 ne { tmp 2 add index 3 eq { /tmp tmp 4 add def tmp index dup=20 spotDict begin spot1/name get ne { spot2 begin /name exch def /spot_K tmp 2 add index def /spot_Y tmp 3 add index def /spot_M tmp 4 add index def /spot_C tmp 5 add index def end } { pop } ifelse end } if } if /color? colorType 0 gt store =09 colorType 3 eq { /tint2Data gMark store } if =09 colorType 2 ge { /tint1Data gMark store } if _compositeSpotDevice 0 ne { spotDict begin =09 colorType 2 ge { colorType 3 eq { spot2 begin /tintImage cBType 0 eq {tint2Data} {tint1Data} ifelse def name null eq {/name /Black def} if end } if spot1 begin /tintImage cBType 0 eq colorType 2 eq or {tint1Data} {tint2Data} = ifelse def colorType 2 eq=20 { name null eq=20 { /name spot2/name get def spot2/name null put } if } { name null eq {/name /Black def} if } ifelse end } if end } if =09 /cData gMark store setCDataLen colorType 0 gt { counttomark 4 add -3 roll /yeData xs /mgData xs /cyData xs } if blend? { /bDataLen cDataLen dup 0 eq color? and { [ cyData mgData yeData ] { dup type /stringtype eq { length exch pop exit } if pop } forall } if store bDataLen 0 eq { /bDataLen 1 store } if getData blend? { composite? cDataLen 0 eq and { /cDataLen bDataLen store } if } if } { setCStop } ifelse } bd /Bg { 0 0 0 0 setcmykcolor 6 { pop } repeat /blendLength xs pop pop pop /cBName xs /bRender xs bRender 2 ne { composite? not { _of setoverprint } if _eo {eoclip} {clip} ifelse _bn cBName 2 copy known { get mark exch aload pop /cBType xs /nColors xs mark exch aload pop 0 0 } if pop pop getRData cBType 0 eq { /linealBm } { bHi? { /pTState? nColors 2 gt store } if /doBlend /rdBlend load store /rdBm } ifelse } { inLine? not { mark mark } if /Bc dup { cleartomark mark } bd /nullProc } ifelse load /Bm xs } bd /linImg noImg { { newpath doRctBlend } } { { /doBlend color? composite? and { /bCImg } { /bwImage } ifelse load store =09 0 0 moveto tRectOK? composite? and { { mark 0 1 dtransform atan cvi 90 mod 0 eq 1 0 dtransform atan cvi 90 mod 0 eq } stopped { cleartomark } { and exch pop { newpath doRctBlend } { doBlend } ifelse } ifelse } { doBlend } ifelse }=20 } ifelse bd /doRctBlend { gsave /sInc 1 store /nSamples bDataLen store /bInc 1 bDataLen div store /ubAxis 1 0 dtransform dUserSpace idtransform dup mul exch dup mul add = sqrt store /pChange ubAxis 0 eq { 0 } { bDataLen ubAxis div } ifelse store pChange .5 gt noImg not and dup /optimize? xs { /nSamples ubAxis 2 div round cvi dup 1 le { pop 2 } if store /bInc 1 nSamples div store /sInc bDataLen 1 sub nSamples 1 sub div store } if 0 nSamples [ /dup cvx optimize? { /round cvx /cvi cvx } if /ndx /exch cvx /store cvx bCFun /rectfill where dup { exch pop _compositeSpotDevice 1 ne and } if { 0 0 bInc 1 /rectfill cvx=09 } { 0 0 /moveto cvx bInc 0 /lineto cvx bInc 1 /lineto cvx 0 1 /lineto cvx /closepath cvx /_fill_ cvx } ifelse bInc 0 /translate cvx sInc /add cvx ] cvx bind repeat pop spotColor? {nsetcustomcolorend} if =09 grestore } bd /rdPrep { /nSamples bDataLen dup 0 eq { pop 1 } if store /sInc -1 store /bAxis rampPoint endPoint sub store /bInc bAxis bDataLen div neg store /optimize? false store tRectOK? { /ubAxis bAxis 0 dtransform dUserSpace idtransform dup mul exch dup mul add = sqrt 0 bAxis dtransform dUserSpace idtransform dup mul exch dup mul add = sqrt 2 copy lt { exch } if pop store /pChange ubAxis 0 eq { 0 } { bDataLen ubAxis div } ifelse store pChange .5 gt noImg not and dup /optimize? xs { /nSamples ubAxis 2 div round cvi dup 1 le { pop 2 } if store /bInc bAxis nSamples div neg store /sInc bDataLen 1 sub nSamples 1 sub div neg store } if } if bHi? { /xBCInc xHi bAxis mul nSamples div store /yBCInc yHi bAxis mul nSamples div store } if } bd /rdBlend { newpath gsave rdPrep rampPoint bDataLen 1 sub nSamples [ /dup cvx optimize? { /round cvx /cvi cvx } if /ndx /exch cvx /store cvx bCFun 0 0 3 /index cvx 0 360 /arc cvx /_fill_ cvx /exch cvx bInc /add cvx /exch cvx sInc /add cvx bHi? { xBCInc yBCInc /translate cvx } if ] cvx bind repeat pop pop spotColor? {nsetcustomcolorend} if grestore pTState? { xHi bAxis mul yHi bAxis mul translate } if } bd /Bh { pop pop /pTState? false store 2 copy 0 ne exch 0 ne or dup /bHi? xs { /yHi xs /xHi xs 0 0 } if pop pop } bd /BD { inLine? not { ] nColors cBType ] _bn cBName 3 -1 roll put end } if } bd /Bn { 1 add dict dup nullString null put /_bn xs } bd /Bd { Adobe_blend_AI5_vars begin 3 -1 roll dup nullString eq dup { setSSave } if /inLine? exch def /cBName exch def /nColors exch def /cBType exch def } bd /Bb { sSave null eq { Adobe_blend_AI5_vars begin setSSave } if composite? { /_fill /fill load store } { /__fill /fill load store /_fill { _of true eq { currentgray 1 ne { __fill } if } { __fill } ifelse } def } ifelse /fill { } def } bd /BB { /cBType xs cleartomark cleartomark cBType dup bRender sSave dup type /savetype eq { restore 0 } if pop currentdict Adobe_blend_AI5_vars eq { end } if 2 ne exch 0 gt and { 2 eq { s } { S } ifelse } { pop newpath } ifelse } bd currentdict readonly pop end end defaultpacking setpacking %%EndResource %%BeginResource: procset Adobe_pattern_AI5 1.1 0 %%Title: (Adobe Illustrator (R) Version 5.0 Pattern Operators) %%Version: 1.1 0 %%CreationDate: (03/26/93) () %%Copyright: ((C) 1987-1996 Adobe Systems Incorporated All Rights = Reserved) currentpacking true setpacking userdict /Adobe_Illustrator_AI5 known not { userdict /Adobe_Illustrator_AI5 95 dict put } if userdict /Adobe_Illustrator_AI5 get begin /@ { } def /& { } def /dp { dup null eq { pop _dp 0 ne { 0 1 _dp 1 sub _dl mod { _da exch get 3 get } for _dp 1 sub _dl mod 1 add packedarray _da 0 get aload pop 8 -1 roll 5 -1 roll pop 4 1 roll definepattern pop } if } { _dp 0 ne _dp _dl mod 0 eq and { null dp } if 7 packedarray _da exch _dp _dl mod exch put _dp _dl mod _da 0 get 4 get 2 packedarray /_dp _dp 1 add def } ifelse } def /E { _ed begin dup 0 get type /arraytype ne { 0 { dup 1 add index type /arraytype eq { 1 add } { exit } ifelse } loop array astore } if /_dd exch def /_ury exch def /_urx exch def /_lly exch def /_llx exch def /_n exch def /_y 0 def /_dl 4 def /_dp 0 def /_da _dl array def 0 1 _dd length 1 sub { /_d exch _dd exch get def 0 2 _d length 2 sub { /_x exch def /_c _d _x get _ ne def /_r _d _x 1 add get cvlit def _r _ ne { _urx _llx sub _ury _lly sub [ 1 0 0 1 0 0 ] [ /save cvx _llx neg _lly neg /translate cvx _c { nc /begin cvx } if _r dup type /stringtype eq { cvx } { { exec } /forall cvx } ifelse _c { /end cvx } if /restore cvx ] cvx /_fn 12 _n length add string def _y _fn cvs pop /_y _y 1 add def _fn 12 _n putinterval _fn _c false dp _d exch _x 1 add exch put } if } for } for null dp _n _dd /_pd end xput } def /fc { _fm dup concatmatrix pop } def /p { /_fm exch ddef 9 -2 roll _pm translate fc 7 -2 roll _pm scale fc 5 -1 roll _pm rotate fc 4 -2 roll exch 0 ne { dup _pm rotate fc 1 -1 _pm scale fc neg _pm rotate fc } { pop } ifelse dup _pm rotate fc exch dup sin exch cos div 1 0 0 1 0 6 2 roll _pm astore fc neg _pm rotate fc _pd exch get /_fdd exch ddef /_pf { save /_doClip 0 ddef 0 1 _fdd length 1 sub { /_fd exch _fdd exch get ddef _fd 0 2 _fd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _fc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _fm patternfill } { pop fill } ifelse grestore pop } for pop } for restore newpath } ddef /_psf { save /_doClip 0 ddef 0 1 _fdd length 1 sub { /_fd exch _fdd exch get ddef _fd 0 2 _fd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _fc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _fm 9 copy 6 npop patternashow } { pop 6 copy 3 npop hvashow } ifelse grestore pop } for pop } for restore sw rmoveto } ddef /_pjsf { save /_doClip 0 ddef 0 1 _fdd length 1 sub { /_fd exch _fdd exch get ddef _fd 0 2 _fd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _fc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _fm 12 copy 6 npop patternawidthshow } { pop 9 copy 3 npop hvawidthshow } ifelse grestore pop } for pop } for restore swj rmoveto } ddef /_lp /none ddef } def /sc { _sm dup concatmatrix pop } def /P { /_sm exch ddef 9 -2 roll _pm translate sc 7 -2 roll _pm scale sc 5 -1 roll _pm rotate sc 4 -2 roll exch 0 ne { dup _pm rotate sc 1 -1 _pm scale sc neg _pm rotate sc } { pop } ifelse dup _pm rotate sc exch dup sin exch cos div 1 0 0 1 0 6 2 roll _pm astore sc neg _pm rotate sc _pd exch get /_sdd exch ddef /_ps { save /_doClip 0 ddef 0 1 _sdd length 1 sub { /_sd exch _sdd exch get ddef _sd 0 2 _sd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _sc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _sm patternstroke } { pop stroke } ifelse grestore pop } for pop } for restore newpath } ddef /_pss { save /_doClip 0 ddef 0 1 _sdd length 1 sub { /_sd exch _sdd exch get ddef _sd 0 2 _sd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _sc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _sm 10 copy 6 npop patternashowstroke } { pop 7 copy 3 npop ss } ifelse grestore pop } for pop } for restore pop sw rmoveto } ddef /_pjss { save /_doClip 0 ddef 0 1 _sdd length 1 sub { /_sd exch _sdd exch get ddef _sd 0 2 _sd length 2 sub { gsave 2 copy get dup _ ne { cvx exec _sc } { pop } ifelse 2 copy 1 add get dup _ ne { aload pop findfont _sm 13 copy 6 npop patternawidthshowstroke } { pop 10 copy 3 npop jss } ifelse grestore pop } for pop } for restore pop swj rmoveto } ddef /_lp /none ddef } def end userdict /Adobe_pattern_AI5 18 dict dup begin put /initialize { /definepattern where { pop } { begin begin Adobe_pattern_AI5 begin Adobe_pattern_AI5 { dup xcheck { bind } if pop pop } forall mark cachestatus 7 1 roll pop pop pop pop exch pop exch { { 10000 add dup 2 index gt { exit } if dup setcachelimit } loop } stopped cleartomark end =09 =09 end end =09 Adobe_pattern_AI5 begin } ifelse } def /terminate { currentdict Adobe_pattern_AI5 eq { end } if } def errordict /nocurrentpoint { pop stop } put errordict /invalidaccess { pop stop } put /patternencoding 256 array def 0 1 255 { patternencoding exch ( ) 2 copy exch 0 exch put cvn put } for /definepattern { 17 dict begin /uniform exch def /cache exch def /key exch def /procarray exch def /mtx exch matrix invertmatrix def /height exch def /width exch def /ctm matrix currentmatrix def /ptm matrix def /str 32 string def /slice 9 dict def slice /s 1 put slice /q 256 procarray length div sqrt floor cvi put slice /b 0 put /FontBBox [ 0 0 0 0 ] def /FontMatrix mtx matrix copy def /Encoding patternencoding def /FontType 3 def /BuildChar { exch begin /setstrokeadjust where {pop true setstrokeadjust} if slice begin dup q dup mul mod s idiv /i exch def dup q dup mul mod s mod /j exch def q dup mul idiv procarray exch get /xl j width s div mul def /xg j 1 add width s div mul def /yl i height s div mul def /yg i 1 add height s div mul def uniform { 1 1 } { width 0 dtransform dup mul exch dup mul add sqrt dup 1 add exch div 0 height dtransform dup mul exch dup mul add sqrt dup 1 add exch div } ifelse width 0 cache { xl 4 index mul yl 4 index mul xg 6 index mul yg 6 index mul setcachedevice } { setcharwidth } ifelse gsave scale newpath xl yl moveto xg yl lineto xg yg lineto xl yg lineto closepath clip newpath end end exec grestore } def key currentdict definefont end } def /patterncachesize { gsave newpath 0 0 moveto width 0 lineto width height lineto 0 height lineto closepath patternmatrix setmatrix pathbbox exch ceiling 4 -1 roll floor sub 3 1 roll ceiling exch floor sub mul 1 add grestore } def /patterncachelimit { cachestatus 7 1 roll 6 npop 8 mul } def /patternpath { exch dup begin setfont ctm setmatrix concat slice exch /b exch slice /q get dup mul mul put FontMatrix concat uniform { width 0 dtransform round width div exch round width div exch 0 height dtransform round height div exch height div exch 0 0 transform round exch round exch ptm astore setmatrix } { ptm currentmatrix pop } ifelse { currentpoint } stopped not { 2 npop pathbbox true 4 index 3 index eq 4 index 3 index eq and { pop false { { 2 npop } { 3 npop true } { 7 npop true } { pop true } pathforall } stopped { 5 npop true } if } if { height div ceiling height mul 4 1 roll width div ceiling width mul 4 1 roll height div floor height mul 4 1 roll width div floor width mul 4 1 roll 2 index sub height div ceiling cvi exch 3 index sub width div ceiling cvi exch 4 2 roll moveto FontMatrix mtx invertmatrix dup dup 4 get exch 5 get rmoveto ptm ptm concatmatrix pop slice /s patterncachesize patterncachelimit div ceiling sqrt ceiling cvi dup slice /q get gt { pop slice /q get } if put 0 1 slice /s get dup mul 1 sub { slice /b get add gsave 0 1 str length 1 sub { str exch 2 index put } for pop dup { gsave ptm setmatrix 1 index str length idiv { str show } repeat 1 index str length mod str exch 0 exch getinterval show grestore 0 height rmoveto } repeat grestore } for 2 npop } { 4 npop } ifelse } if end } def /patternclip { _eo {eoclip} {clip} ifelse } def /patternstrokepath { strokepath } def /patternmatrix matrix def /patternfill { dup type /dicttype eq { Adobe_pattern_AI5 /patternmatrix get } if gsave patternclip Adobe_pattern_AI5 /patternpath get exec grestore newpath } def /patternstroke { dup type /dicttype eq { Adobe_pattern_AI5 /patternmatrix get } if gsave patternstrokepath true { { { newpath moveto } { lineto } { curveto } { closepath 3 copy Adobe_pattern_AI5 /patternfill get exec } pathforall 3 npop } stopped { 5 npop patternclip Adobe_pattern_AI5 /patternfill get exec } if } { patternclip Adobe_pattern_AI5 /patternfill get exec } ifelse grestore newpath } def /vpatternawidthshow { 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef =09 { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 5 index 5 index 5 index Adobe_pattern_AI5 /patternfill get exec grestore _fontRotateAdjust sub moveto _hvwb eq { _hvcx _hvcy rmoveto } if _hvax _hvay rmoveto 90 rotate } { currentpoint _fontHeight sub _hvax sub 3 index _hvwb eq { _hvcx sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 6 index 6 index 6 index Adobe_pattern_AI5 /patternfill get exec grestore newpath moveto pop pop } ifelse } cforall 3 npop } def /hpatternawidthshow { { dup cstring exch gsave 3 index eq { 5 index 5 index rmoveto } if false charpath currentpoint 9 index 9 index 9 index Adobe_pattern_AI5 /patternfill get exec grestore newpath moveto 2 copy rmoveto } cforall 8 npop } def /patternashow { 0 0 0 6 3 roll patternawidthshow } def /patternawidthshow { 6 index type /dicttype eq { Adobe_pattern_AI5 /patternmatrix get 7 1 roll } if _lineorientation 0 eq { hpatternawidthshow } { vpatternawidthshow } = ifelse } def /vpatternawidthshowstroke { 7 1 roll 6 1 roll /_hvay exch ddef /_hvax exch ddef /_hvwb exch ddef /_hvcy exch ddef /_hvcx exch ddef { dup cstring dup length 1 eq _charorientation 1 eq and { -90 rotate currentpoint _fontRotateAdjust add moveto gsave false charpath currentpoint 3 index setmatrix 6 index 6 index 6 index Adobe_pattern_AI5 /patternstroke get exec grestore _fontRotateAdjust sub moveto _hvwb eq { _hvcx _hvcy rmoveto } if _hvax _hvay rmoveto 90 rotate } { currentpoint _fontHeight sub _hvax sub 3 index _hvwb eq { _hvcx sub } if currentpoint exch 4 index stringwidth pop 2 div sub exch _fontAscent sub moveto gsave 2 index false charpath 4 index setmatrix 7 index 7 index 7 index Adobe_pattern_AI5 /patternstroke get exec grestore newpath moveto pop pop } ifelse } cforall 4 npop } def /hpatternawidthshowstroke { 7 1 roll { dup cstring exch gsave 3 index eq { 5 index 5 index rmoveto } if false charpath currentpoint 7 index setmatrix 10 index 10 index 10 index Adobe_pattern_AI5 /patternstroke get exec grestore newpath moveto 2 copy rmoveto } cforall 9 npop } def /patternashowstroke { 0 0 0 7 3 roll patternawidthshowstroke } def /patternawidthshowstroke { 7 index type /dicttype eq { patternmatrix /patternmatrix get 8 1 roll } if _lineorientation 0 eq { hpatternawidthshowstroke } { = vpatternawidthshowstroke } ifelse } def end setpacking %%EndResource %%EndProlog %%BeginSetup Adobe_level2_AI5 /initialize get exec Adobe_screens_AI5 /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_typography_AI5 = /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_blend_AI5 = /initialize get exec Adobe_Illustrator_AI5_vars Adobe_Illustrator_AI5 Adobe_pattern_AI5 = /initialize get exec Adobe_ColorImage_AI6 /initialize get exec Adobe_Illustrator_AI5 /initialize get exec [ 39/quotesingle 96/grave 130/quotesinglbase 131/florin 132/quotedblbase 133/ellipsis 134/dagger 135/daggerdbl 136/circumflex 137/perthousand=20 138/Scaron 139/guilsinglleft 140/OE 145/quoteleft 146/quoteright=20 147/quotedblleft 148/quotedblright 149/bullet 150/endash 151/emdash=20 152/tilde 153/trademark 154/scaron 155/guilsinglright 156/oe = 157/dotlessi=20 159/Ydieresis 164/currency 166/brokenbar 168/dieresis 169/copyright=20 170/ordfeminine 172/logicalnot 174/registered 175/macron 176/ring=20 177/plusminus 178/twosuperior 179/threesuperior 180/acute 181/mu=20 183/periodcentered 184/cedilla 185/onesuperior 186/ordmasculine=20 188/onequarter 189/onehalf 190/threequarters 192/Agrave 193/Aacute=20 194/Acircumflex 195/Atilde 196/Adieresis 197/Aring 198/AE 199/Ccedilla=20 200/Egrave 201/Eacute 202/Ecircumflex 203/Edieresis 204/Igrave = 205/Iacute=20 206/Icircumflex 207/Idieresis 208/Eth 209/Ntilde 210/Ograve 211/Oacute=20 212/Ocircumflex 213/Otilde 214/Odieresis 215/multiply 216/Oslash=20 217/Ugrave 218/Uacute 219/Ucircumflex 220/Udieresis 221/Yacute 222/Thorn = 223/germandbls 224/agrave 225/aacute 226/acircumflex 227/atilde = 228/adieresis=20 229/aring 230/ae 231/ccedilla 232/egrave 233/eacute 234/ecircumflex=20 235/edieresis 236/igrave 237/iacute 238/icircumflex 239/idieresis=20 240/eth 241/ntilde 242/ograve 243/oacute 244/ocircumflex 245/otilde=20 246/odieresis 247/divide 248/oslash 249/ugrave 250/uacute = 251/ucircumflex=20 252/udieresis 253/yacute 254/thorn 255/ydieresis TE %AI3_BeginEncoding: _Helvetica Helvetica [ /_Helvetica/Helvetica 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Helvetica-Bold Helvetica-Bold [ /_Helvetica-Bold/Helvetica-Bold 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Helvetica-Oblique Helvetica-Oblique [ /_Helvetica-Oblique/Helvetica-Oblique 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Helvetica-BoldOblique Helvetica-BoldOblique [ /_Helvetica-BoldOblique/Helvetica-BoldOblique 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Times-Roman Times-Roman [ /_Times-Roman/Times-Roman 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Times-Bold Times-Bold [ /_Times-Bold/Times-Bold 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Times-Italic Times-Italic [ /_Times-Italic/Times-Italic 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Times-BoldItalic Times-BoldItalic [ /_Times-BoldItalic/Times-BoldItalic 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Courier Courier [ /_Courier/Courier 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Courier-Bold Courier-Bold [ /_Courier-Bold/Courier-Bold 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Courier-Oblique Courier-Oblique [ /_Courier-Oblique/Courier-Oblique 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Courier-BoldOblique Courier-BoldOblique [ /_Courier-BoldOblique/Courier-BoldOblique 0 0 1 TZ %AI3_EndEncoding AdobeType %AI3_BeginEncoding: _Symbol Symbol [ /_Symbol/Symbol 0 0 1 TZ %AI3_EndEncoding AdobeType %%EndSetup 1 XR u [] 0 d 0.7500 w 0.000 0.000 0.000 1.000 K 1 J 1 j 34.3200 31.9200 m 32.0400 37.2000 L S U u 0.000 0.000 0.000 1.000 K 30.4800 40.4400 m 28.2000 45.7200 L S U u 26.7600 48.9600 m 24.3600 54.2400 L S U u 22.9200 57.6000 m 20.6400 62.8800 L S U u 19.0800 66.1200 m 16.8000 71.4000 L S U u 15.3600 74.6400 m 12.9600 79.9200 L S U u 11.5200 83.2800 m 9.1200 88.5600 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 5.5200 88.8000 m 4.5600 99.0000 L 11.5200 91.4400 L 5.5200 88.8000 L F U u 0.7500 w 82.8000 32.5200 m 78.4800 36.3600 L S U u 75.7200 38.6400 m 71.4000 42.4800 L S U u 68.6400 44.8800 m 64.3200 48.7200 L S U u 61.5600 51.0000 m 57.2400 54.8400 L S U u 54.4800 57.2400 m 50.1600 61.0800 L S U u 47.4000 63.3600 m 43.0800 67.2000 L S U u 40.3200 69.6000 m 36.0000 73.4400 L S U u 33.2400 75.7200 m 28.9200 79.5600 L S U u 26.1600 81.9600 m 21.8400 85.8000 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 19.6800 83.2800 m 14.5200 92.1600 L 23.8800 88.2000 L 19.6800 83.2800 L F U u 0.7500 w 177.1200 31.6800 m 171.8400 33.9600 L S U u 168.6000 35.4000 m 163.3200 37.6800 L S U u 160.0800 39.1200 m 154.8000 41.5200 L S U u 151.4400 42.9600 m 146.1600 45.2400 L S U u 142.9200 46.6800 m 137.6400 48.9600 L S U u 134.4000 50.4000 m 129.1200 52.6800 L S U u 125.8800 54.1200 m 120.6000 56.5200 L S U u 117.2400 57.9600 m 111.9600 60.2400 L S U u 108.7200 61.6800 m 103.4400 63.9600 L S U u 100.2000 65.4000 m 94.9200 67.8000 L S U u 91.5600 69.2400 m 86.2800 71.5200 L S U u 83.0400 72.9600 m 77.7600 75.2400 L S U u 74.5200 76.6800 m 69.2400 78.9600 L S U u 66.0000 80.4000 m 60.7200 82.8000 L S U u 57.3600 84.2400 m 52.0800 86.5200 L S U u 48.8400 87.9600 m 44.7600 89.7600 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 44.1600 86.4000 m 36.6000 93.2400 L 46.8000 92.4000 L 44.1600 86.4000 L F U u 0.7500 w 224.8800 32.1600 m 219.4800 34.2000 L S U u 216.1200 35.4000 m 210.7200 37.4400 L S U u 207.3600 38.6400 m 201.9600 40.6800 L S U u 198.6000 42.0000 m 193.2000 43.9200 L S U u 189.8400 45.2400 m 184.4400 47.1600 L S U u 181.0800 48.4800 m 175.6800 50.5200 L S U u 172.3200 51.7200 m 166.9200 53.7600 L S U u 163.5600 54.9600 m 158.1600 57.0000 L S U u 154.8000 58.2000 m 149.4000 60.2400 L S U u 146.0400 61.5600 m 140.6400 63.4800 L S U u 137.2800 64.8000 m 131.8800 66.7200 L S U u 128.5200 68.0400 m 123.1200 70.0800 L S U u 119.7600 71.2800 m 114.3600 73.3200 L S U u 111.0000 74.5200 m 105.6000 76.5600 L S U u 102.2400 77.7600 m 96.8400 79.8000 L S U u 93.4800 81.1200 m 88.0800 83.0400 L S U u 84.7200 84.3600 m 79.3200 86.4000 L S U u 75.9600 87.6000 m 70.5600 89.6400 L S U u 67.2000 90.8400 m 61.8000 92.8800 L S U u 58.4400 94.0800 m 53.0400 96.1200 L S U u 58.4400 94.0800 m 53.0400 96.1200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 52.6800 92.8800 m 44.6400 99.2400 L 54.9600 98.8800 L 52.6800 92.8800 L F U u 0.000 0.000 0.000 0.000 k 0.2500 w 192.7200 0.4800 m 194.1600 0.7200 L 195.4800 1.2000 L 196.6800 2.1600 L 197.6400 3.3600 L 198.1200 4.6800 L 198.3600 6.1200 L 198.3600 26.0400 L 198.1200 27.4800 L 197.6400 28.8000 L 196.6800 30.0000 L 195.4800 30.9600 L 194.1600 31.4400 L 192.7200 31.6800 L 161.5200 31.6800 L 160.0800 31.4400 L 158.6400 30.9600 L 157.5600 30.0000 L 156.6000 28.8000 L 156.0000 27.4800 L 155.8800 26.0400 L 155.8800 6.1200 L 156.0000 4.6800 L 156.6000 3.3600 L 157.5600 2.1600 L 158.6400 1.2000 L 160.0800 0.7200 L 161.5200 0.4800 L 192.7200 0.4800 L B U 0 To 1.0000 0.0000 0.0000 1.0000 166.2000 11.8800 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0 j 0.000 0.000 0.000 1.000 k (P\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 174.0000 7.2000 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (C-1\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 240.4800 1.0800 m 241.9200 1.2000 L 243.3600 1.8000 L 244.4400 2.6400 L 245.4000 3.8400 L 246.0000 5.2800 L 246.1200 6.7200 L 246.1200 26.5200 L 246.0000 27.9600 L 245.4000 29.4000 L 244.4400 30.6000 L 243.3600 31.4400 L 241.9200 32.0400 L 240.4800 32.1600 L 209.2800 32.1600 L 207.8400 32.0400 L 206.5200 31.4400 L 205.3200 30.6000 L 204.3600 29.4000 L 203.8800 27.9600 L 203.6400 26.5200 L 203.6400 6.7200 L 203.8800 5.2800 L 204.3600 3.8400 L 205.3200 2.6400 L 206.5200 1.8000 L 207.8400 1.2000 L 209.2800 1.0800 L 240.4800 1.0800 L B U 0 To 1.0000 0.0000 0.0000 1.0000 217.8000 12.3600 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (P\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 225.6000 7.8000 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (C\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 211.9200 121.5600 m 212.0400 124.8000 L 212.7600 128.0400 L 213.8400 131.0400 L 215.2800 133.9200 L 217.2000 136.5600 L 219.3600 138.9600 L 221.8800 141.0000 L 224.6400 142.6800 L 227.6400 143.8800 L 230.7600 144.8400 L 233.8800 145.2000 L 237.1200 145.2000 L 240.3600 144.8400 L 243.4800 143.8800 L 246.4800 142.6800 L 249.2400 141.0000 L 251.6400 138.9600 L 253.9200 136.5600 L 255.7200 133.9200 L 257.2800 131.0400 L 258.3600 128.0400 L 258.9600 124.8000 L 259.2000 121.5600 L 258.9600 118.4400 L 258.3600 115.2000 L 257.2800 112.2000 L 255.7200 109.3200 L 253.9200 106.6800 L 251.6400 104.2800 L 249.2400 102.2400 L 246.4800 100.5600 L 243.4800 99.3600 L 240.3600 98.4000 L 237.1200 98.0400 L 233.8800 98.0400 L 230.7600 98.4000 L 227.6400 99.3600 L 224.6400 100.5600 L 221.8800 102.2400 L 219.3600 104.2800 L 217.2000 106.6800 L 215.2800 109.3200 L 213.8400 112.2000 L 212.7600 115.2000 L 212.0400 118.4400 L 211.9200 121.5600 L B U 0 To 1.0000 0.0000 0.0000 1.0000 229.8000 117.3600 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (I\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 234.4800 112.8000 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (D\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 230.1600 104.6400 m 230.1600 91.3200 L 240.6000 91.3200 L 240.6000 104.6400 L 230.1600 104.6400 L B U u 0.000 0.000 0.000 0.000 k 250.5600 111.8400 m 259.0800 101.7600 L 251.8800 95.6400 L 243.3600 105.8400 L 250.5600 111.8400 L B U u 0.000 0.000 0.000 0.000 k 220.2000 112.0800 m 211.6800 101.8800 L 219.0000 95.7600 L 227.5200 105.9600 L 220.2000 112.0800 L B U u 0.7500 w 223.2000 97.8000 m 223.2000 96.7200 L S U u 223.2000 96.7200 m 223.3200 96.3600 L S U u 224.1600 95.2800 m 224.4000 95.0400 L S U u 224.4000 95.0400 m 225.3600 94.5600 L S U u 226.8000 94.2000 m 227.8800 94.2000 L S U u 242.8800 94.4400 m 243.8400 94.2000 L S U u 243.8400 94.2000 m 244.3200 94.2000 L S U u 245.6400 94.8000 m 246.3600 95.5200 L S U u 246.3600 95.5200 m 246.4800 95.8800 L S U u 247.0800 97.2000 m 247.2000 97.8000 L S U u 0.000 0.000 0.000 0.000 k 0.2500 w 156.0000 121.4400 m 156.2400 124.6800 L 156.8400 127.9200 L 157.9200 130.9200 L 159.4800 133.8000 L 161.2800 136.4400 L 163.5600 138.8400 L 165.9600 140.8800 L 168.7200 142.5600 L 171.7200 143.7600 L 174.8400 144.6000 L 178.0800 145.0800 L 181.3200 145.0800 L 184.4400 144.6000 L 187.5600 143.7600 L 190.5600 142.5600 L 193.3200 140.8800 L 195.8400 138.8400 L 198.0000 136.4400 L 199.9200 133.8000 L 201.3600 130.9200 L 202.4400 127.9200 L 203.1600 124.6800 L 203.2800 121.4400 L 203.1600 118.3200 L 202.4400 115.0800 L 201.3600 112.0800 L 199.9200 109.2000 L 198.0000 106.5600 L 195.8400 104.1600 L 193.3200 102.1200 L 190.5600 100.4400 L 187.5600 99.1200 L 184.4400 98.2800 L 181.3200 97.9200 L 178.0800 97.9200 L 174.8400 98.2800 L 171.7200 99.1200 L 168.7200 100.4400 L 165.9600 102.1200 L 163.5600 104.1600 L 161.2800 106.5600 L 159.4800 109.2000 L 157.9200 112.0800 L 156.8400 115.0800 L 156.2400 118.3200 L 156.0000 121.4400 L B U 0 To 1.0000 0.0000 0.0000 1.0000 170.0400 117.2400 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (I\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 174.7200 112.6800 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (D-1\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 174.3600 104.4000 m 174.3600 91.2000 L 184.8000 91.2000 L 184.8000 104.4000 L 174.3600 104.4000 L B U u 0.000 0.000 0.000 0.000 k 194.7600 111.7200 m 203.2800 101.6400 L 195.9600 95.5200 L 187.4400 105.6000 L 194.7600 111.7200 L B U u 0.000 0.000 0.000 0.000 k 164.4000 111.9600 m 155.8800 101.7600 L 163.0800 95.6400 L 171.6000 105.8400 L 164.4000 111.9600 L B U u 0.7500 w 167.2800 97.6800 m 167.4000 96.6000 L S U u 167.4000 96.6000 m 167.5200 96.2400 L S U u 168.3600 95.0400 m 168.4800 94.9200 L S U u 168.4800 94.9200 m 169.4400 94.4400 L S U u 169.4400 94.4400 m 169.6800 94.4400 L S U u 171.0000 94.0800 m 171.9600 94.0800 L S U u 187.0800 94.3200 m 188.0400 94.0800 L S U u 188.0400 94.0800 m 188.5200 94.0800 L S U u 189.8400 94.6800 m 190.5600 95.4000 L S U u 190.5600 95.4000 m 190.8000 95.7600 L S U u 191.1600 97.2000 m 191.2800 97.6800 L S U u 0.000 0.000 0.000 0.000 k 0.2500 w 49.8000 0.7200 m 51.3600 0.9600 L 52.6800 1.5600 L 53.8800 2.4000 L 54.7200 3.6000 L 55.3200 4.9200 L 55.5600 6.4800 L 55.5600 26.2800 L 55.3200 27.7200 L 54.7200 29.1600 L 53.8800 30.2400 L 52.6800 31.2000 L 51.3600 31.8000 L 49.8000 31.9200 L 18.7200 31.9200 L 17.1600 31.8000 L 15.8400 31.2000 L 14.6400 30.2400 L 13.8000 29.1600 L 13.2000 27.7200 L 12.9600 26.2800 L 12.9600 6.4800 L 13.2000 4.9200 L 13.8000 3.6000 L 14.6400 2.4000 L 15.8400 1.5600 L 17.1600 0.9600 L 18.7200 0.7200 L 49.8000 0.7200 L B U 0 To 1.0000 0.0000 0.0000 1.0000 27.9600 12.1200 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (P\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 35.7600 7.4400 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (1\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 98.4000 1.3200 m 99.9600 1.4400 L 101.2800 2.0400 L 102.4800 3.0000 L 103.3200 4.0800 L 103.9200 5.5200 L 104.1600 6.9600 L 104.1600 26.7600 L 103.9200 28.3200 L 103.3200 29.6400 L 102.4800 30.8400 L 101.2800 31.6800 L 99.9600 32.2800 L 98.4000 32.5200 L 67.3200 32.5200 L 65.7600 32.2800 L 64.4400 31.6800 L 63.2400 30.8400 L 62.4000 29.6400 L 61.8000 28.3200 L 61.5600 26.7600 L 61.5600 6.9600 L 61.8000 5.5200 L 62.4000 4.0800 L 63.2400 3.0000 L 64.4400 2.0400 L 65.7600 1.4400 L 67.3200 1.3200 L 98.4000 1.3200 L B U 0 To 1.0000 0.0000 0.0000 1.0000 76.5600 12.7200 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (P\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 84.3600 8.0400 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (2\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 0.8400 121.9200 m 1.0800 125.1600 L 1.8000 128.2800 L 2.8800 131.2800 L 4.3200 134.1600 L 6.2400 136.8000 L 8.4000 139.2000 L 10.9200 141.2400 L 13.6800 142.9200 L 16.6800 144.2400 L 19.8000 145.0800 L 22.9200 145.5600 L 26.1600 145.5600 L 29.4000 145.0800 L 32.5200 144.2400 L 35.4000 142.9200 L 38.1600 141.2400 L 40.6800 139.2000 L 42.9600 136.8000 L 44.7600 134.1600 L 46.3200 131.2800 L 47.4000 128.2800 L 48.0000 125.1600 L 48.2400 121.9200 L 48.0000 118.6800 L 47.4000 115.5600 L 46.3200 112.4400 L 44.7600 109.5600 L 42.9600 106.9200 L 40.6800 104.6400 L 38.1600 102.6000 L 35.4000 100.9200 L 32.5200 99.6000 L 29.4000 98.7600 L 26.1600 98.2800 L 22.9200 98.2800 L 19.8000 98.7600 L 16.6800 99.6000 L 13.6800 100.9200 L 10.9200 102.6000 L 8.4000 104.6400 L 6.2400 106.9200 L 4.3200 109.5600 L 2.8800 112.4400 L 1.8000 115.5600 L 1.0800 118.6800 L 0.8400 121.9200 L B U 0 To 1.0000 0.0000 0.0000 1.0000 19.9200 117.7200 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (I\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 24.6000 113.0400 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (1\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 19.2000 104.8800 m 19.2000 91.5600 L 29.6400 91.5600 L 29.6400 104.8800 L 19.2000 104.8800 L B U u 0.000 0.000 0.000 0.000 k 39.6000 112.2000 m 48.1200 102.0000 L 40.9200 95.8800 L 32.4000 106.0800 L 39.6000 112.2000 L B U u 0.000 0.000 0.000 0.000 k 9.2400 112.3200 m 0.7200 102.1200 L 8.0400 96.1200 L 16.5600 106.2000 L 9.2400 112.3200 L B U u 0.7500 w 12.2400 98.0400 m 12.2400 96.9600 L S U u 12.2400 96.9600 m 12.3600 96.6000 L S U u 13.3200 95.5200 m 13.4400 95.2800 L S U u 13.4400 95.2800 m 14.4000 94.8000 L S U u 14.4000 94.8000 m 14.5200 94.8000 L S U u 15.9600 94.5600 m 16.9200 94.5600 L S U u 31.9200 94.6800 m 32.8800 94.4400 L S U u 32.8800 94.4400 m 33.3600 94.4400 L S U u 34.6800 95.0400 m 35.4000 95.7600 L S U u 35.4000 95.7600 m 35.5200 96.1200 L S U u 36.1200 97.4400 m 36.2400 98.0400 L S U u 0.000 0.000 0.000 0.000 k 0.2500 w 56.7600 121.8000 m 57.0000 124.9200 L 57.6000 128.1600 L 58.6800 131.1600 L 60.2400 134.0400 L 62.0400 136.6800 L 64.3200 139.0800 L 66.8400 141.1200 L 69.6000 142.8000 L 72.4800 144.0000 L 75.6000 144.9600 L 78.8400 145.3200 L 82.0800 145.3200 L 85.3200 144.9600 L 88.3200 144.0000 L 91.3200 142.8000 L 94.0800 141.1200 L 96.6000 139.0800 L 98.7600 136.6800 L 100.6800 134.0400 L 102.1200 131.1600 L 103.2000 128.1600 L 103.9200 124.9200 L 104.1600 121.8000 L 103.9200 118.5600 L 103.2000 115.3200 L 102.1200 112.3200 L 100.6800 109.4400 L 98.7600 106.8000 L 96.6000 104.4000 L 94.0800 102.3600 L 91.3200 100.6800 L 88.3200 99.4800 L 85.3200 98.5200 L 82.0800 98.1600 L 78.8400 98.1600 L 75.6000 98.5200 L 72.4800 99.4800 L 69.6000 100.6800 L 66.8400 102.3600 L 64.3200 104.4000 L 62.0400 106.8000 L 60.2400 109.4400 L 58.6800 112.3200 L 57.6000 115.3200 L 57.0000 118.5600 L 56.7600 121.8000 L B U 0 To 1.0000 0.0000 0.0000 1.0000 75.7200 117.6000 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (I\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 80.4000 112.9200 0 Tp TP 83.783784 Tz /_Times-Roman 9.2500 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (2\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.000 0.000 0.000 0.000 k 0.2500 w 0.000 0.000 0.000 1.000 K 1 j 75.1200 104.7600 m 75.1200 91.4400 L 85.5600 91.4400 L 85.5600 104.7600 L 75.1200 104.7600 L B U u 0.000 0.000 0.000 0.000 k 95.5200 111.9600 m 104.0400 101.8800 L 96.7200 95.7600 L 88.2000 105.9600 L 95.5200 111.9600 L B U u 0.000 0.000 0.000 0.000 k 65.1600 112.2000 m 56.6400 102.0000 L 63.8400 96.0000 L 72.3600 106.0800 L 65.1600 112.2000 L B U u 0.7500 w 68.0400 97.9200 m 68.1600 96.8400 L S U u 68.1600 96.8400 m 68.2800 96.4800 L S U u 69.1200 95.2800 m 69.2400 95.1600 L S U u 69.2400 95.1600 m 70.3200 94.6800 L S U u 70.3200 94.6800 m 70.4400 94.6800 L S U u 71.8800 94.4400 m 72.8400 94.4400 L S U u 87.8400 94.5600 m 88.8000 94.3200 L S U u 88.8000 94.3200 m 89.2800 94.3200 L S U u 90.6000 94.9200 m 91.3200 95.6400 L S U u 91.3200 95.6400 m 91.4400 96.0000 L S U u 91.9200 97.3200 m 92.0400 97.9200 L S U u 34.3200 31.9200 m 36.3600 37.3200 L S U u 37.6800 40.6800 m 39.8400 46.0800 L S U u 41.1600 49.4400 m 43.3200 54.8400 L S U u 44.6400 58.2000 m 46.6800 63.6000 L S U u 48.0000 66.9600 m 50.1600 72.3600 L S U u 51.4800 75.7200 m 53.5200 81.1200 L S U u 54.8400 84.4800 m 57.0000 89.8800 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 53.8800 90.9600 m 60.4800 98.8800 L 59.8800 88.5600 L 53.8800 90.9600 L F U u 0.7500 w 34.3200 31.9200 m 39.3600 34.6800 L S U u 42.6000 36.3600 m 47.6400 39.0000 L S U u 50.7600 40.6800 m 55.8000 43.3200 L S U u 58.9200 45.0000 m 63.9600 47.7600 L S U u 67.2000 49.4400 m 72.2400 52.0800 L S U u 75.3600 53.7600 m 80.4000 56.5200 L S U u 83.6400 58.2000 m 88.6800 60.8400 L S U u 91.8000 62.5200 m 96.8400 65.1600 L S U u 99.9600 66.8400 m 105.0000 69.6000 L S U u 108.2400 71.2800 m 113.2800 73.9200 L S U u 116.4000 75.6000 m 121.4400 78.3600 L S U u 124.6800 80.0400 m 129.7200 82.6800 L S U u 132.8400 84.3600 m 137.8800 87.0000 L S U u 141.0000 88.6800 m 146.0400 91.4400 L S U u 149.2800 93.1200 m 151.8000 94.4400 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 149.5200 96.8400 m 159.7200 98.5200 L 152.6400 91.2000 L 149.5200 96.8400 L F U u 0.7500 w 34.3200 31.9200 m 39.7200 33.9600 L S U u 43.0800 35.1600 m 48.4800 37.2000 L S U u 51.8400 38.4000 m 57.2400 40.3200 L S U u 60.6000 41.6400 m 66.0000 43.5600 L S U u 69.3600 44.8800 m 74.7600 46.8000 L S U u 78.1200 48.1200 m 83.5200 50.0400 L S U u 86.8800 51.2400 m 92.2800 53.2800 L S U u 95.6400 54.4800 m 101.0400 56.5200 L S U u 104.4000 57.7200 m 109.8000 59.7600 L S U u 113.1600 60.9600 m 118.5600 63.0000 L S U u 121.9200 64.2000 m 127.3200 66.2400 L S U u 130.6800 67.4400 m 136.0800 69.4800 L S U u 139.4400 70.6800 m 144.8400 72.6000 L S U u 148.2000 73.9200 m 153.6000 75.8400 L S U u 156.9600 77.1600 m 162.3600 79.0800 L S U u 165.7200 80.4000 m 171.1200 82.3200 L S U u 174.4800 83.5200 m 179.8800 85.5600 L S U u 183.2400 86.7600 m 188.6400 88.8000 L S U u 192.0000 90.0000 m 197.4000 92.0400 L S U u 200.7600 93.2400 m 206.1600 95.2800 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 205.3200 98.4000 m 215.5200 98.6400 L 207.6000 92.2800 L 205.3200 98.4000 L F U u 0.7500 w 82.8000 32.5200 m 81.8400 38.1600 L S U u 81.2400 41.7600 m 80.4000 47.4000 L S U u 79.8000 51.0000 m 78.8400 56.6400 L S U u 78.2400 60.2400 m 77.2800 65.8800 L S U u 76.8000 69.4800 m 75.8400 75.1200 L S U u 75.2400 78.7200 m 74.2800 84.3600 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 71.2800 83.1600 m 72.8400 93.2400 L 77.6400 84.2400 L 71.2800 83.1600 L F U u 0.7500 w 82.8000 32.5200 m 87.6000 35.7600 L S U u 90.6000 37.8000 m 95.4000 41.0400 L S U u 98.4000 43.0800 m 103.2000 46.3200 L S U u 106.2000 48.2400 m 111.0000 51.4800 L S U u 114.0000 53.5200 m 118.8000 56.7600 L S U u 121.8000 58.8000 m 126.6000 62.0400 L S U u 129.6000 64.0800 m 134.4000 67.3200 L S U u 137.4000 69.3600 m 142.2000 72.6000 L S U u 145.2000 74.6400 m 150.0000 77.7600 L S U u 153.0000 79.8000 m 157.8000 83.0400 L S U u 160.8000 85.0800 m 163.8000 87.1200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 161.4000 89.4000 m 171.2400 92.1600 L 165.0000 84.0000 L 161.4000 89.4000 L F U u 0.7500 w 82.8000 32.5200 m 88.0800 34.8000 L S U u 91.4400 36.1200 m 96.7200 38.4000 L S U u 100.0800 39.8400 m 105.3600 42.1200 L S U u 108.7200 43.4400 m 114.0000 45.7200 L S U u 117.3600 47.0400 m 122.6400 49.3200 L S U u 126.0000 50.7600 m 131.2800 53.0400 L S U u 134.6400 54.3600 m 139.9200 56.6400 L S U u 143.2800 58.0800 m 148.5600 60.3600 L S U u 151.9200 61.6800 m 157.2000 63.9600 L S U u 160.5600 65.2800 m 165.8400 67.5600 L S U u 169.2000 69.0000 m 174.4800 71.2800 L S U u 177.8400 72.6000 m 183.1200 74.8800 L S U u 186.4800 76.3200 m 191.7600 78.6000 L S U u 195.1200 79.9200 m 200.4000 82.2000 L S U u 203.7600 83.5200 m 209.0400 85.8000 L S U u 212.4000 87.2400 m 217.6800 89.5200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 215.7600 92.1600 m 225.9600 93.0000 L 218.2800 86.2800 L 215.7600 92.1600 L F U u 0.7500 w 177.1200 31.6800 m 181.3200 35.6400 L S U u 183.9600 38.1600 m 188.1600 42.1200 L S U u 190.8000 44.5200 m 195.0000 48.4800 L S U u 197.6400 51.0000 m 201.8400 54.9600 L S U u 204.4800 57.3600 m 208.6800 61.3200 L S U u 211.3200 63.8400 m 215.5200 67.8000 L S U u 218.1600 70.3200 m 222.3600 74.2800 L S U u 225.0000 76.6800 m 229.2000 80.6400 L S U u 231.8400 83.1600 m 236.0400 87.1200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 233.4000 89.0400 m 242.6400 93.2400 L 237.8400 84.2400 L 233.4000 89.0400 L F U u 0.7500 w 177.1200 31.6800 m 178.0800 37.3200 L S U u 178.6800 40.9200 m 179.5200 46.5600 L S U u 180.1200 50.1600 m 181.0800 55.8000 L S U u 181.6800 59.4000 m 182.6400 65.0400 L S U u 183.1200 68.6400 m 184.0800 74.2800 L S U u 184.6800 77.8800 m 185.4000 82.2000 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 182.0400 81.9600 m 186.8400 91.0800 L 188.4000 80.8800 L 182.0400 81.9600 L F U u 0.7500 w 177.1200 31.6800 m 172.4400 34.9200 L S U u 169.4400 36.9600 m 164.7600 40.3200 L S U u 161.7600 42.3600 m 157.0800 45.7200 L S U u 154.0800 47.7600 m 149.4000 51.0000 L S U u 146.4000 53.0400 m 141.7200 56.4000 L S U u 138.7200 58.4400 m 134.0400 61.8000 L S U u 131.0400 63.8400 m 126.3600 67.0800 L S U u 123.3600 69.1200 m 118.6800 72.4800 L S U u 115.6800 74.5200 m 111.0000 77.8800 L S U u 108.0000 79.9200 m 103.3200 83.1600 L S U u 100.3200 85.2000 m 95.7600 88.4400 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 94.5600 85.3200 m 88.4400 93.6000 L 98.2800 90.7200 L 94.5600 85.3200 L F U u 0.7500 w 224.8800 32.1600 m 219.8400 34.9200 L S U u 216.6000 36.6000 m 211.5600 39.3600 L S U u 208.4400 41.0400 m 203.4000 43.8000 L S U u 200.1600 45.4800 m 195.1200 48.2400 L S U u 191.8800 49.9200 m 186.8400 52.6800 L S U u 183.7200 54.3600 m 178.6800 57.1200 L S U u 175.4400 58.8000 m 170.4000 61.5600 L S U u 167.2800 63.2400 m 162.2400 66.0000 L S U u 159.0000 67.6800 m 153.9600 70.4400 L S U u 150.7200 72.1200 m 145.6800 74.8800 L S U u 142.5600 76.5600 m 137.5200 79.3200 L S U u 134.2800 81.0000 m 129.2400 83.7600 L S U u 126.0000 85.4400 m 120.9600 88.2000 L S U u 117.8400 89.8800 m 112.8000 92.6400 L S U u 109.5600 94.3200 m 108.4800 94.9200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 107.6400 91.6800 m 100.5600 99.1200 L 110.6400 97.3200 L 107.6400 91.6800 L F U u 0.7500 w 224.8800 32.1600 m 222.8400 37.5600 L S U u 221.5200 40.9200 m 219.6000 46.3200 L S U u 218.2800 49.6800 m 216.2400 55.0800 L S U u 214.9200 58.4400 m 213.0000 63.8400 L S U u 211.6800 67.2000 m 209.6400 72.6000 L S U u 208.4400 75.9600 m 206.4000 81.3600 L S U u 205.0800 84.7200 m 203.0400 90.1200 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 200.1600 88.5600 m 199.8000 98.8800 L 206.2800 90.8400 L 200.1600 88.5600 L F U u 0.7500 w 224.8800 32.1600 m 227.2800 37.4400 L S U u 228.8400 40.6800 m 231.2400 45.9600 L S U u 232.8000 49.2000 m 235.2000 54.4800 L S U u 236.7600 57.7200 m 239.1600 63.0000 L S U u 240.6000 66.2400 m 243.0000 71.4000 L S U u 244.5600 74.6400 m 246.9600 79.9200 L S U u 248.5200 83.1600 m 250.9200 88.4400 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 248.6400 91.5600 m 255.7200 99.0000 L 254.5200 88.8000 L 248.6400 91.5600 L F U u 2.2500 w 110.0400 121.6800 m 114.3600 121.6800 L S U u 118.6800 121.6800 m 123.0000 121.6800 L S U u 127.3200 121.6800 m 131.6400 121.6800 L S U u 135.9600 121.6800 m 140.2800 121.6800 L S U u 144.6000 121.6800 m 148.9200 121.6800 L S U u 110.0400 14.5200 m 114.3600 14.5200 L S U u 118.6800 14.5200 m 123.0000 14.5200 L S U u 127.3200 14.5200 m 131.6400 14.5200 L S U u 135.9600 14.5200 m 140.2800 14.5200 L S U u 144.6000 14.5200 m 148.9200 14.5200 L S U 0 To 1.0000 0.0000 0.0000 1.0000 302.6400 77.2800 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.0000 w 0.000 0.000 0.000 1.000 K 0 j 0.000 0.000 0.000 1.000 k (Potential\r) Tx TO 0.000 0.000 0.000 1.000 K 0 To 1.0000 0.0000 0.0000 1.0000 312.6000 60.4800 0 Tp TP 83.928571 Tz /_Times-Roman 14.0000 Tf 0.0000 Tc 0 Tr 0.000 0.000 0.000 1.000 k (Offer\r) Tx TO 0.000 0.000 0.000 1.000 K u 0.7500 w 0.000 0.000 0.000 1.000 K 1 j 265.3200 72.8400 m 271.0800 72.9600 L S U u 274.6800 72.9600 m 280.4400 73.0800 L S U u 284.0400 73.0800 m 284.7600 73.0800 L S U u 0.000 0.000 0.000 1.000 k 0.0000 w 283.9200 76.3200 m 293.6400 73.2000 L 284.0400 69.8400 L 283.9200 76.3200 L F U %%PageTrailer gsave annotatepage grestore showpage %%Trailer Adobe_Illustrator_AI5 /terminate get exec Adobe_pattern_AI5 /terminate get exec Adobe_blend_AI5 /terminate get exec Adobe_ColorImage_AI6 /terminate get exec Adobe_typography_AI5 /terminate get exec Adobe_screens_AI5 /terminate get exec Adobe_level2_AI5 /terminate get exec %%EOF %%EndDocument @endspecial 1375 1588 a Fs(Figure)j(7.)g(Synchronisation)h(pattern.) 191 1853 y Fr(EXPERIMENT)-7 b(AL)22 b(RESUL)-8 b(TS)191 2056 y Fq(In)23 b(this)g(section,)f(we)i(report)d(on)i(the)g(results)g (of)f(a)i(simulation)e(analysis)h(that)g(w)o(as)g(undertak)o(en)e (using)h(the)h(Casale)191 2156 y(I)30 b(simulation)e(language)g([8)o(]) h(in)h(order)e(to)i(compare)d(EM,)j(MEM,)f(and)g Fm(\013)p Fq(\226core.)f(W)-7 b(e)31 b(also)e(present)g(the)g(results)191 2256 y(of)d(an)g(e)o(xperimental)e(study)h(that)h(w)o(as)h(carried)e (out)h(using)g(our)f(CORB)m(A\226based)h(implementation.)e(The)h (results)191 2355 y(sho)n(w)d(that)g Fm(\013)p Fq(\226core)g(is)h (quite)f(ef)n(fecti)n(v)o(e)f(when)g(compared)f(with)j(EM)f(and)g(MEM,) f(and)h(our)g(implementation)e(also)191 2455 y(achie)n(v)o(es)f(a)i (good)e(performance.)191 2650 y Fr(Comparati)o(v)o(e)g(analysis)191 2853 y Fq(Figure)28 b(7)h(depicts)f(the)h(structure)f(of)g(the)h (systems)g(we)g(used)f(in)h(our)f(e)o(xperiments.)f(Each)h(one)g(w)o (as)i(composed)191 2953 y(of)24 b Fm(C)32 b Fq(participants)23 b(and)i Fm(D)i Fq(interactions.)c(Notice)i(that)f(the)o(y)g(are)h(all)g (potentially)f(con\003icting)f(because)h(the)o(y)g(are)191 3053 y Fm(C)6 b Fq(\226party)20 b(and)g(the)o(y)h(share)f(e)n(v)o(er)h (participant)e(in)i(the)g(system.)g(Ho)n(we)n(v)o(er)m(,)e(this)j(does) e(not)h(imply)f(that)i(the)o(y)e(must)h(be)191 3152 y(necessarily)g (con\003icting)e(at)j(run)e(time.)h(The)g(reason)g(is)h(that)f(a)g (each)g(dotted)g(link)f(in)i(the)f(\002gure)f(is)i(potential)f(of)n (fer)m(,)191 3252 y(and)c(the)g(le)n(v)o(el)g(of)g(actual)g (participation)f(is)i(controlled)e(by)h(means)g(of)g(parameter)f Fm(P)29 b Fj(\(1)23 b Fi(\024)g Fm(P)35 b Fi(\024)22 b Fm(D)r Fj(\))p Fq(.)c(F)o(or)f(e)o(xample,)191 3352 y(if)k Fm(D)27 b Fj(=3D)d(10)c Fq(and)g Fm(P)37 b Fj(=3D)24 b(2)p Fq(,)c(then)h(only)f(2)h(interactions)f(shall)h(be)g (con\003icting)e(at)j(the)f(same)g(time,)g(although)e(the)o(y)h(are)191 3451 y(all)h(potentially)e(con\003icting)g(each)g(other)-5 b(.)274 3551 y(This)32 b(pattern)e(is)i(quite)f(\003e)o(xible)g(and)g (it)h(allo)n(ws)g(us)g(to)f(observ)o(e)f(ho)n(w)h(the)g(studied)g (algorithms)f(perform)g(in)191 3650 y(dif)n(ferent)g(situations:)h(in)h (order)e(to)h(study)g(ho)n(w)g(the)o(y)g(are)g(af)n(fected)f(by)h(the)h (le)n(v)o(el)f(of)g(static)h(con\003ict)f(amongst)191 3750 y(interactions,)19 b(we)i(only)e(need)h(to)h(v)n(ary)e Fm(D)r Fq(;)i(in)g(order)e(to)i(study)e(ho)n(w)h(the)o(y)g(are)g(af)n (fected)g(by)g(the)g(le)n(v)o(el)g(of)g(con\003ict)g(at)191 3850 y(run)d(time,)h(we)h(only)e(need)h(to)g(v)n(ary)f Fm(P)12 b Fq(;)19 b(\002nally)-5 b(,)17 b(in)h(order)f(to)h(study)g(ho) n(w)f(the)i(cardinality)d(of)i(the)g(interactions)f(af)n(fect)191 3949 y(the)j(algorithms,)f(we)h(only)g(need)f(to)i(v)n(ary)e Fm(C)6 b Fq(.)274 4049 y(W)-7 b(e)24 b(considered)e(the)h(system)h (runs)e(on)h(a)h(point\226to\226point)c(netw)o(ork)i(with)h(links)g (connecting)e(all)j(coordinators)191 4149 y(with)h(their)f (participants)f(and)h(vice)h(v)o(ersa,)e(which)h(is)i(adequate)d(for)h (modelling)f(netw)o(orks)g(such)h(as)i(the)e(Internet)191 4248 y(where)c(se)n(v)o(eral)f(messages)h(may)g(be)g(in)h(transit)f (simultaneously)-5 b(.)274 4348 y(Se)n(v)o(eral)19 b(metrics)i(were)f (used)g(in)g(order)f(to)h(compare)f(EM,)h(MEM)g(and)g Fm(\013)p Fq(\226core,)f(namely:)315 4508 y Fi(\017)42 b Fq(Elapsed)19 b(time,)h(which)g(is)h(the)f(total)h(time)f(tak)o(en)g (to)g(complete)f(an)h(e)o(xperiment.)315 4608 y Fi(\017)42 b Fq(Selection)26 b(time,)g(which)g(is)i(the)e(time)h(tak)o(en)f(by)g (an)h(algorithm)e(to)h(select)i(an)e(interaction)f(for)h(e)o(x)o (ecution,)399 4707 y(possibly)16 b(out)g(of)g(man)o(y)g(con\003icting)f (ones.)i(It)g(is)g(measured)f(from)f(the)i(instant)g(that)g(an)f (interaction)g(becomes)399 4807 y(enabled)j(\(as)i(vie)n(wed)e(by)h (its)i(corresponding)17 b(coordinator\))g(to)k(the)g(time)f(that)h(it)g (is)h(selected)e(for)g(e)o(x)o(ecution)399 4907 y(by)f(a)i(speci\002c)f (algorithm.)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)c FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,) f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 21 21 21 20 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(21)p 191 473 3388 5 v 315 606 a Fi(\017)42 b Fq(Interaction)i(time,)h(which)h(is)h(the)f (time)g(elapsed)f(from)g(the)h(instant)g(a)g(participant)f(\002nishes)h (local)399 706 y(computation)17 b(to)k(the)f(instant)g(it)h(e)o(x)o (ecutes)e(one)h(of)g(the)g(interactions)f(it)i(of)n(fers.)315 805 y Fi(\017)42 b Fq(Message)18 b(count,)g(which)g(is)i(the)f(a)n(v)o (erage)e(number)g(of)i(messages)g(needed)e(to)i(schedule)f(one)g (interaction)f(for)399 905 y(e)o(x)o(ecution.)315 1005 y Fi(\017)42 b Fq(Ex)o(ecution)32 b(de)n(viation,)h(which)h(is)i(the)f (mean)f(de)n(viation)f(from)h(the)h(e)o(xpected)e(number)g(of)h(times)h (each)399 1104 y(interaction)18 b(should)i(ha)n(v)o(e)f(been)h(e)o(x)o (ecuted)e(in)i(an)g(impartial)g(e)o(xperimentation)d(en)m(vironment.) 274 1299 y(These)42 b(metrics)g(were)g(studied)g(as)h(a)g(function)d (of)i(a)h(number)d(of)i(parameters)f(including)g(the)h(le)n(v)o(el)g (of)191 1399 y(participation,)20 b(the)i(cardinality)f(of)h(each)g (interaction,)e(the)i(de)o(gree)f(of)h(potential)f(con\003ict,)h(and)g (the)g(a)n(v)o(erage)f(time)191 1498 y(tak)o(en)f(to)g(transmit)g(a)h (message)f(between)f(processes.)274 1601 y(W)-7 b(e)43 b(v)n(aried)e Fm(C)48 b Fq(and)42 b Fm(D)i Fq(in)e(the)g(range)f Fj([2)p Fm(::)p Fj(10])p Fq(,)g Fm(P)54 b Fq(in)42 b(the)g(range)f Fj([1)p Fm(::)p Fj(10])p Fq(,)g(and)g(each)g(e)o(xperiment)f(w)o(as)191 1700 y(run)d(100)h(times)g(for)g(a)g(duration)f(required)f(to)i (schedule)f(10)h(interactions)f(using)h(dif)n(ferent)e(random)h(seeds.) 191 1800 y(Each)27 b(communication)e(link)j(w)o(as)g(modelled)e(as)j(a) f(FCFS)h(serv)o(er)e(with)h(service)f(time,)h(i.e,)g(transmission)f (time,)191 1900 y(sampled)c(from)g(a)h(e)o(xponential)e(distrib)n (ution)g Fj(exp\()p Fm(\026)p Fj(\))j Fq(with)f Fm(\026)30 b Fj(=3D)g(2)24 b Fq(ms.)g(W)-7 b(e)25 b(considered)d(the)i(time)g (participants)191 1999 y(are)32 b(performing)d(local)j(computation)d (or)j(interacting)e(is)j(not)f(ne)o(gligible,)e(and)h(we)h(sampled)f (them)h(from)f(tw)o(o)191 2099 y(e)o(xponential)18 b(distrib)n(ution)h (with)h(mean)g(20)g(ms)g(and)g(2)g(ms,)g(respecti)n(v)o(ely)-5 b(.)274 2202 y(W)e(e)25 b(found)d(out)h(that)h(other)f(things)h(being)f (equal,)f(the)i(metrics)g(v)n(ary)f(almost)h(linearly)f(with)h Fm(\026)p Fq(,)g(e)o(xcept)f(for)g(the)191 2301 y(message)31 b(count,)f(which)h(is)h(ob)o(viously)d(independent)f(from)i(this)i (parameter)-5 b(.)30 b(This)h(beha)n(viour)e(w)o(as)j(e)o(xpected)191 2401 y(because)19 b(the)g(communication)e(medium)h(w)o(as)j(modelled)d (by)h(a)h(FCFS)h(serv)o(er)d(with)i(mean)f(service)g(sampled)g(from)191 2500 y(an)f(e)o(xponential)d(distrib)n(ution)i(with)h(small)g(scale.)g (It)g(is)h(also)f(w)o(orth)f(mentioning)f(that)i(modelling)e (communication)191 2600 y(links)23 b(as)h(FCFS)g(serv)o(ers)e(with)i (service)e(time)h(sampled)g(from)f(another)f(distrib)n(ution)h(v)n (aried)g(the)h(timings)f(of)h(each)191 2700 y(algorithm,)18 b(although)h(the)h(relati)n(v)o(e)f(ranking)g(remained)f(essentially)j (unchanged.)274 2802 y(Furthermore,)13 b(for)i(the)h(purpose)e(of)i (comparison,)d(each)i(manager)g(in)h(the)f(EM)h(and)f(MEM)h(algorithms) f(managed)191 2902 y(only)k(one)h(interaction.)274 3005 y(None)27 b(of)g(the)h(assumptions)f(we)h(ha)n(v)o(e)f(tak)o(en)g(are)g (an)h(inherent)e(feature)h(of)g(the)h(simulation,)e(and)h(alternati)n (v)o(e)191 3104 y(hypothesis)18 b(may)i(be)g(simulated)g(easily)-5 b(.)191 3313 y Fn(The)20 b(r)m(esults)h(of)g(the)f(simulation)191 3509 y Fq(Figure)36 b(8)i(summarises)e(the)h(a)n(v)o(erage)f (percentages)g(of)g(increase)h(or)g(decrease)f(of)h(each)g(metric)g (when)f(each)191 3608 y(parameter)27 b(w)o(as)j(increased)f(by)f(one)h (unit.)f(F)o(or)h(e)o(xample,)e(if)j(we)f(increase)g Fm(C)36 b Fq(from)28 b(7)h(to)g(8,)g(the)g(elapsed)g(time)191 3708 y(needed)19 b(to)h(run)g(the)g(simulation)f(is)j(e)o(xpected)c(to) j(increase)e(3.89\045)h(in)g(the)g(case)h(of)f Fm(\013)p Fq(\226core,)f(6.02\045)h(in)g(the)g(case)h(of)191 3808 y(EM)f(and)g(6.14\045)f(in)h(the)h(case)f(of)g(MEM.)274 3910 y(W)-7 b(e)25 b(can)e(see)h(that)g(both)e(EM)i(and)f(MEM)g(are)h (quite)f(sensiti)n(v)o(e)g(to)h(the)g(de)o(gree)e(of)h(potential)g (con\003ict)g Fm(D)r Fq(,)h(being)191 4010 y(the)j(rise)g(in)g(MEM)g (bigger)-5 b(.)25 b(The)i(reason)f(is)h(that)g(an)g(increase)f(in)h Fm(D)i Fq(increases)e(the)g(number)e(of)h(managers)g(that)191 4110 y(ha)n(v)o(e)21 b(a)i(shared)e(fork.)g(Thus,)g(an)h(increase)g(in) g Fm(D)j Fq(increases)d(the)g(probability)e(that)i(a)h(hungry)c (manager)i(shall)h(ha)n(v)o(e)191 4209 y(to)c(request)g(forks)f(from)g (its)i(neighbours,)c(i.e.,)j(the)g(managers)f(that)h(are)g(potentially) f(con\003icting)g(with)h(it.)h(If)f(a)g(gi)n(v)o(en)191 4309 y(manager)25 b(has)i Fm(D)f Fi(\000)d Fj(1)j Fq(neighbours,)f(we)i (can)f(assume)h(that)g(the)g(probability)e(that)i(a)g(manager)e(o)n (wns)i Fm(k)j Fq(forks)c(is)191 4408 y(uniform)20 b(for)i(all)h Fj(0)j Fi(\024)g Fm(k)k Fi(\024)c Fm(D)c Fi(\000)e Fj(1)p Fq(;)i(thus,)g(the)g(probability)f(of)h(the)g(manager)e(o)n(wning)h (all)i Fm(D)f Fi(\000)e Fj(1)i Fq(forks)f(shall)i(be)191 4508 y Fj(1)p Fm(=3DD)r Fq(,)f(which)g(decreases)g(as)h Fm(D)i Fq(increases.)d(It)h(follo)n(ws)f(that)g(a)h(manager)e(has)i(to) f(request)g(forks)g(more)f(often)h(as)h Fm(D)191 4608 y Fq(increases,)c(thus)h(increasing)e(the)h(selection)h(time)f(and)g (the)h(number)e(of)h(messages)h(e)o(xchanged)d(to)i(achie)n(v)o(e)g (mutual)191 4707 y(e)o(xclusion.)28 b(F)o(or)h(the)g(EM)g(algorithm,)f (increasing)g Fm(D)k Fq(amounts)c(to)i(increasing)e(the)h(distance)g (the)h(tok)o(en)e(needs)191 4807 y(to)e(tra)n(v)o(el)g(before)f (\002nding)g(an)i(enabled)e(manager)m(,)f(thus)i(increasing)f(both)h (the)g(selection)g(time)h(and)e(the)i(number)191 4907 y(of)f(messages)g(needed)f(to)h(pass)h(the)f(tok)o(en)g(until)g(it)h (arri)n(v)o(es)e(at)i(an)f(enabled)f(manager)-5 b(.)25 b(Nonetheless,)g Fm(\013)p Fq(\226core)h(in)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 22 22 22 21 bop 191 299 a Fq(22)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 2903 a @beginspecial 56.689999 @llx 56.689999 @lly 361.769989 @urx 253.089996 @ury 4064 @rwi @setspecial %%BeginDocument: resu-simu.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip060.wmf %%Creator: Windows NT 4.0 %%CreationDate: 14:3 2/21/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 361.77 253.09 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 253.133 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate n 607 384 163 6 B 1 g f 1 sl 0 g n 609 386 162 5 B cp s n 234 59 M 763 59 L 763 281 L 234 281 L 234 59 L cp 0.754 g e 0 g gs n 529 1 234 244 CB n 234 244 M 763 244 L s gr gs n 529 1 234 207 CB n 234 207 M 763 207 L s gr gs n 529 1 234 170 CB n 234 170 M 763 170 L s gr gs n 529 1 234 133 CB n 234 133 M 763 133 L s gr gs n 529 1 234 95 CB n 234 95 M 763 95 L s gr gs n 529 1 234 59 CB n 234 59 M 763 59 L s gr gs n 1 222 366 59 CB n 366 59 M 366 281 L s gr gs n 1 222 498 59 CB n 498 59 M 498 281 L s gr gs n 1 222 631 59 CB n 631 59 M 631 281 L s gr gs n 1 222 763 59 CB n 763 59 M 763 281 L s gr 0.5 g n 234 59 M 763 59 L s n 763 59 M 763 281 L s n 763 281 M 234 281 L s n 234 281 M 234 59 L s 0 g gs n 41 4 280 277 CB n 280 277 M 320 277 L 320 281 L 280 281 L 280 277 L cp gs 0.336 g e gr s gr gs n 41 74 412 207 CB n 412 207 M 452 207 L 452 281 L 412 281 L 412 207 L cp gs 0.336 g e gr s gr gs n 42 7 544 274 CB n 544 274 M 585 274 L 585 281 L 544 281 L 544 274 L cp gs 0.336 g e gr s gr gs n 42 36 676 245 CB n 676 245 M 717 245 L 717 281 L 676 281 L 676 245 L cp gs 0.336 g e gr s gr gs n 43 5 308 276 CB n 308 276 M 350 276 L 350 281 L 308 281 L 308 276 L cp gs 0.977 g e gr s gr gs n 43 185 440 96 CB n 440 96 M 482 96 L 482 281 L 440 281 L 440 96 L cp gs 0.977 g e gr s gr gs n 42 8 573 273 CB n 573 273 M 614 273 L 614 281 L 573 281 L 573 273 L cp gs 0.977 g e gr s gr gs n 42 63 705 218 CB n 705 218 M 746 218 L 746 281 L 705 281 L 705 218 L cp gs 0.977 g e gr s gr n 234 59 M 234 281 L s n 230 281 M 234 281 L s n 230 244 M 234 244 L s n 230 207 M 234 207 L s n 230 170 M 234 170 L s n 230 133 M 234 133 L s n 230 95 M 234 95 L s n 230 59 M 234 59 L s n 234 281 M 763 281 L s NTPSOct95 /FontSV save put %%BeginFont: Times_New_Roman_Negrita011 10 dict dup begin /FontType 3 def /FontMatrix [1 11 div 0 0 1 11 div 0 0] def /FontBBox [-2 -11 16 16] def /Encoding 256 array def 0 1 255 {Encoding exch /.notdef put} for /BuildGlyph {0 begin exch /CD get exch get /CI exch def CI 0 get 0 CI 1 4 getinterval aload pop setcachedevice CI 5 get CI 6 get true [1 0 0 -1 0 0] dup 4 CI 7 get put dup 5 CI 8 get put CI 9 get imagemask end}def /BuildGlyph load 0 5 dict put /BuildChar {1 index /Encoding get exch get 1 index /BuildGlyph get exec} bind def /CD 256 dict def CD /.notdef[.24 0 0 0 0 1 1 0 0 {<>}]put Encoding 54 /c54 put CD /c54 [7 1 8 6 0 5 8 -1 8 <~B\:,iGSo);~>]put Encoding 72 /c72 put CD /c72 [6 0 5 5 0 5 5 0 5 <~E7js$GQ~>]put Encoding 81 /c81 put CD /c81 [7 0 5 7 0 7 5 0 5 <~phXb_mJ~>]put Encoding 86 /c86 put CD /c86 [5 0 5 4 0 4 5 0 5 <~E6r!shu~>]put Encoding 76 /c76 put CD /c76 [4 0 8 4 0 4 8 0 8 <~?sium?smC3~>]put Encoding 87 /c87 put CD /c87 [4 0 7 4 0 4 7 0 7 <~+<^/]?smp~>]put Encoding 89 /c89 put CD /c89 [5 -1 5 5 0 6 5 1 5 <~ltC&d0E~>]put Encoding 92 /c92 put CD /c92 [6 0 5 6 -2 6 7 0 5 <~ltC>l+J?L~>]put Encoding 3 /c3 put CD /c3 [3 0 0 16 -16 1 1 0 0 <~!!~>]put Encoding 82 /c82 put CD /c82 [6 0 5 5 0 5 5 0 5 <~E7igqDu~>]put Encoding 39 /c39 put CD /c39 [8 0 8 8 0 8 8 0 8 <~r+9GK@q0-K~>]put end /Times_New_Roman_Negrita011 exch definefont pop %%EndFont [11 0 0 -11 0 0]/Times_New_Roman_Negrita011 MF (6)432 27 MS (H)439 27 MS (Q)444 27 MS (V)450 27 MS (L)455 27 MS (W)459 = 27 MS (L)462 27 MS (Y)465 27 MS (L)470 27 MS (W)473 27 MS (\\)477 27 MS = (\003)482 27 MS (W)484 27 MS (R)488 27 MS (\003)493 27 MS (')496 27 MS %%IncludeFont: Times-Roman [10.992 0 0 -10.992 0 0]/Times-Roman MF (0)198 286 MS (,)203 286 MS (0)205 286 MS (0)211 286 MS (%)216 286 MS (1)192 249 MS (0)198 249 MS (,)203 249 MS (0)205 249 MS (0)211 249 MS = (%)216 249 MS (2)192 212 MS (0)198 212 MS (,)203 212 MS (0)205 212 MS (0)211 212 MS = (%)216 212 MS (3)192 175 MS (0)198 175 MS (,)203 175 MS (0)205 175 MS (0)211 175 MS = (%)216 175 MS (4)192 138 MS (0)198 138 MS (,)203 138 MS (0)205 138 MS (0)211 138 MS = (%)216 138 MS (5)192 100 MS (0)198 100 MS (,)203 100 MS (0)205 100 MS (0)211 100 MS = (%)216 100 MS (6)192 64 MS (0)198 64 MS (,)203 64 MS (0)205 64 MS (0)211 64 MS (%)216 = 64 MS n 133 18 431 368 B 1 g f 0 g n 135 20 430 367 B cp s n 5 4 435 375 B 0.641 g f 0 g n 7 6 434 374 B cp s (A)444 382 MS (l)452 382 MS (f)455 382 MS (a)459 382 MS ( )464 382 MS = (C)466 382 MS (o)473 382 MS (r)479 382 MS (e)483 382 MS n 4 4 494 375 B 0.336 g f 0 g n 6 6 493 374 B cp s (E)503 382 MS (M)509 382 MS n 4 4 525 375 B 0.977 g f 0 g n 6 6 524 374 B cp s (M)534 382 MS (E)544 382 MS (M)550 382 MS n 173 301 M 763 301 L s n 173 357 M 763 357 L s n 234 281 M 763 281 L s n 173 301 M 173 357 L s n 234 281 M 234 357 L s n 366 281 M 366 357 L s n 498 281 M 498 357 L s n 631 281 M 631 357 L s n 763 281 M 763 357 L s n 4 4 177 310 B 0.641 g f 0 g n 6 6 176 309 B cp s (A)186 317 MS (l)194 317 MS (f)197 317 MS (a)200 317 MS ( )205 317 MS = (C)208 317 MS (o)215 317 MS (r)221 317 MS (e)224 317 MS (0)286 316 MS (,)292 316 MS (0)294 316 MS (0)299 316 MS (%)305 316 MS (0)419 316 MS (,)424 316 MS (0)427 316 MS (0)432 316 MS (%)437 316 MS (0)551 316 MS (,)556 316 MS (0)559 316 MS (0)564 316 MS (%)569 316 MS (0)683 316 MS (,)688 316 MS (0)691 316 MS (0)696 316 MS (%)701 316 MS gs n 589 1 173 320 CB n 173 320 M 763 320 L s gr n 4 4 177 329 B 0.336 g f 0 g n 6 6 176 328 B cp s (E)186 336 MS (M)192 336 MS (1)286 335 MS (,)292 335 MS (1)294 335 MS (9)299 335 MS (%)305 335 MS (1)416 335 MS (9)421 335 MS (,)427 335 MS (9)429 335 MS (2)434 335 MS = (%)440 335 MS (1)551 335 MS (,)556 335 MS (8)559 335 MS (5)564 335 MS (%)569 335 MS (9)683 335 MS (,)688 335 MS (8)691 335 MS (7)696 335 MS (%)701 335 MS gs n 589 1 173 339 CB n 173 339 M 763 339 L s gr n 4 4 177 348 B 0.977 g f 0 g n 6 6 176 347 B cp s gs n 27 13 186 343 CB (M)186 354 MS (E)196 354 MS (M)202 354 MS gr gs n 28 13 286 343 CB (1)286 354 MS (,)292 354 MS (4)294 354 MS (2)299 354 MS (%)305 354 MS gr gs n 33 13 416 343 CB (4)416 354 MS (9)421 354 MS (,)427 354 MS (8)429 354 MS (0)434 354 MS = (%)440 354 MS gr gs n 28 13 551 343 CB (2)551 354 MS (,)556 354 MS (2)559 354 MS (4)564 354 MS (%)569 354 MS gr gs n 33 13 681 343 CB (1)681 354 MS (6)686 354 MS (,)691 354 MS (9)693 354 MS (3)699 354 MS = (%)704 354 MS gr (E)269 296 MS (l)275 296 MS (a)278 296 MS (p)283 296 MS (s)289 296 MS = (e)294 296 MS (d)299 296 MS ( )305 296 MS (T)308 296 MS (i)315 296 MS = (m)318 296 MS (e)325 296 MS (S)398 296 MS (e)404 296 MS (l)409 296 MS (e)412 296 MS (c)417 296 MS = (t)422 296 MS (i)426 296 MS (o)428 296 MS (n)434 296 MS ( )440 296 MS = (T)443 296 MS (i)450 296 MS (m)452 296 MS (e)460 296 MS (I)527 296 MS (n)530 296 MS (t)536 296 MS (e)540 296 MS (r)545 296 MS = (a)548 296 MS (c)554 296 MS (t)559 296 MS (i)562 296 MS (o)565 296 MS = (n)571 296 MS ( )577 296 MS (T)580 296 MS (i)587 296 MS (m)589 296 MS = (e)597 296 MS (M)660 296 MS (e)670 296 MS (s)675 296 MS (s)681 296 MS (a)686 296 MS = (g)691 296 MS (e)697 296 MS ( )702 296 MS (C)705 296 MS (o)712 296 MS = (u)718 296 MS (n)724 296 MS (t)730 296 MS n 609 386 162 5 B cp s n 608 384 812 6 B 1 g f 0 g n 610 386 811 5 B cp s n 882 59 M 1412 59 L 1412 281 L 882 281 L 882 59 L cp 0.754 g e 0 g gs n 530 1 882 281 CB n 882 281 M 1412 281 L s gr gs n 530 1 882 237 CB n 882 237 M 1412 237 L s gr gs n 530 1 882 193 CB n 882 193 M 1412 193 L s gr gs n 530 1 882 147 CB n 882 147 M 1412 147 L s gr gs n 530 1 882 59 CB n 882 59 M 1412 59 L s gr gs n 1 222 1015 59 CB n 1015 59 M 1015 281 L s gr gs n 1 222 1147 59 CB n 1147 59 M 1147 281 L s gr gs n 1 222 1280 59 CB n 1280 59 M 1280 281 L s gr gs n 1 222 1412 59 CB n 1412 59 M 1412 281 L s gr 0.5 g n 882 59 M 1412 59 L s n 1412 59 M 1412 281 L s n 1412 281 M 882 281 L s n 882 281 M 882 59 L s 0 g n 898 77 M 939 77 L 939 103 L 898 103 L 898 77 L cp gs 0.641 g e gr s n 1163 71 M 1204 71 L 1204 103 L 1163 103 L 1163 71 L cp gs 0.641 g e gr s n 1296 69 M 1337 69 L 1337 103 L 1296 103 L 1296 69 L cp gs 0.641 g e gr s n 928 103 M 969 103 L 969 117 L 928 117 L 928 103 L cp gs 0.336 g e gr s n 1060 103 M 1101 103 L 1101 269 L 1060 269 L 1060 103 L cp gs 0.336 g e gr s n 1192 103 M 1234 103 L 1234 124 L 1192 124 L 1192 103 L cp gs 0.336 g e gr s n 1325 103 M 1366 103 L 1366 108 L 1325 108 L 1325 103 L cp gs 0.336 g e gr s n 957 103 M 998 103 L 998 109 L 957 109 L 957 103 L cp gs 0.977 g e gr s n 1089 103 M 1130 103 L 1130 245 L 1089 245 L 1089 103 L cp gs 0.977 g e gr s n 1222 103 M 1263 103 L 1263 112 L 1222 112 L 1222 103 L cp gs 0.977 g e gr s n 1354 93 M 1395 93 L 1395 103 L 1354 103 L 1354 93 L cp gs 0.977 g e gr s n 882 59 M 882 281 L s n 879 281 M 882 281 L s n 879 237 M 882 237 L s n 879 193 M 882 193 L s n 879 147 M 882 147 L s n 879 103 M 882 103 L s n 879 59 M 882 59 L s n 882 103 M 1412 103 L s %%BeginFont: Times_New_Roman_Negrita011 /Times_New_Roman_Negrita011 findfont begin Encoding 51 /c51 put CD /c51 [7 0 8 7 0 7 8 0 8 <~r+9PQHsg@O~>]put end %%EndFont [11 0 0 -11 0 0]/Times_New_Roman_Negrita011 MF (6)1081 27 MS (H)1088 27 MS (Q)1093 27 MS (V)1099 27 MS (L)1104 27 MS = (W)1108 27 MS (L)1111 27 MS (Y)1115 27 MS (L)1119 27 MS (W)1122 27 MS = (\\)1126 27 MS (\003)1131 27 MS (W)1133 27 MS (R)1137 27 MS (\003)1142 = 27 MS (3)1145 27 MS [10.992 0 0 -10.992 0 0]/Times-Roman MF (-)838 286 MS (2)841 286 MS (0)846 286 MS (,)851 286 MS (0)854 286 MS = (0)859 286 MS (%)864 286 MS (-)838 242 MS (1)841 242 MS (5)846 242 MS (,)851 242 MS (0)854 242 MS = (0)859 242 MS (%)864 242 MS (-)838 198 MS (1)841 198 MS (0)846 198 MS (,)851 198 MS (0)854 198 MS = (0)859 198 MS (%)864 198 MS (-)843 152 MS (5)846 152 MS (,)851 152 MS (0)854 152 MS (0)859 152 MS = (%)864 152 MS (0)846 108 MS (,)851 108 MS (0)854 108 MS (0)859 108 MS (%)864 108 MS (5)846 64 MS (,)851 64 MS (0)854 64 MS (0)859 64 MS (%)864 64 MS n 131 18 1081 368 B 1 g f 0 g n 133 20 1080 367 B cp s n 4 4 1085 375 B 0.641 g f 0 g n 6 6 1084 374 B cp s (A)1093 382 MS (l)1102 382 MS (f)1104 382 MS (a)1108 382 MS ( )1113 382 = MS (C)1115 382 MS (o)1122 382 MS (r)1128 382 MS (e)1132 382 MS n 4 4 1143 375 B 0.336 g f 0 g n 6 6 1142 374 B cp s (E)1151 382 MS (M)1157 382 MS n 4 4 1174 375 B 0.977 g f 0 g n 6 6 1173 374 B cp s (M)1182 382 MS (E)1192 382 MS (M)1198 382 MS n 821 301 M 1412 301 L s n 821 357 M 1412 357 L s n 882 281 M 1412 281 L s n 821 301 M 821 357 L s n 882 281 M 882 357 L s n 1015 281 M 1015 357 L s n 1147 281 M 1147 357 L s n 1280 281 M 1280 357 L s n 1412 281 M 1412 357 L s n 4 4 826 310 B 0.641 g f 0 g n 6 6 825 309 B cp s (A)834 317 MS (l)843 317 MS (f)845 317 MS (a)849 317 MS ( )854 317 MS = (C)856 317 MS (o)863 317 MS (r)869 317 MS (e)873 317 MS (2)935 316 MS (,)940 316 MS (8)943 316 MS (7)948 316 MS (%)953 316 MS (0)1068 316 MS (,)1073 316 MS (0)1075 316 MS (0)1080 316 MS (%)1086 316 = MS (3)1200 316 MS (,)1205 316 MS (6)1208 316 MS (6)1213 316 MS (%)1218 316 = MS (3)1333 316 MS (,)1338 316 MS (8)1340 316 MS (3)1346 316 MS (%)1351 316 = MS gs n 589 1 822 320 CB n 821 320 M 1412 320 L s gr n 4 4 826 329 B 0.336 g f 0 g n 6 6 825 328 B cp s (E)834 336 MS (M)840 336 MS (-)933 335 MS (1)937 335 MS (,)942 335 MS (4)945 335 MS (8)950 335 MS = (%)955 335 MS (-)1063 335 MS (1)1067 335 MS (8)1072 335 MS (,)1077 335 MS (6)1080 335 = MS (7)1085 335 MS (%)1090 335 MS (-)1198 335 MS (2)1202 335 MS (,)1207 335 MS (3)1210 335 MS (6)1215 335 = MS (%)1220 335 MS (-)1331 335 MS (0)1334 335 MS (,)1340 335 MS (5)1342 335 MS (4)1347 335 = MS (%)1352 335 MS gs n 589 1 822 339 CB n 821 339 M 1412 339 L s gr n 4 4 826 348 B 0.977 g f 0 g n 6 6 825 347 B cp s gs n 27 13 834 343 CB (M)834 354 MS (E)845 354 MS (M)851 354 MS gr gs n 31 13 933 343 CB (-)933 354 MS (0)937 354 MS (,)942 354 MS (6)945 354 MS (1)950 354 MS = (%)955 354 MS gr gs n 36 13 1063 343 CB (-)1063 354 MS (1)1067 354 MS (5)1072 354 MS (,)1077 354 MS (9)1080 354 = MS (4)1085 354 MS (%)1090 354 MS gr gs n 31 13 1198 343 CB (-)1198 354 MS (0)1202 354 MS (,)1207 354 MS (9)1210 354 MS (8)1215 354 = MS (%)1220 354 MS gr gs n 28 13 1333 343 CB (1)1333 354 MS (,)1338 354 MS (1)1340 354 MS (5)1346 354 MS (%)1351 354 = MS gr (E)918 296 MS (l)924 296 MS (a)927 296 MS (p)932 296 MS (s)938 296 MS = (e)943 296 MS (d)948 296 MS ( )954 296 MS (T)957 296 MS (i)963 296 MS = (m)966 296 MS (e)974 296 MS (S)1047 296 MS (e)1053 296 MS (l)1058 296 MS (e)1061 296 MS (c)1066 296 = MS (t)1071 296 MS (i)1075 296 MS (o)1077 296 MS (n)1083 296 MS ( )1089 = 296 MS (T)1092 296 MS (i)1099 296 MS (m)1101 296 MS (e)1109 296 MS (I)1176 296 MS (n)1180 296 MS (t)1186 296 MS (e)1189 296 MS (r)1194 296 = MS (a)1198 296 MS (c)1203 296 MS (t)1208 296 MS (i)1211 296 MS (o)1214 = 296 MS (n)1220 296 MS ( )1226 296 MS (T)1228 296 MS (i)1235 296 MS = (m)1238 296 MS (e)1246 296 MS (M)1310 296 MS (e)1320 296 MS (s)1325 296 MS (s)1330 296 MS (a)1335 296 = MS (g)1340 296 MS (e)1346 296 MS ( )1352 296 MS (C)1354 296 MS (o)1361 = 296 MS (u)1367 296 MS (n)1373 296 MS (t)1379 296 MS n 610 386 811 5 B cp s n 607 384 163 427 B 1 g f 0 g n 609 386 162 426 B cp s n 233 480 M 763 480 L 763 702 L 233 702 L 233 480 L cp 0.754 g e 0 g gs n 530 1 233 702 CB n 233 702 M 763 702 L s gr gs n 530 1 233 671 CB n 233 671 M 763 671 L s gr gs n 530 1 233 638 CB n 233 638 M 763 638 L s gr gs n 530 1 233 575 CB n 233 575 M 763 575 L s gr gs n 530 1 233 544 CB n 233 544 M 763 544 L s gr gs n 530 1 233 511 CB n 233 511 M 763 511 L s gr gs n 530 1 233 480 CB n 233 480 M 763 480 L s gr gs n 1 222 365 480 CB n 365 480 M 365 702 L s gr gs n 1 222 498 480 CB n 498 480 M 498 702 L s gr gs n 1 222 631 480 CB n 631 480 M 631 702 L s gr gs n 1 222 763 480 CB n 763 480 M 763 702 L s gr 0.5 g n 233 480 M 763 480 L s n 763 480 M 763 702 L s n 763 702 M 233 702 L s n 233 702 M 233 480 L s 0 g n 249 547 M 290 547 L 290 607 L 249 607 L 249 547 L cp gs 0.641 g e gr s n 382 538 M 423 538 L 423 607 L 382 607 L 382 538 L cp gs 0.641 g e gr s n 514 553 M 555 553 L 555 607 L 514 607 L 514 553 L cp gs 0.641 g e gr s n 647 540 M 688 540 L 688 607 L 647 607 L 647 540 L cp gs 0.641 g e gr s n 278 511 M 319 511 L 319 607 L 278 607 L 278 511 L cp gs 0.336 g e gr s n 411 607 M 452 607 L 452 613 L 411 613 L 411 607 L cp gs 0.336 g e gr s n 543 527 M 584 527 L 584 607 L 543 607 L 543 527 L cp gs 0.336 g e gr s n 676 598 M 717 598 L 717 607 L 676 607 L 676 598 L cp gs 0.336 g e gr s n 307 513 M 348 513 L 348 607 L 307 607 L 307 513 L cp gs 0.977 g e gr s n 440 607 M 481 607 L 481 673 L 440 673 L 440 607 L cp gs 0.977 g e gr s n 572 509 M 613 509 L 613 607 L 572 607 L 572 509 L cp gs 0.977 g e gr s n 705 603 M 746 603 L 746 607 L 705 607 L 705 603 L cp gs 0.977 g e gr s n 233 480 M 233 702 L s n 229 702 M 233 702 L s n 229 671 M 233 671 L s n 229 638 M 233 638 L s n 229 607 M 233 607 L s n 229 575 M 233 575 L s n 229 544 M 233 544 L s n 229 511 M 233 511 L s n 229 480 M 233 480 L s n 233 607 M 763 607 L s %%BeginFont: Times_New_Roman_Negrita011 /Times_New_Roman_Negrita011 findfont begin Encoding 38 /c38 put CD /c38 [9 1 8 8 0 7 8 -1 8 <~3bH7E^qaDA~>]put end %%EndFont [11 0 0 -11 0 0]/Times_New_Roman_Negrita011 MF (6)432 448 MS (H)439 448 MS (Q)444 448 MS (V)450 448 MS (L)455 448 MS = (W)459 448 MS (L)462 448 MS (Y)465 448 MS (L)470 448 MS (W)473 448 MS = (\\)477 448 MS (\003)482 448 MS (W)484 448 MS (R)488 448 MS (\003)493 = 448 MS (&)495 448 MS [10.992 0 0 -10.992 0 0]/Times-Roman MF (-)194 707 MS (6)197 707 MS (,)202 707 MS (0)205 707 MS (0)210 707 MS = (%)215 707 MS (-)194 676 MS (4)197 676 MS (,)202 676 MS (0)205 676 MS (0)210 676 MS = (%)215 676 MS (-)194 643 MS (2)197 643 MS (,)202 643 MS (0)205 643 MS (0)210 643 MS = (%)215 643 MS (0)197 612 MS (,)202 612 MS (0)205 612 MS (0)210 612 MS (%)215 612 MS (2)197 580 MS (,)202 580 MS (0)205 580 MS (0)210 580 MS (%)215 580 MS (4)197 549 MS (,)202 549 MS (0)205 549 MS (0)210 549 MS (%)215 549 MS (6)197 516 MS (,)202 516 MS (0)205 516 MS (0)210 516 MS (%)215 516 MS (8)197 485 MS (,)202 485 MS (0)205 485 MS (0)210 485 MS (%)215 485 MS n 132 18 431 789 B 1 g f 0 g n 134 20 430 788 B cp s n 4 4 436 796 B 0.641 g f 0 g n 6 6 435 795 B cp s (A)444 803 MS (l)453 803 MS (f)455 803 MS (a)459 803 MS ( )464 803 MS = (C)466 803 MS (o)473 803 MS (r)479 803 MS (e)483 803 MS n 4 4 494 796 B 0.336 g f 0 g n 6 6 493 795 B cp s (E)502 803 MS (M)508 803 MS n 4 4 525 796 B 0.977 g f 0 g n 6 6 524 795 B cp s (M)533 803 MS (E)543 803 MS (M)549 803 MS n 172 722 M 763 722 L s n 172 778 M 763 778 L s n 233 702 M 763 702 L s n 172 722 M 172 778 L s n 233 702 M 233 778 L s n 365 702 M 365 778 L s n 498 702 M 498 778 L s n 631 702 M 631 778 L s n 763 702 M 763 778 L s n 4 4 177 731 B 0.641 g f 0 g n 6 6 176 730 B cp s (A)185 738 MS (l)194 738 MS (f)196 738 MS (a)200 738 MS ( )205 738 MS = (C)207 738 MS (o)214 738 MS (r)220 738 MS (e)224 738 MS (3)286 737 MS (,)291 737 MS (7)294 737 MS (7)299 737 MS (%)304 737 MS (4)418 737 MS (,)424 737 MS (3)426 737 MS (8)431 737 MS (%)436 737 MS (3)551 737 MS (,)556 737 MS (3)559 737 MS (7)564 737 MS (%)569 737 MS (4)683 737 MS (,)688 737 MS (2)691 737 MS (0)696 737 MS (%)701 737 MS gs n 589 1 173 741 CB n 172 741 M 763 741 L s gr n 4 4 177 750 B 0.336 g f 0 g n 6 6 176 749 B cp s (E)185 757 MS (M)191 757 MS (6)286 756 MS (,)291 756 MS (0)294 756 MS (2)299 756 MS (%)304 756 MS (-)417 756 MS (0)420 756 MS (,)425 756 MS (4)428 756 MS (0)433 756 MS = (%)438 756 MS (5)551 756 MS (,)556 756 MS (0)559 756 MS (2)564 756 MS (%)569 756 MS (0)683 756 MS (,)688 756 MS (5)691 756 MS (6)696 756 MS (%)701 756 MS gs n 589 1 173 760 CB n 172 760 M 763 760 L s gr n 4 4 177 769 B 0.977 g f 0 g n 6 6 176 768 B cp s gs n 27 13 185 764 CB (M)185 775 MS (E)196 775 MS (M)201 775 MS gr (5)286 774 MS (,)291 774 MS (9)294 774 MS (2)299 774 MS (%)304 774 MS (-)417 774 MS (4)420 774 MS (,)425 774 MS (1)428 774 MS (8)433 774 MS = (%)438 774 MS (6)551 774 MS (,)556 774 MS (1)559 774 MS (0)564 774 MS (%)569 774 MS (0)683 774 MS (,)688 774 MS (2)691 774 MS (5)696 774 MS (%)701 774 MS (E)269 716 MS (l)275 716 MS (a)277 716 MS (p)282 716 MS (s)288 716 MS = (e)294 716 MS (d)299 716 MS ( )305 716 MS (T)307 716 MS (i)314 716 MS = (m)317 716 MS (e)324 716 MS (S)398 716 MS (e)404 716 MS (l)409 716 MS (e)412 716 MS (c)417 716 MS = (t)422 716 MS (i)425 716 MS (o)428 716 MS (n)434 716 MS ( )440 716 MS = (T)442 716 MS (i)449 716 MS (m)452 716 MS (e)460 716 MS (I)527 716 MS (n)530 716 MS (t)536 716 MS (e)540 716 MS (r)545 716 MS = (a)548 716 MS (c)554 716 MS (t)559 716 MS (i)562 716 MS (o)565 716 MS = (n)571 716 MS ( )577 716 MS (T)579 716 MS (i)586 716 MS (m)589 716 MS = (e)596 716 MS (M)660 716 MS (e)670 716 MS (s)676 716 MS (s)681 716 MS (a)686 716 MS = (g)691 716 MS (e)697 716 MS ( )702 716 MS (C)705 716 MS (o)712 716 MS = (u)718 716 MS (n)723 716 MS (t)729 716 MS n 609 386 162 426 B cp s n 607 384 812 427 B 1 g f 0 g n 609 386 811 426 B cp s n 883 480 M 1412 480 L 1412 702 L 883 702 L 883 480 L cp 0.754 g e 0 g gs n 529 1 883 665 CB n 883 665 M 1412 665 L s gr gs n 529 1 883 628 CB n 883 628 M 1412 628 L s gr gs n 529 1 883 590 CB n 883 590 M 1412 590 L s gr gs n 529 1 883 554 CB n 883 554 M 1412 554 L s gr gs n 529 1 883 516 CB n 883 516 M 1412 516 L s gr gs n 529 1 883 480 CB n 883 480 M 1412 480 L s gr gs n 1 222 1412 480 CB n 1412 480 M 1412 702 L s gr 0.5 g n 883 480 M 1412 480 L s n 1412 480 M 1412 702 L s n 1412 702 M 883 702 L s n 883 702 M 883 480 L s 0 g gs n 166 129 949 573 CB n 949 573 M 1114 573 L 1114 702 L 949 702 L 949 573 L cp gs 0.641 g e gr s gr gs n 167 189 1064 513 CB n 1064 513 M 1230 513 L 1230 702 L 1064 702 L 1064 513 L cp gs 0.336 g e gr s gr gs n 167 37 1180 665 CB n 1180 665 M 1346 665 L 1346 702 L 1180 702 L 1180 665 L cp gs 0.977 g e gr s gr n 883 480 M 883 702 L s n 880 702 M 883 702 L s n 880 665 M 883 665 L s n 880 628 M 883 628 L s n 880 590 M 883 590 L s n 880 554 M 883 554 L s n 880 516 M 883 516 L s n 880 480 M 883 480 L s n 883 702 M 1412 702 L s %%BeginFont: Times_New_Roman_Negrita011 /Times_New_Roman_Negrita011 findfont begin Encoding 40 /c40 put CD /c40 [6 0 8 6 0 6 8 0 8 <~r+'JcBOGBK~>]put Encoding 91 /c91 put CD /c91 [6 0 5 6 0 6 5 0 5 <~lu4X]put Encoding 70 /c70 put CD /c70 [5 0 5 4 0 4 5 0 5 <~E6uD9Du~>]put Encoding 88 /c88 put CD /c88 [7 0 5 7 0 7 5 0 5 <~ltgKS4o~>]put Encoding 68 /c68 put CD /c68 [6 0 5 6 0 6 5 0 5 <~E0tn&Hi~>]put end %%EndFont [11 0 0 -11 0 0]/Times_New_Roman_Negrita011 MF (\()1070 448 MS ([)1077 448 MS (H)1082 448 MS (F)1087 448 MS (X)1092 448 = MS (W)1098 448 MS (L)1102 448 MS (R)1105 448 MS (Q)1110 448 MS = (\003)1116 448 MS (')1119 448 MS (H)1127 448 MS (Y)1132 448 MS (L)1136 = 448 MS (D)1140 448 MS (W)1145 448 MS (L)1148 448 MS (R)1152 448 MS (Q)1157 448 MS [10.992 0 0 -10.992 0 0]/Times-Roman MF (0)847 707 MS (,)852 707 MS (0)854 707 MS (0)860 707 MS (%)865 707 MS (5)847 670 MS (,)852 670 MS (0)854 670 MS (0)860 670 MS (%)865 670 MS (1)841 633 MS (0)847 633 MS (,)852 633 MS (0)854 633 MS (0)860 633 MS = (%)865 633 MS (1)841 595 MS (5)847 595 MS (,)852 595 MS (0)854 595 MS (0)860 595 MS = (%)865 595 MS (2)841 559 MS (0)847 559 MS (,)852 559 MS (0)854 559 MS (0)860 559 MS = (%)865 559 MS (2)841 521 MS (5)847 521 MS (,)852 521 MS (0)854 521 MS (0)860 521 MS = (%)865 521 MS (3)841 485 MS (0)847 485 MS (,)852 485 MS (0)854 485 MS (0)860 485 MS = (%)865 485 MS n 132 18 1080 789 B 1 g f 0 g n 134 20 1079 788 B cp s n 4 4 1084 796 B 0.641 g f 0 g n 6 6 1083 795 B cp s (A)1093 803 MS (l)1102 803 MS (f)1104 803 MS (a)1108 803 MS ( )1113 803 = MS (C)1115 803 MS (o)1122 803 MS (r)1128 803 MS (e)1132 803 MS n 4 4 1143 796 B 0.336 g f 0 g n 6 6 1142 795 B cp s (E)1152 803 MS (M)1158 803 MS n 4 4 1174 796 B 0.977 g f 0 g n 6 6 1173 795 B cp s (M)1183 803 MS (E)1193 803 MS (M)1199 803 MS n 822 722 M 1412 722 L s n 822 778 M 1412 778 L s n 883 702 M 1412 702 L s n 822 722 M 822 778 L s n 883 702 M 883 778 L s n 1412 702 M 1412 778 L s n 3 4 826 731 B 0.641 g f 0 g n 5 6 825 730 B cp s (A)835 738 MS (l)843 738 MS (f)846 738 MS (a)849 738 MS ( )854 738 MS = (C)857 738 MS (o)864 738 MS (r)870 738 MS (e)873 738 MS (1)1131 737 MS (7)1136 737 MS (,)1141 737 MS (3)1144 737 MS (8)1149 737 = MS (%)1154 737 MS gs n 589 1 822 741 CB n 822 741 M 1412 741 L s gr n 3 4 826 750 B 0.336 g f 0 g n 5 6 825 749 B cp s (E)835 757 MS (M)841 757 MS (2)1131 756 MS (5)1136 756 MS (,)1141 756 MS (5)1144 756 MS (3)1149 756 = MS (%)1154 756 MS gs n 589 1 822 760 CB n 822 760 M 1412 760 L s gr n 3 4 826 769 B 0.977 g f 0 g n 5 6 825 768 B cp s gs n 27 13 835 764 CB (M)835 775 MS (E)845 775 MS (M)851 775 MS gr (4)1134 774 MS (,)1139 774 MS (9)1141 774 MS (3)1147 774 MS (%)1152 774 = MS (E)1101 716 MS (x)1107 716 MS (e)1111 716 MS (c)1116 716 MS (u)1122 716 = MS (t)1128 716 MS (i)1131 716 MS (o)1134 716 MS (n)1140 716 MS ( )1146 = 716 MS (D)1148 716 MS (e)1156 716 MS (v)1161 716 MS (i)1167 716 MS = (a)1170 716 MS (t)1175 716 MS (i)1179 716 MS (o)1181 716 MS (n)1187 716 MS n 609 386 811 426 B cp s showpage FontSV restore PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: %%+ Times_New_Roman_Negrita011 end %%Pages: 1 %%EOF %%EndDocument @endspecial 1229 3083 a Fs(Figure)i(8.)h(Results)g(of)g(the)g (simulation)g(analysis.)191 3404 y Fq(completely)i(insensiti)n(v)o(e)i (to)g Fm(D)j Fq(because)c(coordinators)f(are)i(not)f(directly)h (dependent)d(on)j(each)g(other)f(to)h(achie)n(v)o(e)191 3504 y(mutual)c(e)o(xclusion.)274 3607 y(Notice)k(that)h(the)f(impact)g (on)g(the)h(elapsed)f(time)h(is)g(not)f(so)h(big)f(as)h(it)h(might)d (be)i(e)o(xpected.)d(The)j(reason)e(is)j(that)191 3707 y(this)18 b(metric)g(is)g(hundreds)e(of)i(times)g(greater)f(than)g(the) h(selection)f(time,)h(thus)g(reducing)e(the)i(impact)f(on)g(the)h(a)n (v)o(erage)191 3807 y(percentage.)k(F)o(or)i(e)o(xample,)f(if)h Fm(C)37 b Fj(=3D)30 b(6)p Fm(;)14 b(P)42 b Fj(=3D)30 b(5)p Fq(,)24 b(the)h(selection)e(time)i(for)f(MEM)g(increased)f(4.40)g(ms)i (when)e(we)191 3906 y(increased)d Fm(D)k Fq(from)d(9)g(to)h(10,)f(i.e,) g(it)h(increased)f(by)g(31.18\045.)e(Ho)n(we)n(v)o(er)m(,)h(the)h (total)h(elapsed)f(time)g(increased)g(from)191 4006 y(5277)e(ms)h(to)h (5470)e(ms,)h(which)g(amounts)f(to)h(only)f(2.65\045.)274 4110 y(As)28 b(for)f(parameter)f Fm(P)12 b Fq(,)28 b(it)g(is)g (interesting)f(to)g(observ)o(e)f(that)i(the)g(selection)f(time)g(of)h Fm(\013)p Fq(\226core)e(is)j(insensiti)n(v)o(e)e(to)191 4209 y(it,)d(b)n(ut)f(EM)g(impro)o(v)o(es)e(its)k(selection)e(time)g (as)h(the)f(de)o(gree)f(of)h(run\226time)f(con\003ict)g(increases.)h (The)g(reason)g(is)h(that)191 4309 y(the)32 b(selection)g(time)g(for)g (EM)g(is)h(quite)f(sensiti)n(v)o(e)g(to)g(the)g(a)n(v)o(erage)f (distance)h(between)f(enabled)g(managers.)g(If)191 4408 y(this)24 b(distance)f(decreases,)f(the)i(selection)f(time)g(impro)o(v) o(es.)e(Gi)n(v)o(en)i(that)g(the)g(number)f(of)h(managers)f(is)i(\002x) o(ed,)e(this)191 4508 y(distance)28 b(decreases)f(as)i Fm(P)41 b Fq(increases)27 b(because)h(the)g(number)e(of)i(enabled)f (managers)f(increases)i(as)h(the)f(de)o(gree)191 4608 y(of)f(run-time)f(con\003ict)h(increases.)g(The)g(selection)g(time)h (of)f(MEM)g(also)h(decreases)f(with)h Fm(P)39 b Fq(because)27 b(the)h(more)191 4707 y(managers)16 b(are)h(enabled,)f(the)h(greater)f (the)h(probability)e(of)i(a)h(manager)d(ha)n(ving)h(all)i(its)g(shared) f(forks)f(being)g(enabled)191 4807 y(is.)21 b(In)e(f)o(act,)h(the)g (selection)g(time)g(for)f(both)g(EM)h(and)f(MEM)h(is)h(minimum)e(when)g (the)h(de)o(gree)e(of)i(run\226time)e(con\003ict)191 4907 y(is)28 b(maximum.)e(The)h(time)g Fm(\013)p Fq(\226core)g(tak)o (es)h(to)f(select)h(an)f(enabled)f(interaction)g(is)j(completely)c (insensiti)n(v)o(e)i(to)h Fm(P)12 b Fq(,)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)k FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 23 23 23 22 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(23)p 191 473 3388 5 v 191 606 a(although)28 b(the)i(number)e(of)i(messages)g(needed)e(to) i(achie)n(v)o(e)f(mutual)g(e)o(xclusion)g(increases)g(sharply)g(due)h (to)g(the)191 706 y(e)o(xtra)19 b(messages)i(needed)e(to)h(refuse)g (coordinators)d(that)k(ha)n(v)o(e)e(not)h(succeeded)f(in)h(achie)n (ving)f(mutual)g(e)o(xclusion.)274 807 y(As)h(for)f(parameter)f Fm(C)6 b Fq(,)20 b Fm(\013)p Fq(\226core)e(is)j(sensiti)n(v)o(e)e(to)g (it)h(because)f(it)h(achie)n(v)o(es)e(mutual)h(e)o(xclusion)f(by)h (locking)f(shared)191 907 y(participants.)k(Thus,)h(the)g(selection)g (time)g(increases)g(steadily)h(as)g(the)f Fm(C)30 b Fq(increases.)23 b(On)g(the)g(contrary)-5 b(,)21 b(both)i(EM)191 1006 y(and)k(MEM)h(are)g(almost)f(insensiti)n(v)o(e)g(to)h Fm(C)6 b Fq(.)29 b(W)m(ith)f(respect)f(to)h(the)g(number)e(of)h (messages)h(needed)f(to)h(schedule)191 1106 y(an)h(interaction,)f Fm(\013)p Fq(\226core)g(needs)h(more)f(messages)i(to)f(achie)n(v)o(e)f (mutual)g(e)o(xclusion)g(when)h Fm(C)36 b Fq(increases,)28 b(which)191 1206 y(justi\002es)21 b(the)f(rise)h(sho)n(wn)e(in)i(the)f (plot.)274 1307 y(Finally)-5 b(,)19 b(we)i(e)o(xamine)e(the)h(e)o(x)o (ecution)e(de)n(viation)h(for)g(each)h(algorithm.)e(This)j(metric)f (can)g(be)g(easily)g(measured)191 1407 y(when)i Fm(D)30 b Fj(=3D)e Fm(P)35 b Fq(because,)22 b(in)h(these)g(cases,)g(all)h (interactions)e(are)g(con\003icting)g(permanently)-5 b(.)20 b(Thus,)i(during)f(a)j(run)191 1506 y(long)c(enough)f(to)i (schedule)g Fm(N)30 b Fq(interactions,)20 b(each)g(one)h(should)f(be)h (e)o(x)o(ecuted)e(approximately)f Fm(N)r(=3DD)23 b Fq(times.)f(It)f(is) 191 1606 y(interesting)g(to)h(observ)o(e)f(that)h Fm(\013)p Fq(\226core)f(ranks)h(between)f(EM)h(and)f(MEM.)h(This)g(w)o(as)h (predictable)e(because,)g(in)h(the)191 1706 y(case)j(of)f(EM,)g(the)g (chances)g(of)g(an)g(interaction)f(being)g(e)o(x)o(ecuted)f(depend)h (solely)h(on)g(its)h(chancing)e(on)g(recei)n(ving)191 1805 y(the)c(tok)o(en)e(at)j(the)e(right)g(time.)h(As)g(for)f Fm(\013)p Fq(\226core,)g(it)h(depends)e(on)i(the)f(chances)g(of)g(a)h (coordinator)d(being)i(able)h(to)f(lock)191 1905 y(all)23 b(of)e(its)j(participants)d(in)h(order)-5 b(.)21 b(On)h(the)g(contrary) -5 b(,)20 b(the)i(algorithm)e(for)i(implementing)e(the)i(diner)f (philosophers)191 2005 y(problem)15 b(on)i(which)g(MEM)g(relies)g (guarantees)f(that)h(e)n(v)o(ery)f(philosopher)e(that)j(gets)h(hungry)d (shall)i(e)n(v)o(entually)e(ha)n(v)o(e)191 2104 y(a)21 b(chance)e(to)h(eat,)g(thus)h(producing)c(a)k(better)e(distrib)n(ution) g(of)h(e)o(x)o(ecuted)f(interactions)g(in)h(this)h(set)g(of)f(e)o (xperiments.)191 2309 y Fr(The)h(perf)n(ormance)e(of)h(our)g(pr)o (ototype)191 2506 y Fq(W)-7 b(e)38 b(ha)n(v)o(e)f(implemented)f Fm(\013)p Fq(\226core)g(in)i(the)f(laboratory)f(using)g(Ja)n(v)n(a)i (1.2)f(and)g(the)g(CORB)m(A)i(implementation)191 2606 y(Orbacus)21 b(3.3.2.)f(In)h(this)h(section,)f(we)h(present)f(a)h (performance)d(analysis)i(carried)g(out)g(using)g(this)h(prototipe.)e (The)191 2706 y(tests)26 b(were)e(run)g(on)h(an)f(isolated)h(netw)o (ork)e(composed)g(of)i(200)e(MHz)i(Pentium)f(computers)g(with)g(64)h (MB)g(RAM)191 2805 y(memory)-5 b(.)22 b(P)o(articipants)i(and)f (entities)i(were)f(distrib)n(uted)g(on)g(the)g(a)n(v)n(ailable)g (machines)g(so)g(that)h(each)f(one)f(hosted)191 2905 y(the)d(same)h(number)d(of)i(processes.)274 3006 y(W)-7 b(e)25 b(used)e(a)h(number)d(of)j(well\226kno)n(wn)d(problems)h(as)i (benchmarks,)d(and)i(the)h(results)g(of)f(the)g(e)o(xperiments)f(are) 191 3106 y(sho)n(wn)d(in)h(\002gure)f(9.)g(These)h(results)g(sho)n(w)f (that)h(our)f(prototype)f(performs)g(quite)h(well,)h(and)f(that)h Fm(\013)p Fq(\226core)f(is)i(suited)191 3206 y(to)f(be)g(used)g(in)h (practical)e(applications.)274 3307 y(Ja)n(v)n(a)30 b(is)g(a)g (portable,)e(\003e)o(xible)h(language,)e(and)i(this)h(is)h(the)e (reason)g(why)f(we)i(selected)g(it)g(to)f(implement)g(our)191 3407 y(prototype.)f(Nonetheless,)i(its)h(performance)d(is)k(a)f(clear)f (dra)o(wback,)e(specially)j(if)g(we)f(tak)o(e)h(into)f(account)g(that) 191 3506 y(communication)e(delays)j(are)g(comparable)e(to)i(the)g(time) h(the)f(Ja)n(v)n(a)g(V)-5 b(irtual)31 b(Machine)f(tak)o(es)i(to)f(e)o (x)o(ecute)f(most)191 3606 y(instructions.)274 3707 y(In)19 b(order)e(to)i(study)g(ho)n(w)f(the)h(implementation)d(language)i(af)n (fects)g(the)h(e)o(xperimental)e(results,)i(we)g(carried)f(out)g(a)191 3807 y(series)e(of)f(tests)i(using)e(the)g(synchronisation)e(pattern)i (sk)o(etched)f(in)i(Figure)f(10.)g(W)-7 b(e)16 b(prepared)e(a)i(set)g (of)f(programmes)191 3907 y Fm(T)240 3919 y Fl(1)277 3907 y Fm(;)f(T)363 3919 y Fl(2)399 3907 y Fm(;)g(:)g(:)g(:)g(;)g(T)633 3919 y Fh(n)678 3907 y Fq(,)26 b(and)g(each)g Fm(T)1100 3919 y Fh(k)1168 3907 y Fq(consisted)g(of)g Fm(k)k Fq(bipartite)25 b(interactions,)h(referred)e(to)j(as)g Fm(I)2925 3919 y Fh(i)2980 3907 y Fj(\()p Fm(i)35 b Fj(=3D)f(1)p Fm(;)14 b Fj(2)p Fm(;)g(:)g(:)g(:)e(;)i(k)s Fj(\))p Fq(,)191 4006 y(and)28 b Fm(k)f Fj(+)d(1)k Fq(participants,)f(referred)g(to)i (as)g Fm(P)1543 4018 y Fh(i)1599 4006 y Fj(\()p Fm(i)38 b Fj(=3D)g(1)p Fm(;)14 b Fj(2)p Fm(;)g(:)g(:)g(:)f(;)h(k)27 b Fj(+)d(1\))p Fq(.)k Fm(P)2441 4018 y Fl(1)2479 4006 y Fm(;)14 b(P)2569 4018 y Fl(2)2606 4006 y Fm(;)g(:)g(:)g(:)g(P)2807 4018 y Fh(k)2877 4006 y Fq(of)n(fer)27 b(participation)g(in)191 4106 y(interactions)22 b Fm(I)638 4118 y Fl(1)676 4106 y Fm(;)14 b(I)749 4118 y Fl(2)787 4106 y Fm(;)g(;)g(:)g(:)g(:)f(I)1007 4118 y Fh(k)1049 4106 y Fq(,)23 b(respecti)n(v)o(ely)-5 b(,)21 b(and)i Fm(P)1727 4118 y Fh(k)q Fl(+1)1877 4106 y Fq(of)n(fers)f(participation)g(in)h(an)o(y)g(interaction,)f(thus)h (making)191 4206 y(them)c(con\003icting.)g(Experiment)f Fm(T)1231 4218 y Fl(1)1288 4206 y Fq(is)j(tri)n(vial)e(because)h(it)g (consists)h(of)e(tw)o(o)h(entities)h(and)e(a)h(bipartite)f (interaction,)191 4305 y(b)n(ut)h(it)h(sho)n(ws)f(ho)n(w)g(our)f (algorithm)g(performs)f(in)j(absence)e(of)h(con\003icts.)274 4407 y(Each)j(test)h(w)o(as)h(run)e(until)g(each)g(interaction)f(w)o (as)j(e)o(x)o(ecuted)c(100)i(times,)h(and)f(we)h(measured)e(the)h(the)h (a)n(v)o(erage)191 4506 y(selection)j(time,)g(the)g(number)e(of)i (messages)g(e)o(xchanged)e(during)g(the)j(e)o(xperiments,)d(and)h(the)h (elapsed)g(running)191 4606 y(time.)274 4707 y(Figure)16 b(11)f(sho)n(ws)i(the)f(results)h(of)f(our)f(tests.)i(Theoretically)-5 b(,)14 b(the)j(a)n(v)o(erage)e(selection)h(time)g(is)h(independent)d (from)191 4807 y(the)23 b(number)f(of)h(con\003icting)f(interactions)g (in)h(our)g(scenario,)f(because)h(when)f(coordinator)f Fm(I)2954 4819 y Fh(i)3006 4807 y Fq(becomes)h(enabled)191 4907 y(in)f(test)g Fm(T)462 4919 y Fh(k)524 4907 y Fq(\(participants)e Fm(P)1013 4919 y Fh(i)1062 4907 y Fq(and)h Fm(P)1256 4919 y Fh(k)q Fl(+1)1402 4907 y Fq(ha)n(v)o(e)g(of)n(fered)f (participation)g(in)h Fm(I)2398 4919 y Fh(i)2426 4907 y Fq(\),)h(it)g(sends)g(a)g Fm(LO)r(C)6 b(K)27 b Fq(message)20 b(to)h(its)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f (Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 24 24 24 23 bop 191 299 a Fq(24)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 614 2014 a @beginspecial 56.689999 @llx 56.689999 @lly 375.589996 @urx 218.889999 @ury 3048 @rwi @setspecial %%BeginDocument: exre-bench.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip064.wmf %%Creator: Windows NT 4.0 %%CreationDate: 13:32 2/22/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 375.59 218.89 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 219.117 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate n 1308 657 166 9 B 1 g f 1 sl 0 g n 1310 659 165 8 B cp s n 244 135 M 1460 135 L 1460 551 L 244 551 L 244 135 L cp 0.754 g e 0 g gs n 1216 1 244 510 CB n 244 510 M 1460 510 L s gr gs n 1216 1 244 468 CB n 244 468 M 1460 468 L s gr gs n 1216 1 244 427 CB n 244 427 M 1460 427 L s gr gs n 1216 1 244 384 CB n 244 384 M 1460 384 L s gr gs n 1216 1 244 343 CB n 244 343 M 1460 343 L s gr gs n 1216 1 244 302 CB n 244 302 M 1460 302 L s gr gs n 1216 1 244 259 CB n 244 259 M 1460 259 L s gr gs n 1216 1 244 218 CB n 244 218 M 1460 218 L s gr gs n 1216 1 244 176 CB n 244 176 M 1460 176 L s gr gs n 1216 1 244 135 CB n 244 135 M 1460 135 L s gr gs n 1 416 397 135 CB n 397 135 M 397 551 L s gr gs n 1 416 548 135 CB n 548 135 M 548 551 L s gr gs n 1 416 700 135 CB n 700 135 M 700 551 L s gr gs n 1 416 853 135 CB n 853 135 M 853 551 L s gr gs n 1 416 1004 135 CB n 1004 135 M 1004 551 L s gr gs n 1 416 1156 135 CB n 1156 135 M 1156 551 L s gr gs n 1 416 1307 135 CB n 1307 135 M 1307 551 L s gr gs n 1 416 1460 135 CB n 1460 135 M 1460 551 L s gr 1 j 1 setlinecap 0.5 g n 244 135 M 1460 135 L CM 1.641 1.641 scale s SM n 1460 135 M 1460 551 L CM 1.641 1.641 scale s SM n 1460 551 M 244 551 L CM 1.641 1.641 scale s SM n 244 551 M 244 135 L CM 1.641 1.641 scale s SM 3 sl 0 g gs n 70 337 284 214 CB n 288 218 M 349 218 L 349 551 L 288 551 L 288 218 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 327 437 224 CB n 441 228 M 502 228 L 502 551 L 441 551 L 441 228 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 274 588 277 CB n 592 281 M 653 281 L 653 551 L 592 551 L 592 281 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 212 740 339 CB n 744 343 M 805 343 L 805 551 L 744 551 L 744 343 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 368 893 183 CB n 897 187 M 958 187 L 958 551 L 897 551 L 897 187 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 315 1044 236 CB n 1048 240 M 1109 240 L 1109 551 L 1048 551 L 1048 240 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 69 348 1197 203 CB n 1201 207 M 1261 207 L 1261 551 L 1201 551 L 1201 207 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr gs n 70 379 1347 172 CB n 1351 176 M 1412 176 L 1412 551 L 1351 551 L 1351 176 L cp gs 0.527 g e gr CM 1.641 1.641 scale s SM gr 1 sl n 244 135 M 244 551 L s n 236 551 M 244 551 L s n 236 510 M 244 510 L s n 236 468 M 244 468 L s n 236 427 M 244 427 L s n 236 384 M 244 384 L s n 236 343 M 244 343 L s n 236 302 M 244 302 L s n 236 259 M 244 259 L s n 236 218 M 244 218 L s n 236 176 M 244 176 L s n 236 135 M 244 135 L s n 244 551 M 1460 551 L s n 244 560 M 244 551 L s n 397 560 M 397 551 L s n 548 560 M 548 551 L s n 700 560 M 700 551 L s n 853 560 M 853 551 L s n 1004 560 M 1004 551 L s n 1156 560 M 1156 551 L s n 1307 560 M 1307 551 L s n 1460 560 M 1460 551 L s NTPSOct95 /FontSV save put %%BeginFont: Times_New_Roman_Negrita034.438 10 dict dup begin /FontType 3 def /FontMatrix [1 34 div 0 0 1 34 div 0 0] def /FontBBox [-5 -31 35 16] def /Encoding 256 array def 0 1 255 {Encoding exch /.notdef put} for /BuildGlyph {0 begin exch /CD get exch get /CI exch def CI 0 get 0 CI 1 4 getinterval aload pop setcachedevice CI 5 get CI 6 get true [1 0 0 -1 0 0] dup 4 CI 7 get put dup 5 CI 8 get put CI 9 get imagemask end}def /BuildGlyph load 0 5 dict put /BuildChar {1 index /Encoding get exch get 1 index /BuildGlyph get exec} bind def /CD 256 dict def CD /.notdef[.24 0 0 0 0 1 1 0 0 {<>}]put Encoding 44 /c44 put CD /c44 [13 1 23 12 0 11 23 -1 23 <~s56+l*rmA_*rmA_*rmA_*rmA_*rmA_*rmA_*rmA_*rmA_*rmA_*rnNUs53~>]put Encoding 81 /c81 put CD /c81 [19 0 16 19 0 19 16 0 16 <~r]U9UJ3FKo4qE0-%tHhSJ3FKo4qE0-%tHhSJ3FKo4qE0-%tHhSJH$_L~>]put Encoding 87 /c87 put CD /c87 [11 0 22 10 0 10 22 0 22 <~!WW9%"oo,5*WSA(J&)*"4odbH4odbH4odbH4odbH4odbH5!V]put Encoding 72 /c72 put CD /c72 [15 1 16 14 0 13 16 -1 16 <~#CmfP3,j+]G^0".s7l?hp]1'hquHX#Hk:`\5N!'&~>]put Encoding 85 /c85 put CD /c85 [15 1 16 15 0 14 16 -1 16 <~r]!)h5.j*B58ZQa4odbH4odbH4odbH4odbH4okV5~>]put Encoding 68 /c68 put CD /c68 [17 1 16 16 0 15 16 -1 16 <~&&9phE;8qtnG%"u!r*3!)#-)cGkh(/q"Xg_rr..e~>]put Encoding 70 /c70 put CD /c70 [15 1 16 14 0 13 16 -1 16 <~#N-Tk4Eu*qG]]put Encoding 76 /c76 put CD /c76 [9 0 23 9 0 9 23 0 23 <~)ur/&4odbH)uos=3D!!)uu4odbH4odbH4odbH4odbH4odbH4odbH4odbHs*t~>]put Encoding 82 /c82 put CD /c82 [17 1 16 16 0 15 16 -1 16 <~#J_]put Encoding 86 /c86 put CD /c86 [13 1 16 12 0 11 16 -1 16 <~5!WVn@)29Ipd"`Wrr@P!5JRff#N10k^u4.dn\Cas~>]put Encoding 3 /c3 put CD /c3 [9 0 0 16 -16 1 1 0 0 <~!!~>]put Encoding 51 /c51 put CD /c51 [21 1 23 20 0 19 23 -1 23 <~s82j]%tG`,^`NZo*s:FC"5k7'i#`'Z*s9;##J_Dl!$D+=3D*rl9_!!")@!$;1@*rl9_!!")= @!$;1@*rl:*J,oW-!!~>]put Encoding 54 /c54 put CD /c54 [19 2 23 18 0 16 23 -2 23 <~&&LFaE#rs.n-8@dp]CErs+#UW5O]cm#Q=3Dc'!<7R6J02Q;^^o?5n/TY3KAZ~>]put Encoding 71 /c71 put CD /c71 [19 1 23 18 0 17 23 -1 23 <~!<)ru4obRH!!#1_!'UA_4obRH!"V6n4T5=3DCIK4UV!-g[-pc\]Q4ok@A!;J_Xpc\]Q4ok@= A!.6s1I!u&[^OQhW!!~>]put end /Times_New_Roman_Negrita034.438 exch definefont pop %%EndFont [34.438 0 0 -34.438 0 0]/Times_New_Roman_Negrita034.438 MF (,)646 64 MS (Q)657 64 MS (W)676 64 MS (H)687 64 MS (U)703 64 MS (D)717 = 64 MS (F)735 64 MS (W)751 64 MS (L)762 64 MS (R)771 64 MS (Q)789 64 MS = (V)807 64 MS (\003)820 64 MS (3)828 64 MS (H)851 64 MS (U)867 64 MS (\003)881 64 MS (6)889 64 MS (H)908 64 MS (F)925 64 MS (R)941 64 MS = (Q)959 64 MS (G)977 64 MS %%IncludeFont: Times-Roman [26.25 0 0 -26.25 0 0]/Times-Roman MF (0)211 560 MS (2)198 519 MS (0)211 519 MS (4)198 476 MS (0)211 476 MS (6)198 435 MS (0)211 435 MS (8)198 392 MS (0)211 392 MS (1)185 351 MS (0)198 351 MS (0)211 351 MS (1)185 310 MS (2)198 310 MS (0)211 310 MS (1)185 268 MS (4)198 268 MS (0)211 268 MS (1)185 226 MS (6)198 226 MS (0)211 226 MS (1)185 184 MS (8)198 184 MS (0)211 184 MS (2)185 143 MS (0)198 143 MS (0)211 143 MS (D)290 599 MS (i)308 599 MS (n)313 599 MS (i)324 599 MS (n)329 599 MS = (g)341 599 MS (P)254 633 MS (h)269 633 MS (i)280 633 MS (l)285 633 MS (o)290 633 MS = (s)303 633 MS (o)313 633 MS (p)326 633 MS (h)339 633 MS (e)351 633 MS = (r)362 633 MS (s)370 633 MS (.)380 633 MS (L)438 599 MS (e)452 599 MS (a)464 599 MS (d)475 599 MS (e)488 599 MS = (r)500 599 MS (E)415 633 MS (l)429 633 MS (e)434 633 MS (c)446 633 MS (t)457 633 MS = (i)464 633 MS (o)469 633 MS (n)482 633 MS ( )493 633 MS (\()500 633 MS = (5)508 633 MS (\))521 633 MS (L)590 599 MS (e)605 599 MS (a)616 599 MS (d)628 599 MS (e)641 599 MS = (r)653 599 MS (E)561 633 MS (l)575 633 MS (e)580 633 MS (c)592 633 MS (t)603 633 MS = (i)610 633 MS (o)615 633 MS (n)628 633 MS ( )639 633 MS (\()646 633 MS = (1)654 633 MS (0)667 633 MS (\))680 633 MS (L)741 599 MS (e)756 599 MS (a)767 599 MS (d)779 599 MS (e)792 599 MS = (r)804 599 MS (E)712 633 MS (l)726 633 MS (e)731 633 MS (c)743 633 MS (t)754 633 MS = (i)761 633 MS (o)766 633 MS (n)779 633 MS ( )790 633 MS (\()797 633 MS = (2)805 633 MS (0)818 633 MS (\))831 633 MS (B)858 599 MS (a)874 599 MS (n)886 599 MS (k)897 599 MS ( )910 599 MS = (T)917 599 MS (r)931 599 MS (a)940 599 MS (n)951 599 MS (s)963 599 MS = (f)973 599 MS (e)979 599 MS (r)991 599 MS (M)1048 599 MS (a)1071 599 MS (t)1082 599 MS (r)1089 599 MS (i)1097 599 = MS (x)1102 599 MS (M)1013 633 MS (u)1036 633 MS (l)1048 633 MS (t)1053 633 MS (i)1059 633 = MS (p)1064 633 MS (l)1077 633 MS (i)1082 633 MS (c)1087 633 MS (a)1099 = 633 MS (t)1110 633 MS (i)1117 633 MS (o)1122 633 MS (n)1135 633 MS (T)1187 599 MS (r)1202 599 MS (a)1210 599 MS (v)1222 599 MS (e)1233 599 = MS (l)1245 599 MS (i)1250 599 MS (n)1255 599 MS (g)1266 599 MS (S)1186 633 MS (a)1201 633 MS (l)1212 633 MS (e)1217 633 MS (s)1228 633 = MS (m)1238 633 MS (a)1256 633 MS (n)1268 633 MS (H)1350 599 MS (a)1368 599 MS (n)1379 599 MS (n)1391 599 MS (o)1402 599 = MS (i)1415 599 MS (T)1347 633 MS (o)1361 633 MS (w)1374 633 MS (e)1393 633 MS (r)1404 633 = MS (s)1412 633 MS n 1310 659 165 8 B cp s showpage FontSV restore PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: %%+ Times_New_Roman_Negrita034.438 end %%Pages: 1 %%EOF %%EndDocument @endspecial 1143 2194 a Fs(Figure)i(9.)h(Experimental)g(results)g (using)h(benchmarks.)1292 3436 y @beginspecial 56.689999 @llx 56.689999 @lly 316.459991 @urx 270.790009 @ury 1422 @rwi @setspecial %%BeginDocument: sync-patt-b.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip024.wmf %%Creator: Windows NT 4.0 %%CreationDate: 19:54 2/10/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 316.46 270.79 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 270.988 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate 1 j 1 setlinecap 6 sl n 256 759 M 256 735 L CM 0.496 0.496 scale s SM n 256 720 M 256 696 L CM 0.496 0.496 scale s SM n 257 681 M 257 657 L CM 0.496 0.496 scale s SM n 257 642 M 257 618 L CM 0.496 0.496 scale s SM n 244 610 M 257 570 L 271 610 L 244 610 L cp e 18 sl n 617 434 M 635 434 L CM 0.496 0.496 scale s SM n 653 434 M 671 434 L CM 0.496 0.496 scale s SM n 689 434 M 707 434 L CM 0.496 0.496 scale s SM n 725 434 M 743 434 L CM 0.496 0.496 scale s SM n 761 434 M 779 434 L CM 0.496 0.496 scale s SM 6 sl n 488 757 M 488 733 L CM 0.496 0.496 scale s SM n 489 718 M 489 694 L CM 0.496 0.496 scale s SM n 489 679 M 489 655 L CM 0.496 0.496 scale s SM n 489 640 M 490 616 L CM 0.496 0.496 scale s SM n 476 611 M 490 570 L 503 611 L 476 611 L cp e n 903 760 M 903 736 L CM 0.496 0.496 scale s SM n 903 721 M 903 697 L CM 0.496 0.496 scale s SM n 903 682 M 903 658 L CM 0.496 0.496 scale s SM n 904 643 M 904 619 L CM 0.496 0.496 scale s SM n 890 612 M 904 571 L 917 612 L 890 612 L cp e n 1136 758 M 1136 734 L CM 0.496 0.496 scale s SM n 1137 719 M 1137 695 L CM 0.496 0.496 scale s SM n 1137 680 M 1137 656 L CM 0.496 0.496 scale s SM n 1137 641 M 1138 617 L CM 0.496 0.496 scale s SM n 1124 611 M 1138 571 L 1151 611 L 1124 611 L cp e 1 sl n 762 132 M 768 131 L 774 129 L 779 125 L 782 120 L 785 114 L 786 108 L 786 26 L 785 20 L 782 14 L 779 9 L 774 5 L 768 3 L 762 2 L 633 2 L 626 3 L 621 5 L 616 9 L 612 14 L 610 20 L 609 26 L 609 108 L 610 114 L 612 120 L 616 125 L 621 129 L 626 131 L 633 132 L 762 132 L cp gs 1 g e gr s %%IncludeFont: Times-Roman [58.566 0 0 -58.465 0 0]/Times-Roman MF (P)651 84 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (n)683 104 MS (+)703 104 MS (1)724 104 MS 6 sl n 697 132 M 675 141 L CM 0.496 0.496 scale s SM n 661 147 M 639 156 L CM 0.496 0.496 scale s SM n 626 162 M 604 172 L CM 0.496 0.496 scale s SM n 590 177 M 568 187 L CM 0.496 0.496 scale s SM n 554 193 M 532 202 L CM 0.496 0.496 scale s SM n 518 208 M 496 218 L CM 0.496 0.496 scale s SM n 482 223 M 460 233 L CM 0.496 0.496 scale s SM n 446 239 M 424 248 L CM 0.496 0.496 scale s SM n 410 254 M 388 263 L CM 0.496 0.496 scale s SM n 374 269 M 352 279 L CM 0.496 0.496 scale s SM n 338 284 M 316 294 L CM 0.496 0.496 scale s SM n 302 300 M 292 304 L CM 0.496 0.496 scale s SM n 300 315 M 257 319 L 289 290 L 300 315 L cp e n 697 132 M 679 148 L CM 0.496 0.496 scale s SM n 668 158 M 651 174 L CM 0.496 0.496 scale s SM n 640 184 M 622 200 L CM 0.496 0.496 scale s SM n 611 210 M 593 226 L CM 0.496 0.496 scale s SM n 582 236 M 564 252 L CM 0.496 0.496 scale s SM n 553 262 M 535 278 L CM 0.496 0.496 scale s SM n 524 288 M 518 294 L CM 0.496 0.496 scale s SM n 529 302 M 490 319 L 511 281 L 529 302 L cp e n 697 132 M 715 148 L CM 0.496 0.496 scale s SM n 726 158 M 744 174 L CM 0.496 0.496 scale s SM n 755 184 M 772 200 L CM 0.496 0.496 scale s SM n 783 210 M 801 226 L CM 0.496 0.496 scale s SM n 812 236 M 830 252 L CM 0.496 0.496 scale s SM n 841 262 M 859 278 L CM 0.496 0.496 scale s SM n 870 288 M 877 294 L CM 0.496 0.496 scale s SM n 883 281 M 904 319 L 865 301 L 883 281 L cp e n 697 132 M 719 141 L CM 0.496 0.496 scale s SM n 733 147 M 755 156 L CM 0.496 0.496 scale s SM n 769 162 M 791 172 L CM 0.496 0.496 scale s SM n 805 177 M 827 187 L CM 0.496 0.496 scale s SM n 841 193 M 863 202 L CM 0.496 0.496 scale s SM n 877 208 M 899 217 L CM 0.496 0.496 scale s SM n 913 223 M 935 233 L CM 0.496 0.496 scale s SM n 949 238 M 971 248 L CM 0.496 0.496 scale s SM n 985 254 M 1007 263 L CM 0.496 0.496 scale s SM n 1021 269 M 1043 278 L CM 0.496 0.496 scale s SM n 1057 284 M 1079 294 L CM 0.496 0.496 scale s SM n 1093 300 M 1104 304 L CM 0.496 0.496 scale s SM n 1106 290 M 1138 319 L 1095 315 L 1106 290 L cp e 1 sl n 967 890 M 974 889 L 979 887 L 984 883 L 988 878 L 990 872 L 991 866 L 991 784 L 990 778 L 988 772 L 984 767 L 979 763 L 974 761 L 967 760 L 838 760 L 831 761 L 826 763 L 821 767 L 817 772 L 815 778 L 814 784 L 814 866 L 815 872 L 817 878 L 821 883 L 826 887 L 831 889 L 838 890 L 967 890 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (P)860 842 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (n)893 862 MS (-)912 862 MS (1)925 862 MS n 1201 888 M 1207 887 L 1213 885 L 1218 881 L 1222 876 L 1224 870 L 1225 864 L 1225 781 L 1224 775 L 1222 770 L 1218 765 L 1213 761 L 1207 759 L 1201 758 L 1071 758 L 1065 759 L 1060 761 L 1055 765 L 1051 770 L 1049 775 L 1048 781 L 1048 864 L 1049 870 L 1051 876 L 1055 881 L 1060 885 L 1065 887 L 1071 888 L 1201 888 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (P)1110 840 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (n)1143 860 MS n 321 889 M 327 888 L 333 886 L 337 882 L 341 877 L 344 871 L 344 865 L 344 783 L 344 776 L 341 771 L 337 766 L 333 762 L 327 760 L 321 759 L 191 759 L 185 760 L 179 762 L 175 766 L 171 771 L 168 776 L 168 783 L 168 865 L 168 871 L 171 877 L 175 882 L 179 886 L 185 888 L 191 889 L 321 889 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (P)230 841 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (1)262 861 MS n 553 887 M 560 886 L 565 883 L 570 880 L 574 875 L 576 869 L 577 863 L 577 780 L 576 774 L 574 768 L 570 764 L 565 760 L 560 757 L 553 757 L 423 757 L 417 757 L 412 760 L 407 764 L 403 768 L 401 774 L 400 780 L 400 863 L 401 869 L 403 875 L 407 880 L 412 883 L 417 886 L 423 887 L 553 887 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (P)462 839 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (2)495 859 MS 18 sl n 617 822 M 635 822 L CM 0.496 0.496 scale s SM n 653 822 M 671 822 L CM 0.496 0.496 scale s SM n 689 822 M 707 822 L CM 0.496 0.496 scale s SM n 725 822 M 742 822 L CM 0.496 0.496 scale s SM n 760 822 M 778 822 L CM 0.496 0.496 scale s SM 1 sl n 1039 445 M 1040 431 L 1043 418 L 1048 405 L 1054 393 L 1061 382 L 1071 373 L 1081 364 L 1093 357 L 1105 352 L 1118 348 L 1131 346 L 1145 346 L 1158 348 L 1171 352 L 1183 357 L 1195 364 L 1205 373 L 1214 382 L 1222 393 L 1228 405 L 1233 418 L 1236 431 L 1237 445 L 1236 458 L 1233 471 L 1228 484 L 1222 496 L 1214 507 L 1205 517 L 1195 525 L 1183 532 L 1171 538 L 1158 541 L 1145 543 L 1131 543 L 1118 541 L 1105 538 L 1093 532 L 1081 525 L 1071 517 L 1061 507 L 1054 496 L 1048 484 L 1043 471 L 1040 458 L 1039 445 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (I)1118 462 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (n)1138 482 MS n 1116 516 M 1116 571 L 1160 571 L 1160 516 L 1116 516 L cp gs 1 g e gr s n 1116 319 M 1116 374 L 1160 374 L 1160 319 L 1116 319 L cp gs 1 g e gr s n 805 445 M 806 432 L 809 419 L 814 406 L 820 394 L 828 383 L 837 373 L 847 365 L 859 358 L 871 352 L 884 349 L 897 347 L 911 347 L 924 349 L 937 352 L 950 358 L 961 365 L 971 373 L 981 383 L 988 394 L 995 406 L 999 419 L 1002 432 L 1003 445 L 1002 459 L 999 472 L 995 484 L 988 496 L 981 507 L 971 517 L 961 526 L 950 533 L 937 538 L 924 542 L 911 544 L 897 544 L 884 542 L 871 538 L 859 533 L 847 526 L 837 517 L 828 507 L 820 496 L 814 484 L 809 472 L 806 459 L 805 445 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (I)868 463 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (n)888 482 MS (-)907 482 MS (1)920 482 MS n 882 516 M 882 571 L 926 571 L 926 516 L 882 516 L cp gs 1 g e gr s n 882 319 M 882 374 L 926 374 L 926 319 L 882 319 L cp gs 1 g e gr s n 391 444 M 392 431 L 395 417 L 400 405 L 406 393 L 414 382 L 423 372 L 433 363 L 445 357 L 457 351 L 470 348 L 483 346 L 497 346 L 510 348 L 523 351 L 535 357 L 547 363 L 557 372 L 567 382 L 574 393 L 581 405 L 585 417 L 588 431 L 589 444 L 588 458 L 585 471 L 581 483 L 574 495 L 567 506 L 557 516 L 547 525 L 535 532 L 523 537 L 510 541 L 497 542 L 483 542 L 470 541 L 457 537 L 445 532 L 433 525 L 423 516 L 414 506 L 406 495 L 400 483 L 395 471 L 392 458 L 391 444 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (I)470 462 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (2)490 481 MS n 468 515 M 468 570 L 512 570 L 512 515 L 468 515 L cp gs 1 g e gr s n 468 319 M 468 374 L 512 374 L 512 319 L 468 319 L cp gs 1 g e gr s n 159 444 M 160 430 L 163 417 L 167 404 L 174 392 L 181 381 L 191 371 L 201 363 L 212 356 L 224 351 L 237 347 L 251 345 L 264 345 L 277 347 L 290 351 L 303 356 L 314 363 L 325 371 L 334 381 L 342 392 L 348 404 L 352 417 L 355 430 L 356 444 L 355 457 L 352 470 L 348 483 L 342 495 L 334 506 L 325 516 L 314 524 L 303 531 L 290 536 L 277 540 L 264 542 L 251 542 L 237 540 L 224 536 L 212 531 L 201 524 L 191 516 L 181 506 L 174 495 L 167 483 L 163 470 L 160 457 L 159 444 L cp gs 1 g e gr s [58.566 0 0 -58.465 0 0]/Times-Roman MF (I)238 461 MS [38.629 0 0 -38.977 0 0]/Times-Roman MF (1)257 480 MS n 236 514 M 236 570 L 279 570 L 279 514 L 236 514 L cp gs 1 g e gr s n 236 319 M 236 374 L 279 374 L 279 319 L 236 319 L cp gs 1 g e gr s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 1356 3616 a(Figure)f(10.)g(Synchronisation)i(pattern.)191 3908 y Fq(shared)f(participant)f Fm(P)858 3920 y Fh(k)q Fl(+1)983 3908 y Fq(.)i(The)g(\002rst)g Fm(LO)r(C)6 b(K)27 b Fq(message)21 b(recei)n(v)o(ed)e(by)h Fm(P)2370 3920 y Fh(k)q Fl(+1)2516 3908 y Fq(is)i(replied)e(with)g(an)h Fm(O)r(K)27 b Fq(message,)191 4008 y(so)h(the)g(period)e(of)i(time)g (since)g Fm(I)1172 4020 y Fh(i)1228 4008 y Fq(detects)g(it)h(is)g (enabled)d(until)i(the)g(instant)f(it)i(kno)n(ws)e(it)h(is)h(the)f (winner)f(should)191 4108 y(be)e(about)f Fj(2)p Fm(\026)p Fq(,)h(being)g Fm(\026)g Fq(the)h(a)n(v)o(erage)e(time)h(tak)o(en)g(to) g(transmit)g(a)h(message.)e(In)h(our)g(system,)g Fm(\026)32 b Fi(')g Fj(2)14 b Fm(ms)p Fq(.)25 b(If)g(the)191 4207 y Fm(LO)r(C)6 b(K)28 b Fq(message)21 b(sent)h(by)f(coordinator)d Fm(I)1481 4219 y Fh(i)1531 4207 y Fq(is)23 b(not)e(the)g(\002rst)h(one) f(recei)n(v)o(ed)f(by)h Fm(P)2611 4219 y Fh(k)q Fl(+1)2736 4207 y Fq(,)h(this)g(coordinator)d(will)j(get)191 4307 y(a)29 b Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)33 b Fq(message)28 b(from)f Fm(P)1221 4319 y Fh(k)q Fl(+1)1375 4307 y Fq(as)i(a)g(reply)-5 b(,)27 b(sooner)g(or)h(later)-5 b(.)29 b(Since)f(e)n(v)o(ery)f(time)i Fm(P)2948 4319 y Fh(k)q Fl(+1)3102 4307 y Fq(participates)f(in)191 4406 y(one)21 b(interaction)f(it)i(must)f(refuse)g Fm(k)h Fi(\000)d Fj(1)j Fq(coordinators,)c(the)k(a)n(v)o(erage)e(refuse)h (time)g(is)h(more)f(v)n(ariant,)f(because)h(the)191 4506 y(\002rst)g(coordinator)e(that)h(is)i(refused)e(has)h(to)g(w)o(ait)g (less)h(time)f(than)f(the)h(coordinators)d(that)j(are)g(refused)e (after)i(it.)g(The)191 4606 y(reason)f(is)h(that)g(our)f (implementation)e(w)o(as)k(written)e(in)h(Ja)n(v)n(a,)g(and)f(the)g (loop)g(we)h(used)f(to)h(send)f Fm(k)i Fi(\000)c Fj(1)j Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)191 4705 y Fq(messages)20 b(tak)o(es)h(a)f(time)h(that)f(is)h(comparable)d(to)j(the)f(time)g(a)h (message)f(tak)o(es)g(to)h(get)f(to)g(its)h(destination.)274 4807 y(When)29 b Fm(k)j Fq(coordinators)27 b(are)i(competing)e(to)j (lock)e(the)h(shared)g(participant)e Fm(P)2615 4819 y Fh(k)q Fl(+1)2741 4807 y Fq(,)i(each)g(one)f(has)i(a)f(success)191 4907 y(ratio)j Fj(1)p Fm(=3Dk)s Fq(.)f(In)g(other)g(w)o(ords,)h(the)g (bottle)f(neck)g(of)h(our)f(system)h(is)h(the)f(shared)f(participant)f Fm(P)3081 4919 y Fh(k)q Fl(+1)3207 4907 y Fq(.)i(Since)g(the)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.) 1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 25 25 25 24 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(25)p 191 473 3388 5 v 699 1988 a @beginspecial 56.689999 @llx 56.689999 @lly 361.420013 @urx 219.289993 @ury 2845 @rwi @setspecial %%BeginDocument: exre-test.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip066.wmf %%Creator: Windows NT 4.0 %%CreationDate: 13:41 2/22/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 361.42 219.29 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 219.398 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate n 1249 658 166 9 B 1 g f 1 sl 0 g n 1251 660 165 8 B cp s n 520 48 M 1401 48 L 1401 474 L 520 474 L 520 48 L cp 0.754 g e 0 g gs n 881 1 520 403 CB n 520 403 M 1401 403 L s gr gs n 881 1 520 331 CB n 520 331 M 1401 331 L s gr gs n 881 1 520 261 CB n 520 261 M 1401 261 L s gr gs n 881 1 520 190 CB n 520 190 M 1401 190 L s gr gs n 881 1 520 118 CB n 520 118 M 1401 118 L s gr gs n 881 1 520 48 CB n 520 48 M 1401 48 L s gr gs n 1 426 608 48 CB n 608 48 M 608 474 L s gr gs n 1 426 695 48 CB n 695 48 M 695 474 L s gr gs n 1 426 784 48 CB n 784 48 M 784 474 L s gr gs n 1 426 872 48 CB n 872 48 M 872 474 L s gr gs n 1 426 961 48 CB n 961 48 M 961 474 L s gr gs n 1 426 1048 48 CB n 1048 48 M 1048 474 L s gr gs n 1 426 1137 48 CB n 1137 48 M 1137 474 L s gr gs n 1 426 1225 48 CB n 1225 48 M 1225 474 L s gr gs n 1 426 1312 48 CB n 1312 48 M 1312 474 L s gr gs n 1 426 1401 48 CB n 1401 48 M 1401 474 L s gr 1 j 1 setlinecap 0.5 g n 520 48 M 1401 48 L CM 1.641 1.637 scale s SM n 1401 48 M 1401 474 L CM 1.641 1.637 scale s SM n 1401 474 M 520 474 L CM 1.641 1.637 scale s SM n 520 474 M 520 48 L CM 1.641 1.637 scale s SM 0 g n 520 48 M 520 474 L s n 511 474 M 520 474 L s n 511 403 M 520 403 L s n 511 331 M 520 331 L s n 511 261 M 520 261 L s n 511 190 M 520 190 L s n 511 118 M 520 118 L s n 511 48 M 520 48 L s n 520 474 M 1401 474 L s 3 sl 0.105 g n 564 474 M 653 193 L CM 1.641 1.637 scale s SM n 653 193 M 740 187 L CM 1.641 1.637 scale s SM n 740 187 M 828 182 L CM 1.641 1.637 scale s SM n 828 182 M 917 175 L CM 1.641 1.637 scale s SM n 917 175 M 1004 169 L CM 1.641 1.637 scale s SM n 1004 169 M 1092 157 L CM 1.641 1.637 scale s SM n 1092 157 M 1181 148 L CM 1.641 1.637 scale s SM n 1181 148 M 1268 139 L CM 1.641 1.637 scale s SM n 1268 139 M 1356 133 L CM 1.641 1.637 scale s SM 0.289 g n 564 459 M 653 441 L CM 1.641 1.637 scale s SM n 653 441 M 740 423 L CM 1.641 1.637 scale s SM n 740 423 M 828 411 L CM 1.641 1.637 scale s SM n 828 411 M 917 393 L CM 1.641 1.637 scale s SM n 917 393 M 1004 379 L CM 1.641 1.637 scale s SM n 1004 379 M 1092 370 L CM 1.641 1.637 scale s SM n 1092 370 M 1181 351 L CM 1.641 1.637 scale s SM n 1181 351 M 1268 334 L CM 1.641 1.637 scale s SM n 1268 334 M 1356 325 L CM 1.641 1.637 scale s SM 0.355 g n 564 436 M 653 395 L CM 1.641 1.637 scale s SM n 653 395 M 740 361 L CM 1.641 1.637 scale s SM n 740 361 M 828 321 L CM 1.641 1.637 scale s SM n 828 321 M 917 285 L CM 1.641 1.637 scale s SM n 917 285 M 1004 243 L CM 1.641 1.637 scale s SM n 1004 243 M 1092 208 L CM 1.641 1.637 scale s SM n 1092 208 M 1181 169 L CM 1.641 1.637 scale s SM n 1181 169 M 1268 126 L CM 1.641 1.637 scale s SM n 1268 126 M 1356 87 L CM 1.641 1.637 scale s SM gs n 22 21 554 464 CB n 21 21 554 464 B 0.105 g f gr 1 sl 0.105 g n 564 474 M 556 466 L CM 1.641 1.637 scale s SM n 564 474 M 572 482 L CM 1.641 1.637 scale s SM n 564 474 M 556 482 L CM 1.641 1.637 scale s SM n 564 474 M 572 466 L CM 1.641 1.637 scale s SM n 564 474 M 564 466 L CM 1.641 1.637 scale s SM n 564 474 M 564 482 L CM 1.641 1.637 scale s SM n 21 21 643 184 B f n 653 193 M 644 185 L CM 1.641 1.637 scale s SM n 653 193 M 661 202 L CM 1.641 1.637 scale s SM n 653 193 M 644 202 L CM 1.641 1.637 scale s SM n 653 193 M 661 185 L CM 1.641 1.637 scale s SM n 653 193 M 653 185 L CM 1.641 1.637 scale s SM n 653 193 M 653 202 L CM 1.641 1.637 scale s SM n 21 21 730 177 B f n 740 187 M 731 179 L CM 1.641 1.637 scale s SM n 740 187 M 748 195 L CM 1.641 1.637 scale s SM n 740 187 M 731 195 L CM 1.641 1.637 scale s SM n 740 187 M 748 179 L CM 1.641 1.637 scale s SM n 740 187 M 740 179 L CM 1.641 1.637 scale s SM n 740 187 M 740 195 L CM 1.641 1.637 scale s SM n 21 21 818 172 B f n 828 182 M 820 174 L CM 1.641 1.637 scale s SM n 828 182 M 836 190 L CM 1.641 1.637 scale s SM n 828 182 M 820 190 L CM 1.641 1.637 scale s SM n 828 182 M 836 174 L CM 1.641 1.637 scale s SM n 828 182 M 828 174 L CM 1.641 1.637 scale s SM n 828 182 M 828 190 L CM 1.641 1.637 scale s SM n 21 21 907 166 B f n 917 175 M 909 167 L CM 1.641 1.637 scale s SM n 917 175 M 925 184 L CM 1.641 1.637 scale s SM n 917 175 M 909 184 L CM 1.641 1.637 scale s SM n 917 175 M 925 167 L CM 1.641 1.637 scale s SM n 917 175 M 917 167 L CM 1.641 1.637 scale s SM n 917 175 M 917 184 L CM 1.641 1.637 scale s SM n 21 21 994 159 B f n 1004 169 M 995 161 L CM 1.641 1.637 scale s SM n 1004 169 M 1012 177 L CM 1.641 1.637 scale s SM n 1004 169 M 995 177 L CM 1.641 1.637 scale s SM n 1004 169 M 1012 161 L CM 1.641 1.637 scale s SM n 1004 169 M 1004 161 L CM 1.641 1.637 scale s SM n 1004 169 M 1004 177 L CM 1.641 1.637 scale s SM n 21 21 1082 148 B f n 1092 157 M 1084 149 L CM 1.641 1.637 scale s SM n 1092 157 M 1101 166 L CM 1.641 1.637 scale s SM n 1092 157 M 1084 166 L CM 1.641 1.637 scale s SM n 1092 157 M 1101 149 L CM 1.641 1.637 scale s SM n 1092 157 M 1092 149 L CM 1.641 1.637 scale s SM n 1092 157 M 1092 166 L CM 1.641 1.637 scale s SM n 21 21 1171 138 B f n 1181 148 M 1173 139 L CM 1.641 1.637 scale s SM n 1181 148 M 1189 156 L CM 1.641 1.637 scale s SM n 1181 148 M 1173 156 L CM 1.641 1.637 scale s SM n 1181 148 M 1189 139 L CM 1.641 1.637 scale s SM n 1181 148 M 1181 139 L CM 1.641 1.637 scale s SM n 1181 148 M 1181 156 L CM 1.641 1.637 scale s SM n 21 20 1258 130 B f n 1268 139 M 1260 131 L CM 1.641 1.637 scale s SM n 1268 139 M 1276 148 L CM 1.641 1.637 scale s SM n 1268 139 M 1260 148 L CM 1.641 1.637 scale s SM n 1268 139 M 1276 131 L CM 1.641 1.637 scale s SM n 1268 139 M 1268 131 L CM 1.641 1.637 scale s SM n 1268 139 M 1268 148 L CM 1.641 1.637 scale s SM n 21 21 1347 123 B f n 1356 133 M 1348 125 L CM 1.641 1.637 scale s SM n 1356 133 M 1365 141 L CM 1.641 1.637 scale s SM n 1356 133 M 1348 141 L CM 1.641 1.637 scale s SM n 1356 133 M 1365 125 L CM 1.641 1.637 scale s SM n 1356 133 M 1356 125 L CM 1.641 1.637 scale s SM n 1356 133 M 1356 141 L CM 1.641 1.637 scale s SM 0.289 g n 564 448 M 575 470 L 552 470 L 564 448 L cp gs e gr CM 1.641 1.637 scale s SM n 653 430 M 664 452 L 641 452 L 653 430 L cp gs e gr CM 1.641 1.637 scale s SM n 740 411 M 751 434 L 728 434 L 740 411 L cp gs e gr CM 1.641 1.637 scale s SM n 828 400 M 840 423 L 817 423 L 828 400 L cp gs e gr CM 1.641 1.637 scale s SM n 917 382 M 928 405 L 905 405 L 917 382 L cp gs e gr CM 1.641 1.637 scale s SM n 1004 367 M 1015 390 L 992 390 L 1004 367 L cp gs e gr CM 1.641 1.637 scale s SM n 1092 359 M 1104 382 L 1081 382 L 1092 359 L cp gs e gr CM 1.641 1.637 scale s SM n 1181 339 M 1192 362 L 1169 362 L 1181 339 L cp gs e gr CM 1.641 1.637 scale s SM n 1268 323 M 1279 346 L 1256 346 L 1268 323 L cp gs e gr CM 1.641 1.637 scale s SM n 1356 313 M 1368 336 L 1345 336 L 1356 313 L cp gs e gr CM 1.641 1.637 scale s SM 0.355 g n 564 425 M 575 436 L 564 448 L 552 436 L 564 425 L cp gs e gr CM 1.641 1.637 scale s SM n 653 384 M 664 395 L 653 407 L 641 395 L 653 384 L cp gs e gr CM 1.641 1.637 scale s SM n 740 349 M 751 361 L 740 372 L 728 361 L 740 349 L cp gs e gr CM 1.641 1.637 scale s SM n 828 310 M 840 321 L 828 333 L 817 321 L 828 310 L cp gs e gr CM 1.641 1.637 scale s SM n 917 274 M 928 285 L 917 297 L 905 285 L 917 274 L cp gs e gr CM 1.641 1.637 scale s SM n 1004 231 M 1015 243 L 1004 254 L 992 243 L 1004 231 L cp gs e gr CM 1.641 1.637 scale s SM n 1092 197 M 1104 208 L 1092 220 L 1081 208 L 1092 197 L cp gs e gr CM 1.641 1.637 scale s SM n 1181 157 M 1192 169 L 1181 180 L 1169 169 L 1181 157 L cp gs e gr CM 1.641 1.637 scale s SM n 1268 115 M 1279 126 L 1268 138 L 1256 126 L 1268 115 L cp gs e gr CM 1.641 1.637 scale s SM n 1356 75 M 1368 87 L 1356 98 L 1345 87 L 1356 75 L cp gs e gr CM 1.641 1.637 scale s SM %%IncludeFont: Times-Roman [26.227 0 0 -26.227 0 0]/Times-Roman MF 0 g (0)487 482 MS (2)487 412 MS (4)487 339 MS (6)487 269 MS (8)487 198 MS (1)474 126 MS (0)487 126 MS (1)474 56 MS (2)487 56 MS n 183 521 M 1401 521 L s n 183 649 M 1401 649 L s n 520 474 M 1401 474 L s n 183 521 M 183 649 L s n 520 474 M 520 649 L s n 608 474 M 608 649 L s n 695 474 M 695 649 L s n 784 474 M 784 649 L s n 872 474 M 872 649 L s n 961 474 M 961 649 L s n 1048 474 M 1048 649 L s n 1137 474 M 1137 649 L s n 1225 474 M 1225 649 L s n 1312 474 M 1312 649 L s n 1401 474 M 1401 649 L s 3 sl 0.105 g n 191 548 M 241 548 L CM 1.641 1.637 scale s SM n 21 21 206 538 B f 1 sl n 216 548 M 208 539 L CM 1.641 1.637 scale s SM n 216 548 M 224 556 L CM 1.641 1.637 scale s SM n 216 548 M 208 556 L CM 1.641 1.637 scale s SM n 216 548 M 224 539 L CM 1.641 1.637 scale s SM n 216 548 M 216 539 L CM 1.641 1.637 scale s SM n 216 548 M 216 556 L CM 1.641 1.637 scale s SM 0 g (A)247 556 MS (v)265 556 MS (r)277 556 MS (.)285 556 MS ( )292 556 MS = (S)298 556 MS (e)313 556 MS (l)324 556 MS (e)329 556 MS (c)341 556 MS = (t)352 556 MS (i)359 556 MS (o)364 556 MS (n)377 556 MS ( )388 556 MS = (T)395 556 MS (i)410 556 MS (m)415 556 MS (e)433 556 MS ( )444 556 MS (\()451 556 MS = (m)459 556 MS (s)477 556 MS (\))487 556 MS (0)557 554 MS (7)636 554 MS (,)649 554 MS (9)656 554 MS (8)723 554 MS (,)736 554 MS (1)743 554 MS (8)812 554 MS (,)825 554 MS (2)831 554 MS (8)900 554 MS (,)913 554 MS (4)920 554 MS (8)989 554 MS (,)1002 554 MS (6)1009 554 MS (8)1076 554 MS (,)1089 554 MS (9)1096 554 MS (9)1164 554 MS (,)1178 554 MS (2)1184 554 MS (9)1253 554 MS (,)1266 554 MS (4)1273 554 MS (9)1340 554 MS (,)1353 554 MS (6)1360 554 MS gs n 1214 1 185 566 CB n 183 566 M 1401 566 L s gr 3 sl 0.289 g n 191 590 M 241 590 L CM 1.641 1.637 scale s SM 1 sl n 216 582 M 224 598 L 208 598 L 216 582 L cp gs e gr CM 1.641 1.637 scale s SM 0 g (N)247 598 MS (o)267 598 MS (.)280 598 MS ( )287 598 MS (O)293 598 MS = (f)313 598 MS ( )319 598 MS (M)326 598 MS (e)349 598 MS (s)360 598 MS = (s)370 598 MS (a)380 598 MS (g)392 598 MS (e)403 598 MS (s)415 598 MS ( = )424 598 MS (\()431 598 MS (x)439 598 MS (1)451 598 MS (0)464 598 MS (0)477 598 MS = (0)490 598 MS (\))503 598 MS (0)548 597 MS (,)561 597 MS (4)567 597 MS (0)630 597 MS (,)643 597 MS (9)649 597 MS (2)662 597 MS (1)717 597 MS (,)730 597 MS (4)736 597 MS (4)749 597 MS (1)805 597 MS (,)818 597 MS (7)825 597 MS (6)838 597 MS (2)887 597 MS (,)900 597 MS (2)907 597 MS (4)920 597 MS (8)933 597 MS (2)982 597 MS (,)995 597 MS (6)1002 597 MS (8)1015 597 MS (2)1063 597 MS (,)1076 597 MS (9)1082 597 MS (2)1096 597 MS (4)1109 597 = MS (3)1158 597 MS (,)1171 597 MS (4)1178 597 MS (6)1191 597 MS (3)1247 597 MS (,)1260 597 MS (9)1266 597 MS (2)1279 597 MS (4)1334 597 MS (,)1347 597 MS (2)1353 597 MS (2)1366 597 MS gs n 1214 1 185 608 CB n 183 608 M 1401 608 L s gr 3 sl 0.355 g n 191 633 M 241 633 L CM 1.641 1.637 scale s SM 1 sl n 216 625 M 224 633 L 216 641 L 208 633 L 216 625 L cp gs e gr CM 1.641 1.637 scale s SM 0 g (E)247 641 MS (l)262 641 MS (a)267 641 MS (p)278 641 MS (s)292 641 MS = (e)301 641 MS (d)313 641 MS ( )326 641 MS (T)333 641 MS (i)347 641 MS = (m)352 641 MS (e)370 641 MS ( )382 641 MS (\()388 641 MS (s)397 641 MS = (\))406 641 MS (1)541 639 MS (,)554 639 MS (0)561 639 MS (5)574 639 MS (2)636 639 MS (,)649 639 MS (2)656 639 MS (3)723 639 MS (,)736 639 MS (2)743 639 MS (4)812 639 MS (,)825 639 MS (3)831 639 MS (5)900 639 MS (,)913 639 MS (3)920 639 MS (6)989 639 MS (,)1002 639 MS (5)1009 639 MS (7)1076 639 MS (,)1089 639 MS (5)1096 639 MS (8)1164 639 MS (,)1178 639 MS (6)1184 639 MS (9)1253 639 MS (,)1266 639 MS (8)1273 639 MS (1)1334 639 MS (0)1347 639 MS (,)1360 639 MS (9)1366 639 MS (T)549 505 MS (1)564 505 MS (T)638 505 MS (2)653 505 MS (T)725 505 MS (3)740 505 MS (T)813 505 MS (4)828 505 MS (T)902 505 MS (5)917 505 MS (T)991 505 MS (6)1005 505 MS (T)1078 505 MS (7)1092 505 MS (T)1166 505 MS (8)1181 505 MS (T)1255 505 MS (9)1269 505 MS (T)1335 505 MS (1)1350 505 MS (0)1363 505 MS n 1251 660 165 8 B cp s showpage PageSV restore %%Trailer %%DocumentNeededFonts: %%+ Times-Roman %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 568 2167 a Fs(Figure)19 b(11.)g(Experimental)g(results)g (using)h(the)f(synchronisation)i(pattern)e(sk)o(etched)h(in)f(Figure)g (10.)191 2501 y Fq(number)h(of)h(interactions)f(it)i(can)f(run)g(per)g (time)h(unit)f(depends)f(on)h(the)g(underlying)e(computer)g(and)i(it)h (is)h(constant,)191 2600 y(it)g(will)h(participate)d(less)j(times)f (per)f(unit)h(time)g(in)f(each)h(one)f(as)h(the)g(number)d(of)j(of)n (fered)e(interactions)g(increases.)191 2700 y(Theoretically)-5 b(,)20 b(the)i(a)n(v)o(erage)g(number)e(of)i(times)h(it)g(e)o(x)o (ecutes)f(a)g(interaction)f(per)h(time)h(unit)f(should)g(be)g Fj(1)p Fm(=3Dk)3387 2670 y Fh(th)3477 2700 y Fq(the)191 2800 y(times)k(it)h(w)o(ould)f(e)o(x)o(ecute)e(it)j(in)f(absence)g(of)f (con\003icts.)h(This)g(means)g(that)g(the)g(time)h(tak)o(en)e(by)h(a)g (coordinator)e(to)191 2899 y(e)o(x)o(ecute)17 b(a)i(number)d(of)i (interactions)f(sharing)g(a)i(participant)e(with)i Fm(k)14 b Fi(\000)d Fj(1)18 b Fq(coordinators)e(should)h(be)h(nearly)g Fm(k)j Fq(times)191 2999 y(the)f(time)h(tak)o(en)e(to)i(e)o(x)o(ecute)d (the)j(same)f(number)e(of)i(interactions)f(without)h(con\003icts.)274 3104 y(In)i(\002gure)h(11,)f(we)h(can)f(appreciate)g(an)h(important)e (dif)n(ference)g(between)h(the)g(\002rst)i(column)d(and)i(the)f(follo)n (wing)191 3203 y(ones.)k(T)-6 b(est)28 b Fm(T)605 3215 y Fl(1)669 3203 y Fq(is)f(a)h(particular)d(case,)i(since)g(coordinator) d Fm(I)1996 3215 y Fl(1)2061 3203 y Fq(does)j(not)f(ha)n(v)o(e)g(to)h (lock)f(an)o(y)g(participants,)g(so)h(its)191 3303 y(selection)15 b(time)h(is)h(zero.)d(T)-7 b(o)16 b(e)o(x)o(ecute)e(an)i(interaction,)e (four)g(messages)i(need)f(to)h(be)f(sent)h(\(tw)o(o)g Fm(P)c(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)191 3402 y Fq(and)20 b(tw)o(o)g Fm(S)5 b(T)12 b(AR)q(T)g Fq(\),)18 b(so)j(400)f(messages)g(are)g(transmitted.)g(Although)e(this)j(should)e (require)g(only)h(about)f Fj(800)14 b Fm(ms)p Fq(,)191 3502 y(the)20 b(coordinator)e(elapses)i(1.05)f(seconds)h(due)f(to)i (computation)d(o)o(v)o(erhead.)274 3607 y(T)-6 b(est)23 b Fm(T)483 3619 y Fl(1)542 3607 y Fq(gi)n(v)o(es)e(us)i(the)f(v)o(ery)f (best)h(case.)g(When)g(there)f(are)h(con\003icting,)f(coordinators)e (must)j(lock)g(their)g(shared)191 3706 y(participant)16 b Fm(P)617 3718 y Fh(k)q Fl(+1)742 3706 y Fq(.)i(Then,)f(6)h(messages)g (are)f(needed)g(to)g(e)o(x)o(ecute)g(an)g(interaction,)f(\(one)h Fm(P)12 b(AR)q(T)g(I)7 b(C)f(I)h(P)12 b(AT)g(E)5 b Fq(,)16 b(one)191 3806 y Fm(O)r(F)c(F)g(E)5 b(R)q Fq(,)20 b(one)f Fm(LO)r(C)6 b(K)g Fq(,)20 b(one)f Fm(O)r(K)27 b Fq(and)19 b(tw)o(o)h Fm(S)5 b(T)12 b(AR)q(T)g Fq(\);)18 b(b)n(ut)h(e)n(v)o(ery)g (time)h(a)g(coordinator)d(is)j(refused,)f(a)h(penalty)191 3905 y(of)27 b(4)g(messages)g(is)h(added)d(\(one)h Fm(R)q(E)5 b(F)12 b(U)d(S)c(E)g Fq(,)27 b(one)f Fm(U)9 b(N)g(LO)r(C)d(K)g Fq(,)27 b(another)e Fm(O)r(F)12 b(F)g(E)5 b(R)29 b Fq(and)d(another)g Fm(LO)r(C)6 b(K)g Fq(\).)191 4005 y(Since)23 b(the)f(selection)h(time)f (is)i(measured)d(from)h(the)h(time)g(that)f(an)h(interaction)e(becomes) h(enabled)f(\(after)h(the)h(last)191 4105 y(of)n(fer\))16 b(until)i(the)f(time)h(the)g Fm(O)r(K)24 b Fq(is)19 b(recei)n(v)o(ed,)d (the)h(selection)h(time)f(should)g(be)h Fj(2)p Fm(\026)k Fi(')h Fj(4)14 b Fm(ms)j Fq(\(the)h(transmission)f(time)191 4204 y(of)h(one)g Fm(LO)r(C)6 b(K)25 b Fq(and)18 b(one)g Fm(O)r(K)6 b Fq(\).)19 b(Furthermore,)d(the)i(time)h(each)f (coordinator)e(tak)o(es)j(to)g(e)o(x)o(ecute)e(100)h(interactions)191 4304 y(should)24 b(be)h(the)g(time)g(needed)f(to)h(transmit)f Fj(600)h Fq(messages)g(plus)g(a)g(penalty)f(e)n(v)o(ery)g(time)h(that)g (it)h(is)f(refused.)f(The)191 4404 y(number)18 b(of)i(times)h(that)f(a) h(coordinator)c(is)k(refused)f(should)f(be)h(proportional)d(to)j(the)h (number)d(of)i(coordinators.)274 4508 y(The)h(measures)g(we)h(got)f (are)h(slightly)f(greater)g(than)g(theoretically)f(e)o(xpected,)g(due)h (to)g(computation)f(o)o(v)o(erhead.)191 4608 y(W)m(ith)33 b(tw)o(o)h(coordinators,)d(the)i(selection)g(time)g(is)h(almost)g Fj(8)14 b Fm(ms)33 b Fq(\(four)e(more)i(than)f(e)o(xpected\))g(and)g (the)i(time)191 4707 y(tak)o(en)e(to)g(run)g(100)f(interactions)g(is)i (also)g(a)g(bit)f(greater)f(than)h(e)o(xpected)f(\(double)f(the)j(time) f(elapsed)g(by)g(only)191 4807 y(one)23 b(coordinator\).)e(This)j(dif)n (ference)e(can)i(be)g(justi\002ed)g(if)g(we)g(tak)o(e)g(the)g(number)e (of)i(messages)g(transmitted)f(into)191 4907 y(account.)32 b(Recall)i(that)f(600)f(messages)h(are)g(needed)f(to)i(e)o(x)o(ecute)d (100)i(interactions,)e(so)j(320)e(e)o(xtra)h(messages)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.) 1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 26 26 26 25 bop 191 299 a Fq(26)148 b FB(J.A.)16 b(P)593 285 y(\264)584 299 y(EREZ,)f(R.)i(CORCHUELO,)f(M.T)o(OR)m(O)3329 423 y currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 3329 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 3329 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 3329 423 a 191 473 3388 5 v 191 606 a Fq(ha)n(v)o(e)23 b(been)g(added)g(when)g(a)h(coordinator)d(has)j (been)f(refused.)g(Furthermore,)e(the)j(time)g(needed)e(to)i(transmit)g (920)191 706 y(messages)c(is)h Fj(1)p Fm(:)p Fj(840)14 b Fm(ms)p Fq(,)19 b(so)h(a)h(penalty)e(of)h Fj(360)14 b Fm(ms)19 b Fq(appears)g(due)h(to)g(computation)e(o)o(v)o(erhead.)274 808 y(As)32 b(the)f(number)e(of)i(con\003icting)e(coordinators)g (increases,)i(the)g(selection)f(time)i(increases)e(slightly)h(due)g(to) 191 907 y(computation)22 b(o)o(v)o(erhead.)g(The)i(time)h(tak)o(en)f (to)g(e)o(x)o(ecute)g(100)f(interactions)h(increases)g(almost)h (proportionally)c(to)191 1007 y(the)28 b(number)d(of)i(coordinators.)e (W)-7 b(e)29 b(think)e(that)h(these)f(results)h(are)g(satisf)o(actory)f (because)f(the)i(system)g(beha)n(v)o(es)191 1107 y(as)d(we)g(e)o (xpected)e(it)i(to)g(do,)f(and)g(the)g(selection)g(time)h(increases)f (at)h(a)g(ratio)g(that)f(is)i(about)d(2.47\045.)h(Those)f(results)191 1206 y(are)g(specially)g(good)f(if)i(we)f(tak)o(e)h(into)f(account)f (the)h(limitations)g(on)g(e)o(x)o(ecution)e(speed)i(of)g(our)g (prototype,)d(where)191 1306 y(computation)e(times)i(are)h(rele)n(v)n (ant)e(with)h(respect)g(to)g(transmission)g(times.)191 1617 y Fr(CONCLUSIONS)h(AND)f(FUTURE)h(W)o(ORK)191 1811 y Fq(The)34 b(multiparty)e(interaction)h(model)g(captures)h(three)f (main)h(issues)h(in)g(the)f(design)f(of)h(distrib)n(uted)f(systems:)191 1911 y(synchronisation,)39 b(communication)g(and)j(e)o(xclusion.)e(In)i (this)h(article,)e(we)i(ha)n(v)o(e)e(presented)g(a)h(solution)g(to)191 2010 y(implement)22 b(this)i(interaction)f(model,)f(b)n(ut)i(we)f(ha)n (v)o(e)g(not)h(addressed)e(the)i(problem)e(of)h(communication)d (because)191 2110 y(this)h(feature)e(is)i(tightly)f(coupled)e(with)j (the)f(language)e(we)j(are)f(using.)274 2212 y(A)e(v)n(ariety)f(of)h (solutions)f(e)o(xist)h(in)g(the)g(literature,)f(and)h(ours)f(is)i (inno)o(v)n(ati)n(v)o(e)c(in)j(the)g(sense)h(that)f(we)g(do)g(not)f (require)191 2312 y(the)25 b(set)g(of)g(acti)n(v)o(e)f(entities)h(in)g (a)g(system)g(to)g(be)g(\002x)o(ed)f(and)g(kno)n(wn)g(in)h(adv)n(ance.) e(In)h(addition,)f(managers)h(do)g(not)191 2411 y(need)h(to)h(kno)n(w)f (all)h(of)f(the)h(processes)g(in)g(a)g(system,)f(and)h(entities)g(are)g (not)f(directly)g(dependent)e(on)j(each)f(other)m(,)191 2511 y(which)i(is)i(an)f(important)f(dra)o(wback)f(in)i(other)f (proposals.)g(This)h(w)o(ay)-5 b(,)27 b(our)h(solution)f(can)g(be)h (easily)h(applied)e(in)191 2610 y(open)19 b(conte)o(xts)h(such)g(as)h (Internet)e(applications)h(where)g(multiparty)f(interactions)g(can)h (be)h(used)f(to)g(coordinate)f(an)191 2710 y(arbitrary)g(number)f(of)i (entities.)274 2812 y(W)-7 b(e)42 b(ha)n(v)o(e)e(also)i(presented)d(an) i(e)o(xperimental)e(study)h(that)h(sho)n(ws)g(that)h(our)e(solution)g (achie)n(v)o(es)g(a)h(good)191 2912 y(performance.)32 b(From)j(these)h(results,)f(we)h(can)f(conclude)e(that)j Fm(\013)p Fq(\226core)f(performs)e(well)j(enough)d(to)j(be)f(used)191 3011 y(in)28 b(practical)g(applications)f(where)h(the)g(multiparty)f (interaction)g(model)h(helps)g(the)g(programmer)e(to)i(design)g(an)191 3111 y(adequate)f(solution)g(to)i(his)f(or)g(her)g(problem.)e(In)i(f)o (act,)g(we)h(are)f(using)g(our)f(implementation)f(of)i Fm(\013)p Fq(\226core)g(as)h(the)191 3211 y(basis)h(of)f(the)h (run\226time)e(support)g(needed)g(to)i(animate)e(the)i (aspect\226oriented)d(language)h Fi(C)5 b(AL)30 b Fq([9)o(,)g(18)o(],)f (which)191 3310 y(aims)f(at)f(increasing)g(the)g(le)n(v)o(el)g(of)g (abstraction)f(of)h(a)h(programme)d(by)h(considering)g(the)h (concurrent)e(beha)n(viour)191 3410 y(of)34 b(components)e(as)j(an)g (aspect)f(where)g(multiparty)f(interactions)g(are)i(the)f(sole)h(means) f(for)f(synchronisation)191 3509 y(and)39 b(communication.)e(This)j (implementation)e(is)j(one)e(of)h(the)g(goals)f(of)h(the)g(three-year)e (research)h(project)191 3609 y(GEOZOCO)29 b(\(funded)e(by)i(the)g (Spanish)f(Interministerial)g(Commission)h(of)f(Science)h(and)g(T)-6 b(echnology)26 b(under)191 3709 y(grant)17 b (TIC\2262000\2261106\226C02)o(\2260)o(1\).)11 b(This)18 b(project)f(aims)h(at)g(researching)d(on)j(tools)f(for)g(the)h (automatisation)e(of)h(the)191 3808 y(de)n(v)o(elopment)24 b(of)i(e-commerce)f(applications)g(and)h(its)i(inte)o(gration)c(with)j (geographical)d(information)h(systems.)191 3908 y(The)16 b(multiparty)f(interaction)g(model)g(we)i(ha)n(v)o(e)e(dealt)i(with)f (in)h(this)f(article)h(is)g(quite)f(adequate)f(in)h(this)h(\002eld)f (because)191 4008 y(se)n(v)o(eral)k(entities)g(often)f(need)h(to)g (cooperate)f(to)h(achie)n(v)o(e)f(a)i(common)d(goal.)274 4110 y(W)m(ith)31 b(respect)g(to)g(performance)d(concerns,)i(we)h(ha)n (v)o(e)g(found)e(out)i(that)g Fm(\013)p Fq(\226core)f(is)i(mostly)f (sensiti)n(v)o(e)g(to)g Fm(C)6 b Fq(.)191 4209 y(In)33 b(general,)g(this)h(parameter)e(is)j(not)e(e)o(xpected)f(to)i(be)f (greater)g(than)g(3)h(or)f(4.)h(At)g(least,)g(we)g(ha)n(v)o(e)f(not)h (found)191 4309 y(realistic)19 b(applications)e(of)h(interactions)f (with)i(higher)e(cardinality)g(in)i(the)f(conte)o(xt)f(of)h (e\226commerce)e(applications.)191 4408 y(Although)h(the)i(number)e(of) h(messages)h(needed)e(to)i(achie)n(v)o(e)f(mutual)g(e)o(xclusion)f(and) h(the)h(selection)f(time)h(increases)191 4508 y(when)h Fm(C)27 b Fq(increases,)20 b(the)h(penalty)f(it)h(introduces)e(is)i (not)g(problematical)d(in)j(the)g(general)e(case)i(because)f(it)h(is)h (about)191 4608 y(4\045.)g(Furthermore,)e Fm(\013)p Fq(\226core)i(can)g (be)g(successfully)g(applied)f(in)h(systems)h(where)f(ne)n(w)g (interactions)f(or)h(processes)191 4707 y(may)h(sprout)g(une)o (xpectedly)-5 b(.)20 b(EM)j(and)g(MEM)h(ha)n(v)o(e)f(been)g(designed)f (to)i(implement)e(multiparty)g(interactions)h(in)191 4807 y(systems)29 b(with)f(a)h(\002x)o(ed)e(number)g(of)h(processes)g (and)g(interactions,)e(thus)j(this)f(penalty)g(is)h(a)g(trade\226of)n (f)d(between)191 4907 y(applicability)j(in)i(open)f(systems)h(and)f (performance.)e Fm(\013)p Fq(\226core)i(also)h(performs)e(well)i (independently)d(from)i(the)p 191 5006 V 191 5193 a FB(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)16 b FB(2001)i(John)f(W)m(ile)o(y)h(&)f (Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Page: 27 27 27 26 bop 191 423 a currentpoint currentpoint translate 1.20764 1.20764 scale neg exch neg exch translate 191 423 a @beginspecial 56.689999 @llx 56.689999 @lly 81.440002 @urx 80.699997 @ury 247 @rwi @clip @setspecial %%BeginDocument: cpelogos.eps %!PS-Adobe-3.0 EPSF-3.0 %%Title: WMF2EPS 1.0 (unregistered): WMF->EPS conversion for clip070.wmf %%Creator: Windows NT 4.0 %%CreationDate: 12:45 2/26/2001 %%%%Pages 1 1 %%BoundingBox: 56.69 56.69 81.44 80.70 %%LanguageLevel: 2 %%DocumentNeededFonts: (atend) %%DocumentSuppliedFonts: (atend) %%EndComments %%BeginProlog %%BeginResource: procset NTPSOct95 /NTPSOct95 100 dict dup begin/bd{bind def}bind def/ld{load = def}bd/ed{exch def} bd/a{currentpoint}bd/c/curveto ld/d/dup ld/e/eofill ld/f/fill = ld/tr/translate ld/gr/grestore ld/gs/gsave ld/j/setlinejoin ld/L/lineto ld/M/moveto ld/n /newpath ld/cp/closepath ld/rm/rmoveto ld/sl/setlinewidth ld/sd/setdash = ld/g /setgray ld/r/setrgbcolor ld/s/stroke ld/t/show ld/aw/awidthshow ld/im /imagemask ld/MS{moveto show}bd/SF{findfont exch scalefont = setfont}bd/SM{cmtx setmatrix}bd/MF{findfont exch makefont setfont}bd/CM{/cmtx matrix = currentmatrix def}bd/B{M exch dup 0 rlt exch 0 exch rlt neg 0 rlt}bd/CB{B cp = eoclip}bd/EA{1 index 0/G0 put 4 string 1 1 4 -1 roll{3 copy neg exch cvs dup 0 71 put = cvn 3 -1 roll exch put}for pop}bd/rlt/rlineto ld/L2?/languagelevel where{pop languagelevel 2 ge}{false}ifelse def end def=20 %%EndResource %%EndProlog NTPSOct95 begin %%Page: 1 1 NTPSOct95 /PageSV save put 19 80.785 translate 72 300 div dup neg scale 0 0 transform .25 add round .25 sub exch .25 add round .25 sub exch = itransform translate gs n 103 100 157 0 CB /Adobe_WinNT_Driver_Gfx 175 dict dup begin %%BeginResource: file Adobe_WinNT_Utils 2.0 0 /|/def load def/,/load load |/~/exch load def/?/ifelse load def/!/pop = load def /`/begin load def/^/index load def/@/dup load def/+/translate load = def/$/roll load def/U/userdict load def/-/rlineto load def/&/currentdict load = def/:/gsave load def/;/grestore load def/F/false load def/T/true load def/N/newpath = load def/E/end load def/Ac/arc load def/An/arcn load def/A/ashow load def/D /awidthshow load def/C/closepath load def/O/eofill load def/I/lineto = load def /-C/rcurveto load def/-M/rmoveto load def/+S/scale load def/Ji/setfont = load def /Lc/setlinecap load def/Lj/setlinejoin load def/Lw/setlinewidth load = def/S/show load def/LH/showpage load def/K/stroke load def/W/widthshow load = def/b{bind def}bind def/DefIf_B{dup not{userdict/DefIf_save save put}if userdict /DefIf_bool 2 index put}b/DefIf_El{if userdict/DefIf_bool get not = dup{userdict /DefIf_save get restore}if}b/DefIf_E{DefIf_El pop}b/self currentdict def /reinitialize{[/TextInit/GraphInit/UtilsInit counttomark{dup where{self = eq} {false}ifelse{cvx exec}{pop}ifelse}repeat cleartomark}b/initialize{begin userdict begin/ADO_mxRot exch def/TextInitialised? false def end = reinitialize}b /terminate{pop{currentdict self eq{exit}{end}ifelse}loop = end}b/dsnap{dtransform round exch round exch = idtransform}b<04>cvn{}def/sg{setgray}b/sco{setrgbcolor}b /sgco{{sg}{sco}ifelse}b/rp{4 2 roll M 1 index 0 rlt 0 exch rlt neg 0 = rlt}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L1 2.0 0 L2? not DefIf_B{/rf{newpath rp fill}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Utils_L2 2.0 0 L2? DefIf_B{/colspA/DeviceGray def/colspABC/DeviceRGB = def/setAorABC{{colspA} {colspABC}ifelse setcolorspace}b/rf/rectfill load def/UtilsInit{false setglobal}b}DefIf_E=20 %%EndResource end def [1.000 0 0 1.000 0 0] Adobe_WinNT_Driver_Gfx dup /initialize get exec Adobe_WinNT_Driver_Gfx begin %%BeginResource: file Adobe_WinNT_BW_Images 2.0 0 /iw 0 def/ih 0 def/im_save 0 def/setupimageproc 0 def/polarity 0 = def/smoothflag 0 def/mystring 0 def/bpc 0 def/setup1asciiproc{[currentfile mystring /readhexstring cvx/pop cvx]cvx bind}b/setup1binaryproc{[currentfile = mystring /readstring cvx/pop cvx]cvx = bind}b/setup2asciiproc{currentfile/ASCII85Decode filter/RunLengthDecode = filter}b/setup2binaryproc{currentfile/RunLengthDecode filter}b/mycolorspace{colspABC}def/myimagedict{/myimagedict 10 dict def myimagedict dup begin/ImageType 1 def/MultipleDataSource false def end}b /imageprocarray[/setup1binaryproc/setup1asciiproc/setup2binaryproc /setup2asciiproc]def/L2Polarity{{[1 0]}{[0 = 1]}ifelse}b/beginimage{/im_save save def imageprocarray exch get/setupimageproc exch load def = L2Polarity/polarity exch def/smoothflag exch def translate/dx 2 index def/dy 1 index abs def = scale /mystring exch string def/bpc exch def/ih exch def/iw exch = def}b/endimage {im_save restore}b/1bitmaskimage{sgco myimagedict dup begin/Width iw = def/Height ih def/Decode polarity def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource setupimageproc def/BitsPerComponent 1 def/Interpolate smoothflag def end imagemask}b/1bitcopyimage{sgco 0 0 1 dx div 1 dy div 1 2 index sub 1 2 = index sub L2?{4}{6}ifelse -2 roll pop pop rf 1bitmaskimage}b/1bitbwcopyimage{0 = true 1 true 1bitcopyimage}b=20 %%EndResource %%BeginResource: file Adobe_WinNT_BW_Images_L1 2.0 0 L2? not DefIf_B{/setup2asciiproc{[/Level2ImagesError load aload pop true FatalErrorIf}b/setup2binaryproc/setup2asciiproc load def/L2Polarity{}def /1bitmaskimage{sgco iw ih polarity[iw 0 0 ih 0 0]setupimageproc = imagemask}b} DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L1 2.0 0 L2? not DefIf_B{/isdefined{where dup{exch pop}if}b/ncolors 1 = def/colorimage where{pop true}{false}ifelse{/ncolors 0 statusdict begin/processcolors = where {pop pop processcolors}{/deviceinfo where{pop deviceinfo/Colors = known{pop {deviceinfo/Colors get}}if}if}ifelse end def ncolors 0 ne{/colorimage = isdefined /setcolortransfer isdefined/currentcolortransfer = isdefined/currentcmykcolor isdefined and and and not{/ncolors 0 def}if}if}if ncolors dup 1 ne exch = dup 3 ne exch 4 ne and and{/ncolors 0 def}if ncolors 1 eq DefIf_B{/expandbw {expandfactor mul round cvi bwclut exch get 255 = div}b/doclutimage{pop/bwclut exch def/expandfactor 1 bpc{2 mul}repeat 1 sub def[/expandbw load/exec = load dup currenttransfer exch]cvx bind settransfer iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}b}DefIf_E ncolors dup 3 eq exch 4 eq or = DefIf_B{/nullproc{ {}}def/concatutil{/exec load 7 -1 roll/exec load}b/defsubclut{1 add = getinterval def}b/spconcattransfer{/Dclut exch def/Cclut exch def/Bclut exch = def/Aclut exch def/ncompute exch load def currentcolortransfer[{Aclut = ncompute}concatutil]cvx[ {Bclut ncompute}concatutil]cvx[{Cclut ncompute}concatutil]cvx[{Dclut = ncompute} concatutil]cvx setcolortransfer}b/setuprgbcluts{/bit3x rgbclut length 3 = sub def /bit1x bit3x 3 idiv def/rclut rgbclut def/gclut rclut 1 bit3x = defsubclut/bclut rclut 2 bit3x defsubclut}b}DefIf_E ncolors 3 eq DefIf_B{/3compute{exch = bit3x mul round cvi get 255 div}b/doclutimage{/rgbclut exch def pop = setuprgbcluts /3compute rclut gclut bclut dup spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0] [setupimageproc/exec load/dup load dup]cvx nullproc nullproc true 3 = colorimage} b}DefIf_E ncolors 4 eq DefIf_B{/ftoint{1 exch sub 255 mul round = cvi}b/stuffclut {cmykindex 3 -1 roll put}b/4compute{exch bit4x mul round cvi get 255 = div}b /invalidcolortable? true def/computecmykclut{setuprgbcluts/bit4x rgbclut = length 3 idiv 4 mul 4 sub def/cmykclut bit4x 4 add string def/cclut cmykclut = def/mclut cclut 1 bit4x defsubclut/yclut cclut 2 bit4x defsubclut/kclut cclut 3 = bit4x defsubclut/cmykindex 0 def 0 1 bit1x{dup/cmykindex exch bit1x exch sub 4 = mul def 3 mul dup rclut exch get 255 div exch dup gclut exch get 255 div = exch bclut exch get 255 div setrgbcolor currentcmykcolor ftoint kclut stuffclut = ftoint yclut stuffclut ftoint mclut stuffclut ftoint cclut = stuffclut}for}b/doclutimage {/rgbclut exch def pop invalidcolortable?{computecmykclut}if/4compute = cclut mclut yclut kclut spconcattransfer iw ih bpc[iw 0 0 ih 0 = 0][setupimageproc/exec load/dup load dup dup]cvx nullproc nullproc nullproc true 4 = colorimage}b} DefIf_E ncolors 0 eq DefIf_B{/lookupandstore{3 mul 3 getinterval = putinterval exch 3 add exch 3 copy}b/8lookup/lookupandstore load def/4lookup{/byte 1 = index def -4 bitshift lookupandstore byte 15 and = lookupandstore}b/2lookup{/byte 1 index def -6 bitshift lookupandstore byte -4 bitshift 3 and = lookupandstore byte -2 bitshift 3 and lookupandstore byte 3 and = lookupandstore}b/1lookup{/byte exch def -7 1 0{byte exch bitshift 1 and lookupandstore}bind = for}b/colorexpand {mystringexp 0 rgbclut 3 copy 7 -1 roll/mylookup load forall pop pop pop = pop pop}b/createexpandstr{/mystringexp exch mystring length mul string def}b /doclutimage{/rgbclut exch def pop/mylookup bpc 8 eq{3 = createexpandstr/8lookup} {bpc 4 eq{6 createexpandstr/4lookup}{bpc 2 eq{12 = createexpandstr/2lookup}{24 createexpandstr/1lookup}ifelse}ifelse}ifelse load def iw ih 8[iw 0 0 ih = 0 0] [setupimageproc/exec load/colorexpand load/exec load]cvx false 3 = colorimage}b} DefIf_E/colorimage where{pop true}{false}ifelse DefIf_B{/do24image{iw ih = 8[iw 0 0 ih 0 0]setupimageproc false 3 colorimage}b}DefIf_El{/rgbtogray{/str = exch def /len str length def/smlen len 3 idiv def/rstr str def/gstr str 1 len 1 = sub getinterval def/bstr str 2 len 2 sub getinterval def str dup 0 1 smlen 1 = sub {dup 3 mul rstr 1 index get .3 mul gstr 2 index get .59 mul add bstr 3 = -1 roll get .11 mul add round cvi put dup}for pop 0 smlen = getinterval}b/do24image{iw ih 8[iw 0 0 ih 0 0][setupimageproc/exec load/rgbtogray load/exec load]cvx = bind image}b}DefIf_E/doNimage{bpc 24 eq{do24image}{iw ih bpc[iw 0 0 ih 0 0] setupimageproc image}ifelse}b}DefIf_E=20 %%EndResource %%BeginResource: file Adobe_WinNT_Co_Images_L2 2.0 0 L2? DefIf_B{/doclutimage{/rgbclut exch def pop/hival 1 bpc{2 mul}repeat = 1 sub def[/Indexed colspABC hival rgbclut]setcolorspace myimagedict dup = begin/Width iw def/Height ih def/Decode[0 hival]def/ImageMatrix[iw 0 0 ih 0 0]def /DataSource setupimageproc def/BitsPerComponent bpc def/Interpolate = smoothflag def end image}b/doNimage{bpc 24 eq{colspABC}{colspA}ifelse setcolorspace myimagedict dup begin/Width iw def/Height ih def/Decode bpc 24 eq{[0 1 0 = 1 0 1] }{[0 1]}ifelse def/ImageMatrix[iw 0 0 ih 0 0]def/DataSource = setupimageproc def /BitsPerComponent bpc 24 eq{8}{bpc}ifelse def/Interpolate smoothflag def = end image}b}DefIf_E=20 %%EndResource end reinitialize 33 32 24 99 106 103 157 0 false true 3 beginimage doNimage rh95`r_`[Grq-3[rq68Wrm^r4ro3pGrlG*1rcnFIrr)iarpp&grlb<*rp'L,rgEcLrndWbroa= :\rpKdOrh08[rq?=3Dhrmq)@rpg!\rg3W7rosFArgj&*rpfu5riuJ$rpKdVri5t@qs"+)rgNi= Frn[QaroX4[rpKdOrhTOYroj>trlkBQro=3D";rn.4$rlb;#ri?%lrqcWgriuIP= rpg!JroX3ere19srbDG`rqZQgrq-3KrhTOP qjIH/rq$-Xrh9>QrpB^CroO.)rf-o2rfI,brp0RUrj)OJrq$-QrnRM3riuHVrdOj+rl4s.rpf= ujrhob%rosF9re19Url>#&rhBD'rkJH4rj2Tqro!e;rh07_rlY57rgEbdrjDa>rilC#riZ7cr= n[R4rj)OFrgj%HrlG)rrn.4&rf[8urg!JDri5t)rg`tRriH"SrhoaOrl4r2reg]@rhKItrh9=3D= PrkeZmrn7:0rgEc,rq$-)rf@&]rgWne rlY5irh9>;rndY@rp]pBrg*P[ri,mhrji$VriH+>roj@Krp0RQrl"f'ric#UrmLf!rnRLordt-)rn7;5riZ73rlP/Vrn@A(rn@A+rjD`MrgNiIr= oO-frkn`OrkeYGri?%Hrk\TTrosFFrl+lCrm(Mcrl+kcrg<]6rl>#_roj@Crk&0;rkJHXrlG)= LrbVSErm:Y]rmL\orn.3krk/6crm(MR rnRM'riQ1Dqq:u$rf$iSrn@@prji$]rmUkFrm:Ymrn%/&rlY4`rlP/jrl4rRro=3D";roa9>r= ltH.roO.'rh]V)rh08JrpTjGroX3Urk&0rroF'trhTOurh'2Hrq$-Mro*k2rf7!5roX4=3Drk= SO)ro3qArcA([roO.;rnm^HrltGZrilCjrosFJrfR2fqs"+#?rp9XSrnm_.rd+J&= rp9X:rnm_Drp]o"rlb<"rn[S2rkJHfro3pe rjVmnrpp&Hrj2Udro*k9rlG)ero=3D!gric=3Dlrp'L;rc.r#roO.=3Dro*jFrosFUr`/sKro= sF:ro!dZrn.58roF'VrjVmtrd+RLrpB^?rnm^crlkB*roF']rjr+%rnRKaroa:NrnIG*rjMfR= rp'Jork\U2rp'LHri,nQroF(:rnRL*rk\Slri5trrp9XJrjMgSrosFErnm^>rhBDJrb)5`rr)= i[rndYLrj_r\rc\9srh]Verq-2arpKdSroj@O roF'2rb_Xhrj)Frrj)ORrql]ZroF(?rf[8&rcS3nrk&1'rosF\rk8;[rce?qrh08arq68bqsa= ULrpp'Srdau`re19Qqt^5srmq)Irp'LDrp0QHrb_XXrdXpVrqHEWr]^\r= dau:rce?or^m*0rj_slro!dVrcA(9rfd=3DKr^$NnreCDNr_#Urj2T%rjVmBrhBDBroa:Krpp&2rm^r:rn7:TrkSNBrhTPWroa:FrpTiPrj_= snro*jgrkSNNrhBDDrpTjHrosF>rdFe+rp9X+rjMgfrn[S6rhBD;roO.Ern7:3rl"f?rl4s&r= o=3D";rj;[=3Dqr@\:rh9>)rlY5Cro3qDro3q3rgj&ArndY9rlP0)ro*k=3Drh]V@rpTjGros= Earo3q4ri?%DrosFJrjVmCroX4CrosEnrmLf3 rkSNYrj= r*lrp0RFrlY5ero3qBrjr*9rp0RFrdOk0ro3qAroO-Mrk&1(raPlVrpB^Bro*jsrn@A7rosF'= rfR35reLKVrq-3Oro=3D"%rm^r+rp'LAri#gmrnRKfroX4Kqr@\&rgj%frcJ.5ro!\Arj)Fcr= o3q@rk8;qrbqdsrm1T7rpg!%rn%/=3DroF(=3Drn%.G rf6thri,narp0RHrm(MNreCEtrkAB)rmq)%rg`u0qpbVjrlkA"rkSNVrgj&2rndXRrji$Vrm:= PiriuHdrlP/Fri?%Lrm^gmrlkB$roO-?rgWnirdk&krfd>OrdXp#rjr*kroa9^repcjrg`t.r= d"L)rgNh?rf@'/ro=3D"5reUQNrj2Uirh07]ro*jsrd=3D^YrnIF:rmh#2roO.Frkn_nrn.4q= rdOjErk\T4rkSNuro3q=3Droj?FrjDadrj2TU ric=3DRqrRgKrc%jeqrRg@rhob(rlkB%rnm_8rkn_hrd+RhroX35rg!Jdrl"g!roF(=3Drm^q= /rb;@grosF$rd]M~> endimage gr showpage Adobe_WinNT_Driver_Gfx dup /terminate get exec PageSV restore %%Trailer %%DocumentNeededFonts: %%DocumentSuppliedFonts: end %%Pages: 1 %%EOF %%EndDocument @endspecial 191 423 a currentpoint currentpoint translate 1 1.20764 div 1 1.20764 div scale neg exch neg exch translate 191 423 a 1144 299 a FB(AN)17 b(ORDER-B)n(ASED)f(ALGORITHM)g(FOR)h(MUL)-6 b(TIP)g(AR)l(TY)15 b(SYNCHR)m(ONISA)-7 b(TION)149 b Fq(27)p 191 473 3388 5 v 191 606 a(de)o(gree)21 b(of)h(potential)g(con\003ict,)g(which)g(is) h(adequate)e(in)i(the)g(conte)o(xt)e(we)i(are)f(applying)f Fm(\013)p Fq(\226core)h(because)f(usually)191 706 y(man)o(y)j (interactions)f(are)i(potentially)f(con\003icting,)f(although)g(only)h (a)i(small)f(subset)g(is)h(con\003icting)d(at)j(run\226time.)191 805 y(Thus,)18 b(synchron)o(y)f(loosening)g(can)i(be)g(successfully)g (applied)f(in)h(order)f(to)h(optimise)g(a)g(system)h(if)f(we)g(use)h Fm(\013)p Fq(\226core.)274 905 y(Currently)-5 b(,)18 b(we)j(are)f(w)o(orking)f(to)h(impro)o(v)o(e)e(our)h(algorithm)g(so)h (that)h(participants)e(do)g(not)h(need)g(to)g(re-send)f(their)191 1005 y(of)n(fers)j(when)g(the)o(y)h(are)f(rejected)h(by)f(a)i (coordinator)c(and)i(no)h(other)f(coordinator)e(has)j(tried)g(to)g (lock)g(them.)f(In)h(the)191 1104 y(near)g(future,)f(we)h(are)g(going)f (to)i(research)e(on)h(reducing)e(the)j(e)o(x)o(ecution)d(de)n(viation)h (of)h(our)f(algorithm.)g(Although)191 1204 y(the)16 b(attempt\226w)o (ait\226check)d(scheme)i(in)h(TB)g(does)f(not)g(produce)f(good)g (results)i(due)f(to)h(its)h(high)e(cost,)g(we)h(think)f(a)h(part)191 1303 y(of)25 b(the)g(ideas)h(in)f(this)h(algorithm)e(might)g(be)i (successfully)e(applied)g(in)i Fm(\013)p Fq(\226core.)e(Currently)-5 b(,)24 b(when)g(a)i(participant)191 1403 y(recei)n(v)o(es)18 b(a)h Fm(LO)r(C)6 b(K)25 b Fq(message)19 b(in)f(state)i Fm(W)12 b(AI)7 b(T)12 b(I)7 b(N)i(G)18 b Fq(it)i(replies)e(immediately) -5 b(.)17 b(Delaying)h(the)h(answer)f(for)g(some)191 1503 y(time)g(might)f(gi)n(v)o(e)f(other)h(managers)g(that)g(ha)n(v)o (e)g(been)g(refused)g(in)g(the)h(near)f(past)h(an)f(opportunity)e(to)j (lock)f(its)i(shared)191 1602 y(participants.)191 1901 y Fz(REFERENCES)252 2076 y FB(1.)37 b(R.L.)13 b(Bagrodia.)30 b(Process)15 b(synchronization:)k(Design)d(and)f(performance)h(e)n(v)n (aluation)j(of)14 b(distrib)o(uted)j(algorithms.)30 b FA(IEEE)13 b(T)l(r)o(ansactions)339 2150 y(on)k(Softwar)n(e)h (Engineering)p FB(,)h(15\(9\):1053\2261065,)g(September)g(1989.)252 2225 y(2.)37 b(T)-5 b(.)23 b(Berners-Lee,)i(R.)e(Fielding,)j(and)e(L.)f (Masinter)l(.)49 b(RFC)24 b(2396:)h(Uniform)f(resource)h(identi\002ers) i(\(URI\):)d(Generic)i(syntax,)e(August)339 2300 y(1998.)252 2374 y(3.)37 b(R.)15 b(Canetti.)33 b(Security)17 b(and)f(composition)i (of)d(multiparty)j(cryptographic)h(protocols.)32 b FA(J)n(ournal)18 b(of)d(Cryptolo)o(gy)p FB(,)j(13\(1\):143\226202,)g(2000.)252 2449 y(4.)37 b(K.M.)22 b(Chandy)j(and)f(J.)f(Misra.)47 b(The)24 b(drinking)h(philosophers)h(problem.)47 b FA(A)n(CM)24 b(T)l(r)o(ansactions)h(on)f(Pr)m(o)o(gr)o(amming)g(Langua)o(g)o(es)i (and)339 2524 y(Systems)p FB(,)17 b(6\(4\):632\226646,)i(October)g (1984.)252 2599 y(5.)37 b(K.M.)16 b(Chandy)i(and)g(J.)e(Misra.)33 b FA(P)-5 b(ar)o(allel)18 b(Pr)m(o)o(gr)o(am)f(Design:)h(A)e(F)-7 b(oundation)p FB(.)35 b(Addison\226W)-5 b(esle)o(y)l(,)18 b(1988.)252 2673 y(6.)37 b(E.G.)15 b(Cof)n(fman,)j(M.)e(J.)g(Elphick,)i (and)g(A.)e(Shoshani.)34 b(System)17 b(deadlocks.)36 b FA(Computing)19 b(Surve)n(ys)p FB(,)e(3\(2\):67\22678,)i(June)e (1971.)252 2748 y(7.)37 b(R.)15 b(Corchuelo.)33 b FA(Pr)m(ototipado)17 b(de)f(Especi\002caciones)j(de)d(Sistemas)g(Distrib)o(uidos)h(Basadas)f (en)f(Retricciones.)j(Aplicaci)5 b(\264)-27 b(on)18 b(al)e(Lenguaje)339 2823 y(TESOR)m(O)p FB(.)32 b(PhD)16 b(thesis,)h(F)o(acultad)i(de)e (Inform)t(\264)-26 b(atica)19 b(y)d(Estad)n(\264)-20 b(\021stica.)19 b(Dpto.)d(de)h(Lenguajes)h(y)f(Sistemas)g(Inform)t (\264)-26 b(aticos.)18 b(Uni)n(v)o(ersidad)i(de)339 2897 y(Se)n(villa,)f(1999.)252 2972 y(8.)37 b(R.)25 b(Corchuelo)j(and)e (J.A.)e(P)t(\264)-26 b(erez.)51 b(Casale)27 b(I:)e(A)g(ne)n(w)h (object\226based)j(language)f(for)d(discrete)j(simulation.)52 b(In)25 b FA(Pr)m(oceedings)i(of)f(the)339 3047 y(F)m(ifth)17 b(Eur)m(opean)g(Concurr)n(ent)g(Engineering)i(Confer)n(ence)f(ECEC'98)p FB(,)e(pages)h(310\226312,)g(Erlagen\226Nurember)o(g,)h(German)o(y)l(,) f(1998.)f(The)339 3122 y(Society)j(for)e(Computer)h(Simulation.)252 3196 y(9.)37 b(R.)30 b(Corchuelo,)j(J.A.)c(P)t(\264)-26 b(erez,)31 b(and)g(M.)f(T)-5 b(oro.)60 b(A)30 b(multiparty)j (coordination)h(aspect)e(language.)63 b FA(A)n(CM)30 b(Sigplan)p FB(,)i(35\(12\):24\22632,)339 3271 y(December)18 b(2000.)219 3346 y(10.)37 b(R.)18 b(Corchuelo,)i(D.)e(Ruiz,)h(M.)f(T)-5 b(oro,)18 b(J.M.)f(Prieto,)i(and)g(J.L.)e(Arjona.)37 b(A)18 b(distrib)o(uted)j(solution)f(to)f(multiparty)i(interaction.)40 b(In)19 b FA(Recent)339 3421 y(Advances)f(in)f(Signal)i(Pr)m(ocessing)e (and)h(Communications)p FB(,)h(pages)f(318\226323.)g(W)-5 b(orld)17 b(Scienti\002c)i(Engineering)g(Society)l(,)g(1999.)219 3495 y(11.)37 b(D.F)-5 b(.)21 b(D'Souza)j(and)g(A.C.)e(W)m(ills.)46 b FA(Objects,)24 b(Components,)g(and)f(F)l(r)o(ame)o(works)h(with)g (UML:)e(The)i(Catalysis)g(Appr)m(oac)o(h)p FB(.)46 b(Addison\226)339 3570 y(W)-5 b(esle)o(y)l(,)17 b(Reading,)h(Mass.,)e(1)h(edition,)i (1999.)219 3645 y(12.)37 b(N.)31 b(Francez)i(and)f(I.)e(F)o(orman.)63 b FA(Inter)o(acting)34 b(pr)m(ocesses:)e(A)f(multiparty)j(appr)m(oac)o (h)e(to)g(coor)n(dinated)h(distrib)o(uted)h(pr)m(o)o(gr)o(amming)p FB(.)339 3719 y(Addison\226W)-5 b(esle)o(y)l(,)18 b(1996.)219 3794 y(13.)37 b(C.A.R.)16 b(Hoare.)34 b FA(Communicating)20 b(sequential)g(pr)m(ocessess)p FB(.)33 b(Prentice)20 b(Hall,)d(1985.)219 3869 y(14.)37 b(Y)-9 b(.J.)25 b(Joung.)51 b(Characterizing)30 b(f)o(airness)e(implementability)i(for)c (multiparty)i(interaction.)54 b(In)26 b(F)-5 b(.)25 b(Me)o(yer)i(and)f (B.)f(Monien,)i(editors,)339 3944 y FA(A)o(utomata,)e(Langua)o(g)o(es)i (and)f(Pr)m(o)o(gr)o(amming)o(,)g(23)1552 3920 y Fa(r)r(d)1644 3944 y FA(International)i(Colloquium)p FB(,)f(v)o(olume)f(1099)g(of)f FA(Lectur)n(e)h(Notes)g(in)g(Computer)339 4018 y(Science)p FB(,)19 b(pages)f(110\226121,)g(P)o(aderborn,)g(German)o(y)l(,)f(July)g (1996.)g(Springer)o(-V)-7 b(erlag.)219 4093 y(15.)37 b(Y)-9 b(.J.)22 b(Joung.)46 b(T)-5 b(w)o(o)23 b(decentralized)28 b(algorithms)d(for)e(strong)h(interaction)j(f)o(airness)d(for)f (systems)h(with)g(unbounded)h(speed)f(v)n(ariability)l(.)339 4168 y FA(Theor)n(etical)19 b(Computer)g(Science)p FB(,)g (243\(1\2262\):307\226338,)g(2000.)219 4242 y(16.)37 b(Y)-9 b(.J.)20 b(Joung)i(and)g(S.A.)e(Smolka.)42 b(A)21 b(comprehensi)n(v)o(e)j(study)e(of)g(the)g(comple)o(xity)h(of)f (multiparty)h(interaction.)46 b FA(J)n(ournal)23 b(of)e(the)h(A)n(CM)p FB(,)339 4317 y(43\(1\):75\226115,)d(January)f(1996.)219 4392 y(17.)37 b(Y)-9 b(.J.)13 b(Joung)i(and)f(S.A.)f(Smolka.)29 b(Strong)15 b(interaction)j(f)o(airness)d(via)g(randomization.)31 b FA(IEEE)13 b(T)l(r)o(ansactions)j(on)e(P)-5 b(ar)o(allel)16 b(and)e(Distrib)o(uted)339 4467 y(Systems)p FB(,)j(9\(2\):137\226149,)i (February)g(1998.)219 4541 y(18.)37 b(G.)12 b(Kiczales.)28 b(Aspect-oriented)17 b(programming.)26 b(In)13 b FA(Pr)m(oceedings)i (of)e(the)h(Eur)m(opean)g(Confer)n(ence)h(on)e(Object-Oriented)k(Pr)m (o)o(gr)o(amming)339 4616 y(ECOOP'97)p FB(.)f(Lecture)j(Notes)e(in)g (Computer)i(Science,)f(Springer)o(\226V)-7 b(erlag,)20 b(1997.)219 4691 y(19.)37 b(D.)16 b(Rogerson.)35 b FA(Inside)17 b(COM)p FB(.)34 b(Microsoft)18 b(Press,)f(1997.)219 4765 y(20.)37 b(Y)-9 b(.K.)29 b(Tsay)h(and)h(R.L.)e(Bagrodia.)62 b(Some)30 b(impossibility)i(results)g(in)e(interprocess)j (synchronization.)63 b FA(Distrib)o(uted)32 b(Computing)p FB(,)339 4840 y(6\(4\):221\226231,)19 b(1993.)p 191 5006 V 191 5193 a(Cop)o(yright)497 5191 y(c)476 5193 y Fw(\015)d FB(2001)i(John)f(W)m(ile)o(y)h(&)f(Sons,)f(Ltd.)1105 b FA(Concurr)n(ency:)23 b(Pr)o(act.)16 b(Exper)-7 b(.)17 b FB(2001;)h Fz(00)p FB(:1\2260)p eop %%Trailer end userdict /end-hook known{end-hook}if %%EOF ------=_NextPart_000_04BF_01C0C830.93DD6780--